You're awesome. Have a mirror on us.
We love Linux, privacy, fast and affordable internet access, and working to fulfill our mission of internet freedom for all.
![[ICO]](/icons/blank.gif){kind=icon} | Name | Last modified | Size | Description |
|---|---|---|---|---|
![[PARENTDIR]](/icons/back.gif){kind=icon} | Parent Directory | - | ||
![[DIR]](/icons/folder.gif){kind=icon} | rnc-mode/ | 2005-04-15 03:03 | - | |
| redstone-xmlrpc/ | 2011-01-14 15:05 | - | |
| ruby-capistrano-colors/ | 2012-05-02 02:07 | - | |
| reconf-inetd/ | 2012-06-05 11:18 | - | |
| restlet/ | 2012-07-19 05:15 | - | |
| rcs-latex/ | 2012-08-26 02:33 | - | |
| refdb-client/ | 2012-10-29 09:34 | - | |
| reverend/ | 2012-11-25 08:03 | - | |
| refdb-perlmod/ | 2012-12-14 10:17 | - | |
| refdb-sru/ | 2012-12-14 10:17 | - | |
| redboot-imx/ | 2013-02-28 22:39 | - | |
| redmine-plugin-markdown/ | 2013-07-03 17:21 | - | |
| routeplanner/ | 2013-07-14 15:13 | - | |
| rapicorn/ | 2013-12-29 16:21 | - | |
| rngom/ | 2014-01-15 14:13 | - | |
| recorditnow/ | 2014-03-21 06:18 | - | |
| remote-login-service/ | 2014-04-11 05:28 | - | |
| ruby-deprecated/ | 2014-04-30 05:42 | - | |
| ruby-dust/ | 2014-04-30 05:42 | - | |
| ruby-sinatra-simple-navigation/ | 2014-04-30 06:58 | - | |
| ricky/ | 2014-06-25 16:38 | - | |
| reinteract/ | 2014-07-15 23:27 | - | |
| ruby-fog-softlayer/ | 2014-10-30 11:10 | - | |
| rdscli/ | 2015-04-26 05:10 | - | |
| ruby-algorithm-diff/ | 2015-04-26 05:11 | - | |
| ruby-amrita2/ | 2015-04-26 05:11 | - | |
| ruby-heckle/ | 2015-04-27 08:53 | - | |
| ruby-color-tools/ | 2015-04-27 08:53 | - | |
| rhmessaging/ | 2015-04-27 08:53 | - | |
| ruby-railties-3.2/ | 2015-04-28 10:56 | - | |
| ruby-actionmailer-3.2/ | 2015-04-28 10:56 | - | |
| ruby-activemodel-3.2/ | 2015-04-28 10:56 | - | |
| ruby-activeresource-3.2/ | 2015-04-28 10:56 | - | |
| rt-extension-assettracker/ | 2015-04-28 10:56 | - | |
| rhythmbox-ampache/ | 2015-04-28 10:57 | - | |
| ruby-rails-3.2/ | 2015-04-28 10:57 | - | |
| rrdweather/ | 2015-04-30 06:19 | - | |
| r5rs-doc/ | 2015-04-30 06:19 | - | |
| resilience-theme/ | 2015-04-30 06:19 | - | |
| revu-tools/ | 2015-04-30 06:19 | - | |
| rcconf/ | 2015-04-30 06:19 | - | |
| ruby-actionpack-3.2/ | 2015-05-03 01:07 | - | |
| ruby-activerecord-3.2/ | 2015-05-03 01:07 | - | |
| ruby-activesupport-3.2/ | 2015-05-03 01:07 | - | |
| ruby-fog-serverlove/ | 2015-05-12 04:23 | - | |
| ruby-fog-voxel/ | 2015-05-12 04:23 | - | |
| ruby-fog-riakcs/ | 2015-05-13 06:58 | - | |
| ruby-raphael-rails/ | 2015-07-07 10:48 | - | |
| ruby-underscore-rails/ | 2015-07-07 11:09 | - | |
| rds-tools/ | 2015-07-15 13:58 | - | |
| ruby-jquery-turbolinks/ | 2015-07-18 03:53 | - | |
| ruby-fog-powerdns/ | 2015-07-22 17:24 | - | |
| ruby-facebox-rails/ | 2015-07-28 11:30 | - | |
| ruby-imagesize/ | 2015-08-16 23:46 | - | |
| ruby-extendmatrix/ | 2015-09-09 23:20 | - | |
| rubyfilter/ | 2015-10-08 17:23 | - | |
| ruby-websocket-parser/ | 2015-10-24 02:01 | - | |
| ruby-devise-async/ | 2015-11-09 09:45 | - | |
| ruby-simple-form/ | 2015-11-26 10:05 | - | |
| rfoo/ | 2015-12-04 18:55 | - | |
| rinputd/ | 2015-12-04 18:55 | - | |
| raschsampler/ | 2015-12-05 02:54 | - | |
| ruby-rails-assets-chartjs/ | 2015-12-15 04:06 | - | |
| ruby-rails-assets-clipboard/ | 2015-12-15 04:06 | - | |
| ruby-rubysl/ | 2016-01-02 07:04 | - | |
| ruby-rubinius-debugger/ | 2016-01-04 09:42 | - | |
| razorqt/ | 2016-01-07 22:18 | - | |
| ruby-fog-vsphere/ | 2016-01-11 04:36 | - | |
| ruby-reek/ | 2016-01-27 09:59 | - | |
| ruby-fog-dynect/ | 2016-02-04 03:27 | - | |
| ruby-fog-xenserver/ | 2016-03-14 17:48 | - | |
| ruby-omniauth-remote-user/ | 2016-03-22 08:18 | - | |
| radare2-bindings/ | 2016-03-30 11:19 | - | |
| ruby-gitlab-emoji/ | 2016-04-07 05:41 | - | |
| ruby-setup/ | 2016-04-08 02:20 | - | |
| raptor/ | 2016-04-08 02:21 | - | |
| ruby-compat-resource/ | 2016-06-23 05:25 | - | |
| ruby-fog-azure/ | 2016-07-07 06:49 | - | |
| ruby-activerecord-session-store/ | 2016-07-09 16:24 | - | |
| ruby-diaspora-vines/ | 2016-08-28 00:21 | - | |
| ruby-babel-source/ | 2016-09-16 08:11 | - | |
| ruby-babel-transpiler/ | 2016-09-16 10:39 | - | |
| rsrce/ | 2016-10-31 05:45 | - | |
| resapplet/ | 2016-10-31 06:21 | - | |
| retty/ | 2016-10-31 11:27 | - | |
| rubrica/ | 2016-10-31 18:03 | - | |
| rootstrap/ | 2016-10-31 18:03 | - | |
| rofs-fuse/ | 2016-10-31 18:03 | - | |
| recite/ | 2016-10-31 18:03 | - | |
| randomize-lines/ | 2016-10-31 18:03 | - | |
| rant/ | 2016-10-31 18:03 | - | |
| rdd/ | 2016-10-31 18:03 | - | |
| radiusclient-ng/ | 2016-10-31 18:09 | - | |
| rtgui/ | 2016-11-01 01:03 | - | |
| remuco/ | 2016-11-01 01:03 | - | |
| rebuildd/ | 2016-11-01 01:03 | - | |
| ratproxy/ | 2016-11-01 01:03 | - | |
| rats/ | 2016-11-01 01:03 | - | |
| rawstudio/ | 2016-11-01 01:03 | - | |
| radiance/ | 2016-11-01 01:03 | - | |
| r-other-bio3d/ | 2016-11-01 01:03 | - | |
| rpy/ | 2016-11-01 01:03 | - | |
| rtai/ | 2016-11-01 01:09 | - | |
| rbot/ | 2016-11-01 06:08 | - | |
| radare/ | 2016-11-01 06:08 | - | |
| rhythmbox-radio-browser/ | 2016-11-02 00:11 | - | |
| radiusclient/ | 2016-11-02 00:11 | - | |
| ruby-capybara-screenshot/ | 2016-11-02 15:22 | - | |
| ruby-fog-cloudatcost/ | 2016-11-02 15:22 | - | |
| ruby-state-machine/ | 2016-11-03 06:06 | - | |
| ruby-rack-pjax/ | 2016-11-03 06:06 | - | |
| ruby-rails-autolink/ | 2016-11-03 06:06 | - | |
| ruby-locale-rails/ | 2016-11-03 06:06 | - | |
| ruby-inotify/ | 2016-11-03 06:06 | - | |
| ruby-facets/ | 2016-11-03 06:06 | - | |
| ruby-fixture-builder/ | 2016-11-03 06:06 | - | |
| rails-4.0/ | 2016-11-03 06:06 | - | |
| rhnsd/ | 2016-11-03 06:06 | - | |
| rhnlib/ | 2016-11-03 06:06 | - | |
| ruby-sinon-rails/ | 2016-11-03 06:08 | - | |
| ruby-gettext-activerecord/ | 2016-11-03 06:08 | - | |
| ruby-gettext-rails/ | 2016-11-03 06:08 | - | |
| reminders-app/ | 2016-11-03 06:10 | - | |
| ropemacs/ | 2016-12-01 09:23 | - | |
| refpolicy-ubuntu/ | 2017-03-31 23:15 | - | |
| ruby-naught/ | 2017-07-27 10:34 | - | |
| ruby-email-reply-parser/ | 2017-08-16 16:28 | - | |
| robust-http-client/ | 2017-09-19 06:05 | - | |
| ruby-gemnasium-gitlab-service/ | 2017-10-28 16:23 | - | |
| ruby-flowdock/ | 2017-11-02 21:37 | - | |
| remotecv/ | 2017-11-23 02:06 | - | |
| ruby-sourcify/ | 2018-01-19 01:19 | - | |
| ruby-vegas/ | 2018-01-19 01:19 | - | |
| ruby-yard-sinatra/ | 2018-01-19 01:19 | - | |
| ruby-rash/ | 2018-01-19 01:19 | - | |
| ruby-right-http-connection/ | 2018-01-19 01:19 | - | |
| ruby-rubyforge/ | 2018-01-19 01:19 | - | |
| ruby-rack1.4/ | 2018-01-19 01:19 | - | |
| ruby-platform/ | 2018-01-19 01:19 | - | |
| ruby-popen4/ | 2018-01-19 01:19 | - | |
| ruby-mkrf/ | 2018-01-19 01:19 | - | |
| ruby-multi-xml/ | 2018-01-19 01:19 | - | |
| ruby-notifier/ | 2018-01-19 01:19 | - | |
| ruby-opengl/ | 2018-01-19 01:19 | - | |
| ruby-memoize/ | 2018-01-19 01:19 | - | |
| ruby-innate/ | 2018-01-19 01:19 | - | |
| ruby-haml-magic-translations/ | 2018-01-19 01:19 | - | |
| ruby-globalhotkeys/ | 2018-01-19 01:19 | - | |
| ruby-fog-brightbox/ | 2018-01-19 01:19 | - | |
| ruby-fog-radosgw/ | 2018-01-19 01:19 | - | |
| ruby-echoe/ | 2018-01-19 01:19 | - | |
| ruby-d3-rails/ | 2018-01-19 01:19 | - | |
| readahead-fedora/ | 2018-01-19 01:19 | - | |
| roboptim-core/ | 2018-01-19 01:23 | - | |
| ruby-ramaze/ | 2018-01-19 01:23 | - | |
| rampart/ | 2018-01-19 01:23 | - | |
| ruby-packet/ | 2018-01-19 01:24 | - | |
| ruby-net-netrc/ | 2018-01-19 01:24 | - | |
| ruby-event-loop/ | 2018-01-19 01:25 | - | |
| refit/ | 2018-01-19 01:27 | - | |
| ruby-simple-navigation/ | 2018-01-22 00:42 | - | |
| ruby-test-after-commit/ | 2018-01-22 00:42 | - | |
| ruby-transaction-simple/ | 2018-01-22 00:42 | - | |
| ruby-taglib2/ | 2018-01-22 00:42 | - | |
| ruby-rspec-longrun/ | 2018-01-22 00:42 | - | |
| ruby-semverse/ | 2018-01-22 00:42 | - | |
| ruby-rack-contrib/ | 2018-01-22 00:42 | - | |
| ruby-patron/ | 2018-01-22 00:42 | - | |
| ruby-memcache-client/ | 2018-01-22 00:42 | - | |
| ruby-merb-assets/ | 2018-01-22 00:42 | - | |
| ruby-merb-haml/ | 2018-01-22 00:42 | - | |
| ruby-merb-param-protection/ | 2018-01-22 00:42 | - | |
| ruby-nprogress-rails/ | 2018-01-22 00:42 | - | |
| ruby-mysql/ | 2018-01-22 00:42 | - | |
| ruby-literati/ | 2018-01-22 00:42 | - | |
| ruby-fog-atmos/ | 2018-01-22 00:42 | - | |
| ruby-fog-ecloud/ | 2018-01-22 00:42 | - | |
| ruby-fog-sakuracloud/ | 2018-01-22 00:42 | - | |
| ruby-foreigner/ | 2018-01-22 00:42 | - | |
| ruby-compass-rails/ | 2018-01-22 00:42 | - | |
| ruby-dbd-mysql/ | 2018-01-22 00:42 | - | |
| ruby-dbd-odbc/ | 2018-01-22 00:42 | - | |
| ruby-dbd-pg/ | 2018-01-22 00:42 | - | |
| ruby-equalizer/ | 2018-01-22 00:42 | - | |
| ruby-dbi/ | 2018-01-22 00:42 | - | |
| ruby-dbd-sqlite3/ | 2018-01-22 00:42 | - | |
| ruby-bson-ext/ | 2018-01-22 00:42 | - | |
| ruby-buff-ruby-engine/ | 2018-01-22 00:42 | - | |
| ruby-buff-shell-out/ | 2018-01-22 00:42 | - | |
| ruby-cal-heatmap-rails/ | 2018-01-22 00:42 | - | |
| ruby-celluloid-io/ | 2018-01-22 00:42 | - | |
| ruby-bluecloth/ | 2018-01-22 00:42 | - | |
| ruby-bdb/ | 2018-01-22 00:42 | - | |
| ruby-activerecord-deprecated-finders/ | 2018-01-22 00:42 | - | |
| ruby-amq-client/ | 2018-01-22 00:42 | - | |
| ruby-archive-tar-minitar/ | 2018-01-22 00:42 | - | |
| roxterm/ | 2018-01-22 00:42 | - | |
| rfc5766-turn-server/ | 2018-01-22 00:42 | - | |
| refdb/ | 2018-01-22 00:42 | - | |
| realtimebattle/ | 2018-01-22 00:42 | - | |
| ratbox-services/ | 2018-01-22 00:42 | - | |
| ruby-merb-core/ | 2018-01-22 00:45 | - | |
| root-system/ | 2018-01-22 00:46 | - | |
| ruby-merb-helpers/ | 2018-01-22 00:48 | - | |
| rtcninjajs/ | 2018-01-22 00:48 | - | |
| ruby-passenger/ | 2018-01-22 00:50 | - | |
| rumor/ | 2018-01-23 00:42 | - | |
| ruby-uglifier/ | 2018-01-23 00:42 | - | |
| ruby-sprockets-es6/ | 2018-01-23 00:42 | - | |
| ruby-rails-admin/ | 2018-01-23 00:42 | - | |
| ruby-haikunator/ | 2018-01-23 00:42 | - | |
| rt-authen-externalauth/ | 2018-01-23 00:42 | - | |
| rt-extension-spawnlinkedticketinqueue/ | 2018-01-23 00:42 | - | |
| reel/ | 2018-01-23 00:42 | - | |
| rtslib/ | 2018-01-23 00:45 | - | |
| rapidsvn/ | 2018-01-23 00:53 | - | |
| ruby-dep-selector/ | 2018-02-01 16:17 | - | |
| ruby-memfs/ | 2018-02-06 15:14 | - | |
| ruby-thread-safe/ | 2018-02-23 16:00 | - | |
| ruby-redis-rails/ | 2018-02-25 10:06 | - | |
| ruby-multimap/ | 2018-02-26 10:13 | - | |
| ruby-allocations/ | 2018-03-02 16:18 | - | |
| ruby-logging/ | 2018-03-20 02:33 | - | |
| rekonq/ | 2018-03-22 23:17 | - | |
| ruby-aws-sdk/ | 2018-03-24 17:16 | - | |
| ruby-grpc/ | 2018-04-03 23:14 | - | |
| robojournal/ | 2018-04-05 04:37 | - | |
| rarian/ | 2018-04-06 03:44 | - | |
| ruby-base62/ | 2018-04-07 07:44 | - | |
| ruby-omniauth-cas3/ | 2018-05-22 16:18 | - | |
| remote-logon-config-agent/ | 2018-05-30 12:30 | - | |
| ruby-azure/ | 2018-06-22 08:12 | - | |
| ruby-cucumber-rails/ | 2018-06-22 08:12 | - | |
| ruby-mixlib-archive/ | 2018-06-22 08:12 | - | |
| ruby-omniauth-twitter/ | 2018-06-22 08:12 | - | |
| ruby-compass/ | 2018-06-22 08:12 | - | |
| rhythmbox-plugin-alternative-toolbar/ | 2018-06-22 08:12 | - | |
| ruby-riot/ | 2018-07-31 22:19 | - | |
| ruby-parser/ | 2018-07-31 22:53 | - | |
| ruby-cucumber-wire/ | 2018-08-21 17:24 | - | |
| ruby-maruku/ | 2018-08-21 17:24 | - | |
| ruby-yaml-db/ | 2018-08-21 17:24 | - | |
| ruby-em-websocket/ | 2018-08-21 17:45 | - | |
| ruby-codemirror-rails/ | 2018-11-09 06:34 | - | |
| ruby-minitest-around/ | 2018-11-09 06:34 | - | |
| ruby-omniauth-authentiq/ | 2018-11-09 06:34 | - | |
| ruby-omniauth-shibboleth/ | 2018-11-09 06:34 | - | |
| ruby-device-detector/ | 2018-11-09 14:20 | - | |
| ruby-after-commit-queue/ | 2018-11-23 11:38 | - | |
| ruby-fog-json/ | 2018-11-23 11:38 | - | |
| ruby-arel/ | 2019-01-03 15:13 | - | |
| ruby-inline/ | 2019-01-07 09:29 | - | |
| ruby-introspection/ | 2019-01-07 15:34 | - | |
| ruby-momentjs-rails/ | 2019-01-19 16:21 | - | |
| ruby-albino/ | 2019-01-20 04:22 | - | |
| ruby-bcat/ | 2019-01-20 04:22 | - | |
| ruby-file-tail/ | 2019-01-20 21:23 | - | |
| ruby-sinatra-contrib/ | 2019-02-02 22:21 | - | |
| ruby-blade-qunit-adapter/ | 2019-02-06 16:24 | - | |
| ruby-validate-url/ | 2019-02-06 22:21 | - | |
| ruby-fix-trinity-output/ | 2019-02-14 09:27 | - | |
| ruby-fixwhich/ | 2019-02-14 09:27 | - | |
| ruby-threach/ | 2019-02-14 09:27 | - | |
| registration-agent/ | 2019-02-21 10:59 | - | |
| resiprocate/ | 2019-02-21 10:59 | - | |
| ruby-protected-attributes/ | 2019-03-04 16:27 | - | |
| ruby-poltergeist/ | 2019-03-21 08:35 | - | |
| ruby-expression-parser/ | 2019-03-21 10:43 | - | |
| ruby-omniauth-azure-oauth2/ | 2019-03-21 10:43 | - | |
| ruby-chromedriver-helper/ | 2019-03-27 05:33 | - | |
| ruby-dropzonejs-rails/ | 2019-04-04 17:41 | - | |
| ruby-hangouts-chat/ | 2019-04-09 17:22 | - | |
| ruby2.0/ | 2019-04-12 11:14 | - | |
| ruby1.9.1/ | 2019-04-12 11:14 | - | |
| roundup/ | 2019-06-12 06:43 | - | |
| rekall/ | 2019-09-27 11:29 | - | |
| rawkit/ | 2019-10-25 17:47 | - | |
| ruby-beefcake/ | 2019-10-25 17:48 | - | |
| ruby-rspec-its/ | 2019-10-25 17:48 | - | |
| ruby-metriks/ | 2019-10-25 18:54 | - | |
| ruby-statistics/ | 2019-10-25 20:43 | - | |
| ruby-activerecord-explain-analyze/ | 2019-10-25 21:00 | - | |
| ruby-omniauth-salesforce/ | 2019-10-26 06:08 | - | |
| rust-kvm-ioctls/ | 2019-10-26 07:18 | - | |
| ruby-bootstrap-form/ | 2019-11-05 09:28 | - | |
| ruby-coffee-script/ | 2019-11-10 21:18 | - | |
| ruby-coffee-script-source/ | 2019-11-11 03:18 | - | |
| ruby-rack-openid/ | 2019-11-20 15:44 | - | |
| ruby-peek/ | 2019-12-23 15:18 | - | |
| ruby-retriable/ | 2019-12-26 15:29 | - | |
| ruby-unicode-utils/ | 2019-12-27 22:13 | - | |
| ruby-jekyll-archives/ | 2019-12-28 04:30 | - | |
| ruby-diff-match-patch/ | 2019-12-29 16:31 | - | |
| ruby-devise-lastseenable/ | 2019-12-30 15:18 | - | |
| ruby-akismet/ | 2019-12-31 15:18 | - | |
| ruby-to-regexp/ | 2019-12-31 22:16 | - | |
| ruby-minitar/ | 2020-01-01 09:29 | - | |
| ruby-jekyll-compose/ | 2020-01-06 10:36 | - | |
| ruby-numerizer/ | 2020-01-07 15:18 | - | |
| radosgw-agent/ | 2020-01-09 10:37 | - | |
| ruby-benchmark-suite/ | 2020-01-13 23:53 | - | |
| ruby-get-process-mem/ | 2020-01-13 23:53 | - | |
| ruby-benchmark-ips/ | 2020-01-14 15:18 | - | |
| ruby-amqp/ | 2020-02-05 09:33 | - | |
| routes/ | 2020-02-05 22:18 | - | |
| ruby-buftok/ | 2020-02-06 15:33 | - | |
| ruby-parseconfig/ | 2020-02-07 09:24 | - | |
| ruby-source-map/ | 2020-02-07 15:38 | - | |
| ruby-equatable/ | 2020-02-07 16:19 | - | |
| ruby-tty-platform/ | 2020-02-09 04:17 | - | |
| ruby-unidecode/ | 2020-02-09 04:17 | - | |
| ruby-google-cloud-translate/ | 2020-02-11 04:18 | - | |
| ruby-msfrpc-client/ | 2020-02-11 04:18 | - | |
| ruby-nfnetlink/ | 2020-02-11 04:18 | - | |
| ruby-yell/ | 2020-02-18 16:29 | - | |
| ruby-maxminddb/ | 2020-02-21 16:20 | - | |
| ruby-rspec-collection-matchers/ | 2020-02-23 04:13 | - | |
| ruby-omniauth-wordpress/ | 2020-02-23 21:18 | - | |
| ruby-email-spec/ | 2020-02-25 09:23 | - | |
| ropemode/ | 2020-02-28 10:33 | - | |
| ruby-nfqueue/ | 2020-02-28 22:19 | - | |
| ruby-rubydns/ | 2020-02-28 22:19 | - | |
| ruby-rushover/ | 2020-02-29 04:16 | - | |
| ruby-concurrent-ext/ | 2020-03-02 04:17 | - | |
| ruby-minitest-reporters/ | 2020-03-12 11:08 | - | |
| ruby-mixlib-log/ | 2020-03-20 05:28 | - | |
| ruby-mixlib-cli/ | 2020-03-20 05:48 | - | |
| ruby-mixlib-authentication/ | 2020-03-20 06:08 | - | |
| rest2web/ | 2020-03-30 17:24 | - | |
| ruby-dry-equalizer/ | 2020-03-31 02:58 | - | |
| ruby-pry-rails/ | 2020-03-31 02:58 | - | |
| ruby-rspec-set/ | 2020-03-31 02:58 | - | |
| ruby-spring-commands-rspec/ | 2020-03-31 02:58 | - | |
| ruby-knapsack/ | 2020-03-31 03:48 | - | |
| ruby-dry-configurable/ | 2020-03-31 04:58 | - | |
| ruby-dry-container/ | 2020-03-31 06:03 | - | |
| ruby-dry-types/ | 2020-03-31 07:23 | - | |
| ruby-factory-girl-rails/ | 2020-03-31 08:50 | - | |
| ruby-multipart-parser/ | 2020-03-31 09:43 | - | |
| ruby-em-hiredis/ | 2020-03-31 23:19 | - | |
| raul/ | 2020-04-01 05:21 | - | |
| rainbow/ | 2020-04-01 05:21 | - | |
| ruby-tty-cursor/ | 2020-04-01 17:18 | - | |
| ruby-tty-spinner/ | 2020-04-01 17:18 | - | |
| ruby-wisper/ | 2020-04-02 05:18 | - | |
| randomsound/ | 2020-04-02 11:24 | - | |
| rarpd/ | 2020-04-02 11:24 | - | |
| ratmenu/ | 2020-04-02 11:24 | - | |
| rand/ | 2020-04-02 11:24 | - | |
| resample/ | 2020-04-02 11:44 | - | |
| resolvconf-admin/ | 2020-04-03 09:53 | - | |
| rudecgi/ | 2020-04-03 11:03 | - | |
| rootskel-gtk/ | 2020-04-04 15:08 | - | |
| ruby-mini-histogram/ | 2020-04-05 02:58 | - | |
| ruby-minitest-power-assert/ | 2020-04-05 02:58 | - | |
| ruby-rchardet/ | 2020-04-06 07:09 | - | |
| ruby-minitest-global-expectations/ | 2020-04-11 04:03 | - | |
| rust-box-drawing/ | 2020-04-14 19:03 | - | |
| rust-numtoa/ | 2020-04-14 19:19 | - | |
| rust-permutohedron/ | 2020-04-14 19:19 | - | |
| rust-section-testing/ | 2020-04-14 19:19 | - | |
| rust-scopeguard-0.3/ | 2020-04-14 19:19 | - | |
| rust-sourcefile/ | 2020-04-14 19:48 | - | |
| rust-synstructure-test-traits/ | 2020-04-14 19:48 | - | |
| rust-take-mut/ | 2020-04-14 19:48 | - | |
| rust-xmlwriter/ | 2020-04-14 19:48 | - | |
| rust-try-from/ | 2020-04-14 22:03 | - | |
| rust-lock-api-0.1/ | 2020-04-14 22:18 | - | |
| rust-epoll/ | 2020-04-14 22:33 | - | |
| rust-directories-1/ | 2020-04-14 23:58 | - | |
| rust-pcap-sys/ | 2020-04-14 23:59 | - | |
| rust-actix-derive/ | 2020-04-15 03:53 | - | |
| rust-rfc822-sanitizer/ | 2020-04-15 03:54 | - | |
| rust-parking-lot-0.7/ | 2020-04-15 07:23 | - | |
| rust-include-dir-impl/ | 2020-04-15 07:23 | - | |
| rust-tokio-process/ | 2020-04-15 15:58 | - | |
| rabbyt/ | 2020-04-19 17:13 | - | |
| ruby-netaddr/ | 2020-04-27 14:52 | - | |
| ruby-paint/ | 2020-04-27 14:52 | - | |
| ruby-ponder/ | 2020-04-27 15:37 | - | |
| ruby-actionpack-xml-parser/ | 2020-04-27 15:37 | - | |
| ruby-cssmin/ | 2020-04-27 15:37 | - | |
| ruby-sync/ | 2020-04-27 15:37 | - | |
| ruby-feature/ | 2020-04-27 15:37 | - | |
| ruby-thinking-sphinx/ | 2020-04-27 15:37 | - | |
| ruby-thwait/ | 2020-04-27 15:37 | - | |
| ruby-unicode-display-width/ | 2020-04-27 15:37 | - | |
| ruby-unicode-plot/ | 2020-04-27 15:37 | - | |
| ruby-ffi-compiler/ | 2020-04-27 15:37 | - | |
| ruby-macaddr/ | 2020-04-27 15:37 | - | |
| ruby-mustermann-grape/ | 2020-04-27 15:37 | - | |
| ruby-jekyll-mentions/ | 2020-04-27 15:37 | - | |
| ruby-validate-email/ | 2020-04-27 15:38 | - | |
| ruby-derailed-benchmarks/ | 2020-04-27 17:26 | - | |
| ruby-redis-rack/ | 2020-04-27 17:26 | - | |
| rust-array-macro/ | 2020-04-27 22:10 | - | |
| rust-block/ | 2020-04-27 22:24 | - | |
| rust-boxfnonce/ | 2020-04-27 22:24 | - | |
| rust-cassowary/ | 2020-04-27 22:24 | - | |
| rust-shannon/ | 2020-04-27 22:34 | - | |
| rust-cstr-argument/ | 2020-04-27 22:34 | - | |
| rust-dbus-0.2/ | 2020-04-27 22:49 | - | |
| rust-sw-composite/ | 2020-04-27 22:49 | - | |
| rust-hex-literal-impl/ | 2020-04-27 23:04 | - | |
| rust-linear-map/ | 2020-04-27 23:04 | - | |
| rust-unicode-vo/ | 2020-04-27 23:19 | - | |
| rust-parse-arg/ | 2020-04-27 23:19 | - | |
| rust-unwrap/ | 2020-04-27 23:19 | - | |
| rust-random/ | 2020-04-27 23:28 | - | |
| rust-proc-macro-nested/ | 2020-04-28 03:03 | - | |
| rust-paste-impl/ | 2020-04-28 03:03 | - | |
| rust-tinystr/ | 2020-04-28 03:03 | - | |
| rust-gettext/ | 2020-04-28 03:28 | - | |
| rust-maybe-uninit/ | 2020-04-28 03:28 | - | |
| ruby-linked-list/ | 2020-04-29 16:18 | - | |
| ruby-rspec-temp-dir/ | 2020-04-29 16:18 | - | |
| ruby-hrx/ | 2020-04-29 16:23 | - | |
| rust-pin-utils/ | 2020-05-01 23:13 | - | |
| raidutils/ | 2020-05-02 17:03 | - | |
| rust-unicode-categories/ | 2020-05-10 22:28 | - | |
| ruby-whenever/ | 2020-05-13 16:28 | - | |
| ruby-dbus/ | 2020-05-18 04:23 | - | |
| rust-crossterm-winapi/ | 2020-05-21 04:23 | - | |
| rust-ncurses/ | 2020-05-22 17:13 | - | |
| rdist/ | 2020-05-24 23:13 | - | |
| rust-fsevent-sys/ | 2020-05-25 02:58 | - | |
| r-cran-nortest/ | 2020-05-29 13:08 | - | |
| r-cran-tfisher/ | 2020-05-30 16:48 | - | |
| r-cran-clisymbols/ | 2020-05-31 05:13 | - | |
| r-cran-gwidgets/ | 2020-05-31 05:13 | - | |
| r-cran-ini/ | 2020-05-31 05:13 | - | |
| r-cran-logging/ | 2020-05-31 05:13 | - | |
| r-cran-truncdist/ | 2020-05-31 11:14 | - | |
| r-cran-gmaps/ | 2020-05-31 11:14 | - | |
| r-cran-zeligei/ | 2020-05-31 17:23 | - | |
| r-cran-zeligchoice/ | 2020-05-31 17:23 | - | |
| r-cran-zeligverse/ | 2020-06-01 02:38 | - | |
| r-cran-tmvnsim/ | 2020-06-12 03:18 | - | |
| r-cran-goplot/ | 2020-06-13 05:13 | - | |
| ruby-cmath/ | 2020-06-19 17:13 | - | |
| ruby-protocol-hpack/ | 2020-06-24 17:14 | - | |
| rust-syn-mid/ | 2020-06-24 17:14 | - | |
| ruby-libnotify/ | 2020-06-26 23:15 | - | |
| r-cran-rematch2/ | 2020-06-27 11:17 | - | |
| r-cran-rwiener/ | 2020-06-27 11:17 | - | |
| r-cran-testextra/ | 2020-06-27 11:17 | - | |
| r-cran-assertive.sets/ | 2020-06-27 11:17 | - | |
| r-cran-bindr/ | 2020-06-27 11:17 | - | |
| r-cran-dynamictreecut/ | 2020-06-27 11:17 | - | |
| r-cran-egg/ | 2020-06-27 11:17 | - | |
| r-cran-ei/ | 2020-06-27 11:17 | - | |
| r-cran-ffield/ | 2020-06-27 11:17 | - | |
| r-cran-fingerprint/ | 2020-06-27 11:17 | - | |
| r-cran-gwidgetstcltk/ | 2020-06-27 11:17 | - | |
| r-cran-hypergeo/ | 2020-06-27 11:17 | - | |
| r-cran-isoweek/ | 2020-06-27 11:17 | - | |
| r-cran-itertools/ | 2020-06-27 11:17 | - | |
| r-cran-kaos/ | 2020-06-27 11:17 | - | |
| r-cran-kmsurv/ | 2020-06-27 11:17 | - | |
| r-cran-maxstat/ | 2020-06-27 11:17 | - | |
| r-cran-mediana/ | 2020-06-27 11:17 | - | |
| r-cran-metrics/ | 2020-06-27 11:17 | - | |
| r-cran-postlogic/ | 2020-06-27 11:17 | - | |
| r-cran-proto/ | 2020-06-27 11:17 | - | |
| r-cran-purrrogress/ | 2020-06-27 11:17 | - | |
| r-cran-pwr/ | 2020-06-27 11:17 | - | |
| ruby-jekyll-multiple-languages/ | 2020-07-06 12:39 | - | |
| ruby-unicorn-worker-killer/ | 2020-07-09 16:23 | - | |
| ruby-rubymail/ | 2020-07-09 17:14 | - | |
| ruby-powerpack/ | 2020-07-10 14:50 | - | |
| ruby-rack-mount/ | 2020-07-10 14:50 | - | |
| ruby-ridley/ | 2020-07-10 14:50 | - | |
| ruby-rjb/ | 2020-07-10 14:50 | - | |
| ruby-sdoc/ | 2020-07-10 14:50 | - | |
| ruby-tinder/ | 2020-07-10 14:50 | - | |
| rxvt/ | 2020-07-10 14:50 | - | |
| ruby-innertube/ | 2020-07-10 14:50 | - | |
| ruby-mime/ | 2020-07-10 14:50 | - | |
| ruby-mini-exiftool/ | 2020-07-10 14:50 | - | |
| ruby-molinillo/ | 2020-07-10 14:50 | - | |
| ruby-mecab/ | 2020-07-10 14:50 | - | |
| ruby-hpricot/ | 2020-07-10 14:50 | - | |
| ruby-autoparse/ | 2020-07-10 14:50 | - | |
| ruby-aws/ | 2020-07-10 14:50 | - | |
| ruby-beautify/ | 2020-07-10 14:50 | - | |
| ruby-encryptor/ | 2020-07-10 14:50 | - | |
| ruby-gemojione/ | 2020-07-10 14:50 | - | |
| ruby-gitlab-flowdock-git-hook/ | 2020-07-10 14:50 | - | |
| ruby-gitlab-git/ | 2020-07-10 14:50 | - | |
| ruby-google-protobuf/ | 2020-07-10 14:50 | - | |
| ruby-grape-msgpack/ | 2020-07-10 14:50 | - | |
| ruby-ferret/ | 2020-07-10 14:50 | - | |
| rpm2html/ | 2020-07-10 14:50 | - | |
| reconserver/ | 2020-07-10 14:50 | - | |
| restricted-ssh-commands/ | 2020-07-10 14:50 | - | |
| rhn-client-tools/ | 2020-07-10 14:50 | - | |
| ripole/ | 2020-07-10 14:50 | - | |
| referencer/ | 2020-07-10 14:50 | - | |
| r-cran-miniui/ | 2020-07-10 14:50 | - | |
| r-cran-modeltools/ | 2020-07-10 14:50 | - | |
| r-cran-plogr/ | 2020-07-10 14:50 | - | |
| r-cran-praise/ | 2020-07-10 14:50 | - | |
| r-cran-pwt/ | 2020-07-10 14:50 | - | |
| r-cran-pwt8/ | 2020-07-10 14:50 | - | |
| r-cran-rglwidget/ | 2020-07-10 14:50 | - | |
| r-cran-rsolnp/ | 2020-07-10 14:50 | - | |
| r-cran-tcltk2/ | 2020-07-10 14:50 | - | |
| r-cran-tensor/ | 2020-07-10 14:50 | - | |
| r-other-curvefdp/ | 2020-07-10 14:50 | - | |
| r-other-nitpick/ | 2020-07-10 14:50 | - | |
| rat/ | 2020-07-10 14:50 | - | |
| radiotray/ | 2020-07-10 14:50 | - | |
| relimp/ | 2020-07-10 14:50 | - | |
| r-cran-cellranger/ | 2020-07-10 14:50 | - | |
| r-cran-downloader/ | 2020-07-10 14:50 | - | |
| r-cran-fail/ | 2020-07-10 14:50 | - | |
| r-cran-fitbitscraper/ | 2020-07-10 14:50 | - | |
| r-cran-fitcoach/ | 2020-07-10 14:50 | - | |
| r-cran-futile.logger/ | 2020-07-10 14:50 | - | |
| r-cran-futile.options/ | 2020-07-10 14:50 | - | |
| r-cran-genabel.data/ | 2020-07-10 14:50 | - | |
| r-cran-gridbase/ | 2020-07-10 14:50 | - | |
| r-cran-gridextra/ | 2020-07-10 14:50 | - | |
| r-cran-httpcode/ | 2020-07-10 14:50 | - | |
| r-cran-learnbayes/ | 2020-07-10 14:50 | - | |
| r-cran-epicalc/ | 2020-07-10 14:50 | - | |
| r-cran-epitools/ | 2020-07-10 14:50 | - | |
| r-cran-diagnosismed/ | 2020-07-10 14:50 | - | |
| r-cran-combinat/ | 2020-07-10 14:50 | - | |
| rbtools/ | 2020-07-10 14:51 | - | |
| regex-clojure/ | 2020-07-10 14:51 | - | |
| robert-hooke/ | 2020-07-10 14:51 | - | |
| red5/ | 2020-07-10 14:51 | - | |
| rebar.js/ | 2020-07-10 14:51 | - | |
| ros-geometry-experimental/ | 2020-07-10 14:52 | - | |
| readline6/ | 2020-07-10 23:17 | - | |
| ruby-fog/ | 2020-07-13 01:49 | - | |
| ruby-grape-route-helpers/ | 2020-07-13 01:49 | - | |
| ruby-peek-sidekiq/ | 2020-07-13 01:49 | - | |
| ruby-sidekiq-limit-fetch/ | 2020-07-13 01:49 | - | |
| ruby-webpack-rails/ | 2020-07-13 01:49 | - | |
| r-other-hms-dbmi-spp/ | 2020-07-13 01:49 | - | |
| ratbagd/ | 2020-07-13 01:49 | - | |
| rax-nova-agent/ | 2020-07-13 01:49 | - | |
| rssh/ | 2020-07-13 01:49 | - | |
| r-cran-dynlm/ | 2020-07-13 01:49 | - | |
| r-cran-gclus/ | 2020-07-13 01:49 | - | |
| r-cran-lsmeans/ | 2020-07-13 01:49 | - | |
| r-cran-mlmrev/ | 2020-07-13 01:49 | - | |
| r-cran-natserv/ | 2020-07-13 01:49 | - | |
| r-cran-pheatmap/ | 2020-07-13 01:49 | - | |
| r-cran-epibasix/ | 2020-07-13 01:49 | - | |
| rsbac-admin/ | 2020-07-13 01:50 | - | |
| ryu/ | 2020-07-13 05:15 | - | |
| r-cran-lsd/ | 2020-07-13 11:09 | - | |
| ruby-cucumber-expressions/ | 2020-07-14 07:43 | - | |
| ruby-jekyll-watch/ | 2020-07-14 07:43 | - | |
| ruby-rack-protection/ | 2020-07-14 07:43 | - | |
| ruby-gnome2/ | 2020-07-14 07:43 | - | |
| r-cran-mfilter/ | 2020-07-14 07:43 | - | |
| r-cran-mitools/ | 2020-07-14 07:43 | - | |
| r-cran-numderiv/ | 2020-07-14 07:43 | - | |
| r-cran-prettyr/ | 2020-07-14 07:43 | - | |
| r-cran-pwt9/ | 2020-07-14 07:43 | - | |
| r-cran-registry/ | 2020-07-14 07:43 | - | |
| r-cran-snakecase/ | 2020-07-14 07:43 | - | |
| rel2gpx/ | 2020-07-14 07:43 | - | |
| radiusd-livingston/ | 2020-07-14 07:43 | - | |
| r-cran-xtable/ | 2020-07-14 07:43 | - | |
| r-cran-nws/ | 2020-07-14 07:43 | - | |
| r-bioc-biocinstaller/ | 2020-07-14 07:43 | - | |
| r-cran-assertthat/ | 2020-07-14 07:43 | - | |
| r-cran-conting/ | 2020-07-14 07:43 | - | |
| r-cran-elliptic/ | 2020-07-14 07:43 | - | |
| r-cran-kmi/ | 2020-07-14 07:43 | - | |
| rust-hyphenation-commons/ | 2020-07-14 07:44 | - | |
| rust-hyphenation/ | 2020-07-14 07:44 | - | |
| rust-atlatl/ | 2020-07-14 07:44 | - | |
| rust-enum-primitive/ | 2020-07-14 07:44 | - | |
| rust-failure/ | 2020-07-14 07:44 | - | |
| rust-bitmaps/ | 2020-07-14 11:59 | - | |
| rust-try-or/ | 2020-07-14 12:38 | - | |
| ruby-growl/ | 2020-07-19 05:14 | - | |
| ruby-iso8601/ | 2020-07-19 17:13 | - | |
| rust-entities/ | 2020-07-22 02:04 | - | |
| rust-unchecked-index/ | 2020-07-22 02:04 | - | |
| r-cran-wikitaxa/ | 2020-07-22 23:15 | - | |
| ripit/ | 2020-07-25 22:23 | - | |
| ruby-rack-livereload/ | 2020-08-02 05:14 | - | |
| realmd/ | 2020-08-03 07:58 | - | |
| relacy/ | 2020-08-07 23:14 | - | |
| restartd/ | 2020-08-12 17:08 | - | |
| ruby-rails-assets-highlightjs/ | 2020-08-14 16:18 | - | |
| ruby-morpher/ | 2020-08-20 17:16 | - | |
| ruby-path-expander/ | 2020-08-20 23:16 | - | |
| ruby-wait-for-it/ | 2020-08-21 05:16 | - | |
| ruby-aws-sdk-cloudformation/ | 2020-08-21 17:13 | - | |
| ruby-faraday-middleware-aws-sigv4/ | 2020-08-21 23:13 | - | |
| ruby-rails-assets-blueimp-gallery/ | 2020-08-29 02:48 | - | |
| ruby-pathname2/ | 2020-09-07 11:14 | - | |
| r-cran-calibratr/ | 2020-10-29 00:37 | - | |
| r-cran-cgdsr/ | 2020-10-29 00:37 | - | |
| r-cran-factoextra/ | 2020-10-29 00:37 | - | |
| r-cran-ggplot.multistats/ | 2020-10-29 00:37 | - | |
| r-cran-docopt/ | 2020-10-29 00:37 | - | |
| r-cran-upsetr/ | 2020-10-29 00:37 | - | |
| r-cran-conditionz/ | 2020-10-29 00:37 | - | |
| r-other-rajewsky-dropbead/ | 2020-10-29 02:25 | - | |
| rust-rustc-hash/ | 2020-10-29 08:24 | - | |
| r-cran-knn.covertree/ | 2020-10-29 10:39 | - | |
| r-cran-rle/ | 2020-10-29 10:39 | - | |
| rust-anymap/ | 2020-10-29 10:39 | - | |
| rust-enum-to-u8-slice-derive/ | 2020-10-29 10:39 | - | |
| rust-loggerv/ | 2020-10-29 10:48 | - | |
| rust-proc-quote-impl/ | 2020-10-29 10:48 | - | |
| rust-starship-module-config-derive/ | 2020-10-29 10:48 | - | |
| rust-std-prelude/ | 2020-10-29 10:48 | - | |
| r-cran-gamm4/ | 2020-10-29 23:13 | - | |
| rust-dirs-sys-next/ | 2020-10-31 12:54 | - | |
| rust-urlocator/ | 2020-10-31 23:44 | - | |
| ruby-health-check/ | 2020-11-02 09:33 | - | |
| ruby-uri-template/ | 2020-11-05 04:05 | - | |
| ruby-abstract-type/ | 2020-11-05 04:39 | - | |
| ruby-adamantium/ | 2020-11-05 04:39 | - | |
| ruby-activemodel-serializers-xml/ | 2020-11-05 04:39 | - | |
| ruby-bootstrap-sass/ | 2020-11-05 04:39 | - | |
| ruby-concord/ | 2020-11-05 04:39 | - | |
| ruby-extlib/ | 2020-11-05 04:39 | - | |
| ruby-mustache/ | 2020-11-05 04:39 | - | |
| ruby-js-routes/ | 2020-11-05 04:39 | - | |
| ruby-pundit/ | 2020-11-05 04:39 | - | |
| ruby-rails-assets-fine-uploader/ | 2020-11-05 04:43 | - | |
| ruby-text-format/ | 2020-11-05 04:43 | - | |
| ruby-url-safe-base64/ | 2020-11-05 04:43 | - | |
| ruby-shoulda-matchers/ | 2020-11-05 04:43 | - | |
| ruby-string-direction/ | 2020-11-05 04:43 | - | |
| ruby-shoulda-context/ | 2020-11-05 04:43 | - | |
| ruby-versionist/ | 2020-11-05 04:43 | - | |
| rust-lmdb/ | 2020-11-05 06:53 | - | |
| ruby-ms-rest/ | 2020-11-05 22:03 | - | |
| ruby-safety-net-attestation/ | 2020-11-05 22:14 | - | |
| r-cran-ddrtree/ | 2020-11-05 23:14 | - | |
| rust-pam-sys/ | 2020-11-05 23:14 | - | |
| ruby-ms-rest-azure/ | 2020-11-06 02:09 | - | |
| rust-pidfile-rs/ | 2020-11-06 10:15 | - | |
| ruby-test-prof/ | 2020-11-06 15:28 | - | |
| rust-foreign-types-macros/ | 2020-11-06 22:14 | - | |
| rust-vte-generate-state-changes/ | 2020-11-06 22:14 | - | |
| ruby-awrence/ | 2020-11-07 10:14 | - | |
| ruby-openssl-signature-algorithm/ | 2020-11-07 16:14 | - | |
| ruby-omniauth-atlassian-oauth2/ | 2020-11-09 16:16 | - | |
| ruby-uuidtools/ | 2020-11-10 03:28 | - | |
| ruby-simple-po-parser/ | 2020-11-15 04:16 | - | |
| ruby-rgfa/ | 2020-11-16 10:14 | - | |
| r-cran-isospecr/ | 2020-11-21 16:14 | - | |
| rust-cpp-synom/ | 2020-11-23 04:18 | - | |
| rust-ord-subset/ | 2020-11-23 04:18 | - | |
| ruby-png-quantizator/ | 2020-11-23 16:16 | - | |
| rust-zmq-sys/ | 2020-11-26 04:15 | - | |
| ruby-jekyll-default-layout/ | 2020-11-26 13:33 | - | |
| read-edid/ | 2020-11-27 05:30 | - | |
| rust-unicode-script/ | 2020-11-27 16:18 | - | |
| ruby-behance/ | 2020-12-01 15:39 | - | |
| ruby-android-key-attestation/ | 2020-12-03 04:17 | - | |
| rust-crunchy/ | 2020-12-04 22:40 | - | |
| riddley-clojure/ | 2020-12-05 04:20 | - | |
| rust-cty/ | 2020-12-05 23:14 | - | |
| rust-semver-parser-0.9/ | 2020-12-10 10:19 | - | |
| raynes-fs-clojure/ | 2020-12-11 22:17 | - | |
| rust-dirs-next/ | 2020-12-14 10:19 | - | |
| rbenv/ | 2020-12-16 15:30 | - | |
| rust-cpp-syn/ | 2020-12-17 16:18 | - | |
| ros-eigen-stl-containers/ | 2020-12-21 15:45 | - | |
| rust-cpuid-bool/ | 2020-12-24 16:17 | - | |
| ruby-tty-color/ | 2020-12-27 15:35 | - | |
| ruby-blankslate/ | 2020-12-28 09:50 | - | |
| ruby-thread-order/ | 2020-12-28 15:46 | - | |
| ruby-term-ansicolor/ | 2020-12-28 15:46 | - | |
| ruby-hike/ | 2020-12-28 15:46 | - | |
| ruby-columnize/ | 2020-12-28 15:46 | - | |
| ruby-timers/ | 2020-12-28 15:46 | - | |
| ruby-io-like/ | 2020-12-28 21:35 | - | |
| ruby-metaclass/ | 2020-12-28 21:35 | - | |
| ruby-spring-watcher-listen/ | 2020-12-28 21:35 | - | |
| ruby-rack-cache/ | 2020-12-28 21:35 | - | |
| ruby-em-mongo/ | 2020-12-29 03:44 | - | |
| ruby-contest/ | 2020-12-29 03:44 | - | |
| ruby-blade-sauce-labs-plugin/ | 2020-12-29 03:44 | - | |
| ruby-minitest-focus/ | 2020-12-29 03:44 | - | |
| ruby-bacon/ | 2020-12-29 03:44 | - | |
| ruby-http-connection/ | 2020-12-29 03:44 | - | |
| ruby-minitest-shared-description/ | 2020-12-29 03:44 | - | |
| ruby-samuel/ | 2020-12-29 03:44 | - | |
| ruby-useragent/ | 2020-12-29 03:44 | - | |
| ruby-mizuho/ | 2020-12-29 03:44 | - | |
| ruby-sprockets-export/ | 2020-12-29 12:14 | - | |
| ruby-delorean/ | 2020-12-29 15:25 | - | |
| r-cran-zeallot/ | 2020-12-29 15:34 | - | |
| r-other-iwrlars/ | 2020-12-29 15:34 | - | |
| rcm/ | 2020-12-29 15:34 | - | |
| re/ | 2020-12-29 15:34 | - | |
| repo/ | 2020-12-29 15:34 | - | |
| ries/ | 2020-12-29 15:34 | - | |
| ripmime/ | 2020-12-29 15:34 | - | |
| rkflashtool/ | 2020-12-29 15:34 | - | |
| rlplot/ | 2020-12-29 15:34 | - | |
| robotfindskitten/ | 2020-12-29 15:34 | - | |
| ruby-ahoy-matey/ | 2020-12-29 15:34 | - | |
| ruby-aws-sdk-kms/ | 2020-12-29 15:34 | - | |
| ruby-cancancan/ | 2020-12-29 15:34 | - | |
| ruby-cheffish/ | 2020-12-29 15:34 | - | |
| ruby-classifier/ | 2020-12-29 15:34 | - | |
| ruby-data-uri/ | 2020-12-29 15:34 | - | |
| ruby-declarative/ | 2020-12-29 15:34 | - | |
| ruby-delayer-deferred/ | 2020-12-29 15:34 | - | |
| ruby-diaspora-federation-json-schema/ | 2020-12-29 15:34 | - | |
| ruby-discourse-diff/ | 2020-12-29 15:34 | - | |
| ruby-discriminator/ | 2020-12-29 15:34 | - | |
| ruby-doorkeeper-i18n/ | 2020-12-29 15:34 | - | |
| ruby-geocoder/ | 2020-12-29 15:34 | - | |
| ruby-gettext-setup/ | 2020-12-29 15:34 | - | |
| ruby-gravtastic/ | 2020-12-29 15:34 | - | |
| ruby-heroku-deflater/ | 2020-12-29 15:34 | - | |
| ruby-http-accept-language/ | 2020-12-29 15:34 | - | |
| ruby-i18n-spec/ | 2020-12-29 15:34 | - | |
| ruby-iso/ | 2020-12-29 15:34 | - | |
| ruby-jekyll-include-cache/ | 2020-12-29 15:34 | - | |
| ruby-jekyll-optional-front-matter/ | 2020-12-29 15:34 | - | |
| ruby-jekyll-paginate/ | 2020-12-29 15:34 | - | |
| ruby-jekyll-readme-index/ | 2020-12-29 15:34 | - | |
| ruby-jekyll-redirect-from/ | 2020-12-29 15:34 | - | |
| ruby-jekyll-sitemap/ | 2020-12-29 15:34 | - | |
| ruby-jekyll-titles-from-headings/ | 2020-12-29 15:34 | - | |
| ruby-knife-acl/ | 2020-12-29 15:34 | - | |
| ruby-mobile-fu/ | 2020-12-29 15:34 | - | |
| ruby-oembed/ | 2020-12-29 15:34 | - | |
| ruby-openssl/ | 2020-12-29 15:34 | - | |
| ruby-rails-timeago/ | 2020-12-29 15:34 | - | |
| ruby-rbnacl/ | 2020-12-29 15:34 | - | |
| ruby-referer-parser/ | 2020-12-29 15:34 | - | |
| ruby-rspec-instafail/ | 2020-12-29 15:34 | - | |
| ruby-session/ | 2020-12-29 15:34 | - | |
| ruby-sigdump/ | 2020-12-29 15:34 | - | |
| ruby-socksify/ | 2020-12-29 15:34 | - | |
| ruby-user-agent-parser/ | 2020-12-29 15:34 | - | |
| rurple-ng/ | 2020-12-29 15:34 | - | |
| runlim/ | 2020-12-29 15:34 | - | |
| ruby-mixlib-config/ | 2020-12-29 15:34 | - | |
| rubyluabridge/ | 2020-12-29 15:34 | - | |
| rss2irc/ | 2020-12-29 15:34 | - | |
| rs/ | 2020-12-29 15:34 | - | |
| rng-tools/ | 2020-12-29 15:34 | - | |
| riece/ | 2020-12-29 15:34 | - | |
| redir/ | 2020-12-29 15:34 | - | |
| ratpoison/ | 2020-12-29 15:34 | - | |
| rawdog/ | 2020-12-29 15:34 | - | |
| r-cran-base64url/ | 2020-12-29 15:34 | - | |
| r-cran-bradleyterry2/ | 2020-12-29 15:34 | - | |
| r-cran-ca/ | 2020-12-29 15:34 | - | |
| r-cran-calibrate/ | 2020-12-29 15:34 | - | |
| r-cran-discriminer/ | 2020-12-29 15:34 | - | |
| r-cran-distory/ | 2020-12-29 15:34 | - | |
| r-cran-drr/ | 2020-12-29 15:34 | - | |
| r-cran-flashclust/ | 2020-12-29 15:34 | - | |
| r-cran-globaloptions/ | 2020-12-29 15:34 | - | |
| r-cran-gprofiler/ | 2020-12-29 15:34 | - | |
| r-cran-lambda.r/ | 2020-12-29 15:34 | - | |
| r-cran-lazyeval/ | 2020-12-29 15:34 | - | |
| r-cran-modelmetrics/ | 2020-12-29 15:34 | - | |
| r-cran-multidimbio/ | 2020-12-29 15:34 | - | |
| r-cran-pkgconfig/ | 2020-12-29 15:34 | - | |
| r-cran-prettycode/ | 2020-12-29 15:34 | - | |
| r-cran-pvclust/ | 2020-12-29 15:34 | - | |
| r-cran-rcppprogress/ | 2020-12-29 15:34 | - | |
| r-cran-reshape2/ | 2020-12-29 15:34 | - | |
| r-cran-sdmtools/ | 2020-12-29 15:34 | - | |
| r-cran-selectr/ | 2020-12-29 15:34 | - | |
| r-cran-tcr/ | 2020-12-29 15:34 | - | |
| r-cran-threejs/ | 2020-12-29 15:34 | - | |
| r-cran-treescape/ | 2020-12-29 15:34 | - | |
| r-cran-trimcluster/ | 2020-12-29 15:34 | - | |
| rpy2-2.8/ | 2020-12-29 15:34 | - | |
| rgain/ | 2020-12-29 15:34 | - | |
| rust-plain/ | 2020-12-29 15:34 | - | |
| rust-pledge/ | 2020-12-29 15:34 | - | |
| rust-pocket-resources/ | 2020-12-29 15:34 | - | |
| rust-podio/ | 2020-12-29 15:34 | - | |
| rust-pool/ | 2020-12-29 15:34 | - | |
| rust-precomputed-hash/ | 2020-12-29 15:34 | - | |
| rust-procedural-masquerade/ | 2020-12-29 15:34 | - | |
| rust-rand-0.5/ | 2020-12-29 15:34 | - | |
| rust-rand-core-0.2/ | 2020-12-29 15:34 | - | |
| rust-rand-core-0.3/ | 2020-12-29 15:34 | - | |
| rust-rand-os/ | 2020-12-29 15:34 | - | |
| rust-rctree/ | 2020-12-29 15:34 | - | |
| rust-reduce/ | 2020-12-29 15:34 | - | |
| rust-rustc-std-workspace-core/ | 2020-12-29 15:34 | - | |
| rust-rustc-workspace-hack/ | 2020-12-29 15:34 | - | |
| rust-safemem/ | 2020-12-29 15:34 | - | |
| rust-same-file/ | 2020-12-29 15:34 | - | |
| rust-schannel/ | 2020-12-29 15:34 | - | |
| rust-scoped-threadpool/ | 2020-12-29 15:34 | - | |
| rust-seccomp-sys/ | 2020-12-29 15:34 | - | |
| rust-semver-parser/ | 2020-12-29 15:34 | - | |
| rust-separator/ | 2020-12-29 15:34 | - | |
| rust-simplecss/ | 2020-12-29 15:34 | - | |
| rust-sloppy-rfc4880/ | 2020-12-29 15:34 | - | |
| rust-static-assertions/ | 2020-12-29 15:34 | - | |
| rust-stdweb-derive/ | 2020-12-29 15:34 | - | |
| rust-stdweb-internal-macros/ | 2020-12-29 15:34 | - | |
| rust-stdweb-internal-runtime/ | 2020-12-29 15:34 | - | |
| rust-string-cache-shared/ | 2020-12-29 15:34 | - | |
| rust-svgdom/ | 2020-12-29 15:34 | - | |
| rust-take/ | 2020-12-29 15:34 | - | |
| rust-term-grid/ | 2020-12-29 15:34 | - | |
| rust-term-size/ | 2020-12-29 15:34 | - | |
| rust-thin-slice/ | 2020-12-29 15:34 | - | |
| rust-thread-scoped/ | 2020-12-29 15:34 | - | |
| rust-tokio-async-await/ | 2020-12-29 15:34 | - | |
| rust-tokio-buf/ | 2020-12-29 15:34 | - | |
| rust-tokio-codec/ | 2020-12-29 15:34 | - | |
| rust-tokio-core/ | 2020-12-29 15:34 | - | |
| rust-tokio-fs/ | 2020-12-29 15:34 | - | |
| rust-tokio-io/ | 2020-12-29 15:34 | - | |
| rust-tokio-signal/ | 2020-12-29 15:34 | - | |
| rust-tokio-udp/ | 2020-12-29 15:34 | - | |
| rust-tokio-uds/ | 2020-12-29 15:34 | - | |
| rust-unreachable/ | 2020-12-29 15:34 | - | |
| rust-unveil/ | 2020-12-29 15:34 | - | |
| rust-utf8-ranges/ | 2020-12-29 15:34 | - | |
| rust-vcpkg/ | 2020-12-29 15:34 | - | |
| rust-vec-map/ | 2020-12-29 15:34 | - | |
| rust-void/ | 2020-12-29 15:34 | - | |
| rust-winapi-build/ | 2020-12-29 15:34 | - | |
| rust-winapi-i686-pc-windows-gnu/ | 2020-12-29 15:34 | - | |
| rust-winapi-x86-64-pc-windows-gnu/ | 2020-12-29 15:34 | - | |
| rust-wincolor/ | 2020-12-29 15:34 | - | |
| rust-winreg/ | 2020-12-29 15:34 | - | |
| rust-winutil/ | 2020-12-29 15:34 | - | |
| rust-yaml/ | 2020-12-29 15:34 | - | |
| reactive-streams/ | 2020-12-29 15:34 | - | |
| rivet/ | 2020-12-29 15:34 | - | |
| rust-ansi-term/ | 2020-12-29 15:34 | - | |
| rust-antidote/ | 2020-12-29 15:34 | - | |
| rust-argparse/ | 2020-12-29 15:34 | - | |
| rust-atty/ | 2020-12-29 15:34 | - | |
| rust-base32/ | 2020-12-29 15:34 | - | |
| rust-bufstream/ | 2020-12-29 15:34 | - | |
| rust-build-const/ | 2020-12-29 15:34 | - | |
| rust-byte-tools/ | 2020-12-29 15:34 | - | |
| rust-c2-chacha/ | 2020-12-29 15:34 | - | |
| rust-clicolors-control/ | 2020-12-29 15:34 | - | |
| rust-cloudabi/ | 2020-12-29 15:34 | - | |
| rust-colored-json/ | 2020-12-29 15:34 | - | |
| rust-commoncrypto-sys/ | 2020-12-29 15:34 | - | |
| rust-commoncrypto/ | 2020-12-29 15:34 | - | |
| rust-content-inspector/ | 2020-12-29 15:34 | - | |
| rust-crossbeam-0.3/ | 2020-12-29 15:34 | - | |
| rust-crypto-hash/ | 2020-12-29 15:34 | - | |
| rust-data-url/ | 2020-12-29 15:34 | - | |
| rust-derive-new/ | 2020-12-29 15:34 | - | |
| rust-discard/ | 2020-12-29 15:34 | - | |
| rust-dogged/ | 2020-12-29 15:34 | - | |
| rust-encode-unicode/ | 2020-12-29 15:34 | - | |
| rust-encoding-index-japanese/ | 2020-12-29 15:34 | - | |
| rust-encoding-index-korean/ | 2020-12-29 15:34 | - | |
| rust-encoding-index-simpchinese/ | 2020-12-29 15:34 | - | |
| rust-encoding-index-singlebyte/ | 2020-12-29 15:34 | - | |
| rust-encoding-index-tradchinese/ | 2020-12-29 15:34 | - | |
| rust-encoding/ | 2020-12-29 15:34 | - | |
| rust-endian-type/ | 2020-12-29 15:34 | - | |
| rust-environment/ | 2020-12-29 15:34 | - | |
| rust-euclid-0.19/ | 2020-12-29 15:34 | - | |
| rust-failure-derive/ | 2020-12-29 15:34 | - | |
| rust-fake-simd/ | 2020-12-29 15:34 | - | |
| rust-foreign-types/ | 2020-12-29 15:34 | - | |
| rust-fs2/ | 2020-12-29 15:34 | - | |
| rust-fuchsia-cprng/ | 2020-12-29 15:34 | - | |
| rust-fuchsia-zircon-sys/ | 2020-12-29 15:34 | - | |
| rust-fuchsia-zircon/ | 2020-12-29 15:34 | - | |
| rust-futures-cpupool/ | 2020-12-29 15:34 | - | |
| rust-fxhash/ | 2020-12-29 15:34 | - | |
| rust-gtk-rs-lgpl-docs/ | 2020-12-29 15:34 | - | |
| rust-hash/ | 2020-12-29 15:34 | - | |
| rust-heapsize/ | 2020-12-29 15:34 | - | |
| rust-hidapi-sys/ | 2020-12-29 15:34 | - | |
| rust-ident-case/ | 2020-12-29 15:34 | - | |
| rust-inflate/ | 2020-12-29 15:34 | - | |
| rust-iovec/ | 2020-12-29 15:34 | - | |
| rust-ipnetwork/ | 2020-12-29 15:34 | - | |
| rust-is-match/ | 2020-12-29 15:34 | - | |
| rust-libflate/ | 2020-12-29 15:34 | - | |
| rust-libnghttp2-sys/ | 2020-12-29 15:34 | - | |
| rust-libudev-sys/ | 2020-12-29 15:34 | - | |
| rust-locale/ | 2020-12-29 15:34 | - | |
| rust-lru-cache/ | 2020-12-29 15:34 | - | |
| rust-lua52-sys/ | 2020-12-29 15:34 | - | |
| rust-lzw/ | 2020-12-29 15:34 | - | |
| rust-mac/ | 2020-12-29 15:34 | - | |
| rust-mach-o-sys/ | 2020-12-29 15:34 | - | |
| rust-macro-attr/ | 2020-12-29 15:34 | - | |
| rust-matches/ | 2020-12-29 15:34 | - | |
| rust-md5/ | 2020-12-29 15:34 | - | |
| rust-memmap/ | 2020-12-29 15:34 | - | |
| rust-mio-named-pipes/ | 2020-12-29 15:34 | - | |
| rust-mio-uds/ | 2020-12-29 15:34 | - | |
| rust-natord/ | 2020-12-29 15:34 | - | |
| rust-nitrokey-sys/ | 2020-12-29 15:34 | - | |
| rust-nitrokey-test/ | 2020-12-29 15:34 | - | |
| rust-nodrop/ | 2020-12-29 15:34 | - | |
| rust-nom-4/ | 2020-12-29 15:34 | - | |
| rust-num-derive/ | 2020-12-29 15:34 | - | |
| rust-number-prefix/ | 2020-12-29 15:34 | - | |
| rust-opaque-debug/ | 2020-12-29 15:34 | - | |
| rust-openssl-probe/ | 2020-12-29 15:34 | - | |
| rust-ordermap/ | 2020-12-29 15:34 | - | |
| rust-output-vt100/ | 2020-12-29 15:34 | - | |
| rust-owning-ref/ | 2020-12-29 15:34 | - | |
| rust-pad/ | 2020-12-29 15:34 | - | |
| rome/ | 2020-12-29 15:34 | - | |
| ros-pcl-conversions/ | 2020-12-29 15:34 | - | |
| ros-robot-model/ | 2020-12-29 15:34 | - | |
| rust-crypto-mac/ | 2021-01-01 04:15 | - | |
| ruby-fog-xml/ | 2021-01-01 16:21 | - | |
| ruby-rc4/ | 2021-01-01 16:21 | - | |
| ruby-trollop/ | 2021-01-01 16:21 | - | |
| ruby-polyglot/ | 2021-01-01 16:21 | - | |
| ruby-log4r/ | 2021-01-01 16:21 | - | |
| ruby-lockfile/ | 2021-01-01 22:13 | - | |
| ruby-systemu/ | 2021-01-01 22:13 | - | |
| ruby-fuzzyurl/ | 2021-01-02 16:27 | - | |
| ruby-syslog-logger/ | 2021-01-02 16:27 | - | |
| ruby-iniparse/ | 2021-01-02 16:27 | - | |
| ruby-rails-observers/ | 2021-01-02 16:27 | - | |
| relaxngcc/ | 2021-01-02 16:27 | - | |
| ruby-proxifier/ | 2021-01-02 16:27 | - | |
| ruby-rails-assets-jquery-placeholder/ | 2021-01-03 09:47 | - | |
| ruby-xdg/ | 2021-01-03 09:47 | - | |
| ruby-colored/ | 2021-01-03 16:27 | - | |
| ruby-oauth/ | 2021-01-03 16:27 | - | |
| ruby-faye-websocket/ | 2021-01-03 22:15 | - | |
| ruby-faye/ | 2021-01-03 22:15 | - | |
| ruby-rack-ssl/ | 2021-01-04 16:06 | - | |
| ruby-os/ | 2021-01-04 21:24 | - | |
| ruby-journey/ | 2021-01-04 21:39 | - | |
| ruby-descendants-tracker/ | 2021-01-04 21:39 | - | |
| ruby-hashie-forbidden-attributes/ | 2021-01-04 21:39 | - | |
| ruby-snmp/ | 2021-01-05 10:24 | - | |
| ruby-ddmemoize/ | 2021-01-05 15:56 | - | |
| ruby-coercible/ | 2021-01-05 15:56 | - | |
| ruby-ddmetrics/ | 2021-01-05 15:56 | - | |
| ruby-faraday-middleware-multi-json/ | 2021-01-05 15:56 | - | |
| ruby-fog-openstack/ | 2021-01-05 15:56 | - | |
| ruby-gssapi/ | 2021-01-05 15:56 | - | |
| ruby-omniauth-crowd/ | 2021-01-05 15:56 | - | |
| ruby-omniauth-kerberos/ | 2021-01-05 15:56 | - | |
| ruby-mp3tag/ | 2021-01-05 15:56 | - | |
| ruby-rack-accept/ | 2021-01-05 15:56 | - | |
| ruby-sasl/ | 2021-01-05 15:56 | - | |
| ruby-uuid/ | 2021-01-05 16:19 | - | |
| rfcdiff/ | 2021-01-05 16:19 | - | |
| ruby-brandur-json-schema/ | 2021-01-05 16:19 | - | |
| ruby-attr-required/ | 2021-01-05 16:19 | - | |
| ruby-spreadsheet/ | 2021-01-05 16:19 | - | |
| ruby-ghi/ | 2021-01-05 22:19 | - | |
| ruby-celluloid-extras/ | 2021-01-06 15:45 | - | |
| ring-defaults-clojure/ | 2021-01-06 16:26 | - | |
| ring-ssl-clojure/ | 2021-01-06 16:26 | - | |
| ring-headers-clojure/ | 2021-01-06 16:26 | - | |
| ruby-capture-output/ | 2021-01-06 16:26 | - | |
| ring-anti-forgery-clojure/ | 2021-01-06 16:26 | - | |
| ruby-directory-watcher/ | 2021-01-06 16:26 | - | |
| ruby-faraday-cookie-jar/ | 2021-01-06 16:26 | - | |
| ruby-jquery-scrollto-rails/ | 2021-01-06 16:26 | - | |
| ruby-html2text/ | 2021-01-06 16:26 | - | |
| ruby-lograge/ | 2021-01-06 16:26 | - | |
| ruby-mixlib-versioning/ | 2021-01-06 16:26 | - | |
| ruby-nakayoshi-fork/ | 2021-01-06 16:27 | - | |
| ruby-omniauth-bitbucket/ | 2021-01-06 16:27 | - | |
| ruby-validatable/ | 2021-01-06 16:27 | - | |
| ruby-nested-form/ | 2021-01-06 16:27 | - | |
| ruby-net-irc/ | 2021-01-06 16:27 | - | |
| ruby-statsd/ | 2021-01-06 16:27 | - | |
| ruby-rails-tokeninput/ | 2021-01-07 10:15 | - | |
| ruby-nokogiri-diff/ | 2021-01-07 10:15 | - | |
| ruby-securecompare/ | 2021-01-07 10:15 | - | |
| ruby-tdiff/ | 2021-01-07 10:34 | - | |
| ruby-ffi-bit-masks/ | 2021-01-07 16:43 | - | |
| ruby-flot-rails/ | 2021-01-07 16:43 | - | |
| ruby-middleware/ | 2021-01-07 16:43 | - | |
| rtpg/ | 2021-01-07 16:43 | - | |
| ruby-rubytorrent/ | 2021-01-07 16:43 | - | |
| ruby-database-cleaner/ | 2021-01-07 16:43 | - | |
| ruby-zip-zip/ | 2021-01-07 16:43 | - | |
| ricochet/ | 2021-01-07 22:17 | - | |
| ruby-lumberjack/ | 2021-01-08 03:44 | - | |
| ruby-mab/ | 2021-01-08 03:44 | - | |
| ruby-minitest-utils/ | 2021-01-08 03:44 | - | |
| ruby-inflecto/ | 2021-01-08 03:44 | - | |
| ruby-rails-assets-bootstrap/ | 2021-01-08 03:44 | - | |
| ruby-test-construct/ | 2021-01-08 04:18 | - | |
| ring-basic-authentication-clojure/ | 2021-01-08 04:18 | - | |
| ruby-metaid/ | 2021-01-08 10:30 | - | |
| ruby-logger-application/ | 2021-01-08 10:30 | - | |
| ruby-rails-assets-jquery-ui/ | 2021-01-08 10:30 | - | |
| ruby-test-spec/ | 2021-01-08 10:30 | - | |
| ruby-peek-gc/ | 2021-01-08 10:30 | - | |
| ruby-azure-core/ | 2021-01-08 16:22 | - | |
| ruby-acts-as-api/ | 2021-01-08 16:26 | - | |
| ruby-cutest/ | 2021-01-08 16:26 | - | |
| ruby-fog-profitbricks/ | 2021-01-08 16:26 | - | |
| ruby-fog-vmfusion/ | 2021-01-08 16:26 | - | |
| ruby-haml-contrib/ | 2021-01-08 16:26 | - | |
| ruby-integration/ | 2021-01-08 16:26 | - | |
| ruby-jsonapi-renderer/ | 2021-01-08 16:26 | - | |
| ruby-jsonify/ | 2021-01-08 16:26 | - | |
| ruby-climate-control/ | 2021-01-08 16:26 | - | |
| ruby-fog-storm-on-demand/ | 2021-01-08 16:26 | - | |
| ruby-mtrc/ | 2021-01-08 16:26 | - | |
| ruby-jeweler/ | 2021-01-08 16:26 | - | |
| ruby-fog-terremark/ | 2021-01-08 16:26 | - | |
| ruby-peek-redis/ | 2021-01-08 16:26 | - | |
| ruby-case-transform/ | 2021-01-08 16:26 | - | |
| ruby-brass/ | 2021-01-08 16:26 | - | |
| ruby-rails-assets-jquery-idletimer/ | 2021-01-08 16:26 | - | |
| ruby-mina/ | 2021-01-08 16:26 | - | |
| ruby-rails-assets-markdown-it-hashtag/ | 2021-01-08 16:26 | - | |
| ruby-rails-assets-markdown-it-sub/ | 2021-01-08 16:26 | - | |
| ruby-rails-assets-jakobmattsson-jquery-elastic/ | 2021-01-08 16:26 | - | |
| ruby-riemann-client/ | 2021-01-08 16:26 | - | |
| ruby-gli/ | 2021-01-08 16:26 | - | |
| ruby-rails-assets-bootstrap-markdown/ | 2021-01-08 16:26 | - | |
| ruby-rails-assets-jquery-fullscreen/ | 2021-01-08 16:26 | - | |
| ruby-rails-assets-markdown-it-sup/ | 2021-01-08 16:26 | - | |
| ruby-stud/ | 2021-01-08 16:26 | - | |
| ruby-subexec/ | 2021-01-08 16:26 | - | |
| ruby-peek-rblineprof/ | 2021-01-08 16:26 | - | |
| ruby-stringify-hash/ | 2021-01-08 16:26 | - | |
| ruby-prawn-manual-builder/ | 2021-01-08 16:26 | - | |
| ruby-rails-assets-markdown-it--markdown-it-for-inline/ | 2021-01-08 16:26 | - | |
| remotetea/ | 2021-01-08 16:26 | - | |
| ruby-valid/ | 2021-01-08 16:26 | - | |
| rust-rustc-std-workspace-std/ | 2021-01-08 16:28 | - | |
| ruby-rsync/ | 2021-01-08 22:18 | - | |
| r-cran-profmem/ | 2021-01-09 04:17 | - | |
| ruby-appraiser-reek/ | 2021-01-09 09:51 | - | |
| ruby-asetus/ | 2021-01-09 09:51 | - | |
| ruby-cat/ | 2021-01-09 09:51 | - | |
| ruby-client-side-validations/ | 2021-01-09 09:51 | - | |
| ruby-dependor/ | 2021-01-09 09:51 | - | |
| ruby-errbase/ | 2021-01-09 09:51 | - | |
| ruby-generator-spec/ | 2021-01-09 09:52 | - | |
| ruby-exception-notification/ | 2021-01-09 09:52 | - | |
| ruby-grit-ext/ | 2021-01-09 09:52 | - | |
| ruby-gyoku/ | 2021-01-09 09:52 | - | |
| ruby-httpauth/ | 2021-01-09 09:52 | - | |
| ruby-jquery-datatables-rails/ | 2021-01-09 09:52 | - | |
| ruby-logify/ | 2021-01-09 09:52 | - | |
| ruby-omniauth-jwt/ | 2021-01-09 09:52 | - | |
| ruby-letter-opener/ | 2021-01-09 09:52 | - | |
| ruby-peek-host/ | 2021-01-09 09:52 | - | |
| ruby-peach/ | 2021-01-09 09:52 | - | |
| ruby-peek-performance-bar/ | 2021-01-09 09:52 | - | |
| ruby-parse-cron/ | 2021-01-09 09:52 | - | |
| ruby-net-ssh-krb/ | 2021-01-09 09:52 | - | |
| ruby-stamp/ | 2021-01-09 09:52 | - | |
| ruby-nori/ | 2021-01-09 09:52 | - | |
| ruby-rspec-logsplit/ | 2021-01-09 09:52 | - | |
| ruby-rails-assets-jeresig-jquery.hotkeys/ | 2021-01-09 09:52 | - | |
| ruby-rack-rewrite/ | 2021-01-09 09:52 | - | |
| ruby-logging-rails/ | 2021-01-09 09:52 | - | |
| ruby-remotipart/ | 2021-01-09 09:52 | - | |
| ruby-test-unit-context/ | 2021-01-09 09:52 | - | |
| ruby-ya2yaml/ | 2021-01-09 09:52 | - | |
| ruby-rubyvis/ | 2021-01-09 09:52 | - | |
| ruby-rack-piwik/ | 2021-01-09 10:09 | - | |
| ruby-rugments/ | 2021-01-09 10:09 | - | |
| ruby-dirty-memoize/ | 2021-01-09 15:59 | - | |
| ruby-celluloid-fsm/ | 2021-01-09 15:59 | - | |
| ruby-celluloid-supervision/ | 2021-01-09 15:59 | - | |
| ruby-ami/ | 2021-01-09 15:59 | - | |
| ruby-barrier/ | 2021-01-09 15:59 | - | |
| ruby-email-validator/ | 2021-01-09 15:59 | - | |
| ruby-snorlax/ | 2021-01-09 15:59 | - | |
| ruby-rack-google-analytics/ | 2021-01-09 15:59 | - | |
| ruby-sequenced/ | 2021-01-09 15:59 | - | |
| rabbitmq-java-client/ | 2021-01-09 15:59 | - | |
| ruby-tool/ | 2021-01-09 15:59 | - | |
| ruby-torquebox-no-op/ | 2021-01-09 15:59 | - | |
| ruby-fastimage/ | 2021-01-09 22:18 | - | |
| rtpproxy/ | 2021-01-10 18:24 | - | |
| ruby-raemon/ | 2021-01-11 16:20 | - | |
| ruby-rethtool/ | 2021-01-11 16:20 | - | |
| ruby-symboltable/ | 2021-01-11 16:20 | - | |
| ruby-cstruct/ | 2021-01-11 16:20 | - | |
| ruby-net-ssh-gateway/ | 2021-01-12 21:24 | - | |
| ruby-em-redis/ | 2021-01-14 16:20 | - | |
| rtv/ | 2021-01-14 21:34 | - | |
| rust-globwalk/ | 2021-01-15 10:19 | - | |
| r-cran-formattable/ | 2021-01-16 22:14 | - | |
| ruby-slow-enumerator-tools/ | 2021-01-17 15:34 | - | |
| rust-mdl/ | 2021-01-18 09:15 | - | |
| r-cran-genie/ | 2021-01-18 10:20 | - | |
| rcs-blame/ | 2021-01-23 21:48 | - | |
| ruby-rollout/ | 2021-01-26 13:24 | - | |
| ruby-fiber-local/ | 2021-01-26 22:15 | - | |
| ring-json-clojure/ | 2021-01-27 16:20 | - | |
| rephrase/ | 2021-02-01 21:58 | - | |
| rifiuti/ | 2021-02-01 21:58 | - | |
| ruby-spdx-licenses/ | 2021-02-03 16:18 | - | |
| rust-match-cfg/ | 2021-02-04 22:16 | - | |
| ruby-upr/ | 2021-02-05 19:33 | - | |
| ruby-bourne/ | 2021-02-05 21:29 | - | |
| ruby-graphql-errors/ | 2021-02-06 04:15 | - | |
| ruby-rack-parser/ | 2021-02-06 04:15 | - | |
| ruby-rake-ant/ | 2021-02-06 16:16 | - | |
| ruby-scanf/ | 2021-02-06 16:16 | - | |
| recap/ | 2021-02-06 16:16 | - | |
| rust-libnotcurses-sys/ | 2021-02-06 16:16 | - | |
| ruby-sshkey/ | 2021-02-06 21:43 | - | |
| ruby-ae/ | 2021-02-08 10:18 | - | |
| ruby-graffiti/ | 2021-02-08 15:29 | - | |
| reclass/ | 2021-02-08 16:18 | - | |
| runsnakerun/ | 2021-02-08 21:24 | - | |
| ruby-select2-rails/ | 2021-02-09 10:16 | - | |
| ruby-pdf-inspector/ | 2021-02-09 15:24 | - | |
| ruby-azure-storage-blob/ | 2021-02-10 04:15 | - | |
| ruby-svg-graph/ | 2021-02-10 16:16 | - | |
| ruby-ffi-rzmq-core/ | 2021-02-11 21:18 | - | |
| ruby-ffi-rzmq/ | 2021-02-12 03:33 | - | |
| ruby-autoprefixer-rails/ | 2021-02-17 22:15 | - | |
| rapidxml/ | 2021-02-21 09:24 | - | |
| ruby-em-synchrony/ | 2021-02-23 17:14 | - | |
| redboot-tools/ | 2021-02-24 10:19 | - | |
| r-cran-rcppmlpack/ | 2021-02-25 22:15 | - | |
| ruby-coffee-rails/ | 2021-02-26 22:15 | - | |
| repsnapper/ | 2021-03-06 04:15 | - | |
| rust-harfbuzz-sys/ | 2021-03-24 19:08 | - | |
| rust-harfbuzz-rs/ | 2021-03-24 19:43 | - | |
| rust-cpp-synmap/ | 2021-03-24 22:53 | - | |
| rust-argon2rs/ | 2021-04-05 17:15 | - | |
| rust-tokio-current-thread/ | 2021-04-05 17:15 | - | |
| ruby2.3/ | 2021-04-21 11:14 | - | |
| r-cran-genoplotr/ | 2021-04-29 12:05 | - | |
| rust-fallible-streaming-iterator/ | 2021-04-29 13:54 | - | |
| ruby-mail-gpg/ | 2021-05-23 16:22 | - | |
| ruby-ssrf-filter/ | 2021-06-14 17:16 | - | |
| ruby-markerb/ | 2021-07-11 22:29 | - | |
| ruby-js-image-paths/ | 2021-07-14 06:39 | - | |
| rust-zoneinfo-compiled/ | 2021-09-11 23:58 | - | |
| ruby-chef-utils/ | 2021-10-07 12:24 | - | |
| ruby-fauxhai/ | 2021-10-10 05:14 | - | |
| ruby-mixlib-shellout/ | 2021-10-19 02:34 | - | |
| ruby-progressbar/ | 2021-10-19 02:34 | - | |
| r-cran-benchmarkmedata/ | 2021-10-19 08:50 | - | |
| r-cran-gsubfn/ | 2021-10-19 08:50 | - | |
| r-cran-fancova/ | 2021-10-19 08:50 | - | |
| r-cran-here/ | 2021-10-19 08:50 | - | |
| r-cran-ratelimitr/ | 2021-10-19 08:50 | - | |
| r-cran-ids/ | 2021-10-19 08:50 | - | |
| r-cran-unbalanced/ | 2021-10-19 08:50 | - | |
| r-cran-rose/ | 2021-10-19 08:50 | - | |
| r-cran-whoami/ | 2021-10-19 08:51 | - | |
| ruby-state-machines-activerecord/ | 2021-10-19 09:21 | - | |
| remem/ | 2021-10-19 13:34 | - | |
| ruby-amq-protocol/ | 2021-10-20 17:04 | - | |
| rust-copyless/ | 2021-10-21 05:50 | - | |
| rust-doc-comment/ | 2021-10-21 05:50 | - | |
| rust-termios/ | 2021-10-21 05:50 | - | |
| rust-tinytemplate/ | 2021-10-21 05:50 | - | |
| rust-ioctl-rs/ | 2021-10-21 08:53 | - | |
| rust-libudev/ | 2021-10-21 09:04 | - | |
| rust-oorandom/ | 2021-10-21 09:04 | - | |
| rust-normalize-line-endings/ | 2021-10-21 09:04 | - | |
| rust-reference-counted-singleton/ | 2021-10-21 09:04 | - | |
| rust-pipeline/ | 2021-10-21 09:04 | - | |
| rust-serial-core/ | 2021-10-21 09:04 | - | |
| rust-tiny-keccak/ | 2021-10-21 09:14 | - | |
| rotix/ | 2021-10-21 09:33 | - | |
| rust-want/ | 2021-10-21 11:54 | - | |
| ruby-pastel/ | 2021-10-21 22:34 | - | |
| ruby-tty-reader/ | 2021-10-22 00:53 | - | |
| rust-fishers-exact/ | 2021-10-22 04:04 | - | |
| ruby-tty-prompt/ | 2021-10-22 04:33 | - | |
| ruby-fakeweb/ | 2021-10-22 16:43 | - | |
| rust-fwdansi/ | 2021-10-23 23:40 | - | |
| rust-yaml-rust/ | 2021-10-24 17:08 | - | |
| ruby-async-process/ | 2021-10-25 11:18 | - | |
| ruby-github-pages-health-check/ | 2021-10-26 16:39 | - | |
| ruby-postmark/ | 2021-10-27 11:14 | - | |
| rust-crossbeam-utils-0.7/ | 2021-10-27 23:44 | - | |
| rust-utf-8/ | 2021-11-02 11:17 | - | |
| ros-cmake-modules/ | 2021-11-03 22:24 | - | |
| ros-wstool/ | 2021-11-03 22:39 | - | |
| ruby-hkdf/ | 2021-11-06 11:15 | - | |
| ruby-humanize/ | 2021-11-06 11:15 | - | |
| ruby-motion-require/ | 2021-11-06 11:15 | - | |
| ruby-scarf/ | 2021-11-06 11:15 | - | |
| ruby-attribute-normalizer/ | 2021-11-06 11:15 | - | |
| ruby-file-validators/ | 2021-11-06 11:15 | - | |
| r-cran-svunit/ | 2021-11-08 16:17 | - | |
| r-other-kcha-psiplot/ | 2021-11-08 22:17 | - | |
| r-cran-mpoly/ | 2021-11-09 10:16 | - | |
| r-cran-shades/ | 2021-11-09 10:16 | - | |
| ruby-backports/ | 2021-11-10 04:15 | - | |
| ruby-terrapin/ | 2021-11-14 21:34 | - | |
| ruby-process-daemon/ | 2021-11-17 10:02 | - | |
| ruby-sham-rack/ | 2021-11-18 09:24 | - | |
| ruby-twitter-stream/ | 2021-11-19 23:24 | - | |
| ruby-buff-config/ | 2021-11-20 02:20 | - | |
| ruby-unleash/ | 2021-11-20 15:29 | - | |
| ruby-bogus/ | 2021-11-21 22:09 | - | |
| rust-downcast-rs/ | 2021-11-22 03:14 | - | |
| rust-khronos-api/ | 2021-11-22 03:14 | - | |
| ruby-sprite-factory/ | 2021-11-23 03:33 | - | |
| ruby-dry-inflector/ | 2021-11-23 03:33 | - | |
| ruby-binding-of-caller/ | 2021-11-26 21:36 | - | |
| ruby-avl-tree/ | 2021-11-26 23:54 | - | |
| ruby-rspec-retry/ | 2021-11-27 03:23 | - | |
| ruby-json-schema/ | 2021-11-27 10:15 | - | |
| rust-path-abs/ | 2021-11-29 01:24 | - | |
| rust-rustc-version/ | 2021-11-29 03:04 | - | |
| rust-string/ | 2021-11-29 19:24 | - | |
| ruby-sorted-set/ | 2021-11-30 16:23 | - | |
| rust-newtype-derive/ | 2021-12-01 02:55 | - | |
| ruby-async-rspec/ | 2021-12-01 10:17 | - | |
| rust-pretty-bytes/ | 2021-12-02 19:26 | - | |
| r-cran-wikidataqueryservicer/ | 2021-12-04 22:16 | - | |
| rust-stdweb/ | 2021-12-05 01:49 | - | |
| r-cran-sqldf/ | 2021-12-05 22:16 | - | |
| ruby-declarative-policy/ | 2021-12-08 04:16 | - | |
| ruby-has-secure-token/ | 2021-12-08 04:49 | - | |
| ruby-kitchen-salt/ | 2021-12-08 15:34 | - | |
| ruby-kitchen-docker/ | 2021-12-08 15:34 | - | |
| restbed/ | 2021-12-08 16:15 | - | |
| ruby-gaffe/ | 2021-12-09 04:19 | - | |
| ruby-glob/ | 2021-12-09 10:21 | - | |
| ruby-semantic-range/ | 2021-12-09 22:21 | - | |
| ruby-mdurl-rb/ | 2021-12-09 22:21 | - | |
| ruby-actionpack-action-caching/ | 2021-12-11 01:23 | - | |
| ruby-dry-core/ | 2021-12-11 02:08 | - | |
| ruby-awesome-print/ | 2021-12-11 02:09 | - | |
| ruby-api-pagination/ | 2021-12-11 02:09 | - | |
| ruby-roxml/ | 2021-12-11 02:09 | - | |
| ruby-dry-logic/ | 2021-12-11 03:09 | - | |
| ruby-diaspora-federation-rails/ | 2021-12-11 04:24 | - | |
| rust-lliw/ | 2021-12-12 03:30 | - | |
| rust-serial/ | 2021-12-12 03:30 | - | |
| ruby-jekyll-data/ | 2021-12-12 10:15 | - | |
| r-cran-modeest/ | 2021-12-12 22:15 | - | |
| r-cran-statip/ | 2021-12-13 04:15 | - | |
| ruby-retryable/ | 2021-12-13 15:39 | - | |
| ruby-slowpoke/ | 2021-12-14 04:17 | - | |
| ruby-activerecord-nulldb-adapter/ | 2021-12-17 22:24 | - | |
| rust-signal-hook-registry/ | 2021-12-18 22:14 | - | |
| ruby-xmpp4r/ | 2021-12-22 18:57 | - | |
| ruby-serverengine/ | 2021-12-22 18:57 | - | |
| ruby-rspec-junit-formatter/ | 2021-12-22 18:57 | - | |
| ruby-rubocop-packaging/ | 2021-12-22 18:57 | - | |
| ruby-procto/ | 2021-12-22 18:57 | - | |
| ruby-image-science/ | 2021-12-22 18:57 | - | |
| ruby-facade/ | 2021-12-22 18:57 | - | |
| ruby-activeldap/ | 2021-12-22 18:57 | - | |
| ros-ros-environment/ | 2021-12-22 18:57 | - | |
| r-other-x4r/ | 2021-12-22 18:57 | - | |
| r-other-amsmercury/ | 2021-12-22 18:57 | - | |
| r-other-chbutils/ | 2021-12-22 18:57 | - | |
| r-cran-wordcloud/ | 2021-12-22 18:57 | - | |
| r-cran-whatif/ | 2021-12-22 18:57 | - | |
| r-cran-urltools/ | 2021-12-22 18:57 | - | |
| r-cran-spp/ | 2021-12-22 18:57 | - | |
| r-cran-squarem/ | 2021-12-22 18:57 | - | |
| r-cran-shinycssloaders/ | 2021-12-22 18:57 | - | |
| r-cran-samr/ | 2021-12-22 18:57 | - | |
| r-cran-rentrez/ | 2021-12-22 18:57 | - | |
| r-cran-rdbnomics/ | 2021-12-22 18:57 | - | |
| r-cran-princurve/ | 2021-12-22 18:57 | - | |
| r-cran-pbivnorm/ | 2021-12-22 18:57 | - | |
| r-cran-npsurv/ | 2021-12-22 18:57 | - | |
| r-cran-nlp/ | 2021-12-22 18:57 | - | |
| r-cran-medadherence/ | 2021-12-22 18:57 | - | |
| r-cran-lsei/ | 2021-12-22 18:57 | - | |
| r-cran-getoptlong/ | 2021-12-22 18:57 | - | |
| r-cran-fts/ | 2021-12-22 18:57 | - | |
| r-cran-fit.models/ | 2021-12-22 18:57 | - | |
| r-cran-etm/ | 2021-12-22 18:57 | - | |
| r-cran-contfrac/ | 2021-12-22 18:57 | - | |
| r-cran-bit64/ | 2021-12-22 18:57 | - | |
| r-cran-base64enc/ | 2021-12-22 18:57 | - | |
| rw/ | 2021-12-22 18:57 | - | |
| rust-error-chain/ | 2021-12-22 18:57 | - | |
| rust-cfg-if/ | 2021-12-22 18:57 | - | |
| rust-adler32/ | 2021-12-22 18:57 | - | |
| recastnavigation/ | 2021-12-25 18:50 | - | |
| r-cran-sparql/ | 2021-12-26 22:18 | - | |
| rust-syslog/ | 2021-12-26 22:18 | - | |
| ruby-sd-notify/ | 2021-12-27 16:18 | - | |
| rust-cache-padded/ | 2021-12-29 02:39 | - | |
| rust-dbus-tree/ | 2021-12-29 02:39 | - | |
| rust-parse-zoneinfo/ | 2021-12-31 23:43 | - | |
| rust-waker-fn/ | 2021-12-31 23:58 | - | |
| rust-tree-sitter-highlight/ | 2021-12-31 23:58 | - | |
| rust-jargon-args/ | 2022-01-02 22:18 | - | |
| ruby-git-bump/ | 2022-01-04 16:24 | - | |
| rust-atom/ | 2022-01-09 02:14 | - | |
| raqm/ | 2022-01-11 00:33 | - | |
| rust-gl-generator/ | 2022-01-14 17:39 | - | |
| rust-wasm-bindgen-webidl/ | 2022-01-17 14:54 | - | |
| ruby-grack/ | 2022-01-21 21:19 | - | |
| raintpl/ | 2022-01-22 09:24 | - | |
| rust-proc-macro-hack/ | 2022-01-22 10:29 | - | |
| ruby-opentracing/ | 2022-01-22 15:29 | - | |
| ruby-rails-dom-testing/ | 2022-01-23 03:24 | - | |
| ruby-dotenv/ | 2022-01-23 15:19 | - | |
| ruby-multipart-post/ | 2022-01-23 21:24 | - | |
| ruby-rainbow/ | 2022-01-24 21:44 | - | |
| ruby-ice-nine/ | 2022-01-24 21:44 | - | |
| ruby-with-env/ | 2022-01-24 22:19 | - | |
| ruby-gitlab-license-finder/ | 2022-01-25 04:18 | - | |
| rig/ | 2022-01-26 03:54 | - | |
| ruby-memo-wise/ | 2022-01-26 04:19 | - | |
| ruby-safe-yaml/ | 2022-01-28 21:39 | - | |
| rust-redox-termios/ | 2022-01-29 16:29 | - | |
| ruby-ddplugin/ | 2022-01-31 15:39 | - | |
| rust-data-encoding-macro-internal/ | 2022-02-01 23:34 | - | |
| rust-inotify/ | 2022-02-05 15:53 | - | |
| ruby-base32/ | 2022-02-06 03:49 | - | |
| rust-nitrokey/ | 2022-02-06 16:54 | - | |
| rust-rand-isaac/ | 2022-02-06 17:46 | - | |
| rust-rand-xorshift/ | 2022-02-06 17:46 | - | |
| rust-rand-pcg/ | 2022-02-06 17:46 | - | |
| rust-rand-xoshiro/ | 2022-02-06 17:46 | - | |
| rust-adler/ | 2022-02-07 04:19 | - | |
| rust-file-diff/ | 2022-02-07 16:14 | - | |
| rust-compare/ | 2022-02-07 16:14 | - | |
| rust-exitfailure/ | 2022-02-07 16:14 | - | |
| rust-gcd/ | 2022-02-07 16:14 | - | |
| rust-utf8-width/ | 2022-02-07 16:14 | - | |
| rust-binary-heap-plus/ | 2022-02-09 06:29 | - | |
| rust-libsensors-sys/ | 2022-02-10 03:10 | - | |
| rust-random-trait/ | 2022-02-10 03:10 | - | |
| rust-neli-proc-macros/ | 2022-02-10 03:10 | - | |
| rust-inflector/ | 2022-02-12 01:24 | - | |
| rust-rand-hc/ | 2022-02-12 02:08 | - | |
| rime-wugniu/ | 2022-02-17 04:24 | - | |
| rime-bopomofo/ | 2022-02-17 04:24 | - | |
| r-cran-kernelheaping/ | 2022-02-19 16:21 | - | |
| rust-smallbitvec/ | 2022-02-21 16:24 | - | |
| reentry/ | 2022-02-23 03:18 | - | |
| rust-der-oid-macro/ | 2022-03-02 05:09 | - | |
| rust-libhandy/ | 2022-03-02 06:09 | - | |
| rust-num/ | 2022-03-02 06:29 | - | |
| rust-statistical/ | 2022-03-02 08:34 | - | |
| rutilt/ | 2022-03-12 16:19 | - | |
| rpiboot/ | 2022-04-08 01:14 | - | |
| ruby-hamster/ | 2022-04-09 05:18 | - | |
| rust-thread-id/ | 2022-04-13 23:19 | - | |
| rpi-ws281x/ | 2022-04-20 15:39 | - | |
| raphael/ | 2022-04-29 20:17 | - | |
| r-cran-shinystan/ | 2022-04-29 20:17 | - | |
| rdf4j/ | 2022-04-29 20:40 | - | |
| r-cran-dirmult/ | 2022-04-29 21:00 | - | |
| r-cran-cvst/ | 2022-04-29 21:00 | - | |
| r-cran-batchjobs/ | 2022-04-29 21:00 | - | |
| rust-conv/ | 2022-04-29 22:34 | - | |
| rust-chunked-transfer/ | 2022-04-29 22:34 | - | |
| r-cran-stable/ | 2022-04-29 22:50 | - | |
| rarcrack/ | 2022-04-29 23:09 | - | |
| r-cran-cutpointr/ | 2022-04-30 01:04 | - | |
| rust-weedle/ | 2022-04-30 01:45 | - | |
| retweet/ | 2022-04-30 03:29 | - | |
| redet/ | 2022-04-30 03:29 | - | |
| r-cran-multilevel/ | 2022-04-30 03:29 | - | |
| ruby-zip/ | 2022-04-30 03:44 | - | |
| ruby-net-ssh-multi/ | 2022-04-30 03:44 | - | |
| r-cran-hwriter/ | 2022-04-30 03:44 | - | |
| ruby-i18n-inflector/ | 2022-04-30 03:44 | - | |
| ruby-em-socksify/ | 2022-04-30 03:44 | - | |
| r-cran-gsa/ | 2022-04-30 03:44 | - | |
| r-cran-mathjaxr/ | 2022-04-30 03:59 | - | |
| r-cran-linprog/ | 2022-04-30 03:59 | - | |
| ruby-delayer/ | 2022-04-30 04:14 | - | |
| ruby-bsearch/ | 2022-04-30 04:14 | - | |
| ruby-devise-two-factor/ | 2022-04-30 06:22 | - | |
| ros-vcstool/ | 2022-04-30 06:22 | - | |
| redmine-plugin-custom-css/ | 2022-04-30 06:22 | - | |
| r-cran-xmlparsedata/ | 2022-04-30 06:22 | - | |
| r-cran-cmdfun/ | 2022-04-30 06:22 | - | |
| ruby-ssh-data/ | 2022-04-30 06:23 | - | |
| rust-fdlimit/ | 2022-04-30 06:27 | - | |
| rust-easy-cast/ | 2022-04-30 06:27 | - | |
| rust-difflib/ | 2022-04-30 06:27 | - | |
| rust-device-tree/ | 2022-04-30 06:27 | - | |
| ros2-colcon-pkg-config/ | 2022-04-30 14:56 | - | |
| ros2-colcon-package-selection/ | 2022-04-30 14:56 | - | |
| ros2-colcon-test-result/ | 2022-04-30 14:56 | - | |
| ros2-colcon-library-path/ | 2022-04-30 14:56 | - | |
| ros2-colcon-argcomplete/ | 2022-04-30 14:56 | - | |
| rust-local-ipaddress/ | 2022-04-30 21:37 | - | |
| rust-libflate-lz77/ | 2022-04-30 21:37 | - | |
| rust-new-debug-unreachable/ | 2022-04-30 21:38 | - | |
| rust-minimal-lexical/ | 2022-04-30 21:38 | - | |
| rust-intervaltree/ | 2022-04-30 21:38 | - | |
| rust-enum-primitive-derive/ | 2022-04-30 21:38 | - | |
| rust-color-quant/ | 2022-04-30 21:38 | - | |
| regionset/ | 2022-04-30 21:38 | - | |
| r-cran-rlrsim/ | 2022-05-01 02:11 | - | |
| rust-bencher/ | 2022-05-01 02:11 | - | |
| rust-weezl/ | 2022-05-01 02:11 | - | |
| rust-uncased/ | 2022-05-01 02:11 | - | |
| rust-servo-fontconfig/ | 2022-05-01 02:11 | - | |
| rust-seahash/ | 2022-05-01 02:11 | - | |
| rust-pkg-version-impl/ | 2022-05-01 02:11 | - | |
| rang/ | 2022-05-01 04:40 | - | |
| rust-rusticata-macros/ | 2022-05-01 08:49 | - | |
| rust-structopt-derive/ | 2022-05-01 09:04 | - | |
| rust-structopt/ | 2022-05-01 10:39 | - | |
| rust-gif/ | 2022-05-01 10:59 | - | |
| rust-dhcp4r/ | 2022-05-01 11:13 | - | |
| rust-cexpr/ | 2022-05-01 11:44 | - | |
| rust-pktparse/ | 2022-05-01 11:44 | - | |
| rust-nom-derive/ | 2022-05-02 03:44 | - | |
| rust-pathfinder-geometry/ | 2022-05-02 03:44 | - | |
| rust-der-parser/ | 2022-05-02 04:34 | - | |
| rust-xcursor/ | 2022-05-02 04:34 | - | |
| rust-serde-urlencoded/ | 2022-05-04 05:34 | - | |
| ruby-deep-merge/ | 2022-05-04 11:24 | - | |
| r-cran-km.ci/ | 2022-05-04 14:39 | - | |
| ruby-sentry-ruby-core/ | 2022-05-10 17:19 | - | |
| raku-zef/ | 2022-05-13 05:20 | - | |
| rust-shell-words/ | 2022-05-15 04:34 | - | |
| rust-tree-sitter-tags/ | 2022-05-15 10:39 | - | |
| rust-osmesa-sys/ | 2022-05-15 10:59 | - | |
| r-cran-dygraphs/ | 2022-05-15 16:29 | - | |
| rust-assert-approx-eq/ | 2022-05-16 02:20 | - | |
| rust-shared-library/ | 2022-05-16 11:21 | - | |
| rsyntaxtextarea/ | 2022-05-17 04:50 | - | |
| r-cran-maptree/ | 2022-05-17 10:34 | - | |
| r-cran-dichromat/ | 2022-05-17 10:34 | - | |
| r-cran-polynom/ | 2022-05-18 10:44 | - | |
| r-cran-reshape/ | 2022-05-18 10:44 | - | |
| r-cran-psy/ | 2022-05-18 10:44 | - | |
| r-cran-r2d2/ | 2022-05-18 10:44 | - | |
| r-cran-pbmcapply/ | 2022-05-18 11:35 | - | |
| ruby-terminal-table/ | 2022-05-18 16:44 | - | |
| r-cran-randomglm/ | 2022-05-20 11:09 | - | |
| rcolorbrewer/ | 2022-05-21 11:18 | - | |
| r-cran-setrng/ | 2022-05-22 16:35 | - | |
| rust-http-body/ | 2022-05-25 03:39 | - | |
| rust-assert-cli/ | 2022-05-25 11:21 | - | |
| r-cran-tsne/ | 2022-05-25 18:45 | - | |
| r-cran-survmisc/ | 2022-05-25 18:45 | - | |
| ruby-omniauth-ultraauth/ | 2022-05-26 22:49 | - | |
| r-cran-shinybs/ | 2022-05-28 04:29 | - | |
| rust-fnv/ | 2022-05-28 17:39 | - | |
| rust-merge-derive/ | 2022-05-29 11:04 | - | |
| rust-ref-filter-map/ | 2022-05-29 11:04 | - | |
| rust-enumber/ | 2022-05-29 11:04 | - | |
| rust-hex-view/ | 2022-05-29 11:04 | - | |
| rust-enclose/ | 2022-05-29 11:04 | - | |
| rust-core-graphics-types/ | 2022-05-29 11:04 | - | |
| rust-const-cstr/ | 2022-05-29 11:04 | - | |
| rust-sensors/ | 2022-05-29 11:04 | - | |
| rust-zbase32/ | 2022-05-29 11:04 | - | |
| rust-mnt/ | 2022-05-29 11:04 | - | |
| rust-checked-int-cast/ | 2022-05-29 11:04 | - | |
| rust-bare-metal/ | 2022-05-29 11:04 | - | |
| resfinder-db/ | 2022-05-29 17:24 | - | |
| r-cran-rcppml/ | 2022-05-31 14:05 | - | |
| rust-rlimit/ | 2022-05-31 17:21 | - | |
| r-cran-metadat/ | 2022-06-01 11:19 | - | |
| rust-blobby/ | 2022-06-01 11:44 | - | |
| rust-quick-error/ | 2022-06-01 17:14 | - | |
| rust-ioctl-sys/ | 2022-06-01 17:14 | - | |
| rust-z85/ | 2022-06-01 17:14 | - | |
| rust-instant/ | 2022-06-01 22:49 | - | |
| ruby-rails-assets-markdown-it/ | 2022-06-02 17:05 | - | |
| ruby-entypo-rails/ | 2022-06-02 17:05 | - | |
| ruby-backbone-on-rails/ | 2022-06-02 17:05 | - | |
| rust-hmac/ | 2022-06-02 22:54 | - | |
| rust-stream-cipher/ | 2022-06-03 10:43 | - | |
| rust-sha1-asm/ | 2022-06-03 17:21 | - | |
| rust-retain-mut/ | 2022-06-04 10:43 | - | |
| requests-aws/ | 2022-06-04 22:44 | - | |
| redis-py-cluster/ | 2022-06-04 22:44 | - | |
| ruby-tty-screen/ | 2022-06-04 23:20 | - | |
| rust-sha2-asm/ | 2022-06-04 23:20 | - | |
| rust-dns-parser/ | 2022-06-05 10:44 | - | |
| rust-bit-vec/ | 2022-06-05 16:44 | - | |
| rime-scj/ | 2022-06-07 11:20 | - | |
| rust-core-graphics/ | 2022-06-07 17:54 | - | |
| ruby-webrick/ | 2022-06-09 11:43 | - | |
| r-cran-prevalence/ | 2022-06-10 11:20 | - | |
| rust-yeslogic-fontconfig-sys/ | 2022-06-11 12:14 | - | |
| rust-openssl-macros/ | 2022-06-11 12:14 | - | |
| rust-bit-set/ | 2022-06-11 14:23 | - | |
| rust-slog-async/ | 2022-06-12 14:25 | - | |
| rust-sha-1/ | 2022-06-13 11:19 | - | |
| ruby-cocoon/ | 2022-06-14 10:35 | - | |
| ruby-celluloid-essentials/ | 2022-06-14 10:35 | - | |
| ruby-clamp/ | 2022-06-14 10:35 | - | |
| ruby-appraisal/ | 2022-06-14 10:35 | - | |
| ruby-ace-rails-ap/ | 2022-06-14 10:35 | - | |
| ruby-devise-token-authenticatable/ | 2022-06-14 10:35 | - | |
| ruby-cliver/ | 2022-06-14 10:35 | - | |
| ruby-celluloid-pool/ | 2022-06-14 10:35 | - | |
| ruby-blockenspiel/ | 2022-06-14 10:35 | - | |
| ruby-colorize/ | 2022-06-14 10:35 | - | |
| ruby-unindent/ | 2022-06-14 11:00 | - | |
| ruby-u2f/ | 2022-06-14 11:00 | - | |
| ruby-ref/ | 2022-06-14 11:00 | - | |
| ruby-zentest/ | 2022-06-14 11:00 | - | |
| ruby-wikicloth/ | 2022-06-14 11:00 | - | |
| ruby-webfinger/ | 2022-06-14 11:00 | - | |
| ruby-unf/ | 2022-06-14 11:00 | - | |
| ruby-webrobots/ | 2022-06-14 11:00 | - | |
| ruby-rspec-pending-for/ | 2022-06-14 11:00 | - | |
| ruby-minimization/ | 2022-06-14 11:00 | - | |
| ruby-little-plugger/ | 2022-06-14 11:00 | - | |
| ruby-text-table/ | 2022-06-14 11:00 | - | |
| ruby-remcached/ | 2022-06-14 11:00 | - | |
| ruby-table-print/ | 2022-06-14 11:00 | - | |
| ruby-ruby-engine/ | 2022-06-14 11:00 | - | |
| ruby-multi-test/ | 2022-06-14 11:00 | - | |
| ruby-rack-flash3/ | 2022-06-14 11:00 | - | |
| ruby-swd/ | 2022-06-14 11:00 | - | |
| ruby-ogginfo/ | 2022-06-14 11:00 | - | |
| ruby-ruby-version/ | 2022-06-14 11:00 | - | |
| ruby-romkan/ | 2022-06-14 11:00 | - | |
| ruby-rack-mobile-detect/ | 2022-06-14 11:00 | - | |
| ruby-indentation/ | 2022-06-14 11:00 | - | |
| ruby-prawn-table/ | 2022-06-14 11:00 | - | |
| ruby-origin/ | 2022-06-14 11:00 | - | |
| ruby-htmlentities/ | 2022-06-14 11:00 | - | |
| ruby-hmac/ | 2022-06-14 11:00 | - | |
| ruby-hashery/ | 2022-06-14 11:00 | - | |
| ruby-gherkin/ | 2022-06-14 11:00 | - | |
| ruby-eye/ | 2022-06-14 11:00 | - | |
| ruby-em-spec/ | 2022-06-14 11:00 | - | |
| ruby-escape/ | 2022-06-14 11:00 | - | |
| ruby-ejs/ | 2022-06-14 11:00 | - | |
| ruby-diaspora-prosody-config/ | 2022-06-14 11:00 | - | |
| rdtool/ | 2022-06-14 11:00 | - | |
| ruby-docile/ | 2022-06-14 11:00 | - | |
| rust-colorsys/ | 2022-06-14 23:49 | - | |
| rust-magnet-uri/ | 2022-06-14 23:49 | - | |
| rust-wio/ | 2022-06-15 02:28 | - | |
| rust-valuable-derive/ | 2022-06-15 02:28 | - | |
| rust-streaming-stats/ | 2022-06-15 02:28 | - | |
| rust-x11/ | 2022-06-15 05:44 | - | |
| radioclk/ | 2022-06-16 23:06 | - | |
| reptyr/ | 2022-06-17 17:20 | - | |
| r-cran-benchmarkme/ | 2022-06-17 22:59 | - | |
| r-cran-biwt/ | 2022-06-17 22:59 | - | |
| rust-json/ | 2022-06-21 10:53 | - | |
| rust-wait-timeout/ | 2022-06-23 19:09 | - | |
| rust-stable-deref-trait/ | 2022-06-23 19:09 | - | |
| rust-language-tags/ | 2022-06-23 19:09 | - | |
| ruby-public-suffix/ | 2022-06-23 22:24 | - | |
| rust-threadpool/ | 2022-06-23 23:33 | - | |
| r-cran-r.methodss3/ | 2022-06-24 04:34 | - | |
| rust-tower-service/ | 2022-06-24 12:34 | - | |
| rust-simd-helpers/ | 2022-06-24 17:38 | - | |
| rust-noop-proc-macro/ | 2022-06-24 17:38 | - | |
| r-cran-restfulr/ | 2022-06-24 19:29 | - | |
| rust-size-format/ | 2022-06-25 20:14 | - | |
| rust-pathdiff/ | 2022-06-25 20:14 | - | |
| rust-gl/ | 2022-06-25 20:14 | - | |
| rust-num-format/ | 2022-06-26 05:19 | - | |
| ruby-test-unit-rr/ | 2022-06-26 10:24 | - | |
| rust-float-cmp/ | 2022-06-26 22:54 | - | |
| rust-autocfg/ | 2022-06-26 22:54 | - | |
| r-cran-gb2/ | 2022-06-27 10:29 | - | |
| rust-snafu-derive/ | 2022-06-28 04:58 | - | |
| r-cran-lobstr/ | 2022-06-28 11:28 | - | |
| r-cran-uniqtag/ | 2022-06-28 16:25 | - | |
| rust-mime-guess/ | 2022-06-29 05:19 | - | |
| r-cran-qap/ | 2022-06-29 05:33 | - | |
| ruby-buff-ignore/ | 2022-06-30 22:44 | - | |
| ruby-buff-extensions/ | 2022-06-30 22:44 | - | |
| rexical/ | 2022-06-30 22:44 | - | |
| redmine-recaptcha/ | 2022-07-01 16:29 | - | |
| rust-lab/ | 2022-07-01 17:20 | - | |
| rust-ar/ | 2022-07-02 18:44 | - | |
| rust-pamsm/ | 2022-07-06 14:39 | - | |
| ruby-faker/ | 2022-07-07 05:19 | - | |
| rust-ghost/ | 2022-07-08 22:39 | - | |
| rust-indenter/ | 2022-07-08 22:39 | - | |
| rust-send-wrapper/ | 2022-07-08 22:39 | - | |
| rust-assert-impl/ | 2022-07-09 17:19 | - | |
| rust-ptr-meta-derive/ | 2022-07-09 23:25 | - | |
| r-cran-bios2cor/ | 2022-07-11 10:34 | - | |
| rust-gettext-sys/ | 2022-07-11 11:19 | - | |
| rust-scan-fmt/ | 2022-07-11 19:30 | - | |
| rust-getset/ | 2022-07-11 19:30 | - | |
| r-cran-ica/ | 2022-07-12 16:40 | - | |
| r-cran-enrichwith/ | 2022-07-13 11:19 | - | |
| r-cran-paramhelpers/ | 2022-07-13 12:04 | - | |
| r-cran-rhandsontable/ | 2022-07-13 16:34 | - | |
| ruby-ipynbdiff/ | 2022-07-15 11:20 | - | |
| ruby-simple-oauth/ | 2022-07-16 10:24 | - | |
| ruby-notify/ | 2022-07-16 10:24 | - | |
| ruby-numru-units/ | 2022-07-16 16:19 | - | |
| ruby-numru-misc/ | 2022-07-16 16:19 | - | |
| ruby-memoist/ | 2022-07-17 11:04 | - | |
| ruby-jekyll-test-plugin-malicious/ | 2022-07-17 11:04 | - | |
| ruby-colorator/ | 2022-07-17 16:39 | - | |
| ruby-nenv/ | 2022-07-17 17:21 | - | |
| ruby-shellany/ | 2022-07-17 17:21 | - | |
| ruby-guard-compat/ | 2022-07-17 17:21 | - | |
| ruby-classifier-reborn/ | 2022-07-18 05:09 | - | |
| ruby-twitter-oauth/ | 2022-07-18 10:28 | - | |
| ruby-emot/ | 2022-07-18 10:28 | - | |
| rust-tree-magic-db/ | 2022-07-21 05:20 | - | |
| rust-tinyvec-macros/ | 2022-07-21 05:20 | - | |
| rust-protobuf-support/ | 2022-07-21 05:20 | - | |
| ruby-jekyll-coffeescript/ | 2022-07-22 11:09 | - | |
| r-cran-partitions/ | 2022-07-22 11:29 | - | |
| rust-security-framework-sys/ | 2022-07-23 01:03 | - | |
| rust-core-foundation-sys/ | 2022-07-23 01:03 | - | |
| rust-core-arch/ | 2022-07-23 01:03 | - | |
| rust-block-cipher-trait/ | 2022-07-23 01:03 | - | |
| rust-aes-ctr/ | 2022-07-23 01:03 | - | |
| rust-aes-soft/ | 2022-07-23 01:03 | - | |
| ruby-rspec-stubbed-env/ | 2022-07-23 01:03 | - | |
| ruby-csv/ | 2022-07-23 01:03 | - | |
| rt-app/ | 2022-07-23 01:03 | - | |
| ros-message-runtime/ | 2022-07-23 01:03 | - | |
| ros-genlisp/ | 2022-07-23 01:03 | - | |
| remaster-iso/ | 2022-07-23 01:03 | - | |
| r-cran-zelig/ | 2022-07-23 01:03 | - | |
| r-cran-shinythemes/ | 2022-07-23 01:03 | - | |
| r-cran-ritis/ | 2022-07-23 01:03 | - | |
| r-cran-rappdirs/ | 2022-07-23 01:03 | - | |
| r-cran-purrrlyr/ | 2022-07-23 01:03 | - | |
| r-cran-profilemodel/ | 2022-07-23 01:03 | - | |
| r-cran-gridgraphics/ | 2022-07-23 01:03 | - | |
| r-cran-epiestim/ | 2022-07-23 01:03 | - | |
| ruby-hikidoc/ | 2022-07-23 10:54 | - | |
| ruby-forwardable-extended/ | 2022-07-23 10:54 | - | |
| rabit/ | 2022-07-23 18:06 | - | |
| redkite/ | 2022-07-23 18:06 | - | |
| ruby-rexml/ | 2022-07-23 18:06 | - | |
| rust-librespot-protocol/ | 2022-07-23 18:06 | - | |
| rust-liquid-core/ | 2022-07-23 18:06 | - | |
| rust-liquid-derive/ | 2022-07-23 18:06 | - | |
| rust-winapi/ | 2022-07-23 20:42 | - | |
| rust-tokio-timer/ | 2022-07-23 20:42 | - | |
| rust-tokio-sync/ | 2022-07-23 20:42 | - | |
| rust-tokio-tcp/ | 2022-07-23 20:42 | - | |
| rust-tokio-threadpool/ | 2022-07-23 20:42 | - | |
| rust-tokio-executor/ | 2022-07-23 20:42 | - | |
| rust-tokio-reactor/ | 2022-07-23 20:42 | - | |
| rust-termion/ | 2022-07-23 20:42 | - | |
| rust-stackvector/ | 2022-07-23 20:42 | - | |
| rust-sized-chunks/ | 2022-07-23 20:42 | - | |
| rust-rand-chacha/ | 2022-07-23 20:42 | - | |
| rust-quickcheck-macros/ | 2022-07-23 20:42 | - | |
| rust-proc-quote/ | 2022-07-23 20:42 | - | |
| rust-num-iter/ | 2022-07-23 20:42 | - | |
| rust-miow/ | 2022-07-23 20:42 | - | |
| rust-kurbo/ | 2022-07-23 20:42 | - | |
| rust-inotify-sys/ | 2022-07-23 20:42 | - | |
| rust-im-rc/ | 2022-07-23 20:42 | - | |
| rust-expat-sys/ | 2022-07-23 20:42 | - | |
| rust-dissimilar/ | 2022-07-23 20:42 | - | |
| rust-dlv-list/ | 2022-07-23 20:42 | - | |
| rust-data-encoding-macro/ | 2022-07-23 20:42 | - | |
| rust-cmake/ | 2022-07-23 20:42 | - | |
| rust-block-modes/ | 2022-07-23 20:42 | - | |
| rust-bincode/ | 2022-07-23 20:42 | - | |
| rust-backtrace-sys/ | 2022-07-23 20:42 | - | |
| ruby-websocket-extensions/ | 2022-07-23 20:42 | - | |
| ruby-wirble/ | 2022-07-23 20:42 | - | |
| ruby-xml-simple/ | 2022-07-23 20:42 | - | |
| ruby-vagrant-cloud/ | 2022-07-23 20:42 | - | |
| ruby-tomlrb/ | 2022-07-23 20:42 | - | |
| ruby-ttfunk/ | 2022-07-23 20:42 | - | |
| ruby-tty-command/ | 2022-07-23 20:42 | - | |
| ruby-tty-which/ | 2022-07-23 20:42 | - | |
| ruby-text/ | 2022-07-23 20:42 | - | |
| ruby-stringex/ | 2022-07-23 20:42 | - | |
| ruby-slop/ | 2022-07-23 20:42 | - | |
| ruby-spoon/ | 2022-07-23 20:42 | - | |
| ruby-spring/ | 2022-07-23 20:42 | - | |
| ruby-sentry-raven/ | 2022-07-23 20:42 | - | |
| ruby-rubypants/ | 2022-07-23 20:42 | - | |
| ruby-rspec-puppet-facts/ | 2022-07-23 20:42 | - | |
| ruby-rspec-rails/ | 2022-07-23 20:42 | - | |
| ruby-roadie-rails/ | 2022-07-23 20:42 | - | |
| ruby-rotp/ | 2022-07-23 20:42 | - | |
| ruby-rqrcode-rails3/ | 2022-07-23 20:42 | - | |
| ruby-rr/ | 2022-07-23 20:42 | - | |
| ruby-responders/ | 2022-07-23 20:42 | - | |
| ruby-redis-activesupport/ | 2022-07-23 20:42 | - | |
| ruby-recursive-open-struct/ | 2022-07-23 20:42 | - | |
| ruby-rails-assets-jquery-nicescroll/ | 2022-07-23 20:42 | - | |
| ruby-rails-assets-jquery.are-you-sure/ | 2022-07-23 20:42 | - | |
| ruby-rails-controller-testing/ | 2022-07-23 20:42 | - | |
| ruby-rails-assets-autosize/ | 2022-07-23 20:42 | - | |
| ruby-rails-assets-corejs-typeahead/ | 2022-07-23 20:42 | - | |
| ruby-rails-assets-emojione/ | 2022-07-23 20:42 | - | |
| ruby-raabro/ | 2022-07-23 20:42 | - | |
| ruby-protocol-http2/ | 2022-07-23 20:42 | - | |
| ruby-puma-worker-killer/ | 2022-07-23 20:42 | - | |
| ruby-prawn-svg/ | 2022-07-23 20:42 | - | |
| ruby-prawn/ | 2022-07-23 20:42 | - | |
| ruby-pdf-core/ | 2022-07-23 20:42 | - | |
| ruby-packable/ | 2022-07-23 20:42 | - | |
| ruby-open-graph-reader/ | 2022-07-23 20:42 | - | |
| ruby-openstack/ | 2022-07-23 20:42 | - | |
| ruby-mixlib-install/ | 2022-07-23 20:42 | - | |
| ruby-joiner/ | 2022-07-23 20:42 | - | |
| ruby-jquery-rails/ | 2022-07-23 20:42 | - | |
| ruby-json-schemer/ | 2022-07-23 20:42 | - | |
| ruby-httpclient/ | 2022-07-23 20:42 | - | |
| ruby-i18n-inflector-rails/ | 2022-07-23 20:42 | - | |
| ruby-inherited-resources/ | 2022-07-23 20:42 | - | |
| ruby-http-2/ | 2022-07-23 20:42 | - | |
| ruby-gollum-lib/ | 2022-07-23 20:42 | - | |
| ruby-gon/ | 2022-07-23 20:42 | - | |
| ruby-gitlab/ | 2022-07-23 20:42 | - | |
| ruby-factory-girl/ | 2022-07-23 20:42 | - | |
| ruby-fakeredis/ | 2022-07-23 20:42 | - | |
| ruby-email-reply-trimmer/ | 2022-07-23 20:42 | - | |
| ruby-enum/ | 2022-07-23 20:42 | - | |
| ruby-diaspora-federation/ | 2022-07-23 20:42 | - | |
| ruby-diva/ | 2022-07-23 20:42 | - | |
| ruby-data-migrate/ | 2022-07-23 20:42 | - | |
| ruby-creole/ | 2022-07-23 20:42 | - | |
| ruby-cssminify/ | 2022-07-23 20:42 | - | |
| ruby-clean-test/ | 2022-07-23 20:42 | - | |
| ruby-cocaine/ | 2022-07-23 20:42 | - | |
| ruby-citrus/ | 2022-07-23 20:42 | - | |
| ruby-bluefeather/ | 2022-07-23 20:42 | - | |
| ruby-beaker-hostgenerator/ | 2022-07-23 20:42 | - | |
| ruby-atlassian-jwt/ | 2022-07-23 20:42 | - | |
| ruby-actionpack-page-caching/ | 2022-07-23 20:42 | - | |
| ruby-acts-as-list/ | 2022-07-23 20:42 | - | |
| ruby-appraiser/ | 2022-07-23 20:42 | - | |
| rtax/ | 2022-07-23 20:42 | - | |
| rsymphony/ | 2022-07-23 20:42 | - | |
| rsprng/ | 2022-07-23 20:42 | - | |
| rss-bridge/ | 2022-07-23 20:42 | - | |
| rsakeyfind/ | 2022-07-23 20:42 | - | |
| ros-rosconsole-bridge/ | 2022-07-23 20:42 | - | |
| ros-random-numbers/ | 2022-07-23 20:42 | - | |
| ros-dynamic-reconfigure/ | 2022-07-23 20:42 | - | |
| roguenarok/ | 2022-07-23 20:42 | - | |
| ricks-amdgpu-utils/ | 2022-07-23 20:42 | - | |
| rickshaw/ | 2022-07-23 20:42 | - | |
| rhc/ | 2022-07-23 20:42 | - | |
| rgtk2/ | 2022-07-23 20:42 | - | |
| rggobi/ | 2022-07-23 20:42 | - | |
| revelation/ | 2022-07-23 20:42 | - | |
| rgain3/ | 2022-07-23 20:42 | - | |
| retro-gtk/ | 2022-07-23 20:42 | - | |
| requirejs-text/ | 2022-07-23 20:42 | - | |
| reqwest/ | 2022-07-23 20:42 | - | |
| redisearch/ | 2022-07-23 20:42 | - | |
| reactphp-promise-timer/ | 2022-07-23 20:42 | - | |
| reactphp-socket/ | 2022-07-23 20:42 | - | |
| reactphp-stream/ | 2022-07-23 20:42 | - | |
| reactphp-cache/ | 2022-07-23 20:42 | - | |
| reactphp-dns/ | 2022-07-23 20:42 | - | |
| reactphp-event-loop/ | 2022-07-23 20:42 | - | |
| reactphp-promise-stream/ | 2022-07-23 20:42 | - | |
| rcs/ | 2022-07-23 20:42 | - | |
| rate4site/ | 2022-07-23 20:42 | - | |
| ratchet-pawl/ | 2022-07-23 20:42 | - | |
| ratchet-rfc6455/ | 2022-07-23 20:42 | - | |
| ratchetphp/ | 2022-07-23 20:42 | - | |
| r-other-mott-happy/ | 2022-07-23 20:42 | - | |
| r-omegahat-xmlrpc/ | 2022-07-23 20:42 | - | |
| r-cran-wikidatar/ | 2022-07-23 20:42 | - | |
| r-cran-venndiagram/ | 2022-07-23 20:42 | - | |
| r-cran-testit/ | 2022-07-23 20:42 | - | |
| r-cran-svmisc/ | 2022-07-23 20:42 | - | |
| r-cran-survminer/ | 2022-07-23 20:42 | - | |
| r-cran-solrium/ | 2022-07-23 20:42 | - | |
| r-cran-sjlabelled/ | 2022-07-23 20:42 | - | |
| r-cran-shinydashboard/ | 2022-07-23 20:42 | - | |
| r-cran-shinyjs/ | 2022-07-23 20:42 | - | |
| r-cran-sitmo/ | 2022-07-23 20:42 | - | |
| r-cran-sessioninfo/ | 2022-07-23 20:42 | - | |
| r-cran-rtdists/ | 2022-07-23 20:42 | - | |
| r-cran-rsvd/ | 2022-07-23 20:42 | - | |
| r-cran-rsgcc/ | 2022-07-23 20:42 | - | |
| r-cran-rngtools/ | 2022-07-23 20:42 | - | |
| r-cran-rneos/ | 2022-07-23 20:42 | - | |
| r-cran-rlinsolve/ | 2022-07-23 20:42 | - | |
| r-cran-rlist/ | 2022-07-23 20:42 | - | |
| r-cran-rex/ | 2022-07-23 20:42 | - | |
| r-cran-rcmdcheck/ | 2022-07-23 20:42 | - | |
| r-cran-randomfieldsutils/ | 2022-07-23 20:42 | - | |
| r-cran-randomfields/ | 2022-07-23 20:42 | - | |
| r-cran-r6/ | 2022-07-23 20:42 | - | |
| r-cran-psychotree/ | 2022-07-23 20:42 | - | |
| r-cran-proxy/ | 2022-07-23 20:42 | - | |
| r-cran-polycor/ | 2022-07-23 20:42 | - | |
| r-cran-pkgcond/ | 2022-07-23 20:42 | - | |
| r-cran-permute/ | 2022-07-23 20:42 | - | |
| r-cran-parsetools/ | 2022-07-23 20:42 | - | |
| r-cran-parallelmap/ | 2022-07-23 20:42 | - | |
| r-cran-optimalcutpoints/ | 2022-07-23 20:42 | - | |
| r-cran-multicore/ | 2022-07-23 20:42 | - | |
| r-cran-minerva/ | 2022-07-23 20:42 | - | |
| r-cran-memoise/ | 2022-07-23 20:42 | - | |
| r-cran-manipulatewidgets/ | 2022-07-23 20:42 | - | |
| r-cran-magrittr/ | 2022-07-23 20:42 | - | |
| r-cran-lasso2/ | 2022-07-23 20:42 | - | |
| r-cran-iterators/ | 2022-07-23 20:42 | - | |
| r-cran-irdisplay/ | 2022-07-23 20:42 | - | |
| r-cran-int64/ | 2022-07-23 20:42 | - | |
| r-cran-hdf5/ | 2022-07-23 20:42 | - | |
| r-cran-gwidgetsrgtk2/ | 2022-07-23 20:42 | - | |
| r-cran-goftest/ | 2022-07-23 20:42 | - | |
| r-cran-generics/ | 2022-07-23 20:42 | - | |
| r-cran-genetics/ | 2022-07-23 20:42 | - | |
| r-cran-foreach/ | 2022-07-23 20:42 | - | |
| r-cran-exactranktests/ | 2022-07-23 20:42 | - | |
| r-cran-ellipsis/ | 2022-07-23 20:42 | - | |
| r-cran-dosnow/ | 2022-07-23 20:42 | - | |
| r-cran-doparallel/ | 2022-07-23 20:42 | - | |
| r-cran-domc/ | 2022-07-23 20:42 | - | |
| r-cran-diffobj/ | 2022-07-23 20:42 | - | |
| r-cran-coarsedatatools/ | 2022-07-23 20:42 | - | |
| r-cran-cmprsk/ | 2022-07-23 20:42 | - | |
| r-cran-clipr/ | 2022-07-23 20:42 | - | |
| r-cran-catools/ | 2022-07-23 20:42 | - | |
| r-cran-cardata/ | 2022-07-23 20:42 | - | |
| r-cran-caic4/ | 2022-07-23 20:42 | - | |
| r-cran-brglm/ | 2022-07-23 20:42 | - | |
| r-cran-bridgesampling/ | 2022-07-23 20:42 | - | |
| r-cran-beeswarm/ | 2022-07-23 20:42 | - | |
| r-cran-aplpack/ | 2022-07-23 20:42 | - | |
| r-cran-argparser/ | 2022-07-23 20:42 | - | |
| r-cran-assertive.base/ | 2022-07-23 20:42 | - | |
| r-cran-amore/ | 2022-07-23 20:42 | - | |
| r-cran-animation/ | 2022-07-23 20:42 | - | |
| r-cran-r.cache/ | 2022-07-24 04:33 | - | |
| rust-nibble-vec/ | 2022-07-24 04:33 | - | |
| rust-protobuf/ | 2022-07-24 11:13 | - | |
| rabbiter/ | 2022-07-28 23:37 | - | |
| ruby-test-unit-notify/ | 2022-07-29 11:31 | - | |
| r-cran-rlumshiny/ | 2022-08-02 09:18 | - | |
| rust-resolv-conf/ | 2022-08-03 17:19 | - | |
| rust-tokio-openssl/ | 2022-08-04 08:59 | - | |
| r-cran-scatterd3/ | 2022-08-05 10:24 | - | |
| ruby-http-cookie/ | 2022-08-05 22:34 | - | |
| ruby-http-form-data/ | 2022-08-05 22:34 | - | |
| ruby-awesome-nested-set/ | 2022-08-06 04:34 | - | |
| ruby-activerecord-precounter/ | 2022-08-06 04:34 | - | |
| ruby-anima/ | 2022-08-06 04:34 | - | |
| ruby-mercenary/ | 2022-08-06 11:30 | - | |
| ruby-ole/ | 2022-08-08 04:33 | - | |
| ruby-will-paginate/ | 2022-08-08 10:24 | - | |
| ruby-paper-trail/ | 2022-08-08 16:39 | - | |
| rttool/ | 2022-08-09 04:34 | - | |
| r-cran-rcarb/ | 2022-08-11 16:49 | - | |
| r-cran-bms/ | 2022-08-11 16:49 | - | |
| ruby-grape-logging/ | 2022-08-14 16:19 | - | |
| ruby-aes-key-wrap/ | 2022-08-14 22:18 | - | |
| rust-core-foundation/ | 2022-08-15 04:39 | - | |
| rust-listenfd/ | 2022-08-15 04:39 | - | |
| readerwriterqueue/ | 2022-08-15 16:34 | - | |
| r-cran-covid19us/ | 2022-08-16 17:41 | - | |
| ruby2.7/ | 2022-08-16 20:58 | - | |
| rust-unic-char-range/ | 2022-08-17 04:19 | - | |
| rust-deunicode/ | 2022-08-17 04:19 | - | |
| ruby-omniauth-ldap/ | 2022-08-17 10:39 | - | |
| rust-radix-trie/ | 2022-08-17 19:49 | - | |
| ruby-rubame/ | 2022-08-17 22:39 | - | |
| rust-slug/ | 2022-08-17 23:29 | - | |
| rust-ptr-meta/ | 2022-08-17 23:29 | - | |
| rust-snafu/ | 2022-08-17 23:29 | - | |
| rust-protobuf-codegen-pure/ | 2022-08-18 01:24 | - | |
| rust-unic-char-property/ | 2022-08-18 03:04 | - | |
| rust-unic-ucd-version/ | 2022-08-18 03:48 | - | |
| rust-unic-ucd-segment/ | 2022-08-18 08:44 | - | |
| ruby-jmespath/ | 2022-08-18 10:34 | - | |
| rust-md5-asm/ | 2022-08-18 17:34 | - | |
| rust-debugid/ | 2022-08-18 17:39 | - | |
| rust-rand-distr/ | 2022-08-18 19:39 | - | |
| rust-protoc-rust/ | 2022-08-18 19:58 | - | |
| rust-rust-cast/ | 2022-08-18 22:08 | - | |
| rust-hyper-tls/ | 2022-08-18 22:29 | - | |
| ruby-warning/ | 2022-08-19 10:34 | - | |
| ruby-rack-timeout/ | 2022-08-19 10:34 | - | |
| rust-onig/ | 2022-08-19 11:31 | - | |
| rust-rusty-fork/ | 2022-08-19 17:32 | - | |
| rust-quantiles/ | 2022-08-19 23:32 | - | |
| rust-unic-segment/ | 2022-08-20 03:19 | - | |
| r-cran-waveslim/ | 2022-08-20 23:33 | - | |
| r-cran-urlchecker/ | 2022-08-20 23:33 | - | |
| r-cran-furrr/ | 2022-08-20 23:33 | - | |
| rust-findshlibs/ | 2022-08-21 11:09 | - | |
| ruby-axiom-types/ | 2022-08-21 22:39 | - | |
| r-cran-palmerpenguins/ | 2022-08-22 04:49 | - | |
| rainloop/ | 2022-08-22 17:41 | - | |
| r-cran-shinyfiles/ | 2022-08-23 17:36 | - | |
| ruby-truncato/ | 2022-08-25 10:39 | - | |
| ruby-ntlm/ | 2022-09-08 02:25 | - | |
| rust-rspotify/ | 2022-09-09 12:08 | - | |
| ruby-deckar01-task-list/ | 2022-09-22 19:00 | - | |
| resolvconf/ | 2022-10-16 23:34 | - | |
| ros-genpy/ | 2022-11-05 23:18 | - | |
| ros-gencpp/ | 2022-11-05 23:18 | - | |
| ros-genmsg/ | 2022-11-05 23:18 | - | |
| ros-angles/ | 2022-11-05 23:18 | - | |
| re2j/ | 2022-11-05 23:18 | - | |
| rainbow.js/ | 2022-11-05 23:18 | - | |
| r-cran-rversions/ | 2022-11-05 23:18 | - | |
| r-cran-aweek/ | 2022-11-05 23:19 | - | |
| r-cran-lmertest/ | 2022-11-05 23:19 | - | |
| r-cran-janeaustenr/ | 2022-11-05 23:19 | - | |
| r-cran-ggsignif/ | 2022-11-05 23:19 | - | |
| r-cran-ggtext/ | 2022-11-05 23:19 | - | |
| rx-java/ | 2022-11-05 23:53 | - | |
| ros-rosinstall/ | 2022-11-05 23:54 | - | |
| rover/ | 2022-11-05 23:54 | - | |
| r-cran-brobdingnag/ | 2022-11-06 00:54 | - | |
| r-cran-optimparallel/ | 2022-11-06 14:49 | - | |
| r-cran-mapdata/ | 2022-11-06 21:23 | - | |
| r-cran-rwave/ | 2022-11-06 22:59 | - | |
| r-cran-tfmpvalue/ | 2022-11-06 23:14 | - | |
| remote-tty/ | 2022-11-06 23:43 | - | |
| ripser/ | 2022-11-06 23:53 | - | |
| roaraudio/ | 2022-11-07 00:03 | - | |
| root-tail/ | 2022-11-07 00:03 | - | |
| roarplaylistd/ | 2022-11-07 00:04 | - | |
| rust-nodrop-union/ | 2022-11-07 01:14 | - | |
| rust-maplit/ | 2022-11-07 01:14 | - | |
| rust-linked-hash-map/ | 2022-11-07 01:14 | - | |
| rox/ | 2022-11-07 01:14 | - | |
| ros-laser-geometry/ | 2022-11-07 01:14 | - | |
| rust-redox-syscall/ | 2022-11-07 01:33 | - | |
| rust-array-init/ | 2022-11-07 01:33 | - | |
| rust-siphasher/ | 2022-11-07 02:04 | - | |
| rust-cookie-factory/ | 2022-11-07 02:24 | - | |
| rust-wild/ | 2022-11-07 02:34 | - | |
| rust-encoding-index-tests/ | 2022-11-07 02:44 | - | |
| rust-xi-unicode/ | 2022-11-07 02:44 | - | |
| rust-getopts/ | 2022-11-07 03:35 | - | |
| rust-fixedbitset/ | 2022-11-07 03:35 | - | |
| rust-float-ord/ | 2022-11-07 03:35 | - | |
| rust-encoding-rs-io/ | 2022-11-07 03:36 | - | |
| rust-httpdate/ | 2022-11-07 04:39 | - | |
| rust-gumdrop-derive/ | 2022-11-07 04:39 | - | |
| rust-human-sort/ | 2022-11-07 10:40 | - | |
| rust-executable-path/ | 2022-11-07 10:40 | - | |
| rust-counted-array/ | 2022-11-07 10:40 | - | |
| rust-assert-matches/ | 2022-11-07 10:40 | - | |
| rust-assign/ | 2022-11-07 10:40 | - | |
| rust-ab-glyph-rasterizer/ | 2022-11-07 10:40 | - | |
| rust-wildmatch/ | 2022-11-07 10:40 | - | |
| rust-as-result/ | 2022-11-07 10:40 | - | |
| rust-psl-types/ | 2022-11-07 10:40 | - | |
| rust-ntest-proc-macro-helper/ | 2022-11-07 10:40 | - | |
| rust-nias/ | 2022-11-07 10:40 | - | |
| r-cran-mlr/ | 2022-11-07 12:59 | - | |
| rust-sharded-slab/ | 2022-11-07 15:45 | - | |
| rust-roff/ | 2022-11-07 15:45 | - | |
| rust-qrcodegen/ | 2022-11-07 15:45 | - | |
| r-cran-vim/ | 2022-11-07 17:49 | - | |
| rust-unic-langid-impl/ | 2022-11-07 19:29 | - | |
| rust-unescape/ | 2022-11-07 19:29 | - | |
| rust-uname/ | 2022-11-07 19:29 | - | |
| rust-treeline/ | 2022-11-07 19:29 | - | |
| rust-js-int/ | 2022-11-07 19:29 | - | |
| rust-lexiclean/ | 2022-11-07 19:29 | - | |
| rust-tokio-serde/ | 2022-11-07 20:25 | - | |
| rust-sluice/ | 2022-11-07 20:25 | - | |
| rrep/ | 2022-11-07 22:39 | - | |
| ruby-toml-rb/ | 2022-11-09 21:34 | - | |
| ruby-marginalia/ | 2022-11-10 03:29 | - | |
| ruby-pathutil/ | 2022-11-10 09:39 | - | |
| rust-cast/ | 2022-11-11 03:44 | - | |
| r-cran-deal/ | 2022-11-11 03:44 | - | |
| rust-version-compare/ | 2022-11-12 10:31 | - | |
| ruby-heapy/ | 2022-11-13 15:34 | - | |
| ruby-traces/ | 2022-11-13 16:35 | - | |
| ruby-amazon-ec2/ | 2022-11-14 04:06 | - | |
| r-cran-cubelyr/ | 2022-11-15 09:24 | - | |
| rust-futures-codec/ | 2022-11-15 12:09 | - | |
| rust-assert/ | 2022-11-15 16:12 | - | |
| rust-linkify/ | 2022-11-16 03:44 | - | |
| r-cran-rook/ | 2022-11-16 10:04 | - | |
| r-cran-gbutils/ | 2022-11-16 16:41 | - | |
| ruby-websocket/ | 2022-11-16 22:19 | - | |
| ruby-ice-cube/ | 2022-11-16 22:19 | - | |
| r-cran-rredlist/ | 2022-11-17 10:23 | - | |
| r-cran-deoptim/ | 2022-11-17 10:33 | - | |
| r-cran-cvar/ | 2022-11-17 16:37 | - | |
| ruby-simplecov-html/ | 2022-11-19 02:14 | - | |
| ruby-simple-captcha2/ | 2022-11-19 02:14 | - | |
| ruby-rspec-memory/ | 2022-11-19 02:14 | - | |
| ruby-rspec-files/ | 2022-11-19 02:14 | - | |
| ruby-protocol-http/ | 2022-11-19 02:14 | - | |
| ruby-protocol-http1/ | 2022-11-19 02:14 | - | |
| ruby-prawn-icon/ | 2022-11-19 02:14 | - | |
| ruby-fog-rackspace/ | 2022-11-19 02:14 | - | |
| ruby-elasticsearch-rails/ | 2022-11-19 02:14 | - | |
| ruby-espeak/ | 2022-11-19 02:14 | - | |
| ruby-diffy/ | 2022-11-19 02:14 | - | |
| ruby-em-http-request/ | 2022-11-19 02:14 | - | |
| ruby-console/ | 2022-11-19 02:14 | - | |
| ruby-configurate/ | 2022-11-19 02:14 | - | |
| ruby-builder/ | 2022-11-19 02:14 | - | |
| ruby-bootstrap-switch-rails/ | 2022-11-19 02:14 | - | |
| ruby-asset-sync/ | 2022-11-19 02:14 | - | |
| ruby-bindata/ | 2022-11-19 02:14 | - | |
| ruby-async-pool/ | 2022-11-19 02:14 | - | |
| ruby-asciidoctor-plantuml/ | 2022-11-19 02:14 | - | |
| ruby-async/ | 2022-11-19 02:14 | - | |
| rust-duct/ | 2022-11-19 02:33 | - | |
| ruby-omniauth-oauth2/ | 2022-11-19 04:30 | - | |
| rust-thread-local/ | 2022-11-19 05:24 | - | |
| ruby-omniauth-azure-activedirectory-v2/ | 2022-11-19 07:44 | - | |
| rust-ena/ | 2022-11-19 09:04 | - | |
| rust-log-reroute/ | 2022-11-19 10:02 | - | |
| rust-gumdrop/ | 2022-11-19 10:02 | - | |
| rust-generator/ | 2022-11-19 10:02 | - | |
| rust-tracing-futures/ | 2022-11-19 10:02 | - | |
| rust-temptree/ | 2022-11-19 10:02 | - | |
| rust-usb-disk-probe/ | 2022-11-19 12:29 | - | |
| rust-bytelines/ | 2022-11-19 12:29 | - | |
| ruby-omniauth-rails-csrf-protection/ | 2022-11-19 16:19 | - | |
| rust-unic-langid-macros-impl/ | 2022-11-19 16:19 | - | |
| rust-man/ | 2022-11-19 16:19 | - | |
| rust-unic-langid-macros/ | 2022-11-19 22:04 | - | |
| rust-serde-xml-rs/ | 2022-11-19 23:24 | - | |
| rust-num-enum/ | 2022-11-20 05:44 | - | |
| rust-perfrecord-mach-ipc-rendezvous/ | 2022-11-20 05:44 | - | |
| rust-talktosc/ | 2022-11-20 06:04 | - | |
| rust-app-dirs2/ | 2022-11-20 06:04 | - | |
| rust-filedescriptor/ | 2022-11-20 06:24 | - | |
| rust-better-panic/ | 2022-11-20 07:19 | - | |
| rust-educe/ | 2022-11-20 07:19 | - | |
| rust-html5ever/ | 2022-11-20 07:19 | - | |
| rust-xml5ever/ | 2022-11-20 07:19 | - | |
| rust-enquote/ | 2022-11-20 07:19 | - | |
| ruby-omniauth-dingtalk-oauth2/ | 2022-11-20 10:05 | - | |
| rust-wasmer-enumset-derive/ | 2022-11-20 10:05 | - | |
| rust-markup5ever-rcdom/ | 2022-11-20 10:06 | - | |
| rust-flexiber/ | 2022-11-20 10:06 | - | |
| rust-html2text/ | 2022-11-20 10:29 | - | |
| rust-rand/ | 2022-11-20 10:29 | - | |
| rust-libhandy-sys/ | 2022-11-20 15:51 | - | |
| rust-fix-getters-rules/ | 2022-11-20 16:54 | - | |
| rust-ntapi/ | 2022-11-20 16:54 | - | |
| rsh-redone/ | 2022-11-20 16:54 | - | |
| ruby-sixarm-ruby-unaccent/ | 2022-11-20 21:49 | - | |
| r-cran-bit/ | 2022-11-21 11:14 | - | |
| ruby-elasticsearch-model/ | 2022-11-22 07:24 | - | |
| ruby-combustion/ | 2022-11-22 15:39 | - | |
| rust-unic-langid/ | 2022-11-22 16:37 | - | |
| rust-temporary/ | 2022-11-22 16:37 | - | |
| rust-read-color/ | 2022-11-22 16:37 | - | |
| rust-os-release/ | 2022-11-22 16:37 | - | |
| r-cran-magic/ | 2022-11-23 10:15 | - | |
| r-cran-geosphere/ | 2022-11-23 13:24 | - | |
| r-cran-eco/ | 2022-11-23 13:24 | - | |
| rust-gzip-header/ | 2022-11-24 16:04 | - | |
| rampler/ | 2022-11-25 16:05 | - | |
| ruby-faraday-net-http/ | 2022-11-29 04:33 | - | |
| ruby-cvss-suite/ | 2022-11-30 04:31 | - | |
| ruby-memoizable/ | 2022-11-30 16:35 | - | |
| rust-console-error-panic-hook/ | 2022-12-01 10:55 | - | |
| ruby-narray-miss/ | 2022-12-01 15:34 | - | |
| r-cran-jpeg/ | 2022-12-02 10:19 | - | |
| rng-tools5/ | 2022-12-03 09:44 | - | |
| ruby-otr-activerecord/ | 2022-12-03 16:14 | - | |
| redberry-pipe/ | 2022-12-03 22:04 | - | |
| r-cran-jquerylib/ | 2022-12-05 02:39 | - | |
| rust-genawaiter-macro/ | 2022-12-05 08:25 | - | |
| rust-anes/ | 2022-12-05 08:25 | - | |
| radeontop/ | 2022-12-05 11:15 | - | |
| ruby-rack-oauth2/ | 2022-12-06 04:33 | - | |
| rdp-readseq/ | 2022-12-06 16:03 | - | |
| r-cran-seroincidence/ | 2022-12-06 16:03 | - | |
| rdp-alignment/ | 2022-12-06 16:03 | - | |
| r-other-wasabi/ | 2022-12-06 16:03 | - | |
| radiant/ | 2022-12-06 16:03 | - | |
| ruby-sequel/ | 2022-12-07 09:29 | - | |
| r-cran-whisker/ | 2022-12-09 09:55 | - | |
| rust-simple-asn1/ | 2022-12-10 20:39 | - | |
| r-cran-mixtools/ | 2022-12-13 04:40 | - | |
| rust-locale-config/ | 2022-12-14 15:54 | - | |
| ruby-twitter/ | 2022-12-14 21:59 | - | |
| ruby-omniauth-oauth/ | 2022-12-14 21:59 | - | |
| rust-fehler-macros/ | 2022-12-15 15:54 | - | |
| ruby-omniauth-github/ | 2022-12-15 22:32 | - | |
| rust-fehler/ | 2022-12-16 09:44 | - | |
| ruby-oedipus-lex/ | 2022-12-16 22:32 | - | |
| rubocop/ | 2022-12-21 00:09 | - | |
| rebound/ | 2022-12-21 03:24 | - | |
| runoverssh/ | 2022-12-21 09:44 | - | |
| ruby-rubocop-rspec/ | 2022-12-21 21:54 | - | |
| ruby-asciidoctor-pdf/ | 2022-12-21 22:35 | - | |
| ruby-rubocop-ast/ | 2022-12-22 22:35 | - | |
| rust-bzip2-sys/ | 2022-12-22 23:34 | - | |
| ruby-signet/ | 2022-12-23 15:19 | - | |
| ruby-uniform-notifier/ | 2022-12-23 21:34 | - | |
| ruby-test-declarative/ | 2022-12-24 15:34 | - | |
| rust-aliasable/ | 2022-12-25 21:15 | - | |
| rust-overload/ | 2022-12-25 21:15 | - | |
| rust-js-option/ | 2022-12-25 21:15 | - | |
| rust-is-debug/ | 2022-12-25 21:15 | - | |
| ruby-request-store/ | 2022-12-26 10:09 | - | |
| ruby-netrc/ | 2022-12-26 15:39 | - | |
| ruby-kaminari/ | 2022-12-28 09:24 | - | |
| rust-ucd-trie/ | 2022-12-28 16:09 | - | |
| rust-beef/ | 2022-12-29 01:00 | - | |
| rust-zbar-rust/ | 2022-12-29 04:33 | - | |
| ruby-coveralls/ | 2022-12-29 09:39 | - | |
| ruby-shoulda/ | 2022-12-29 09:39 | - | |
| ruby-omniauth-tumblr/ | 2022-12-29 15:29 | - | |
| r-cran-isoband/ | 2022-12-29 16:33 | - | |
| ruby-regexp-parser/ | 2022-12-29 22:35 | - | |
| rust-futures-locks/ | 2022-12-30 04:33 | - | |
| ruby-aruba/ | 2022-12-30 04:33 | - | |
| r-cran-gower/ | 2022-12-30 09:43 | - | |
| rust-fomat-macros/ | 2022-12-30 10:03 | - | |
| rust-codespan-reporting/ | 2022-12-31 10:30 | - | |
| rust-libc-print/ | 2022-12-31 21:44 | - | |
| rust-ctor/ | 2022-12-31 21:44 | - | |
| ruby-bunny/ | 2023-01-02 09:29 | - | |
| runawk/ | 2023-01-02 16:44 | - | |
| repopush/ | 2023-01-02 22:09 | - | |
| ruby-async-io/ | 2023-01-02 22:33 | - | |
| ruby-gh/ | 2023-01-03 03:19 | - | |
| ruby-slack-notifier/ | 2023-01-03 03:19 | - | |
| ruby-multi-json/ | 2023-01-03 03:19 | - | |
| ruby-stomp/ | 2023-01-03 09:34 | - | |
| ruby-rubocop-performance/ | 2023-01-03 09:34 | - | |
| ruby-seamless-database-pool/ | 2023-01-03 09:34 | - | |
| ruby-influxdb/ | 2023-01-04 04:05 | - | |
| ruby-task-list/ | 2023-01-05 10:24 | - | |
| rust-sptr/ | 2023-01-06 10:19 | - | |
| rust-colorful/ | 2023-01-06 10:19 | - | |
| rust-lzma-sys/ | 2023-01-06 16:39 | - | |
| ros-python-qt-binding/ | 2023-01-07 21:49 | - | |
| rust-remain/ | 2023-01-08 12:15 | - | |
| rust-progressing/ | 2023-01-08 12:15 | - | |
| rust-include-dir-macros/ | 2023-01-08 12:15 | - | |
| rust-enumn/ | 2023-01-08 12:15 | - | |
| rust-async-recursion/ | 2023-01-08 12:15 | - | |
| ruby-eim-xml/ | 2023-01-08 22:33 | - | |
| ruby-js-regex/ | 2023-01-11 03:39 | - | |
| r-cran-mclustcomp/ | 2023-01-12 16:34 | - | |
| r-cran-dendsort/ | 2023-01-12 22:36 | - | |
| rust-genawaiter-proc-macro/ | 2023-01-13 04:34 | - | |
| r-cran-rcppdist/ | 2023-01-14 04:04 | - | |
| ruby-locale/ | 2023-01-14 21:44 | - | |
| rust-ruma-macros/ | 2023-01-16 10:31 | - | |
| rust-ruma-identifiers-validation/ | 2023-01-16 10:31 | - | |
| ruby-power-assert/ | 2023-01-16 10:31 | - | |
| rust-xz2/ | 2023-01-16 16:44 | - | |
| rust-ufmt-write/ | 2023-01-16 16:44 | - | |
| rust-ufmt-macros/ | 2023-01-16 16:44 | - | |
| rust-tap/ | 2023-01-16 16:44 | - | |
| rust-secrecy/ | 2023-01-16 16:44 | - | |
| rust-scheduled-thread-pool/ | 2023-01-16 16:44 | - | |
| rust-envy/ | 2023-01-16 16:44 | - | |
| rust-dbus-udisks2/ | 2023-01-16 16:44 | - | |
| rust-pathsearch/ | 2023-01-16 16:44 | - | |
| rust-os-display/ | 2023-01-17 16:37 | - | |
| r-cran-mapproj/ | 2023-01-17 22:37 | - | |
| rust-unicode-xid/ | 2023-01-18 04:39 | - | |
| ruby-has-scope/ | 2023-01-18 21:29 | - | |
| ruby-hocon/ | 2023-01-18 22:35 | - | |
| rust-serde-path-to-error/ | 2023-01-19 16:36 | - | |
| rust-scratch/ | 2023-01-19 16:36 | - | |
| rust-termsize/ | 2023-01-20 01:49 | - | |
| ruby-rails-assets-favico.js/ | 2023-01-21 03:34 | - | |
| rust-rs-tracing/ | 2023-01-21 04:32 | - | |
| rust-inventory/ | 2023-01-21 04:32 | - | |
| r-cran-tokenizers/ | 2023-01-21 04:32 | - | |
| rust-bzip2/ | 2023-01-21 10:32 | - | |
| resvg/ | 2023-01-21 16:34 | - | |
| ruby-crack/ | 2023-01-21 16:34 | - | |
| r-cran-dorng/ | 2023-01-22 04:34 | - | |
| raku-test-meta/ | 2023-01-24 16:38 | - | |
| raku-license-spdx/ | 2023-01-24 16:38 | - | |
| ruby-rash-alt/ | 2023-01-24 21:59 | - | |
| ruby-scientist/ | 2023-01-24 21:59 | - | |
| ruby-markdown-it-html5-embed/ | 2023-01-24 21:59 | - | |
| ruby-rails-assets-jquery-fullscreen-plugin/ | 2023-01-24 21:59 | - | |
| ruby-leaflet-rails/ | 2023-01-24 21:59 | - | |
| ruby-jquery-atwho-rails/ | 2023-01-24 21:59 | - | |
| ruby-aubio/ | 2023-01-24 21:59 | - | |
| rpki-trust-anchors/ | 2023-01-24 21:59 | - | |
| ring-codec-clojure/ | 2023-01-24 21:59 | - | |
| r-cran-publish/ | 2023-01-24 21:59 | - | |
| rust-sd-notify/ | 2023-01-25 01:39 | - | |
| rust-multimap/ | 2023-01-25 01:39 | - | |
| ruby-git/ | 2023-01-25 03:49 | - | |
| ruby-jekyll-paginate-v2/ | 2023-01-25 21:49 | - | |
| ruby-omniauth/ | 2023-01-25 22:38 | - | |
| rust-faccess/ | 2023-01-26 10:34 | - | |
| rust-cxxbridge-flags/ | 2023-01-26 22:38 | - | |
| rust-cxx/ | 2023-01-26 22:38 | - | |
| rust-cxx-gen/ | 2023-01-26 22:38 | - | |
| rust-cxx-build/ | 2023-01-26 22:38 | - | |
| ruby-telesignenterprise/ | 2023-01-26 22:38 | - | |
| ruby-liquid/ | 2023-01-26 22:38 | - | |
| ruby-varia-model/ | 2023-01-27 03:55 | - | |
| r-cran-sparsesvd/ | 2023-01-27 16:37 | - | |
| rust-valuable-serde/ | 2023-01-27 16:38 | - | |
| ruby-rails-assets-diaspora-jsxc/ | 2023-01-28 09:29 | - | |
| reboot-notifier/ | 2023-01-28 10:33 | - | |
| ruby-whitewash/ | 2023-01-28 22:24 | - | |
| ruby-faraday-middleware/ | 2023-01-28 22:35 | - | |
| r-cran-wkutils/ | 2023-01-28 22:35 | - | |
| r-cran-rcpptoml/ | 2023-02-01 04:34 | - | |
| ruby-version-gem/ | 2023-02-01 22:36 | - | |
| rust-fasteval/ | 2023-02-02 04:35 | - | |
| ruby-rufus-scheduler/ | 2023-02-02 10:36 | - | |
| r-cran-lexrankr/ | 2023-02-02 16:37 | - | |
| r-cran-sourcetools/ | 2023-02-04 17:44 | - | |
| radicale-dovecot-auth/ | 2023-02-04 19:45 | - | |
| rsendmail/ | 2023-02-04 20:09 | - | |
| rust-thousands/ | 2023-02-04 21:00 | - | |
| rust-hexplay/ | 2023-02-04 21:00 | - | |
| rust-askama-escape/ | 2023-02-04 21:00 | - | |
| ruby-sys-proctable/ | 2023-02-05 15:24 | - | |
| ruby-fog-local/ | 2023-02-05 22:02 | - | |
| rust-dockerfile/ | 2023-02-06 10:35 | - | |
| ruby-turbolinks/ | 2023-02-06 15:35 | - | |
| ring-mock-clojure/ | 2023-02-07 10:33 | - | |
| ruby-localhost/ | 2023-02-07 15:35 | - | |
| ruby-jekyll-toc/ | 2023-02-07 15:35 | - | |
| ruby-net-ntp/ | 2023-02-07 15:35 | - | |
| ruby-rails-html-sanitizer/ | 2023-02-07 16:37 | - | |
| ruby-turbolinks-source/ | 2023-02-07 22:38 | - | |
| ruby-jekyll-test-plugin/ | 2023-02-08 09:29 | - | |
| ruby-jekyll-seo-tag/ | 2023-02-08 09:29 | - | |
| ruby-jekyll-relative-links/ | 2023-02-08 16:08 | - | |
| rime-essay/ | 2023-02-08 21:39 | - | |
| r-cran-shapes/ | 2023-02-09 09:45 | - | |
| ruby-oauth2/ | 2023-02-10 09:44 | - | |
| rust-migrations-internals/ | 2023-02-10 12:49 | - | |
| ruby-omniauth-google-oauth2/ | 2023-02-10 15:54 | - | |
| rust-ogg/ | 2023-02-10 22:29 | - | |
| rust-libsodium-sys/ | 2023-02-11 03:34 | - | |
| rust-lewton/ | 2023-02-11 12:03 | - | |
| rhinote/ | 2023-02-12 15:39 | - | |
| ruby-jekyll-avatar/ | 2023-02-15 22:36 | - | |
| rkt/ | 2023-02-17 10:36 | - | |
| rinutils/ | 2023-02-17 22:35 | - | |
| ruby-rails-assets-perfect-scrollbar/ | 2023-02-17 22:36 | - | |
| ruby-feedparser/ | 2023-02-18 15:34 | - | |
| ruby-celluloid/ | 2023-02-18 22:36 | - | |
| r-cran-readstata13/ | 2023-02-23 14:34 | - | |
| rust-migrations-macros/ | 2023-02-25 11:50 | - | |
| r-cran-rstatix/ | 2023-02-27 10:34 | - | |
| r-cran-pcict/ | 2023-02-27 10:34 | - | |
| r-cran-ggpubr/ | 2023-02-27 10:34 | - | |
| r-cran-bibtex/ | 2023-02-27 10:34 | - | |
| ruby-nokogumbo/ | 2023-02-28 22:46 | - | |
| ruby-ldap/ | 2023-02-28 22:46 | - | |
| ruby-god/ | 2023-02-28 22:46 | - | |
| ruby-dataobjects-sqlite3/ | 2023-02-28 22:46 | - | |
| rust-tree-magic/ | 2023-03-05 12:58 | - | |
| rust-bindgen-0.56/ | 2023-03-06 13:24 | - | |
| racon/ | 2023-03-08 16:49 | - | |
| radare2-cutter/ | 2023-03-10 21:49 | - | |
| ruby-ruby2-keywords/ | 2023-03-15 02:54 | - | |
| ruby-childprocess/ | 2023-03-15 02:54 | - | |
| ruby-mustermann/ | 2023-03-15 02:54 | - | |
| ruby-mime-types-data/ | 2023-03-15 02:54 | - | |
| ruby-ethon/ | 2023-03-15 02:54 | - | |
| ruby-ffi/ | 2023-03-15 02:54 | - | |
| ruby-nio4r/ | 2023-03-15 02:54 | - | |
| rust-r2d2/ | 2023-03-15 11:36 | - | |
| rust-parking-lot-core-0.4/ | 2023-04-10 11:30 | - | |
| ruby-github-api/ | 2023-04-10 11:30 | - | |
| ruby-omniauth-oauth2-generic/ | 2023-04-10 12:24 | - | |
| ruby-telesign/ | 2023-05-01 19:49 | - | |
| ruby-settingslogic/ | 2023-05-01 19:49 | - | |
| ruby-parallel/ | 2023-05-01 19:49 | - | |
| ruby-omniauth-facebook/ | 2023-05-01 19:49 | - | |
| r-cran-tinytest/ | 2023-05-01 19:49 | - | |
| r-cran-rslurm/ | 2023-05-01 19:49 | - | |
| r-cran-ggalluvial/ | 2023-05-01 19:49 | - | |
| r-cran-formula/ | 2023-05-01 19:49 | - | |
| ruby-asciidoctor-include-ext/ | 2023-05-01 19:49 | - | |
| refcard/ | 2023-05-01 19:50 | - | |
| ruby-silent-stream/ | 2023-05-01 23:49 | - | |
| ruby-rspec-block-is-expected/ | 2023-05-01 23:49 | - | |
| ruby-omniauth-auth0/ | 2023-05-01 23:49 | - | |
| ruby-digest-crc/ | 2023-05-01 23:49 | - | |
| randmac/ | 2023-05-02 05:29 | - | |
| ruby-kakasi-ffi/ | 2023-05-02 06:24 | - | |
| rust-vm-superio/ | 2023-05-02 07:00 | - | |
| rust-rgb/ | 2023-05-02 07:00 | - | |
| rust-async-stream-impl/ | 2023-05-02 07:00 | - | |
| rust-path-clean/ | 2023-05-02 08:14 | - | |
| rust-capng/ | 2023-05-02 08:14 | - | |
| r-cran-eipack/ | 2023-05-02 12:09 | - | |
| r-cran-mvnfast/ | 2023-05-02 12:34 | - | |
| rust-async-stream/ | 2023-05-03 01:34 | - | |
| rust-pci-driver/ | 2023-05-11 17:24 | - | |
| rust-named-lock/ | 2023-05-11 17:24 | - | |
| rust-bitreader/ | 2023-05-11 17:24 | - | |
| rtl8821ce/ | 2023-05-13 11:24 | - | |
| resteasy3.0/ | 2023-05-14 16:24 | - | |
| rust-quoted-printable/ | 2023-05-24 03:12 | - | |
| rust-bendy/ | 2023-05-24 22:19 | - | |
| rust-pyo3-asyncio-macros/ | 2023-05-26 17:04 | - | |
| rust-nomcup/ | 2023-06-02 17:54 | - | |
| r-cran-batchtools/ | 2023-06-09 17:15 | - | |
| r-cran-bold/ | 2023-06-12 11:47 | - | |
| r-cran-blob/ | 2023-06-12 11:47 | - | |
| r-cran-caret/ | 2023-06-12 14:00 | - | |
| rust-nasm-rs/ | 2023-06-12 14:34 | - | |
| rus-ispell/ | 2023-06-12 17:16 | - | |
| ruby-openid-connect/ | 2023-06-12 17:16 | - | |
| ros-rosinstall-generator/ | 2023-06-12 22:30 | - | |
| ruby-i18n-data/ | 2023-06-13 10:40 | - | |
| ruby-six/ | 2023-06-13 10:40 | - | |
| r-cran-pillar/ | 2023-06-13 10:40 | - | |
| ruby-et-orbi/ | 2023-06-13 10:40 | - | |
| rust-caps/ | 2023-06-13 11:19 | - | |
| ruby-fugit/ | 2023-06-13 13:44 | - | |
| rust-ordered-stream/ | 2023-06-13 17:05 | - | |
| rust-rfc2047/ | 2023-06-13 19:14 | - | |
| ruby-snowplow-tracker/ | 2023-06-14 05:09 | - | |
| rust-hprof/ | 2023-06-14 05:30 | - | |
| r-cran-fauxpas/ | 2023-06-14 10:39 | - | |
| r-cran-flexmix/ | 2023-06-14 10:39 | - | |
| ruby-tpm-key-attestation/ | 2023-06-14 10:39 | - | |
| r-cran-findpython/ | 2023-06-14 10:39 | - | |
| rust-sftp/ | 2023-06-14 11:29 | - | |
| ruby-fog-aliyun/ | 2023-06-14 16:24 | - | |
| ruby-google-apis-compute-v1/ | 2023-06-14 16:59 | - | |
| ruby-google-apis-sqladmin-v1beta4/ | 2023-06-14 16:59 | - | |
| ruby-google-apis-container-v1beta1/ | 2023-06-14 16:59 | - | |
| ruby-google-apis-iam-v1/ | 2023-06-14 16:59 | - | |
| ruby-jekyll-github-metadata/ | 2023-06-14 17:28 | - | |
| rust-y4m/ | 2023-06-14 23:00 | - | |
| rust-muldiv/ | 2023-06-14 23:34 | - | |
| rust-option-operations/ | 2023-06-14 23:34 | - | |
| rust-gir-format-check/ | 2023-06-14 23:34 | - | |
| ruby-jekyll-remote-theme/ | 2023-06-14 23:34 | - | |
| rust-resize/ | 2023-06-15 00:04 | - | |
| ruby-google-apis-serviceusage-v1/ | 2023-06-15 10:34 | - | |
| ruby-google-apis-cloudresourcemanager-v1/ | 2023-06-15 10:34 | - | |
| ruby-cfpropertylist/ | 2023-06-15 10:34 | - | |
| ruby-google-apis-cloudbilling-v1/ | 2023-06-15 10:34 | - | |
| rapidcheck/ | 2023-06-15 10:35 | - | |
| r-cran-dtplyr/ | 2023-06-15 11:31 | - | |
| rust-nettle/ | 2023-06-15 18:24 | - | |
| rust-termtree/ | 2023-06-15 23:04 | - | |
| rust-pager/ | 2023-06-15 23:04 | - | |
| rust-if-addrs/ | 2023-06-15 23:04 | - | |
| rust-exec/ | 2023-06-15 23:04 | - | |
| rust-predicates-tree/ | 2023-06-16 06:40 | - | |
| ros-roslisp/ | 2023-06-16 16:29 | - | |
| ros-message-generation/ | 2023-06-16 16:29 | - | |
| ros-common-msgs/ | 2023-06-16 16:59 | - | |
| ros-std-msgs/ | 2023-06-16 16:59 | - | |
| ros-navigation-msgs/ | 2023-06-16 16:59 | - | |
| ros-pcl-msgs/ | 2023-06-16 16:59 | - | |
| ros-ros-comm-msgs/ | 2023-06-16 16:59 | - | |
| ruby-google-api-client/ | 2023-06-17 16:34 | - | |
| ruby-google-apis-storage-v1/ | 2023-06-17 19:59 | - | |
| ruby-google-apis-iamcredentials-v1/ | 2023-06-17 19:59 | - | |
| ruby-google-apis-pubsub-v1/ | 2023-06-17 19:59 | - | |
| ruby-google-apis-monitoring-v3/ | 2023-06-17 19:59 | - | |
| ruby-google-apis-dns-v1/ | 2023-06-17 19:59 | - | |
| ruby-google-apis-container-v1/ | 2023-06-17 19:59 | - | |
| ruby-fog-google/ | 2023-06-17 22:54 | - | |
| ros-geometric-shapes/ | 2023-06-17 22:54 | - | |
| ruby-recaptcha/ | 2023-06-18 10:59 | - | |
| ruby-google-cloud-env/ | 2023-06-18 10:59 | - | |
| rust-countme/ | 2023-06-18 12:34 | - | |
| r-cran-scatterplot3d/ | 2023-06-18 16:39 | - | |
| ruby-googleauth/ | 2023-06-18 17:27 | - | |
| rust-psa-crypto/ | 2023-06-19 12:44 | - | |
| rust-base16ct/ | 2023-06-19 16:49 | - | |
| rust-canonical-path/ | 2023-06-19 16:49 | - | |
| rust-native-tls/ | 2023-06-20 03:59 | - | |
| ruby-countries/ | 2023-06-20 11:29 | - | |
| rust-twox-hash/ | 2023-06-20 17:49 | - | |
| rust-wyz/ | 2023-06-20 17:49 | - | |
| rust-traitobject/ | 2023-06-20 17:49 | - | |
| rust-addchain/ | 2023-06-20 17:49 | - | |
| rust-anstyle-query/ | 2023-06-20 17:49 | - | |
| r-cran-ecosolver/ | 2023-06-21 11:25 | - | |
| r-cran-bench/ | 2023-06-21 11:25 | - | |
| ruby-faraday-follow-redirects/ | 2023-06-21 11:31 | - | |
| r-cran-googledrive/ | 2023-06-21 16:34 | - | |
| r-cran-ggrastr/ | 2023-06-21 16:34 | - | |
| r-cran-gmm/ | 2023-06-21 17:04 | - | |
| r-cran-gridsvg/ | 2023-06-22 10:25 | - | |
| r-cran-googlevis/ | 2023-06-22 10:25 | - | |
| r-cran-googlesheets4/ | 2023-06-22 10:25 | - | |
| r-cran-hms/ | 2023-06-22 16:29 | - | |
| r-cran-hexbin/ | 2023-06-22 16:59 | - | |
| rust-diesel-derives/ | 2023-06-22 16:59 | - | |
| ros-ros/ | 2023-06-22 17:28 | - | |
| ros2-colcon-output/ | 2023-06-22 22:39 | - | |
| r-cran-viridislite/ | 2023-06-23 05:20 | - | |
| r-cran-sn/ | 2023-06-23 05:20 | - | |
| r-cran-simplermarkdown/ | 2023-06-23 05:20 | - | |
| r-cran-th.data/ | 2023-06-23 05:20 | - | |
| r-cran-tzdb/ | 2023-06-23 05:21 | - | |
| r-cran-inum/ | 2023-06-24 04:45 | - | |
| r-cran-jomo/ | 2023-06-24 05:19 | - | |
| r-cran-kohonen/ | 2023-06-24 05:19 | - | |
| r-cran-labdsv/ | 2023-06-24 05:19 | - | |
| r-cran-maotai/ | 2023-06-24 23:18 | - | |
| recan/ | 2023-06-25 22:59 | - | |
| r-cran-mitml/ | 2023-06-26 05:09 | - | |
| r-cran-misctools/ | 2023-06-26 05:09 | - | |
| r-cran-mice/ | 2023-06-26 05:09 | - | |
| r-cran-mnp/ | 2023-06-26 05:09 | - | |
| r-cran-spdl/ | 2023-06-26 11:19 | - | |
| r-cran-multcompview/ | 2023-06-26 11:19 | - | |
| r-cran-mutoss/ | 2023-06-26 11:19 | - | |
| r-cran-pec/ | 2023-06-26 11:19 | - | |
| r-cran-rotl/ | 2023-06-26 16:24 | - | |
| r-cran-robumeta/ | 2023-06-26 16:24 | - | |
| r-cran-qvcalc/ | 2023-06-26 16:49 | - | |
| r-cran-psychotools/ | 2023-06-26 16:49 | - | |
| r-cran-rcsdp/ | 2023-06-26 16:49 | - | |
| r-cran-regsem/ | 2023-06-26 17:44 | - | |
| rust-serde-repr/ | 2023-06-26 22:54 | - | |
| rust-if-chain/ | 2023-06-26 23:49 | - | |
| rust-mailparse/ | 2023-06-26 23:49 | - | |
| rust-iai/ | 2023-06-26 23:49 | - | |
| rust-dateparser/ | 2023-06-26 23:49 | - | |
| rust-ufmt/ | 2023-06-26 23:49 | - | |
| rust-sm3/ | 2023-06-26 23:49 | - | |
| rust-rstest-macros/ | 2023-06-26 23:49 | - | |
| rust-prettyplease/ | 2023-06-26 23:49 | - | |
| rust-rstest/ | 2023-06-27 04:34 | - | |
| r-cran-scattermore/ | 2023-06-27 04:59 | - | |
| r-cran-snowballc/ | 2023-06-27 10:48 | - | |
| ruby-zeitwerk/ | 2023-06-28 05:09 | - | |
| r-cran-stablelearner/ | 2023-06-28 05:09 | - | |
| ruby-simpleidn/ | 2023-06-28 05:09 | - | |
| r-cran-tidyverse/ | 2023-06-28 16:39 | - | |
| ruby-net-dns/ | 2023-06-28 22:34 | - | |
| ruby-ipaddr/ | 2023-06-28 22:34 | - | |
| r-cran-tufte/ | 2023-06-29 10:34 | - | |
| ruby-rackup/ | 2023-06-29 11:30 | - | |
| ruby-rack-session/ | 2023-06-29 11:30 | - | |
| r-cran-mclogit/ | 2023-06-29 11:30 | - | |
| r-cran-diagram/ | 2023-06-29 11:30 | - | |
| r-cran-triebeard/ | 2023-06-29 11:39 | - | |
| rust-num-bigint-dig/ | 2023-06-29 17:28 | - | |
| r-cran-worrms/ | 2023-06-29 23:09 | - | |
| rust-crypto-common/ | 2023-06-29 23:09 | - | |
| r-cran-mda/ | 2023-06-29 23:09 | - | |
| r-cran-fontquiver/ | 2023-06-30 06:04 | - | |
| r-cran-pbapply/ | 2023-06-30 16:34 | - | |
| r-other-ascat/ | 2023-06-30 22:54 | - | |
| r-cran-webgestaltr/ | 2023-06-30 23:31 | - | |
| rust-sc/ | 2023-07-02 17:26 | - | |
| r-cran-pkgmaker/ | 2023-07-02 17:26 | - | |
| rust-block-padding/ | 2023-07-03 02:19 | - | |
| rust-lexopt/ | 2023-07-03 18:28 | - | |
| rust-fancy-regex/ | 2023-07-04 21:38 | - | |
| rust-actix-macros/ | 2023-07-05 00:59 | - | |
| rust-cryptovec/ | 2023-07-05 01:29 | - | |
| rust-der-derive/ | 2023-07-05 01:29 | - | |
| rust-dbl/ | 2023-07-05 01:29 | - | |
| rust-cargo-emit/ | 2023-07-05 01:29 | - | |
| rust-const-oid/ | 2023-07-05 01:29 | - | |
| rust-build-rs/ | 2023-07-05 01:29 | - | |
| rust-bit/ | 2023-07-05 01:29 | - | |
| rust-binfarce/ | 2023-07-05 01:29 | - | |
| rust-atomic-polyfill/ | 2023-07-05 01:29 | - | |
| rust-iai-macro/ | 2023-07-05 02:42 | - | |
| rust-pem-rfc7468/ | 2023-07-05 02:42 | - | |
| rust-multicache/ | 2023-07-05 02:42 | - | |
| rust-mockstream/ | 2023-07-05 02:42 | - | |
| rust-typemap/ | 2023-07-05 05:04 | - | |
| rust-picky-asn1/ | 2023-07-05 06:04 | - | |
| rust-picky-asn1-der/ | 2023-07-05 12:39 | - | |
| rust-der/ | 2023-07-05 17:34 | - | |
| r-cran-sftime/ | 2023-07-06 11:01 | - | |
| rust-scroll-derive/ | 2023-07-06 13:44 | - | |
| r-cran-gridtext/ | 2023-07-06 17:04 | - | |
| rust-unsafe-any/ | 2023-07-06 17:33 | - | |
| rust-triple-accel/ | 2023-07-06 23:44 | - | |
| rust-topological-sort/ | 2023-07-06 23:44 | - | |
| rust-memo-map/ | 2023-07-06 23:44 | - | |
| rust-option-ext/ | 2023-07-06 23:44 | - | |
| rust-llvm-bitcode/ | 2023-07-06 23:44 | - | |
| rust-edit-distance/ | 2023-07-06 23:44 | - | |
| rust-flagset/ | 2023-07-06 23:44 | - | |
| ruby-ruby2ruby/ | 2023-07-07 10:29 | - | |
| rust-x11-dl/ | 2023-07-07 11:34 | - | |
| ruby-browser/ | 2023-07-07 17:29 | - | |
| rust-aes/ | 2023-07-07 17:29 | - | |
| ruby-afm/ | 2023-07-07 22:49 | - | |
| ruby-benchmark-memory/ | 2023-07-08 10:19 | - | |
| ruby-sexp-processor/ | 2023-07-08 11:26 | - | |
| ruby-ruby-parser/ | 2023-07-08 11:26 | - | |
| ruy/ | 2023-07-09 00:09 | - | |
| ruby-doorkeeper-openid-connect/ | 2023-07-10 11:27 | - | |
| rust-rtoolbox/ | 2023-07-12 02:51 | - | |
| rust-twofish/ | 2023-07-12 02:51 | - | |
| rust-thiserror-core-impl/ | 2023-07-12 02:51 | - | |
| rust-json5/ | 2023-07-12 02:51 | - | |
| rust-eww-shared-util/ | 2023-07-12 02:51 | - | |
| rust-dot-writer/ | 2023-07-12 02:51 | - | |
| rust-build-time/ | 2023-07-12 02:51 | - | |
| rust-cfb/ | 2023-07-12 02:51 | - | |
| rust-scroll/ | 2023-07-12 02:51 | - | |
| r-cran-truncnorm/ | 2023-07-12 11:31 | - | |
| r-cran-tibble/ | 2023-07-12 11:31 | - | |
| rust-utf8parse/ | 2023-07-12 17:17 | - | |
| ruby-app-store-connect/ | 2023-07-12 23:35 | - | |
| ruby-color/ | 2023-07-14 11:05 | - | |
| rust-auditable-extract/ | 2023-07-16 01:40 | - | |
| rust-proc-macro-error-attr/ | 2023-07-16 01:40 | - | |
| rust-backslash/ | 2023-07-16 01:40 | - | |
| rust-actix-rt/ | 2023-07-16 01:40 | - | |
| rust-smol-str/ | 2023-07-16 02:09 | - | |
| rust-thrussh-libsodium/ | 2023-07-16 02:09 | - | |
| rust-tcmalloc-sys/ | 2023-07-16 02:09 | - | |
| rust-sval-fmt/ | 2023-07-16 02:09 | - | |
| rust-mutants/ | 2023-07-16 02:09 | - | |
| rust-futures-intrusive/ | 2023-07-16 02:09 | - | |
| rust-dotenvy/ | 2023-07-16 02:09 | - | |
| rust-packed-simd/ | 2023-07-16 02:09 | - | |
| rust-peekread/ | 2023-07-16 02:09 | - | |
| rust-mutate-once/ | 2023-07-16 02:09 | - | |
| rust-camellia/ | 2023-07-16 02:09 | - | |
| rust-levenshtein/ | 2023-07-16 02:09 | - | |
| rust-blowfish/ | 2023-07-16 02:09 | - | |
| rust-funty/ | 2023-07-16 02:09 | - | |
| rust-des/ | 2023-07-16 02:09 | - | |
| rust-cast5/ | 2023-07-16 02:09 | - | |
| rust-auditable-serde/ | 2023-07-16 02:09 | - | |
| rust-anstyle-parse/ | 2023-07-16 02:09 | - | |
| rust-proc-macro-error/ | 2023-07-16 05:54 | - | |
| rust-atoi/ | 2023-07-16 10:50 | - | |
| rust-etcetera/ | 2023-07-16 11:49 | - | |
| rust-fuzzy-matcher/ | 2023-07-16 11:49 | - | |
| rust-daemonize/ | 2023-07-16 18:15 | - | |
| rust-random-number-macro-impl/ | 2023-07-16 18:15 | - | |
| rust-tracing-appender/ | 2023-07-16 21:45 | - | |
| rust-derivative/ | 2023-07-17 05:04 | - | |
| rust-serde-stacker/ | 2023-07-17 06:04 | - | |
| rust-serde-bytes/ | 2023-07-17 06:04 | - | |
| rust-ref-cast-impl/ | 2023-07-17 08:49 | - | |
| rust-subprocess/ | 2023-07-17 10:49 | - | |
| rust-camino/ | 2023-07-17 10:49 | - | |
| rust-ref-cast/ | 2023-07-17 11:19 | - | |
| rust-servo-arc/ | 2023-07-18 18:40 | - | |
| rust-cssparser-macros/ | 2023-07-18 18:40 | - | |
| r-cran-arsenal/ | 2023-07-19 10:30 | - | |
| rust-yasna/ | 2023-07-19 11:37 | - | |
| rust-goblin/ | 2023-07-19 18:09 | - | |
| rust-trackable-derive/ | 2023-07-19 19:09 | - | |
| rust-unicode-truncate/ | 2023-07-19 19:44 | - | |
| rust-chrono-humanize/ | 2023-07-20 17:06 | - | |
| rust-cssparser/ | 2023-07-21 05:34 | - | |
| ruby-babosa/ | 2023-07-23 02:34 | - | |
| r-cran-emdbook/ | 2023-07-23 10:50 | - | |
| r-cran-decor/ | 2023-07-25 03:36 | - | |
| rust-defmt-macros/ | 2023-07-25 11:31 | - | |
| rust-dirs-sys/ | 2023-07-25 11:50 | - | |
| rust-dirs/ | 2023-07-25 17:25 | - | |
| rust-rawloader/ | 2023-07-25 17:28 | - | |
| rastertosag-gdi/ | 2023-07-25 22:21 | - | |
| rust-directories/ | 2023-07-25 23:22 | - | |
| rust-phf-shared/ | 2023-07-25 23:55 | - | |
| rust-trackable/ | 2023-07-26 19:49 | - | |
| rust-lddtree/ | 2023-07-26 19:49 | - | |
| rust-ecb/ | 2023-07-26 19:49 | - | |
| rust-cfb-mode/ | 2023-07-26 19:49 | - | |
| rust-byte-string/ | 2023-07-26 19:49 | - | |
| rust-bugreport/ | 2023-07-26 19:49 | - | |
| rust-ouroboros-macro/ | 2023-07-26 22:44 | - | |
| rust-tree-sitter-config/ | 2023-07-26 23:41 | - | |
| r-cran-ellipse/ | 2023-07-27 05:30 | - | |
| rust-clap-complete-fig/ | 2023-07-27 05:42 | - | |
| rust-versionize-derive/ | 2023-07-27 06:18 | - | |
| rust-webbrowser/ | 2023-07-27 06:18 | - | |
| rust-scoped-tls/ | 2023-07-27 17:00 | - | |
| rust-glob/ | 2023-07-27 17:00 | - | |
| rust-ouroboros/ | 2023-07-29 02:09 | - | |
| rust-phf/ | 2023-07-29 02:09 | - | |
| rust-phf-codegen/ | 2023-07-29 05:19 | - | |
| rust-phf-macros/ | 2023-07-29 05:19 | - | |
| r-cran-conflicted/ | 2023-07-30 11:26 | - | |
| rust-async-tar/ | 2023-07-30 11:26 | - | |
| ruby-neighbor/ | 2023-07-31 05:29 | - | |
| rust-bs58/ | 2023-07-31 08:18 | - | |
| rust-simdutf8/ | 2023-07-31 17:14 | - | |
| ruby-circuitbox/ | 2023-08-01 17:26 | - | |
| rust-equivalent/ | 2023-08-02 02:22 | - | |
| rust-libpulse-sys/ | 2023-08-02 10:50 | - | |
| rust-xz/ | 2023-08-04 23:34 | - | |
| ruby-fission/ | 2023-08-04 23:34 | - | |
| rust-generic-array/ | 2023-08-05 22:49 | - | |
| rust-serial-test-derive/ | 2023-08-06 16:44 | - | |
| rust-hex-literal/ | 2023-08-06 23:05 | - | |
| rust-fs-extra/ | 2023-08-06 23:33 | - | |
| rust-ctr/ | 2023-08-07 05:08 | - | |
| rust-dtoa/ | 2023-08-07 05:08 | - | |
| rust-lexical-core/ | 2023-08-07 06:33 | - | |
| rust-futf/ | 2023-08-09 04:49 | - | |
| rust-tendril/ | 2023-08-09 06:49 | - | |
| rust-fat-macho/ | 2023-08-09 20:50 | - | |
| rust-defmt/ | 2023-08-09 20:50 | - | |
| rust-selectors/ | 2023-08-10 11:30 | - | |
| r-cran-locfdr/ | 2023-08-10 23:34 | - | |
| rust-serial-test/ | 2023-08-11 04:36 | - | |
| rust-quickcheck/ | 2023-08-11 04:36 | - | |
| rust-pretty-env-logger/ | 2023-08-11 04:36 | - | |
| rust-shellexpand/ | 2023-08-12 11:30 | - | |
| rust-universal-hash/ | 2023-08-12 16:34 | - | |
| rust-unic-ucd-category/ | 2023-08-13 15:04 | - | |
| rust-volatile/ | 2023-08-13 15:04 | - | |
| rust-joinery/ | 2023-08-13 15:04 | - | |
| rust-bitfield/ | 2023-08-13 15:04 | - | |
| rust-bitvec/ | 2023-08-13 15:04 | - | |
| rust-hexf-parse/ | 2023-08-13 15:04 | - | |
| rime-quick/ | 2023-08-13 23:09 | - | |
| rime-double-pinyin/ | 2023-08-15 02:44 | - | |
| rime-ipa/ | 2023-08-15 05:04 | - | |
| rust-yansi-term/ | 2023-08-15 17:09 | - | |
| rust-unicode-names2/ | 2023-08-15 17:09 | - | |
| rust-unic-ucd-ident/ | 2023-08-15 17:09 | - | |
| rust-titlecase/ | 2023-08-15 17:09 | - | |
| rust-mbox/ | 2023-08-15 17:29 | - | |
| redmine-plugin-pretend/ | 2023-08-16 16:46 | - | |
| redmine-plugin-local-avatars/ | 2023-08-16 16:46 | - | |
| r-cran-gargle/ | 2023-08-16 17:29 | - | |
| ruby-crb-blast/ | 2023-08-21 23:39 | - | |
| rust-sval-derive/ | 2023-08-25 11:35 | - | |
| rust-sval-ref/ | 2023-08-25 13:39 | - | |
| rust-sval-dynamic/ | 2023-08-25 13:39 | - | |
| rust-sval-buffer/ | 2023-08-26 00:34 | - | |
| rust-lzma-rs/ | 2023-08-27 11:37 | - | |
| rust-litrs/ | 2023-09-01 04:29 | - | |
| rust-sleef-sys/ | 2023-09-02 11:22 | - | |
| rust-document-features/ | 2023-09-02 11:30 | - | |
| rust-sval-serde/ | 2023-09-03 05:39 | - | |
| rust-jpeg-decoder/ | 2023-09-08 18:14 | - | |
| rust-base-x/ | 2023-09-08 20:19 | - | |
| rust-multibase/ | 2023-09-09 05:44 | - | |
| rust-core2/ | 2023-09-10 06:04 | - | |
| rust-parity-scale-codec-derive/ | 2023-09-11 04:31 | - | |
| rust-miniz-oxide/ | 2023-09-11 13:09 | - | |
| rust-parity-scale-codec/ | 2023-09-13 14:44 | - | |
| rust-inout/ | 2023-09-16 05:35 | - | |
| rust-cipher/ | 2023-09-16 05:35 | - | |
| rust-kamadak-exif/ | 2023-09-30 02:14 | - | |
| rust-ansi-str/ | 2023-10-03 18:11 | - | |
| rust-gtk3-macros/ | 2023-10-03 23:37 | - | |
| rust-gtk-sys/ | 2023-10-03 23:37 | - | |
| rust-gdkx11/ | 2023-10-03 23:37 | - | |
| rust-gdkx11-sys/ | 2023-10-03 23:37 | - | |
| rust-gdk/ | 2023-10-03 23:37 | - | |
| rust-atk/ | 2023-10-03 23:37 | - | |
| ruby-immutable-ruby/ | 2023-10-08 22:21 | - | |
| rust-tcmalloc/ | 2023-10-09 17:14 | - | |
| rust-convert-case/ | 2023-10-26 15:20 | - | |
| ruby-jwt/ | 2023-10-26 16:26 | - | |
| ruby-pdf-reader/ | 2023-10-26 16:26 | - | |
| ruby-rb-inotify/ | 2023-10-26 16:26 | - | |
| ruby-rails-deprecated-sanitizer/ | 2023-10-26 16:26 | - | |
| rt-extension-assetautoname/ | 2023-10-26 16:26 | - | |
| ruby-tzinfo/ | 2023-10-26 16:26 | - | |
| ruby-schash/ | 2023-10-26 16:26 | - | |
| ruby-jekyll-commonmark/ | 2023-10-26 16:26 | - | |
| ruby-html-proofer/ | 2023-10-26 16:26 | - | |
| ruby-hipchat/ | 2023-10-26 16:26 | - | |
| ruby-mini-mime/ | 2023-10-26 16:26 | - | |
| ruby-execjs/ | 2023-10-26 16:26 | - | |
| ruby-kramdown-parser-gfm/ | 2023-10-26 16:26 | - | |
| ruby-hana/ | 2023-10-26 16:26 | - | |
| ruby-guard-shell/ | 2023-10-26 16:26 | - | |
| ruby-font-awesome-rails/ | 2023-10-26 16:26 | - | |
| ruby-gettext-i18n-rails/ | 2023-10-26 16:26 | - | |
| ruby-formatador/ | 2023-10-26 16:26 | - | |
| ruby-erubi/ | 2023-10-26 16:26 | - | |
| ruby-cucumber-core/ | 2023-10-26 16:26 | - | |
| ruby-commander/ | 2023-10-26 16:26 | - | |
| restrictedpython/ | 2023-10-26 16:26 | - | |
| ruby-algebrick/ | 2023-10-26 16:26 | - | |
| ruby-addressable/ | 2023-10-26 16:26 | - | |
| rtirq/ | 2023-10-26 16:26 | - | |
| rt-extension-elapsedbusinesstime/ | 2023-10-26 16:26 | - | |
| r-cran-themis/ | 2023-10-26 16:26 | - | |
| rt-extension-assets-import-csv/ | 2023-10-26 16:26 | - | |
| r-cran-mockery/ | 2023-10-26 16:26 | - | |
| r-cran-logcondens/ | 2023-10-26 16:26 | - | |
| r-cran-labeling/ | 2023-10-26 16:26 | - | |
| r-cran-jrc/ | 2023-10-26 16:26 | - | |
| r-cran-kutils/ | 2023-10-26 16:26 | - | |
| r-cran-heatmaply/ | 2023-10-26 16:26 | - | |
| r-cran-hash/ | 2023-10-26 16:26 | - | |
| r-cran-rematch/ | 2023-10-26 16:26 | - | |
| r-cran-readmzxmldata/ | 2023-10-26 16:26 | - | |
| r-cran-ggbeeswarm/ | 2023-10-26 16:26 | - | |
| r-cran-getopt/ | 2023-10-26 16:26 | - | |
| r-cran-rcmdrmisc/ | 2023-10-26 16:26 | - | |
| r-cran-colourpicker/ | 2023-10-26 16:26 | - | |
| r-cran-rcdk/ | 2023-10-26 16:26 | - | |
| r-cran-qqman/ | 2023-10-26 16:26 | - | |
| r-cran-psyphy/ | 2023-10-26 16:26 | - | |
| r-cran-cyclocomp/ | 2023-10-26 16:26 | - | |
| r-cran-dfoptim/ | 2023-10-26 16:26 | - | |
| r-cran-clustergeneration/ | 2023-10-26 16:27 | - | |
| r-cran-prettyunits/ | 2023-10-26 16:27 | - | |
| r-cran-pammtools/ | 2023-10-26 16:27 | - | |
| r-cran-adegraphics/ | 2023-10-26 16:27 | - | |
| r-cran-airr/ | 2023-10-26 16:27 | - | |
| repetier-host/ | 2023-10-26 17:58 | - | |
| roundcube-plugins-extra/ | 2023-10-26 17:58 | - | |
| ruby-unicode-blocks/ | 2023-10-26 17:58 | - | |
| roundcube-plugin-thunderbird-labels/ | 2023-10-26 17:58 | - | |
| roundcube-plugin-contextmenu/ | 2023-10-26 17:58 | - | |
| roundcube-plugin-message-highlight/ | 2023-10-26 17:58 | - | |
| roundcube-plugin-listcommands/ | 2023-10-26 17:58 | - | |
| roundcube-plugin-sauserprefs/ | 2023-10-26 17:58 | - | |
| roundcube-plugin-keyboard-shortcuts/ | 2023-10-26 17:58 | - | |
| roundcube-plugin-fail2ban/ | 2023-10-26 17:58 | - | |
| roundcube-plugin-html5-notifier/ | 2023-10-26 17:58 | - | |
| roundcube-plugin-dovecot-impersonate/ | 2023-10-26 17:58 | - | |
| roundcube-plugin-compose-addressbook/ | 2023-10-26 17:58 | - | |
| roundcube-plugin-authres-status/ | 2023-10-26 17:58 | - | |
| rt-extension-customfieldsonupdate/ | 2023-10-26 17:59 | - | |
| rt-extension-smsnotify/ | 2023-10-26 17:59 | - | |
| rt-extension-nagios/ | 2023-10-26 17:59 | - | |
| r-cran-httr/ | 2023-10-26 20:36 | - | |
| rust-fluent-syntax/ | 2023-10-26 20:37 | - | |
| r-cran-coin/ | 2023-10-27 06:03 | - | |
| r-cran-pan/ | 2023-10-27 06:03 | - | |
| recoverjpeg/ | 2023-10-27 07:24 | - | |
| rust-cmac/ | 2023-10-27 07:24 | - | |
| rust-num-cpus/ | 2023-10-27 07:57 | - | |
| rust-uluru/ | 2023-10-27 07:57 | - | |
| rust-ucd-parse/ | 2023-10-27 07:57 | - | |
| rust-ucd-util/ | 2023-10-27 07:57 | - | |
| rust-ascii/ | 2023-10-27 08:41 | - | |
| rust-colorchoice/ | 2023-10-27 08:41 | - | |
| rust-btoi/ | 2023-10-27 10:52 | - | |
| r-cran-tigger/ | 2023-10-27 11:21 | - | |
| rust-cov-mark/ | 2023-10-27 11:21 | - | |
| rust-io-operations/ | 2023-10-27 11:52 | - | |
| rust-drop-bomb/ | 2023-10-27 11:52 | - | |
| rust-binary-merge/ | 2023-10-27 11:52 | - | |
| rust-intmap/ | 2023-10-27 12:35 | - | |
| rust-io-close/ | 2023-10-27 12:35 | - | |
| rust-prometheus-client-derive-encode/ | 2023-10-27 12:35 | - | |
| rust-is-ci/ | 2023-10-27 12:35 | - | |
| rust-jod-thread/ | 2023-10-27 12:35 | - | |
| rust-cachedir/ | 2023-10-27 15:40 | - | |
| rust-byteorder-slice/ | 2023-10-27 15:40 | - | |
| rust-blake2/ | 2023-10-27 15:40 | - | |
| rust-bit-utils/ | 2023-10-27 15:40 | - | |
| r-cran-textshaping/ | 2023-10-27 15:40 | - | |
| rust-abscissa-derive/ | 2023-10-27 15:40 | - | |
| rust-askama-derive/ | 2023-10-27 16:35 | - | |
| rust-tabled-derive/ | 2023-10-27 16:35 | - | |
| rust-libmimalloc-sys/ | 2023-10-27 17:41 | - | |
| rust-markup-proc-macro/ | 2023-10-27 17:41 | - | |
| rust-libsqlite3-sys/ | 2023-10-27 17:41 | - | |
| rust-lalrpop-util/ | 2023-10-27 17:41 | - | |
| rust-lexical-util/ | 2023-10-27 17:41 | - | |
| rust-headers-core/ | 2023-10-27 17:41 | - | |
| rust-cvt/ | 2023-10-27 17:41 | - | |
| rust-dhcproto-macros/ | 2023-10-27 17:41 | - | |
| rust-cpp-common/ | 2023-10-27 17:42 | - | |
| rust-partition-identity/ | 2023-10-27 18:11 | - | |
| rust-derive-into-owned/ | 2023-10-27 18:11 | - | |
| rust-pbkdf2/ | 2023-10-27 18:11 | - | |
| rust-owo-colors/ | 2023-10-27 18:11 | - | |
| rust-nom/ | 2023-10-27 18:11 | - | |
| rust-page-size/ | 2023-10-27 18:11 | - | |
| rust-aes-siv/ | 2023-10-27 18:11 | - | |
| rust-pest/ | 2023-10-27 18:11 | - | |
| ruby-filepath/ | 2023-10-27 19:02 | - | |
| ruby-cassiopee/ | 2023-10-27 19:02 | - | |
| rust-salsa20/ | 2023-10-27 19:02 | - | |
| rust-unic-emoji-char/ | 2023-10-27 19:02 | - | |
| rust-quick-protobuf/ | 2023-10-27 19:02 | - | |
| rust-syn-ext/ | 2023-10-27 19:02 | - | |
| rust-normpath/ | 2023-10-27 19:02 | - | |
| r-cran-udunits2/ | 2023-10-27 19:02 | - | |
| rust-structmeta-derive/ | 2023-10-27 19:50 | - | |
| rust-struct-patch-derive/ | 2023-10-27 19:50 | - | |
| rust-m-lexer/ | 2023-10-27 19:50 | - | |
| rust-inplace-vec-builder/ | 2023-10-27 20:58 | - | |
| rust-xflags-macros/ | 2023-10-27 20:58 | - | |
| rust-gethostname/ | 2023-10-27 20:58 | - | |
| rust-varint/ | 2023-10-27 20:58 | - | |
| rust-unic-ucd-hangul/ | 2023-10-27 20:58 | - | |
| rust-lexical-parse-integer/ | 2023-10-27 23:50 | - | |
| ruby-fssm/ | 2023-10-28 01:56 | - | |
| rust-range-collections/ | 2023-10-28 04:27 | - | |
| rust-fluent-langneg/ | 2023-10-28 04:27 | - | |
| rust-extprim/ | 2023-10-28 04:27 | - | |
| rust-structmeta/ | 2023-10-28 05:15 | - | |
| rust-lexical-parse-float/ | 2023-10-28 08:21 | - | |
| rime-soutzoe/ | 2023-10-28 09:04 | - | |
| rime-middle-chinese/ | 2023-10-28 09:30 | - | |
| rime-loengfan/ | 2023-10-28 09:30 | - | |
| rust-unic-ucd-normal/ | 2023-10-28 14:36 | - | |
| rust-unicode-casing/ | 2023-10-28 14:36 | - | |
| rust-unic-ucd-age/ | 2023-10-28 14:36 | - | |
| rust-unic-ucd-bidi/ | 2023-10-28 14:36 | - | |
| rust-type-map/ | 2023-10-28 14:36 | - | |
| rust-ungrammar/ | 2023-10-28 14:36 | - | |
| rust-test-strategy/ | 2023-10-28 14:36 | - | |
| rust-struct-patch/ | 2023-10-28 14:36 | - | |
| rust-to-method/ | 2023-10-28 14:36 | - | |
| rust-spinning/ | 2023-10-28 14:36 | - | |
| rust-streebog/ | 2023-10-28 14:36 | - | |
| rust-sync-wrapper/ | 2023-10-28 14:36 | - | |
| rust-sha1-smol/ | 2023-10-28 14:36 | - | |
| rust-poly1305/ | 2023-10-28 14:36 | - | |
| rust-salsa-macros/ | 2023-10-28 14:36 | - | |
| rust-rangemap/ | 2023-10-28 14:36 | - | |
| rust-pmac/ | 2023-10-28 14:36 | - | |
| rust-nohash-hasher/ | 2023-10-28 14:36 | - | |
| rust-mt19937/ | 2023-10-28 14:36 | - | |
| rust-mimalloc/ | 2023-10-28 14:36 | - | |
| rust-maybe-owned/ | 2023-10-28 14:36 | - | |
| rust-maybe-async/ | 2023-10-28 14:36 | - | |
| rust-markup/ | 2023-10-28 14:36 | - | |
| rust-jwalk/ | 2023-10-28 14:36 | - | |
| rust-macaddr/ | 2023-10-28 14:36 | - | |
| rust-libcst-derive/ | 2023-10-28 14:36 | - | |
| rust-la-arena/ | 2023-10-28 14:36 | - | |
| rust-gnuplot/ | 2023-10-28 14:36 | - | |
| rust-humantime-serde/ | 2023-10-28 14:36 | - | |
| rust-human-format/ | 2023-10-28 14:36 | - | |
| rust-hidapi/ | 2023-10-28 14:36 | - | |
| rust-http-range-header/ | 2023-10-28 14:36 | - | |
| rust-hex-fmt/ | 2023-10-28 14:36 | - | |
| rust-cvss/ | 2023-10-28 14:36 | - | |
| rust-compound-duration/ | 2023-10-28 14:36 | - | |
| rust-clru/ | 2023-10-28 14:36 | - | |
| rust-cbc/ | 2023-10-28 14:36 | - | |
| rust-allocator-api2/ | 2023-10-28 14:36 | - | |
| rust-write-json/ | 2023-10-28 15:25 | - | |
| rust-xshell-macros/ | 2023-10-28 15:25 | - | |
| rust-unicode-properties/ | 2023-10-28 15:25 | - | |
| rust-xflags/ | 2023-10-28 15:25 | - | |
| rust-unsize/ | 2023-10-28 15:25 | - | |
| r-cran-freetypeharfbuzz/ | 2023-10-28 17:21 | - | |
| r-cran-fastmatch/ | 2023-10-28 17:21 | - | |
| r-cran-raschsampler/ | 2023-10-28 17:21 | - | |
| r-cran-purrr/ | 2023-10-28 17:21 | - | |
| r-cran-boolnet/ | 2023-10-28 17:21 | - | |
| r-cran-propclust/ | 2023-10-28 17:21 | - | |
| r-cran-circular/ | 2023-10-28 17:21 | - | |
| r-cran-blockmodeling/ | 2023-10-28 17:21 | - | |
| r-cran-biasedurn/ | 2023-10-28 17:21 | - | |
| r-cran-bayesm/ | 2023-10-28 18:31 | - | |
| rust-bcder/ | 2023-10-28 18:31 | - | |
| rotter/ | 2023-10-28 18:31 | - | |
| r-cran-utf8/ | 2023-10-28 18:31 | - | |
| r-cran-rpf/ | 2023-10-28 18:31 | - | |
| r-cran-slider/ | 2023-10-28 18:31 | - | |
| r-cran-lubridate/ | 2023-10-28 18:31 | - | |
| r-cran-libcoin/ | 2023-10-28 18:31 | - | |
| r-cran-ksamples/ | 2023-10-28 18:31 | - | |
| r-cran-irace/ | 2023-10-28 18:31 | - | |
| r-cran-iso/ | 2023-10-28 18:31 | - | |
| r-cran-genabel/ | 2023-10-28 18:31 | - | |
| r-cran-gnm/ | 2023-10-28 18:31 | - | |
| rust-sval/ | 2023-10-28 19:00 | - | |
| rust-shell-escape/ | 2023-10-28 19:00 | - | |
| rust-rustversion/ | 2023-10-28 19:00 | - | |
| rust-qoi/ | 2023-10-28 19:00 | - | |
| rust-pin-project-lite/ | 2023-10-28 19:00 | - | |
| rust-pq-sys/ | 2023-10-28 19:00 | - | |
| rust-md-5/ | 2023-10-28 19:00 | - | |
| rust-mysqlclient-sys/ | 2023-10-28 19:00 | - | |
| rust-kuznyechik/ | 2023-10-28 19:00 | - | |
| rust-heck/ | 2023-10-28 19:00 | - | |
| rust-geo-types/ | 2023-10-28 19:00 | - | |
| rust-gtk-macros/ | 2023-10-28 19:00 | - | |
| rust-fst/ | 2023-10-28 19:00 | - | |
| rust-xxhash-rust/ | 2023-10-28 19:45 | - | |
| rust-xxhash-c-sys/ | 2023-10-28 19:45 | - | |
| rust-urlencoding/ | 2023-10-28 19:45 | - | |
| rust-umask/ | 2023-10-28 19:45 | - | |
| rust-uniquote/ | 2023-10-28 19:45 | - | |
| rust-tint/ | 2023-10-28 19:45 | - | |
| rust-tower-layer/ | 2023-10-28 19:45 | - | |
| rust-text-size/ | 2023-10-28 19:45 | - | |
| rust-thiserror-core/ | 2023-10-28 19:45 | - | |
| restinio/ | 2023-10-28 20:09 | - | |
| ruby-hashie/ | 2023-10-28 22:55 | - | |
| ruby-htree/ | 2023-10-28 22:55 | - | |
| ruby-gollum-rugged-adapter/ | 2023-10-28 22:55 | - | |
| ruby-rails-assets-punycode/ | 2023-10-29 00:26 | - | |
| rust-eax/ | 2023-10-29 00:26 | - | |
| rust-tiny-bench/ | 2023-10-29 01:51 | - | |
| rust-timsort/ | 2023-10-29 01:51 | - | |
| rust-ripemd/ | 2023-10-29 01:51 | - | |
| rust-ringbuf/ | 2023-10-29 01:51 | - | |
| rust-pmutil/ | 2023-10-29 01:51 | - | |
| rust-proc-mounts/ | 2023-10-29 01:51 | - | |
| rust-platforms/ | 2023-10-29 01:51 | - | |
| rust-exitcode/ | 2023-10-29 01:51 | - | |
| rust-pcap-file/ | 2023-10-29 01:51 | - | |
| rust-ansiterm/ | 2023-10-29 01:51 | - | |
| rime-wubi/ | 2023-10-29 02:14 | - | |
| rust-iri-string/ | 2023-10-29 04:55 | - | |
| rust-cpp-macros/ | 2023-10-29 04:55 | - | |
| rust-argfile/ | 2023-10-29 04:55 | - | |
| rust-srcsrv/ | 2023-10-29 05:21 | - | |
| rust-pest-meta/ | 2023-10-29 08:05 | - | |
| rust-polyline/ | 2023-10-29 08:05 | - | |
| rust-password-hash/ | 2023-10-29 08:05 | - | |
| rust-memfd/ | 2023-10-29 08:05 | - | |
| rust-humansize/ | 2023-10-29 08:05 | - | |
| rust-env-proxy/ | 2023-10-29 08:05 | - | |
| rust-fragile/ | 2023-10-29 08:05 | - | |
| rust-predicates-core/ | 2023-10-29 08:05 | - | |
| rust-console-log/ | 2023-10-29 08:44 | - | |
| rust-cpp/ | 2023-10-29 08:44 | - | |
| rust-result-like-derive/ | 2023-10-29 08:44 | - | |
| rust-pest-generator/ | 2023-10-29 09:34 | - | |
| rust-scopetime/ | 2023-10-29 09:34 | - | |
| rust-multihash-derive/ | 2023-10-29 10:00 | - | |
| rust-remove-dir-all/ | 2023-10-29 10:00 | - | |
| rust-scrypt/ | 2023-10-29 10:00 | - | |
| rust-path-dedot/ | 2023-10-29 10:40 | - | |
| rust-intl-pluralrules/ | 2023-10-29 10:40 | - | |
| rust-insta-cmd/ | 2023-10-29 10:40 | - | |
| rust-tokio-io-timeout/ | 2023-10-29 10:40 | - | |
| rust-find-crate/ | 2023-10-29 10:40 | - | |
| rust-supports-color/ | 2023-10-29 10:40 | - | |
| rust-timeago/ | 2023-10-29 11:40 | - | |
| rust-cpp-build/ | 2023-10-29 11:40 | - | |
| rust-parsec-client/ | 2023-10-29 12:19 | - | |
| rust-parse-datetime/ | 2023-10-29 12:19 | - | |
| rust-path-absolutize/ | 2023-10-29 12:39 | - | |
| rust-lsp-server/ | 2023-10-29 12:39 | - | |
| rust-multihash-codetable/ | 2023-10-29 12:39 | - | |
| rust-onig-sys/ | 2023-10-29 12:39 | - | |
| rust-criterion-cycles-per-byte/ | 2023-10-29 12:59 | - | |
| rust-caseless/ | 2023-10-29 12:59 | - | |
| rust-syntect/ | 2023-10-29 12:59 | - | |
| rust-pest-derive/ | 2023-10-29 13:24 | - | |
| rust-goldenfile/ | 2023-10-29 13:24 | - | |
| rust-ruma-push-gateway-api/ | 2023-10-29 13:50 | - | |
| rust-pkcs1/ | 2023-10-29 14:35 | - | |
| rust-petgraph/ | 2023-10-29 14:35 | - | |
| rust-result-like/ | 2023-10-29 15:24 | - | |
| rust-cp-r/ | 2023-10-29 15:24 | - | |
| rust-cargo-metadata/ | 2023-10-29 15:24 | - | |
| rust-tracing-error/ | 2023-10-29 15:24 | - | |
| rust-rustpython-ast/ | 2023-10-29 15:24 | - | |
| rust-pkcs5/ | 2023-10-29 15:24 | - | |
| rust-quitters/ | 2023-10-29 15:24 | - | |
| rust-opam-file-rs/ | 2023-10-29 15:49 | - | |
| rust-assert-fs/ | 2023-10-29 16:09 | - | |
| rust-xkb/ | 2023-10-29 16:36 | - | |
| raku-json-unmarshal/ | 2023-10-29 18:59 | - | |
| raku-json-marshal/ | 2023-10-29 18:59 | - | |
| rust-color-spantrace/ | 2023-10-29 19:44 | - | |
| rust-rust-unixfs/ | 2023-10-29 19:44 | - | |
| rust-stfu8/ | 2023-10-30 11:38 | - | |
| rust-pty-process/ | 2023-10-30 17:41 | - | |
| rust-postgres-derive/ | 2023-10-31 07:35 | - | |
| ros2-colcon-bash/ | 2023-10-31 10:42 | - | |
| ros2-colcon-parallel-executor/ | 2023-10-31 16:35 | - | |
| ros2-colcon-zsh/ | 2023-10-31 16:35 | - | |
| ros2-colcon-recursive-crawl/ | 2023-10-31 16:35 | - | |
| rust-wasm-bindgen-shared/ | 2023-10-31 18:04 | - | |
| rust-multer/ | 2023-11-01 01:21 | - | |
| rust-relative-path/ | 2023-11-01 01:21 | - | |
| rust-wasm-bindgen-backend/ | 2023-11-01 05:30 | - | |
| rust-wasm-bindgen-macro-support/ | 2023-11-01 07:50 | - | |
| rust-wasm-bindgen-macro/ | 2023-11-01 08:55 | - | |
| rust-wasm-bindgen/ | 2023-11-01 11:26 | - | |
| rng-tools-debian/ | 2023-11-01 23:53 | - | |
| rust-geojson/ | 2023-11-02 03:37 | - | |
| r-cran-rhpcblasctl/ | 2023-11-02 03:37 | - | |
| ruby-distribution/ | 2023-11-02 10:45 | - | |
| rust-quinn-udp/ | 2023-11-02 10:45 | - | |
| rust-dns-lookup/ | 2023-11-02 10:45 | - | |
| rust-nb-connect/ | 2023-11-02 10:45 | - | |
| rust-ipconfig/ | 2023-11-02 11:25 | - | |
| rust-js-sys/ | 2023-11-02 12:06 | - | |
| rust-html2md/ | 2023-11-02 16:56 | - | |
| rust-tokio-uring/ | 2023-11-03 11:42 | - | |
| rust-ucd/ | 2023-11-04 00:19 | - | |
| rust-fiat-crypto/ | 2023-11-04 00:19 | - | |
| r-cran-ecodist/ | 2023-11-04 15:30 | - | |
| ruby-activerecord-import/ | 2023-11-05 16:09 | - | |
| ruby-timeliness/ | 2023-11-06 21:46 | - | |
| ruby-minispec-metadata/ | 2023-11-07 03:24 | - | |
| r-cran-treespace/ | 2023-11-07 06:21 | - | |
| r-cran-adephylo/ | 2023-11-07 06:21 | - | |
| rust-untrusted/ | 2023-11-07 21:56 | - | |
| rust-serdect/ | 2023-11-08 01:38 | - | |
| rust-rustc-hex/ | 2023-11-08 01:38 | - | |
| rust-ff-derive/ | 2023-11-08 01:38 | - | |
| rust-doxygen-rs/ | 2023-11-08 01:38 | - | |
| rust-nom-permutation/ | 2023-11-08 01:38 | - | |
| rust-barrel/ | 2023-11-08 04:42 | - | |
| r-cran-guerry/ | 2023-11-09 21:30 | - | |
| rust-atomic-waker/ | 2023-11-09 21:30 | - | |
| r-cran-jinjar/ | 2023-11-09 22:04 | - | |
| rust-sct/ | 2023-11-10 10:32 | - | |
| rust-stderrlog/ | 2023-11-11 05:14 | - | |
| rust-pathfinder-simd/ | 2023-11-12 22:15 | - | |
| rust-diesel-migrations/ | 2023-11-13 08:20 | - | |
| rust-rlp-derive/ | 2023-11-13 08:20 | - | |
| rust-embedded-io/ | 2023-11-13 08:20 | - | |
| r-cran-ncmeta/ | 2023-11-13 15:24 | - | |
| ruby-gir-ffi/ | 2023-11-14 03:39 | - | |
| r-cran-nozzle.r1/ | 2023-11-14 21:26 | - | |
| r-cran-gfonts/ | 2023-11-14 21:26 | - | |
| rust-polyval/ | 2023-11-16 05:25 | - | |
| ruby-tins/ | 2023-11-16 15:30 | - | |
| ruby-voight-kampff/ | 2023-11-16 21:34 | - | |
| ruby-typed-array/ | 2023-11-16 21:34 | - | |
| ruby-google-cloud-errors/ | 2023-11-16 21:34 | - | |
| ruby-jekyll-last-modified-at/ | 2023-11-16 21:34 | - | |
| ruby-daemons/ | 2023-11-16 21:34 | - | |
| rust-pin-project-internal/ | 2023-11-16 21:34 | - | |
| rust-signal-hook/ | 2023-11-17 03:24 | - | |
| r-cran-matrixmodels/ | 2023-11-17 15:14 | - | |
| rust-pin-project/ | 2023-11-18 06:29 | - | |
| ruby-treetop/ | 2023-11-18 15:34 | - | |
| ruby-temple/ | 2023-11-18 21:19 | - | |
| rust-rfc6979/ | 2023-11-19 16:51 | - | |
| rust-idea/ | 2023-11-19 16:51 | - | |
| rust-ff/ | 2023-11-19 16:51 | - | |
| r-cran-sampling/ | 2023-11-20 09:51 | - | |
| rust-gpt/ | 2023-11-21 06:20 | - | |
| rust-futures-micro/ | 2023-11-21 06:20 | - | |
| rust-deluxe-macros/ | 2023-11-21 06:20 | - | |
| rust-crypto-bigint/ | 2023-11-21 06:20 | - | |
| rust-dasp-sample/ | 2023-11-21 06:20 | - | |
| rust-chacha20/ | 2023-11-21 06:20 | - | |
| rust-ct-codecs/ | 2023-11-21 06:20 | - | |
| rust-synchronoise/ | 2023-11-21 06:20 | - | |
| rust-libcst/ | 2023-11-21 06:20 | - | |
| rust-isocountry/ | 2023-11-21 06:20 | - | |
| r-cran-lifecycle/ | 2023-11-21 09:32 | - | |
| r-cran-mcmc/ | 2023-11-21 10:21 | - | |
| r-cran-psychometric/ | 2023-11-21 15:49 | - | |
| r-cran-plotrix/ | 2023-11-21 15:49 | - | |
| r-cran-rgooglemaps/ | 2023-11-21 15:49 | - | |
| r-cran-rprojroot/ | 2023-11-21 15:49 | - | |
| r-cran-ranger/ | 2023-11-21 15:50 | - | |
| rust-ed25519-compact/ | 2023-11-21 20:20 | - | |
| r-cran-warp/ | 2023-11-21 21:30 | - | |
| ruby-secure-headers/ | 2023-11-22 03:35 | - | |
| rust-botan-sys/ | 2023-11-22 21:41 | - | |
| rust-tui/ | 2023-11-23 06:29 | - | |
| rust-botan/ | 2023-11-23 12:26 | - | |
| rust-asynchronous-codec/ | 2023-11-23 15:46 | - | |
| rust-arrayvec/ | 2023-11-23 15:46 | - | |
| ruby-uc.micro-rb/ | 2023-11-23 21:30 | - | |
| ruby-in-parallel/ | 2023-11-23 21:30 | - | |
| rust-gg-alloc/ | 2023-11-23 23:40 | - | |
| rust-gag/ | 2023-11-23 23:40 | - | |
| rust-sec1/ | 2023-11-23 23:40 | - | |
| rust-route-recognizer/ | 2023-11-23 23:40 | - | |
| ruby-spy/ | 2023-11-24 04:37 | - | |
| rust-ghash/ | 2023-11-24 07:46 | - | |
| rust-unsigned-varint/ | 2023-11-24 12:20 | - | |
| rust-cid/ | 2023-11-24 15:55 | - | |
| rust-byteorder/ | 2023-11-24 21:45 | - | |
| rust-libpulse-mainloop-glib-sys/ | 2023-11-24 23:55 | - | |
| rust-chacha20poly1305/ | 2023-11-24 23:55 | - | |
| rust-alsa-sys/ | 2023-11-25 03:30 | - | |
| rust-lv2-core-derive/ | 2023-11-25 16:05 | - | |
| rust-group/ | 2023-11-25 16:05 | - | |
| rust-nbd/ | 2023-11-25 18:50 | - | |
| rust-urid-derive/ | 2023-11-25 18:50 | - | |
| rust-biquad/ | 2023-11-25 18:50 | - | |
| rust-urid/ | 2023-11-26 03:14 | - | |
| rust-lv2-core/ | 2023-11-26 04:30 | - | |
| rust-lv2-units/ | 2023-11-26 04:30 | - | |
| rust-lv2-urid/ | 2023-11-26 05:44 | - | |
| rust-lv2-midi/ | 2023-11-26 12:10 | - | |
| rust-lv2/ | 2023-11-26 13:24 | - | |
| r-cran-crosstalk/ | 2023-11-26 15:44 | - | |
| rust-lv2-time/ | 2023-11-26 15:44 | - | |
| rust-lv2-state/ | 2023-11-26 15:44 | - | |
| rust-grep-matcher/ | 2023-11-26 21:35 | - | |
| raxml/ | 2023-11-28 09:51 | - | |
| rust-fern/ | 2023-11-28 15:54 | - | |
| ruby-factory-bot-rails/ | 2023-11-28 16:30 | - | |
| rexima/ | 2023-11-29 03:25 | - | |
| ruby-librarian/ | 2023-11-29 21:35 | - | |
| ruby-pygments.rb/ | 2023-11-29 21:35 | - | |
| ruby-pathspec/ | 2023-11-29 21:35 | - | |
| rust-tokio-util/ | 2023-11-30 16:01 | - | |
| rust-ryu/ | 2023-11-30 16:01 | - | |
| rust-form-urlencoded/ | 2023-11-30 16:01 | - | |
| rust-pkg-config/ | 2023-11-30 16:01 | - | |
| rust-derive-arbitrary/ | 2023-11-30 21:35 | - | |
| rust-arbitrary/ | 2023-11-30 21:35 | - | |
| r-cran-ttr/ | 2023-12-02 16:07 | - | |
| rockhopper/ | 2023-12-03 09:56 | - | |
| rust-elliptic-curve/ | 2023-12-03 10:44 | - | |
| rust-winapi-util/ | 2023-12-03 15:38 | - | |
| rust-print-bytes/ | 2023-12-03 15:38 | - | |
| rust-os-str-bytes/ | 2023-12-03 15:38 | - | |
| rust-libssh2-sys/ | 2023-12-03 15:38 | - | |
| rust-clircle/ | 2023-12-03 15:38 | - | |
| rust-pcre2-sys/ | 2023-12-05 03:37 | - | |
| rust-pcre2/ | 2023-12-05 11:06 | - | |
| rust-dyn-clone/ | 2023-12-05 15:57 | - | |
| rust-ansi-colours/ | 2023-12-05 15:57 | - | |
| ruby-ast/ | 2023-12-05 21:52 | - | |
| rust-tracing-serde/ | 2023-12-06 03:49 | - | |
| ruby-pry-byebug/ | 2023-12-06 21:37 | - | |
| ruby-docker-api/ | 2023-12-07 21:52 | - | |
| ruby-json-spec/ | 2023-12-09 21:32 | - | |
| ruby-jar-dependencies/ | 2023-12-09 21:32 | - | |
| r-cran-lava/ | 2023-12-10 16:03 | - | |
| ruby-minitest-excludes/ | 2023-12-10 16:03 | - | |
| ruby-maven-libs/ | 2023-12-10 16:03 | - | |
| rear/ | 2023-12-10 16:03 | - | |
| rust-arg-enum-proc-macro/ | 2023-12-10 16:53 | - | |
| rust-interpolate-name/ | 2023-12-10 16:53 | - | |
| rally-openstack/ | 2023-12-11 08:33 | - | |
| r-cran-sets/ | 2023-12-11 10:16 | - | |
| rust-lcms2-sys/ | 2023-12-13 16:58 | - | |
| rust-p384/ | 2023-12-14 01:23 | - | |
| rust-orion/ | 2023-12-14 01:23 | - | |
| rust-ipnet/ | 2023-12-14 21:57 | - | |
| rust-trust-dns-resolver/ | 2023-12-15 05:33 | - | |
| rust-urlshortener/ | 2023-12-15 07:12 | - | |
| ruby-invisible-captcha/ | 2023-12-15 15:57 | - | |
| ruby-aws-eventstream/ | 2023-12-15 21:32 | - | |
| ruby-open-uri-redirections/ | 2023-12-15 21:32 | - | |
| ruby-rack-proxy/ | 2023-12-16 11:21 | - | |
| ruby-sawyer/ | 2023-12-16 15:26 | - | |
| ruby-rack-attack/ | 2023-12-16 15:26 | - | |
| rime-stroke/ | 2023-12-16 16:07 | - | |
| ruby-lockbox/ | 2023-12-18 09:42 | - | |
| r-cran-bindrcpp/ | 2023-12-18 17:31 | - | |
| rust-libpulse-glib-binding/ | 2023-12-18 18:31 | - | |
| ruby-plist/ | 2023-12-18 22:17 | - | |
| ruby-hashdiff/ | 2023-12-18 22:17 | - | |
| r-cran-xml2/ | 2023-12-20 05:56 | - | |
| r-cran-prophet/ | 2023-12-20 09:06 | - | |
| r-cran-brew/ | 2023-12-20 10:06 | - | |
| rdp-classifier/ | 2023-12-20 22:46 | - | |
| r-cran-extradistr/ | 2023-12-21 01:01 | - | |
| r-cran-filelock/ | 2023-12-21 01:01 | - | |
| r-cran-dicedesign/ | 2023-12-21 01:01 | - | |
| rust-snap/ | 2023-12-21 04:11 | - | |
| rust-gpg-error/ | 2023-12-21 15:07 | - | |
| rust-uuhelp-parser/ | 2023-12-21 16:42 | - | |
| rnahybrid/ | 2023-12-21 17:26 | - | |
| r-cran-vipor/ | 2023-12-22 09:27 | - | |
| r-cran-rniftilib/ | 2023-12-22 10:17 | - | |
| rust-uucore-procs/ | 2023-12-22 22:47 | - | |
| r-cran-future.batchtools/ | 2023-12-23 15:27 | - | |
| rust-p256/ | 2023-12-26 01:37 | - | |
| rust-linux-keyutils/ | 2023-12-26 01:37 | - | |
| ruby-flipper/ | 2023-12-30 09:39 | - | |
| ruby-chronic-duration/ | 2023-12-30 09:39 | - | |
| rust-slab/ | 2023-12-30 15:47 | - | |
| ruby-http-parser/ | 2023-12-30 21:52 | - | |
| rust-strict-num/ | 2024-01-01 16:12 | - | |
| rust-term/ | 2024-01-01 22:06 | - | |
| rust-pico-args/ | 2024-01-01 22:06 | - | |
| rust-slog-term/ | 2024-01-02 10:31 | - | |
| rust-ascii-canvas/ | 2024-01-02 10:31 | - | |
| ros2-colcon-metadata/ | 2024-01-04 09:39 | - | |
| rust-percent-encoding/ | 2024-01-05 10:09 | - | |
| rust-tikv-jemalloc-sys/ | 2024-01-05 17:00 | - | |
| rust-sys-locale/ | 2024-01-05 17:00 | - | |
| rust-rustix-openpty/ | 2024-01-05 17:00 | - | |
| rust-powerfmt-macros/ | 2024-01-05 17:00 | - | |
| rust-vsort/ | 2024-01-05 17:00 | - | |
| rust-h3-quinn/ | 2024-01-05 17:00 | - | |
| rust-concat-idents/ | 2024-01-05 17:00 | - | |
| rust-powerfmt/ | 2024-01-05 19:55 | - | |
| rust-fallible-iterator/ | 2024-01-06 04:14 | - | |
| rust-lz4-sys/ | 2024-01-06 04:55 | - | |
| rust-emojis/ | 2024-01-06 04:55 | - | |
| rust-as-raw-xcb-connection/ | 2024-01-06 04:55 | - | |
| rust-circular/ | 2024-01-06 04:55 | - | |
| rust-testing-logger/ | 2024-01-06 04:55 | - | |
| rust-str-stack/ | 2024-01-06 04:55 | - | |
| rust-ntp-ctl/ | 2024-01-06 15:45 | - | |
| rust-signature-derive/ | 2024-01-06 15:45 | - | |
| r-cran-later/ | 2024-01-08 16:15 | - | |
| r-cran-keyring/ | 2024-01-08 16:15 | - | |
| r-cran-lbfgsb3c/ | 2024-01-08 22:30 | - | |
| r-cran-mixsqp/ | 2024-01-08 23:22 | - | |
| r-cran-mets/ | 2024-01-09 00:12 | - | |
| r-cran-progress/ | 2024-01-09 03:21 | - | |
| r-cran-pingr/ | 2024-01-09 05:06 | - | |
| rust-postgres/ | 2024-01-09 05:51 | - | |
| r-cran-scales/ | 2024-01-09 09:37 | - | |
| r-cran-uroot/ | 2024-01-09 09:37 | - | |
| r-cran-snowfall/ | 2024-01-09 09:37 | - | |
| r-cran-rtsne/ | 2024-01-09 10:20 | - | |
| r-cran-tensora/ | 2024-01-09 11:12 | - | |
| r-cran-stringdist/ | 2024-01-09 11:12 | - | |
| rust-pretty-hex/ | 2024-01-09 22:26 | - | |
| rust-atomic-refcell/ | 2024-01-10 04:45 | - | |
| rust-tree-sitter/ | 2024-01-10 11:14 | - | |
| rust-tiff/ | 2024-01-10 11:14 | - | |
| rust-tiny-http/ | 2024-01-10 11:14 | - | |
| rust-string-cache-codegen/ | 2024-01-10 11:14 | - | |
| rust-string-cache/ | 2024-01-10 11:14 | - | |
| rust-raw-window-handle/ | 2024-01-10 11:14 | - | |
| rust-png/ | 2024-01-10 11:14 | - | |
| rust-nom-derive-impl/ | 2024-01-10 11:14 | - | |
| rust-markup5ever/ | 2024-01-10 11:14 | - | |
| rust-fd-lock/ | 2024-01-10 11:14 | - | |
| rust-deflate/ | 2024-01-10 11:14 | - | |
| rust-bytemuck/ | 2024-01-10 11:14 | - | |
| rust-alloc-no-stdlib/ | 2024-01-10 11:14 | - | |
| ruby-webauthn/ | 2024-01-10 11:14 | - | |
| ruby-sdbm/ | 2024-01-10 11:14 | - | |
| ruby-prawn-templates/ | 2024-01-10 11:14 | - | |
| ruby-net-scp/ | 2024-01-10 11:14 | - | |
| ruby-license-finder/ | 2024-01-10 11:14 | - | |
| ruby-gnuplot/ | 2024-01-10 11:14 | - | |
| ruby-httparty/ | 2024-01-10 11:14 | - | |
| ruby-async-http/ | 2024-01-10 11:14 | - | |
| rpl/ | 2024-01-10 11:14 | - | |
| ros2-colcon-python-setup-py/ | 2024-01-10 11:14 | - | |
| ros2-colcon-defaults/ | 2024-01-10 11:14 | - | |
| ros-osrf-pycommon/ | 2024-01-10 11:14 | - | |
| rename/ | 2024-01-10 11:14 | - | |
| readlike/ | 2024-01-10 11:14 | - | |
| r-zoo/ | 2024-01-10 11:14 | - | |
| r-cran-sparr/ | 2024-01-10 11:14 | - | |
| r-cran-rncl/ | 2024-01-10 11:14 | - | |
| r-cran-rmutil/ | 2024-01-10 11:14 | - | |
| r-cran-rinside/ | 2024-01-10 11:14 | - | |
| r-cran-pander/ | 2024-01-10 11:14 | - | |
| r-cran-haven/ | 2024-01-10 11:14 | - | |
| r-cran-gitcreds/ | 2024-01-10 11:14 | - | |
| r-cran-glmnet/ | 2024-01-10 11:14 | - | |
| r-cran-fansi/ | 2024-01-10 11:14 | - | |
| r-cran-expint/ | 2024-01-10 11:14 | - | |
| r-cran-desc/ | 2024-01-10 11:14 | - | |
| r-cran-crayon/ | 2024-01-10 11:14 | - | |
| r-cran-conquer/ | 2024-01-10 11:14 | - | |
| r-cran-brms/ | 2024-01-10 11:14 | - | |
| r-cran-bio3d/ | 2024-01-10 11:14 | - | |
| r-cran-bbmisc/ | 2024-01-10 11:14 | - | |
| r-cran-ade4/ | 2024-01-10 11:14 | - | |
| rust-valuable/ | 2024-01-10 17:10 | - | |
| rust-unicode-normalization/ | 2024-01-10 17:10 | - | |
| rust-tree-magic-mini/ | 2024-01-10 17:10 | - | |
| rust-tokio-rustls/ | 2024-01-10 17:10 | - | |
| rust-test-dir/ | 2024-01-10 17:10 | - | |
| rust-serde-test/ | 2024-01-10 17:10 | - | |
| rust-sha2/ | 2024-01-10 17:10 | - | |
| rust-rpassword/ | 2024-01-10 17:10 | - | |
| rust-path-slash/ | 2024-01-10 17:10 | - | |
| rust-link-cplusplus/ | 2024-01-10 17:10 | - | |
| rust-kstring/ | 2024-01-10 17:10 | - | |
| rust-is-executable/ | 2024-01-10 17:10 | - | |
| rust-idna/ | 2024-01-10 17:10 | - | |
| rust-httparse/ | 2024-01-10 17:10 | - | |
| rust-gettext-rs/ | 2024-01-10 17:10 | - | |
| rust-float-eq-derive/ | 2024-01-10 17:10 | - | |
| rust-float-eq/ | 2024-01-10 17:10 | - | |
| rust-encoding-rs/ | 2024-01-10 17:10 | - | |
| rust-digest/ | 2024-01-10 17:10 | - | |
| rust-delegate/ | 2024-01-10 17:10 | - | |
| rust-cpufeatures/ | 2024-01-10 17:10 | - | |
| rust-concolor/ | 2024-01-10 17:10 | - | |
| rust-concolor-query/ | 2024-01-10 17:10 | - | |
| rust-combine/ | 2024-01-10 17:10 | - | |
| rust-cascade/ | 2024-01-10 17:10 | - | |
| rust-block-buffer/ | 2024-01-10 17:10 | - | |
| rust-binascii/ | 2024-01-10 17:10 | - | |
| rust-argmax/ | 2024-01-10 17:10 | - | |
| rust-alloc-stdlib/ | 2024-01-10 17:10 | - | |
| rubygems/ | 2024-01-10 17:10 | - | |
| ruby-versionomy/ | 2024-01-10 17:10 | - | |
| ruby-serverspec/ | 2024-01-10 17:10 | - | |
| ruby-simplecov/ | 2024-01-10 17:10 | - | |
| ruby-parallel-tests/ | 2024-01-10 17:10 | - | |
| ruby-omniauth-openid/ | 2024-01-10 17:10 | - | |
| ruby-omniauth-gitlab/ | 2024-01-10 17:10 | - | |
| ruby-net-http-digest-auth/ | 2024-01-10 17:10 | - | |
| ruby-net-sftp/ | 2024-01-10 17:10 | - | |
| ruby-json-jwt/ | 2024-01-10 17:10 | - | |
| ruby-gruff/ | 2024-01-10 17:10 | - | |
| ruby-fogbugz/ | 2024-01-10 17:10 | - | |
| ruby-eb/ | 2024-01-10 17:10 | - | |
| ruby-contracts/ | 2024-01-10 17:10 | - | |
| rrdcollect/ | 2024-01-10 17:10 | - | |
| ros-catkin-pkg/ | 2024-01-10 17:10 | - | |
| ros-catkin-tools/ | 2024-01-10 17:10 | - | |
| ros-catkin/ | 2024-01-10 17:10 | - | |
| rich/ | 2024-01-10 17:10 | - | |
| reserialize/ | 2024-01-10 17:10 | - | |
| reparser/ | 2024-01-10 17:10 | - | |
| recommonmark/ | 2024-01-10 17:10 | - | |
| raspi-config/ | 2024-01-10 17:10 | - | |
| raku-log/ | 2024-01-10 17:10 | - | |
| r-cran-webshot/ | 2024-01-10 17:10 | - | |
| r-cran-wavethresh/ | 2024-01-10 17:10 | - | |
| r-cran-vcdextra/ | 2024-01-10 17:10 | - | |
| r-cran-timereg/ | 2024-01-10 17:10 | - | |
| r-cran-systemfit/ | 2024-01-10 17:10 | - | |
| r-cran-statnet.common/ | 2024-01-10 17:10 | - | |
| r-cran-spatstat.sparse/ | 2024-01-10 17:10 | - | |
| r-cran-spatstat.core/ | 2024-01-10 17:10 | - | |
| r-cran-shazam/ | 2024-01-10 17:10 | - | |
| r-cran-skimr/ | 2024-01-10 17:10 | - | |
| r-cran-seqinr/ | 2024-01-10 17:10 | - | |
| r-cran-sendmailr/ | 2024-01-10 17:10 | - | |
| r-cran-rnexml/ | 2024-01-10 17:10 | - | |
| r-cran-rgdal/ | 2024-01-10 17:10 | - | |
| r-cran-r.utils/ | 2024-01-10 17:10 | - | |
| r-cran-progressr/ | 2024-01-10 17:10 | - | |
| r-cran-plumber/ | 2024-01-10 17:10 | - | |
| r-cran-plyr/ | 2024-01-10 17:10 | - | |
| r-cran-phangorn/ | 2024-01-10 17:10 | - | |
| r-cran-packrat/ | 2024-01-10 17:10 | - | |
| r-cran-orthopolynom/ | 2024-01-10 17:10 | - | |
| r-cran-network/ | 2024-01-10 17:10 | - | |
| r-cran-mockr/ | 2024-01-10 17:10 | - | |
| r-cran-minpack.lm/ | 2024-01-10 17:10 | - | |
| r-cran-matchit/ | 2024-01-10 17:10 | - | |
| r-cran-matching/ | 2024-01-10 17:10 | - | |
| r-cran-markovchain/ | 2024-01-10 17:10 | - | |
| r-cran-maptools/ | 2024-01-10 17:10 | - | |
| r-cran-leiden/ | 2024-01-10 17:10 | - | |
| r-cran-gunifrac/ | 2024-01-10 17:10 | - | |
| r-cran-clue/ | 2024-01-10 17:10 | - | |
| r-cran-classint/ | 2024-01-10 17:10 | - | |
| r-cran-brglm2/ | 2024-01-10 17:10 | - | |
| r-cran-bbmle/ | 2024-01-10 17:10 | - | |
| r-cran-adegenet/ | 2024-01-10 17:10 | - | |
| r-bioc-nanostringqcpro/ | 2024-01-10 17:10 | - | |
| r-bioc-bitseq/ | 2024-01-10 17:10 | - | |
| rust-lz4/ | 2024-01-10 19:47 | - | |
| rust-xdg/ | 2024-01-10 23:30 | - | |
| rust-wrapcenum-derive/ | 2024-01-10 23:30 | - | |
| rust-unic-common/ | 2024-01-10 23:30 | - | |
| rust-trust-dns-client/ | 2024-01-10 23:30 | - | |
| rust-tinyvec/ | 2024-01-10 23:30 | - | |
| rust-tester/ | 2024-01-10 23:30 | - | |
| rust-symbolic-demangle/ | 2024-01-10 23:30 | - | |
| rust-scale-info-derive/ | 2024-01-10 23:30 | - | |
| rust-rend/ | 2024-01-10 23:30 | - | |
| rust-enum-ordinalize/ | 2024-01-10 23:30 | - | |
| rust-curl-sys/ | 2024-01-10 23:30 | - | |
| rust-cpp-demangle/ | 2024-01-10 23:30 | - | |
| rust-capstone/ | 2024-01-10 23:30 | - | |
| rust-assert-cmd/ | 2024-01-10 23:30 | - | |
| ruby-rabl/ | 2024-01-10 23:30 | - | |
| ruby-notiffany/ | 2024-01-10 23:30 | - | |
| ruby-jekyll-feed/ | 2024-01-10 23:30 | - | |
| ruby-jekyll-sass-converter/ | 2024-01-10 23:30 | - | |
| ruby-certificate-authority/ | 2024-01-10 23:30 | - | |
| rmtfs/ | 2024-01-10 23:30 | - | |
| raku/ | 2024-01-10 23:30 | - | |
| raku-tap-harness/ | 2024-01-10 23:30 | - | |
| raku-librarycheck/ | 2024-01-10 23:30 | - | |
| raku-json-fast/ | 2024-01-10 23:30 | - | |
| raku-getopt-long/ | 2024-01-10 23:30 | - | |
| raku-hash-merge/ | 2024-01-10 23:30 | - | |
| raku-file-find/ | 2024-01-10 23:30 | - | |
| raku-file-which/ | 2024-01-10 23:30 | - | |
| r-cran-wdi/ | 2024-01-10 23:30 | - | |
| r-cran-tsp/ | 2024-01-10 23:30 | - | |
| r-cran-stringr/ | 2024-01-10 23:30 | - | |
| r-cran-statmod/ | 2024-01-10 23:30 | - | |
| r-cran-spatialreg/ | 2024-01-10 23:30 | - | |
| r-cran-robustrankaggreg/ | 2024-01-10 23:30 | - | |
| r-cran-relsurv/ | 2024-01-10 23:30 | - | |
| r-cran-readxl/ | 2024-01-10 23:30 | - | |
| r-cran-rcpphnsw/ | 2024-01-10 23:30 | - | |
| r-cran-qqconf/ | 2024-01-10 23:30 | - | |
| r-cran-pkgdown/ | 2024-01-10 23:30 | - | |
| r-cran-nleqslv/ | 2024-01-10 23:30 | - | |
| r-cran-luminescence/ | 2024-01-10 23:30 | - | |
| r-cran-fontawesome/ | 2024-01-10 23:30 | - | |
| r-cran-devtools/ | 2024-01-10 23:30 | - | |
| rust-atk-sys/ | 2024-01-11 05:23 | - | |
| ruby-virtus/ | 2024-01-11 05:23 | - | |
| ruby-mime-types/ | 2024-01-11 05:23 | - | |
| ruby-fog-aws/ | 2024-01-11 05:23 | - | |
| ruby-arbre/ | 2024-01-11 05:23 | - | |
| remrun/ | 2024-01-11 05:23 | - | |
| r-cran-susier/ | 2024-01-11 05:23 | - | |
| r-cran-modelr/ | 2024-01-11 05:23 | - | |
| r-cran-forcats/ | 2024-01-11 05:23 | - | |
| ruby-tilt/ | 2024-01-11 11:18 | - | |
| r-cran-geoknife/ | 2024-01-11 11:18 | - | |
| r-cran-bh/ | 2024-01-11 15:44 | - | |
| ruby-doorkeeper/ | 2024-01-12 11:11 | - | |
| rust-webpki/ | 2024-01-12 17:09 | - | |
| rust-symbolic-common/ | 2024-01-12 17:09 | - | |
| rust-pdb/ | 2024-01-12 17:09 | - | |
| rust-multihash/ | 2024-01-12 17:09 | - | |
| rust-matchit/ | 2024-01-12 17:09 | - | |
| rust-faster-hex/ | 2024-01-12 17:09 | - | |
| rust-curl/ | 2024-01-12 17:09 | - | |
| rust-bytecount/ | 2024-01-12 17:09 | - | |
| ruby-devise/ | 2024-01-12 17:09 | - | |
| ruby-duo-api/ | 2024-01-12 17:09 | - | |
| ruby-factory-bot/ | 2024-01-12 17:09 | - | |
| robber/ | 2024-01-12 17:09 | - | |
| r-cran-webfakes/ | 2024-01-12 17:09 | - | |
| r-cran-vroom/ | 2024-01-12 17:09 | - | |
| r-cran-vctrs/ | 2024-01-12 17:09 | - | |
| r-cran-units/ | 2024-01-12 17:09 | - | |
| r-cran-tmvtnorm/ | 2024-01-12 17:09 | - | |
| r-cran-tiff/ | 2024-01-12 17:09 | - | |
| r-cran-tikzdevice/ | 2024-01-12 17:09 | - | |
| r-cran-sodium/ | 2024-01-12 17:09 | - | |
| r-cran-sctransform/ | 2024-01-12 17:09 | - | |
| r-cran-riskregression/ | 2024-01-12 17:09 | - | |
| r-cran-projpred/ | 2024-01-12 17:09 | - | |
| r-cran-proc/ | 2024-01-12 17:09 | - | |
| r-cran-optimx/ | 2024-01-12 17:09 | - | |
| r-cran-poorman/ | 2024-01-12 17:09 | - | |
| r-cran-leidenbase/ | 2024-01-12 17:09 | - | |
| r-cran-grimport2/ | 2024-01-12 17:09 | - | |
| r-cran-dqrng/ | 2024-01-12 17:09 | - | |
| r-cran-desolve/ | 2024-01-12 17:09 | - | |
| r-cran-cairo/ | 2024-01-12 17:09 | - | |
| r-cran-actuar/ | 2024-01-12 17:09 | - | |
| rust-web-sys/ | 2024-01-12 23:20 | - | |
| rust-tokio-postgres/ | 2024-01-12 23:20 | - | |
| rust-tera/ | 2024-01-12 23:20 | - | |
| rust-postgres-types/ | 2024-01-12 23:20 | - | |
| rust-futures-ringbuf/ | 2024-01-12 23:20 | - | |
| rust-color-thief/ | 2024-01-12 23:20 | - | |
| ruby-neovim/ | 2024-01-12 23:20 | - | |
| r-cran-maps/ | 2024-01-12 23:20 | - | |
| r-cran-covr/ | 2024-01-12 23:20 | - | |
| rust-ssh2/ | 2024-01-13 05:12 | - | |
| rust-rlp/ | 2024-01-13 05:12 | - | |
| rust-async-oneshot/ | 2024-01-13 05:12 | - | |
| rust-aes-gcm/ | 2024-01-13 05:12 | - | |
| ruby-mdl/ | 2024-01-13 05:12 | - | |
| r-cran-dotcall64/ | 2024-01-13 05:12 | - | |
| rust-wmidi/ | 2024-01-13 11:07 | - | |
| rust-rusqlite/ | 2024-01-13 11:07 | - | |
| rust-lv2-atom/ | 2024-01-13 11:07 | - | |
| rust-lmdb-sys/ | 2024-01-13 11:07 | - | |
| rust-exa/ | 2024-01-13 11:07 | - | |
| rust-cpal/ | 2024-01-13 11:07 | - | |
| rust-bytemuck-derive/ | 2024-01-13 11:07 | - | |
| ruby-validates-hostname/ | 2024-01-13 11:07 | - | |
| r-cran-htmlwidgets/ | 2024-01-13 11:07 | - | |
| rust-tracing-attributes/ | 2024-01-13 16:05 | - | |
| rust-tracing-core/ | 2024-01-13 16:05 | - | |
| rglpk/ | 2024-01-13 16:05 | - | |
| r-cran-readr/ | 2024-01-13 16:05 | - | |
| ruby-tanuki-emoji/ | 2024-01-13 17:04 | - | |
| r-cran-patrick/ | 2024-01-13 17:04 | - | |
| r-cran-broom.helpers/ | 2024-01-13 17:04 | - | |
| rust-async-compat/ | 2024-01-13 18:34 | - | |
| rust-tracing/ | 2024-01-14 06:44 | - | |
| rust-quinn-proto/ | 2024-01-14 10:47 | - | |
| ripe-atlas-cousteau/ | 2024-01-14 15:35 | - | |
| rust-rpds/ | 2024-01-14 18:59 | - | |
| rust-errno/ | 2024-01-14 21:50 | - | |
| rungetty/ | 2024-01-15 10:21 | - | |
| ruby-connection-pool/ | 2024-01-16 03:30 | - | |
| rust-fs-err/ | 2024-01-16 09:55 | - | |
| rust-trycmd/ | 2024-01-16 16:49 | - | |
| r-cran-bigmemory.sri/ | 2024-01-17 09:30 | - | |
| regripper/ | 2024-01-17 15:55 | - | |
| rpi-ws281x-python/ | 2024-01-19 13:47 | - | |
| rtimulib/ | 2024-01-19 16:36 | - | |
| ruby-po-to-json/ | 2024-01-20 09:30 | - | |
| ruby-gettext-i18n-rails-js/ | 2024-01-20 12:00 | - | |
| relic/ | 2024-01-20 23:03 | - | |
| rust-statsd/ | 2024-01-22 04:45 | - | |
| rust-include-dir/ | 2024-01-22 04:45 | - | |
| renderdoc/ | 2024-01-22 05:02 | - | |
| rust-symphonia-metadata/ | 2024-01-22 08:44 | - | |
| rust-symphonia-codec-alac/ | 2024-01-22 09:43 | - | |
| rust-symphonia-codec-adpcm/ | 2024-01-22 09:43 | - | |
| rust-symphonia-codec-aac/ | 2024-01-22 09:43 | - | |
| rust-symphonia-bundle-mp3/ | 2024-01-22 10:42 | - | |
| rust-symphonia-format-wav/ | 2024-01-22 10:42 | - | |
| rust-symphonia-utils-xiph/ | 2024-01-22 10:42 | - | |
| regina-normal/ | 2024-01-22 11:05 | - | |
| rust-symphonia-bundle-flac/ | 2024-01-22 17:16 | - | |
| rust-symphonia-codec-vorbis/ | 2024-01-22 17:16 | - | |
| rust-symphonia-format-isomp4/ | 2024-01-22 17:16 | - | |
| rust-symphonia-format-mkv/ | 2024-01-22 18:05 | - | |
| rust-symphonia-format-ogg/ | 2024-01-22 18:05 | - | |
| rust-pkg-version/ | 2024-01-23 21:45 | - | |
| rust-hex/ | 2024-01-23 21:45 | - | |
| rust-hostname/ | 2024-01-23 21:45 | - | |
| r-cran-gmp/ | 2024-01-24 04:56 | - | |
| rust-self-cell/ | 2024-01-24 10:53 | - | |
| rust-pyo3-file/ | 2024-01-24 23:01 | - | |
| r-cran-dbitest/ | 2024-01-25 09:32 | - | |
| rust-isolang/ | 2024-01-25 10:55 | - | |
| rust-shlex/ | 2024-01-25 23:02 | - | |
| rust-kvm-bindings/ | 2024-01-26 04:56 | - | |
| revolt/ | 2024-01-26 16:57 | - | |
| r-cran-maldiquantforeign/ | 2024-01-28 04:51 | - | |
| r-cran-ggridges/ | 2024-01-28 04:51 | - | |
| r-cran-cowplot/ | 2024-01-28 04:51 | - | |
| rust-crossbeam-utils/ | 2024-01-28 09:44 | - | |
| rust-crossbeam-epoch/ | 2024-01-28 12:19 | - | |
| rust-crossbeam-queue/ | 2024-01-28 12:19 | - | |
| rust-crossbeam/ | 2024-01-28 16:40 | - | |
| rjava/ | 2024-01-28 23:08 | - | |
| r-cran-zip/ | 2024-01-29 10:30 | - | |
| rust-tikv-jemalloc-ctl/ | 2024-01-29 10:55 | - | |
| rust-ecdsa/ | 2024-01-29 10:55 | - | |
| r-cran-laeken/ | 2024-01-29 21:30 | - | |
| r-cran-powerlaw/ | 2024-01-29 21:30 | - | |
| rust-crossbeam-deque/ | 2024-01-30 05:00 | - | |
| rust-crossbeam-channel/ | 2024-01-30 05:00 | - | |
| rust-git-testament-derive/ | 2024-01-30 21:40 | - | |
| r-cran-mcmcpack/ | 2024-01-31 04:57 | - | |
| r-cran-kableextra/ | 2024-01-31 04:57 | - | |
| r-cran-interp/ | 2024-01-31 04:57 | - | |
| rust-git-testament/ | 2024-01-31 07:46 | - | |
| r-cran-r.devices/ | 2024-01-31 15:55 | - | |
| r-cran-r.oo/ | 2024-01-31 21:55 | - | |
| rust-colored/ | 2024-02-01 12:00 | - | |
| r-cran-g.data/ | 2024-02-01 17:51 | - | |
| r-cran-coda/ | 2024-02-01 17:51 | - | |
| r-cran-listenv/ | 2024-02-01 17:51 | - | |
| rust-timerfd/ | 2024-02-01 17:51 | - | |
| r-cran-pscl/ | 2024-02-01 17:51 | - | |
| r-cran-viridis/ | 2024-02-01 21:31 | - | |
| r-cran-tidyr/ | 2024-02-01 22:21 | - | |
| ragout/ | 2024-02-02 10:25 | - | |
| rust-terminal-size/ | 2024-02-02 10:57 | - | |
| rust-bytesize/ | 2024-02-02 10:57 | - | |
| ruby-rb-sys/ | 2024-02-02 15:39 | - | |
| r-cran-rcppannoy/ | 2024-02-02 16:51 | - | |
| r-cran-psych/ | 2024-02-02 16:51 | - | |
| ruby3.2/ | 2024-02-02 20:41 | - | |
| rust-async-std-resolver/ | 2024-02-02 23:02 | - | |
| rust-rayon-core/ | 2024-02-03 10:47 | - | |
| r-cran-rmpfr/ | 2024-02-03 10:47 | - | |
| r-cran-plotly/ | 2024-02-03 10:47 | - | |
| ruby-rqrcode-core/ | 2024-02-03 15:40 | - | |
| r-cran-timechange/ | 2024-02-03 16:53 | - | |
| ruby-rqrcode/ | 2024-02-03 17:09 | - | |
| ruby-acts-as-taggable-on/ | 2024-02-03 21:25 | - | |
| ruby-google-apis-androidpublisher-v3/ | 2024-02-04 09:45 | - | |
| ruby-graphql-client/ | 2024-02-04 09:45 | - | |
| ruby-faraday-multipart/ | 2024-02-04 09:45 | - | |
| rust-substring/ | 2024-02-04 09:45 | - | |
| rust-smartstring/ | 2024-02-04 09:45 | - | |
| rust-ryu-floating-decimal/ | 2024-02-04 09:45 | - | |
| rust-elf-rs/ | 2024-02-04 09:45 | - | |
| rust-core-error/ | 2024-02-04 09:45 | - | |
| ruby-asana/ | 2024-02-04 10:24 | - | |
| ruby-faraday-net-http-persistent/ | 2024-02-06 11:20 | - | |
| ruby-dataobjects/ | 2024-02-06 13:05 | - | |
| r-cran-densityclust/ | 2024-02-07 02:49 | - | |
| reprounzip/ | 2024-02-08 16:40 | - | |
| ruby-grib/ | 2024-02-09 04:48 | - | |
| ruby-dataobjects-postgres/ | 2024-02-09 04:48 | - | |
| ruby-dataobjects-mysql/ | 2024-02-09 04:48 | - | |
| ruby-seed-fu/ | 2024-02-15 05:36 | - | |
| ruby-redis-actionpack/ | 2024-02-15 05:36 | - | |
| ruby-delayed-job/ | 2024-02-15 05:36 | - | |
| ruby-globalid/ | 2024-02-15 05:36 | - | |
| ruby-graphlient/ | 2024-02-15 05:36 | - | |
| ruby-azure-storage-common/ | 2024-02-15 05:36 | - | |
| r-cran-plot3d/ | 2024-02-15 05:36 | - | |
| r-cran-mertools/ | 2024-02-15 05:36 | - | |
| r-cran-kedd/ | 2024-02-15 05:36 | - | |
| r-cran-distributional/ | 2024-02-15 05:36 | - | |
| r-cran-ggvis/ | 2024-02-15 05:36 | - | |
| r-cran-ggseqlogo/ | 2024-02-15 05:36 | - | |
| ruby-faraday-retry/ | 2024-02-15 06:47 | - | |
| r-cran-latte/ | 2024-02-15 06:47 | - | |
| ruby-sidekiq-cron/ | 2024-02-15 10:29 | - | |
| ruby-delayed-job-active-record/ | 2024-02-15 10:29 | - | |
| r-cran-bayesfactor/ | 2024-02-15 10:56 | - | |
| r-cran-phylobase/ | 2024-02-15 13:03 | - | |
| rust-v-frame/ | 2024-02-15 13:03 | - | |
| r-cran-ctmcd/ | 2024-02-15 13:03 | - | |
| r-cran-fracdiff/ | 2024-02-15 13:03 | - | |
| rust-av1-grain/ | 2024-02-15 13:56 | - | |
| rust-average/ | 2024-02-15 13:56 | - | |
| rust-zeroize-derive/ | 2024-02-15 13:56 | - | |
| rust-unicode-linebreak/ | 2024-02-15 14:43 | - | |
| rust-smart-default/ | 2024-02-15 14:43 | - | |
| rust-serde-big-array/ | 2024-02-15 14:43 | - | |
| rust-impls/ | 2024-02-15 14:43 | - | |
| rust-mime/ | 2024-02-15 14:43 | - | |
| rust-hex-slice/ | 2024-02-15 14:43 | - | |
| rust-criterion-plot/ | 2024-02-15 14:43 | - | |
| ruby-google-apis-core/ | 2024-02-15 15:28 | - | |
| rust-tokio-native-tls/ | 2024-02-15 15:28 | - | |
| rust-rustyline-derive/ | 2024-02-15 16:13 | - | |
| rust-pulsectl-rs/ | 2024-02-15 16:13 | - | |
| rust-proptest-derive/ | 2024-02-15 16:13 | - | |
| rust-rawpointer/ | 2024-02-15 16:13 | - | |
| rust-profiling-procmacros/ | 2024-02-15 16:13 | - | |
| rust-voca-rs/ | 2024-02-15 16:59 | - | |
| rust-symphonia-codec-pcm/ | 2024-02-15 16:59 | - | |
| rust-unarray/ | 2024-02-15 16:59 | - | |
| rust-cstr/ | 2024-02-15 16:59 | - | |
| rust-evdev-sys/ | 2024-02-15 16:59 | - | |
| rust-alloc-traits/ | 2024-02-15 16:59 | - | |
| rust-sys-mount/ | 2024-02-15 17:53 | - | |
| rust-ivf/ | 2024-02-15 17:53 | - | |
| rust-blanket/ | 2024-02-15 17:53 | - | |
| ruby-mail-room/ | 2024-02-15 21:49 | - | |
| rust-openpgp-keylist/ | 2024-02-16 04:55 | - | |
| rust-symphonia/ | 2024-02-16 04:55 | - | |
| rust-audio-checker/ | 2024-02-16 08:58 | - | |
| ruby-net-http-persistent/ | 2024-02-16 10:58 | - | |
| ring-clojure/ | 2024-02-16 15:57 | - | |
| rust-configparser/ | 2024-02-17 10:41 | - | |
| rust-clap-num/ | 2024-02-17 10:41 | - | |
| ruby-loofah/ | 2024-02-17 10:41 | - | |
| r-cran-nanoarrow/ | 2024-02-17 10:41 | - | |
| r-cran-multicool/ | 2024-02-17 10:41 | - | |
| r-cran-isocodes/ | 2024-02-17 10:41 | - | |
| r-cran-haplo.stats/ | 2024-02-17 10:41 | - | |
| r-cran-ggthemes/ | 2024-02-17 10:41 | - | |
| ruby-rails-assets-markdown-it-sanitizer/ | 2024-02-17 11:15 | - | |
| ruby-powerbar/ | 2024-02-17 11:15 | - | |
| reformat/ | 2024-02-17 12:41 | - | |
| rust-rkyv-derive/ | 2024-02-17 16:46 | - | |
| rust-publicsuffix/ | 2024-02-17 16:46 | - | |
| rust-lcms2/ | 2024-02-17 16:46 | - | |
| rust-const-random/ | 2024-02-17 16:46 | - | |
| ruby-sys-filesystem/ | 2024-02-17 22:14 | - | |
| ruby-fog-libvirt/ | 2024-02-17 22:14 | - | |
| rinse/ | 2024-02-17 22:14 | - | |
| r-cran-ncdfgeom/ | 2024-02-17 22:14 | - | |
| rust-zmq/ | 2024-02-17 22:15 | - | |
| rust-time-core/ | 2024-02-18 04:02 | - | |
| rust-time-macros/ | 2024-02-18 06:47 | - | |
| rocm-cmake/ | 2024-02-18 10:40 | - | |
| rust-wu-diff/ | 2024-02-18 12:12 | - | |
| rust-line-numbers/ | 2024-02-18 12:12 | - | |
| rust-rkyv/ | 2024-02-19 04:42 | - | |
| ringdove/ | 2024-02-19 04:42 | - | |
| r-cran-areal/ | 2024-02-19 04:42 | - | |
| r-cran-intergraph/ | 2024-02-19 04:42 | - | |
| r-cran-ggally/ | 2024-02-19 10:46 | - | |
| ruby-grape-path-helpers/ | 2024-02-19 13:27 | - | |
| rust-strobe-rs/ | 2024-02-19 16:44 | - | |
| rust-deranged/ | 2024-02-19 16:44 | - | |
| r-cran-rstantools/ | 2024-02-19 22:49 | - | |
| r-cran-r.rsp/ | 2024-02-20 03:57 | - | |
| r-cran-quantmod/ | 2024-02-20 04:46 | - | |
| ruby-gitlab-experiment/ | 2024-02-20 16:49 | - | |
| ruby-rails-assets-underscore/ | 2024-02-20 19:12 | - | |
| ruby-rails-assets-markdown-it-diaspora-mention/ | 2024-02-20 19:12 | - | |
| ruby-rspec-puppet/ | 2024-02-21 21:28 | - | |
| ruby-puppetlabs-spec-helper/ | 2024-02-22 00:29 | - | |
| ruby-shindo/ | 2024-02-22 04:03 | - | |
| ruby-wavefile/ | 2024-02-22 04:03 | - | |
| ruby-riddle/ | 2024-02-22 23:58 | - | |
| ruby-grape/ | 2024-02-23 04:51 | - | |
| ruby-google-cloud-core/ | 2024-02-23 04:51 | - | |
| roodi/ | 2024-02-23 09:08 | - | |
| ruby-cmdparse/ | 2024-02-23 09:08 | - | |
| ruby-insist/ | 2024-02-23 09:08 | - | |
| ruby-instantiator/ | 2024-02-23 09:08 | - | |
| ruby-launchy/ | 2024-02-23 09:08 | - | |
| ruby-parslet/ | 2024-02-23 09:08 | - | |
| ruby-puppet-forge/ | 2024-02-23 09:08 | - | |
| ruby-rbvmomi/ | 2024-02-23 09:08 | - | |
| ruby-rsec/ | 2024-02-23 09:08 | - | |
| rust-four-cc/ | 2024-02-23 17:17 | - | |
| ruby-puppet-resource-api/ | 2024-02-23 21:53 | - | |
| ruby-spider/ | 2024-02-24 22:54 | - | |
| rocm-device-libs/ | 2024-02-25 10:41 | - | |
| rkhunter/ | 2024-02-26 05:52 | - | |
| rust-tokio-io-utility/ | 2024-02-26 08:41 | - | |
| rust-sendfd/ | 2024-02-26 08:41 | - | |
| rust-ssh-format-error/ | 2024-02-26 08:41 | - | |
| rust-tokio-pipe/ | 2024-02-26 08:41 | - | |
| rust-non-zero-byte-slice/ | 2024-02-26 08:41 | - | |
| ruby-reverse-markdown/ | 2024-02-27 16:47 | - | |
| r-cran-rnaturalearthdata/ | 2024-02-27 21:28 | - | |
| rust-futures-rustls/ | 2024-02-27 22:46 | - | |
| ragel/ | 2024-02-28 06:13 | - | |
| ruby-roo/ | 2024-02-28 13:12 | - | |
| ruby-twitter-text/ | 2024-02-28 22:37 | - | |
| r-cran-runit/ | 2024-02-28 22:37 | - | |
| ruby-graphql/ | 2024-02-28 22:51 | - | |
| ruby-guard/ | 2024-02-29 04:45 | - | |
| ruby-graphviz/ | 2024-02-29 05:53 | - | |
| ruby-rspec/ | 2024-03-01 04:48 | - | |
| roundcube-skin-classic/ | 2024-03-02 10:13 | - | |
| racket-mode/ | 2024-03-03 04:43 | - | |
| ruby-diff-lcs/ | 2024-03-03 09:42 | - | |
| ruby-http-accept/ | 2024-03-03 09:42 | - | |
| ruby-bio/ | 2024-03-03 15:57 | - | |
| ruby-domain-name/ | 2024-03-03 15:57 | - | |
| roundcube-skin-larry/ | 2024-03-03 16:45 | - | |
| remotezip/ | 2024-03-04 10:47 | - | |
| rerun/ | 2024-03-04 21:38 | - | |
| ruby-test-unit/ | 2024-03-05 16:44 | - | |
| ruby-highline/ | 2024-03-05 16:44 | - | |
| ruby-listen/ | 2024-03-06 04:47 | - | |
| r-cran-bayesplot/ | 2024-03-06 10:44 | - | |
| retext/ | 2024-03-18 06:41 | - | |
| resource-agents-paf/ | 2024-03-20 05:46 | - | |
| rust-foreign-types-shared/ | 2024-03-24 17:41 | - | |
| r-cran-alakazam/ | 2024-03-26 05:42 | - | |
| rustc-1.62/ | 2024-03-26 11:44 | - | |
| rust-quinn/ | 2024-03-26 17:52 | - | |
| rust-polling/ | 2024-03-26 17:52 | - | |
| ruby-thor/ | 2024-03-29 00:38 | - | |
| ruby-serialport/ | 2024-03-29 06:27 | - | |
| ruby-prometheus-client-mmap/ | 2024-03-30 00:16 | - | |
| ruby-nfc/ | 2024-03-30 00:16 | - | |
| ruby-mmap2/ | 2024-03-30 00:16 | - | |
| redsocks/ | 2024-04-02 20:51 | - | |
| ruli/ | 2024-04-03 12:19 | - | |
| rtmpdump/ | 2024-04-03 12:19 | - | |
| repowerd/ | 2024-04-03 18:12 | - | |
| rasterview/ | 2024-04-03 18:12 | - | |
| rust-transformation-pipeline/ | 2024-04-04 12:15 | - | |
| rust-test-log-macros/ | 2024-04-04 12:15 | - | |
| rust-static-alloc/ | 2024-04-04 12:15 | - | |
| rust-mac-address/ | 2024-04-04 12:15 | - | |
| rust-libwebp-sys/ | 2024-04-04 12:15 | - | |
| rust-libslirp-sys/ | 2024-04-04 12:15 | - | |
| rust-libmount/ | 2024-04-04 12:15 | - | |
| rust-home-dir/ | 2024-04-04 12:15 | - | |
| rust-dircpy/ | 2024-04-04 12:15 | - | |
| rust-endi/ | 2024-04-04 12:15 | - | |
| rust-card-backend/ | 2024-04-04 12:15 | - | |
| rstatd/ | 2024-04-04 12:15 | - | |
| rlwrap/ | 2024-04-04 12:15 | - | |
| remake/ | 2024-04-04 12:15 | - | |
| rdiff-backup-fs/ | 2024-04-04 12:15 | - | |
| rdfind/ | 2024-04-04 12:15 | - | |
| rc/ | 2024-04-04 12:15 | - | |
| rttr/ | 2024-04-04 18:26 | - | |
| rlog/ | 2024-04-04 18:26 | - | |
| rawtran/ | 2024-04-04 18:26 | - | |
| rsyncrypto/ | 2024-04-05 00:45 | - | |
| rnetclient/ | 2024-04-05 00:45 | - | |
| radcli/ | 2024-04-05 00:45 | - | |
| rpma/ | 2024-04-05 06:13 | - | |
| recordmydesktop/ | 2024-04-05 06:13 | - | |
| rdesktop/ | 2024-04-05 06:13 | - | |
| r-cran-rgeos/ | 2024-04-05 12:05 | - | |
| r-cran-earth/ | 2024-04-05 12:05 | - | |
| rust-x11rb/ | 2024-04-06 06:47 | - | |
| rust-ssh-format/ | 2024-04-06 06:47 | - | |
| rust-openssh-mux-client-error/ | 2024-04-06 06:47 | - | |
| rust-libsystemd/ | 2024-04-06 06:47 | - | |
| rust-hafas-rs/ | 2024-04-06 06:47 | - | |
| rust-fs-at/ | 2024-04-06 06:47 | - | |
| runcircos-gui/ | 2024-04-06 06:47 | - | |
| ruby-gd/ | 2024-04-06 06:47 | - | |
| rtklib/ | 2024-04-06 06:47 | - | |
| rssguard/ | 2024-04-06 06:47 | - | |
| rsplib/ | 2024-04-06 06:47 | - | |
| rsibreak/ | 2024-04-06 06:47 | - | |
| rofi/ | 2024-04-06 06:47 | - | |
| rocm-compilersupport/ | 2024-04-06 06:47 | - | |
| robocut/ | 2024-04-06 06:47 | - | |
| rlvm/ | 2024-04-06 06:47 | - | |
| rlpr/ | 2024-04-06 06:47 | - | |
| ricochet-im/ | 2024-04-06 06:47 | - | |
| ri-li/ | 2024-04-06 06:47 | - | |
| rhonabwy/ | 2024-04-06 06:47 | - | |
| rgbpaint/ | 2024-04-06 06:47 | - | |
| rfdump/ | 2024-04-06 06:47 | - | |
| renameutils/ | 2024-04-06 06:47 | - | |
| remote-logon-service/ | 2024-04-06 06:47 | - | |
| reaver/ | 2024-04-06 06:47 | - | |
| rbootd/ | 2024-04-06 06:47 | - | |
| rblcheck/ | 2024-04-06 06:47 | - | |
| rasmol/ | 2024-04-06 06:47 | - | |
| radium-compressor/ | 2024-04-06 06:47 | - | |
| r-cran-vdiffr/ | 2024-04-06 06:47 | - | |
| r-cran-svglite/ | 2024-04-06 06:47 | - | |
| r-cran-rsvg/ | 2024-04-06 06:47 | - | |
| r-cran-rsclient/ | 2024-04-06 06:47 | - | |
| r-cran-rprotobuf/ | 2024-04-06 06:47 | - | |
| r-cran-rnetcdf/ | 2024-04-06 06:47 | - | |
| r-cran-png/ | 2024-04-06 06:47 | - | |
| r-cran-pki/ | 2024-04-06 06:47 | - | |
| r-cran-lwgeom/ | 2024-04-06 06:47 | - | |
| r-cran-exactextractr/ | 2024-04-06 06:47 | - | |
| r-cran-deldir/ | 2024-04-06 06:47 | - | |
| rpi-imager/ | 2024-04-06 11:46 | - | |
| reprepro/ | 2024-04-06 11:46 | - | |
| rdup/ | 2024-04-06 11:46 | - | |
| ring/ | 2024-04-06 17:45 | - | |
| regexxer/ | 2024-04-07 05:50 | - | |
| repeatmasker-recon/ | 2024-04-08 03:16 | - | |
| radlib/ | 2024-04-08 03:59 | - | |
| regina-rexx/ | 2024-04-08 06:15 | - | |
| raspberrypi-userland/ | 2024-04-08 11:39 | - | |
| rustc-1.74/ | 2024-04-08 11:54 | - | |
| readseq/ | 2024-04-10 11:51 | - | |
| rxp/ | 2024-04-10 17:50 | - | |
| ruby-sigar/ | 2024-04-10 17:50 | - | |
| rolldice/ | 2024-04-10 17:50 | - | |
| render-bench/ | 2024-04-10 17:50 | - | |
| ripoff/ | 2024-04-12 11:46 | - | |
| redshift/ | 2024-04-12 23:50 | - | |
| r-cran-rstanarm/ | 2024-04-13 11:42 | - | |
| rust-capnp/ | 2024-04-14 11:42 | - | |
| rust-capnp-rpc/ | 2024-04-14 11:42 | - | |
| rust-capnp-futures/ | 2024-04-14 11:42 | - | |
| ramond/ | 2024-04-14 17:45 | - | |
| rakarrack/ | 2024-04-15 05:45 | - | |
| rsem/ | 2024-04-15 17:47 | - | |
| ruby-maxitest/ | 2024-04-15 22:34 | - | |
| rust-gtk/ | 2024-04-17 11:53 | - | |
| rustc-1.73/ | 2024-04-17 11:53 | - | |
| rust-gtk-layer-shell-sys/ | 2024-04-18 10:02 | - | |
| rust-gdk-sys/ | 2024-04-18 11:52 | - | |
| rev-plugins/ | 2024-04-18 15:27 | - | |
| rust-pwhash/ | 2024-04-21 07:57 | - | |
| routino/ | 2024-04-22 04:49 | - | |
| readosm/ | 2024-04-22 04:49 | - | |
| ratpoints/ | 2024-04-22 04:49 | - | |
| rtfilter/ | 2024-04-22 04:49 | - | |
| r-cran-class/ | 2024-04-22 05:45 | - | |
| r-cran-spatial/ | 2024-04-22 05:45 | - | |
| r-cran-nnet/ | 2024-04-22 05:45 | - | |
| ros2-ament-package/ | 2024-04-22 11:53 | - | |
| ros2-ament-lint/ | 2024-04-22 11:53 | - | |
| ros2-ament-cmake/ | 2024-04-22 11:53 | - | |
| ros-vision-opencv/ | 2024-04-22 11:53 | - | |
| ros-vcstools/ | 2024-04-22 11:53 | - | |
| ros-rviz/ | 2024-04-22 11:53 | - | |
| ros-rosdistro/ | 2024-04-22 11:53 | - | |
| ros-rospack/ | 2024-04-22 11:53 | - | |
| ros-rosdep/ | 2024-04-22 11:53 | - | |
| ros-roscpp-core/ | 2024-04-22 11:53 | - | |
| ros-rosconsole/ | 2024-04-22 11:53 | - | |
| ros-ros-comm/ | 2024-04-22 11:53 | - | |
| ros-robot-state-publisher/ | 2024-04-22 11:53 | - | |
| ros-resource-retriever/ | 2024-04-22 11:53 | - | |
| ros-pluginlib/ | 2024-04-22 11:53 | - | |
| ros-perception-pcl/ | 2024-04-22 11:53 | - | |
| ros-opencv-apps/ | 2024-04-22 11:53 | - | |
| ros-nodelet-core/ | 2024-04-22 11:53 | - | |
| ros-metapackages/ | 2024-04-22 11:53 | - | |
| ros-kdl-parser/ | 2024-04-22 11:53 | - | |
| ros-joint-state-publisher/ | 2024-04-22 11:53 | - | |
| ros-interactive-markers/ | 2024-04-22 11:53 | - | |
| ros-image-pipeline/ | 2024-04-22 11:53 | - | |
| ros-image-common/ | 2024-04-22 11:53 | - | |
| ros-geometry2/ | 2024-04-22 11:53 | - | |
| ros-geometry/ | 2024-04-22 11:53 | - | |
| ros-diagnostics/ | 2024-04-22 11:53 | - | |
| ros-collada-urdf/ | 2024-04-22 11:53 | - | |
| ros-class-loader/ | 2024-04-22 11:53 | - | |
| ros-bond-core/ | 2024-04-22 11:53 | - | |
| ros-actionlib/ | 2024-04-22 11:53 | - | |
| rccl/ | 2024-04-22 11:53 | - | |
| rxtx/ | 2024-04-22 15:19 | - | |
| rust-test-log/ | 2024-04-23 08:59 | - | |
| ros-image-transport-plugins/ | 2024-04-23 09:00 | - | |
| rpart/ | 2024-04-23 11:54 | - | |
| ros-urdf/ | 2024-04-24 17:45 | - | |
| recutils/ | 2024-04-24 17:45 | - | |
| ruby-sanitize/ | 2024-04-25 05:49 | - | |
| r-cran-rcppparallel/ | 2024-04-25 11:44 | - | |
| ruby-specinfra/ | 2024-05-02 21:28 | - | |
| ruby-webpacker/ | 2024-05-02 21:28 | - | |
| ruby-valid-email/ | 2024-05-02 21:28 | - | |
| ruby-solve/ | 2024-05-02 21:28 | - | |
| ruby-premailer-rails/ | 2024-05-02 21:28 | - | |
| ruby-jekyll-polyglot/ | 2024-05-02 21:28 | - | |
| ruby-omniauth-alicloud/ | 2024-05-02 21:28 | - | |
| ruby-ffi-libarchive/ | 2024-05-02 21:28 | - | |
| ruby-e2mmap/ | 2024-05-02 21:28 | - | |
| ruby-ascii85/ | 2024-05-02 21:28 | - | |
| ruby-dbf/ | 2024-05-02 21:28 | - | |
| ruamel.yaml/ | 2024-05-02 21:28 | - | |
| ros2-colcon-package-information/ | 2024-05-02 21:28 | - | |
| ros2-colcon-devtools/ | 2024-05-02 21:28 | - | |
| ros-rospkg/ | 2024-05-02 21:28 | - | |
| ros2-colcon-notification/ | 2024-05-02 21:28 | - | |
| ros2-colcon-cd/ | 2024-05-02 21:28 | - | |
| robot-detection/ | 2024-05-02 21:28 | - | |
| robin-map/ | 2024-05-02 21:28 | - | |
| rnc2rng/ | 2024-05-02 21:28 | - | |
| rapmap/ | 2024-05-02 21:28 | - | |
| ree/ | 2024-05-02 21:28 | - | |
| readability/ | 2024-05-02 21:28 | - | |
| r-cran-semtools/ | 2024-05-02 21:28 | - | |
| r-cran-semplot/ | 2024-05-02 21:28 | - | |
| r-cran-circlize/ | 2024-05-02 21:28 | - | |
| r-cran-future.apply/ | 2024-05-02 21:28 | - | |
| r-cran-formatr/ | 2024-05-02 21:28 | - | |
| r-cran-d3network/ | 2024-05-02 21:28 | - | |
| r-cran-corpcor/ | 2024-05-02 21:28 | - | |
| r-cran-rockchalk/ | 2024-05-02 21:28 | - | |
| r-cran-plm/ | 2024-05-02 21:28 | - | |
| r-cran-nfactors/ | 2024-05-02 21:28 | - | |
| r-cran-mi/ | 2024-05-02 21:28 | - | |
| r-cran-matrixcalc/ | 2024-05-02 21:28 | - | |
| r-cran-markdown/ | 2024-05-02 21:28 | - | |
| r-cran-lintr/ | 2024-05-02 21:28 | - | |
| r-cran-lisreltor/ | 2024-05-02 21:28 | - | |
| r-cran-globals/ | 2024-05-02 21:28 | - | |
| r-cran-ggm/ | 2024-05-02 21:29 | - | |
| runc-app/ | 2024-05-03 09:35 | - | |
| ruby-test-unit-ruby-core/ | 2024-05-03 09:35 | - | |
| r-cran-fadist/ | 2024-05-03 09:35 | - | |
| ruby-sshkit/ | 2024-05-06 10:55 | - | |
| ruby-mongo/ | 2024-05-06 16:28 | - | |
| ruby-magic/ | 2024-05-07 04:24 | - | |
| r-cran-xopen/ | 2024-05-07 22:58 | - | |
| rfc3986-validator/ | 2024-05-07 23:51 | - | |
| rfc3339-validator/ | 2024-05-07 23:51 | - | |
| ruby-minitest/ | 2024-05-08 16:39 | - | |
| ruby-i18n/ | 2024-05-08 22:54 | - | |
| rust-gix-chunk/ | 2024-05-09 01:24 | - | |
| rust-fundu/ | 2024-05-09 01:24 | - | |
| rust-file-size/ | 2024-05-09 01:24 | - | |
| rust-defmac/ | 2024-05-09 01:24 | - | |
| rust-fluent-pseudo/ | 2024-05-09 01:24 | - | |
| rust-fax-derive/ | 2024-05-09 01:24 | - | |
| rust-file-id/ | 2024-05-09 01:24 | - | |
| rust-enum-as-inner/ | 2024-05-09 01:24 | - | |
| rust-email-address/ | 2024-05-09 01:24 | - | |
| rust-ego-tree/ | 2024-05-09 01:24 | - | |
| rust-distro-info/ | 2024-05-09 01:24 | - | |
| rust-diff/ | 2024-05-09 01:24 | - | |
| rust-destructure-traitobject/ | 2024-05-09 01:24 | - | |
| rust-cached-proc-macro/ | 2024-05-09 01:24 | - | |
| rust-core-affinity/ | 2024-05-09 01:24 | - | |
| rust-bcrypt-pbkdf/ | 2024-05-09 01:24 | - | |
| rust-chrono/ | 2024-05-09 01:24 | - | |
| rust-capnpc/ | 2024-05-09 01:24 | - | |
| rust-ansi-width/ | 2024-05-09 01:24 | - | |
| rifiuti2/ | 2024-05-09 01:24 | - | |
| rust-addr/ | 2024-05-09 01:24 | - | |
| rust-askama/ | 2024-05-09 01:24 | - | |
| rust-bit-field/ | 2024-05-09 01:24 | - | |
| rolo/ | 2024-05-09 01:24 | - | |
| raft/ | 2024-05-09 01:24 | - | |
| riemann-c-client/ | 2024-05-09 01:24 | - | |
| rgxg/ | 2024-05-09 01:24 | - | |
| readpe/ | 2024-05-09 01:24 | - | |
| rbldnsd/ | 2024-05-09 01:24 | - | |
| rust-servo-freetype-sys/ | 2024-05-09 02:09 | - | |
| rust-sanitize-filename/ | 2024-05-09 02:09 | - | |
| rust-rustc-cfg/ | 2024-05-09 02:09 | - | |
| rust-scala-native-demangle/ | 2024-05-09 02:09 | - | |
| rust-rhai-codegen/ | 2024-05-09 02:09 | - | |
| rust-psm/ | 2024-05-09 02:09 | - | |
| rust-radium/ | 2024-05-09 02:09 | - | |
| rust-primal-estimate/ | 2024-05-09 02:09 | - | |
| rust-proc-status/ | 2024-05-09 02:09 | - | |
| rust-pure-rust-locales/ | 2024-05-09 02:09 | - | |
| rust-primal-check/ | 2024-05-09 02:09 | - | |
| rust-pe-unwind-info/ | 2024-05-09 02:09 | - | |
| rust-mock-instant/ | 2024-05-09 02:09 | - | |
| rust-pretty-dtoa/ | 2024-05-09 02:09 | - | |
| rust-openssl-sys/ | 2024-05-09 02:09 | - | |
| rust-opener/ | 2024-05-09 02:09 | - | |
| rust-no-std-net/ | 2024-05-09 02:09 | - | |
| rust-minimad/ | 2024-05-09 02:09 | - | |
| rust-net2/ | 2024-05-09 02:09 | - | |
| rust-logos-codegen/ | 2024-05-09 02:09 | - | |
| rust-log-mdc/ | 2024-05-09 02:09 | - | |
| rust-interprocess/ | 2024-05-09 02:09 | - | |
| rust-linux-perf-event-reader/ | 2024-05-09 02:09 | - | |
| rust-line-wrap/ | 2024-05-09 02:09 | - | |
| rust-lifeguard/ | 2024-05-09 02:09 | - | |
| rust-lev-distance/ | 2024-05-09 02:09 | - | |
| rust-iso7816-tlv/ | 2024-05-09 02:09 | - | |
| rust-gix-hash/ | 2024-05-09 02:09 | - | |
| rust-intl-memoizer/ | 2024-05-09 02:09 | - | |
| rust-is-docker/ | 2024-05-09 02:09 | - | |
| rust-hickory-resolver/ | 2024-05-09 02:09 | - | |
| rust-hickory-client/ | 2024-05-09 02:09 | - | |
| rust-histo/ | 2024-05-09 02:09 | - | |
| rust-hyper/ | 2024-05-09 02:09 | - | |
| rust-hamming/ | 2024-05-09 02:09 | - | |
| rust-h2/ | 2024-05-09 02:09 | - | |
| rust-globalcache/ | 2024-05-09 02:09 | - | |
| rust-value-bag-sval2/ | 2024-05-09 02:54 | - | |
| rust-regex-test/ | 2024-05-09 02:54 | - | |
| rust-tokio-vsock/ | 2024-05-09 02:54 | - | |
| rust-value-bag/ | 2024-05-09 02:54 | - | |
| rust-webpki-roots/ | 2024-05-09 02:54 | - | |
| rust-unzip/ | 2024-05-09 02:54 | - | |
| rust-uutils-term-grid/ | 2024-05-09 02:54 | - | |
| rust-unix-socket/ | 2024-05-09 02:54 | - | |
| rust-value-bag-serde1/ | 2024-05-09 02:54 | - | |
| rust-unsafe-any-ors/ | 2024-05-09 02:54 | - | |
| rust-textwrap/ | 2024-05-09 02:54 | - | |
| rust-tracing-tunnel/ | 2024-05-09 02:54 | - | |
| rust-tr/ | 2024-05-09 02:54 | - | |
| rust-thin-vec/ | 2024-05-09 02:54 | - | |
| rust-test-casing-macro/ | 2024-05-09 02:54 | - | |
| rust-thiserror-impl-no-std/ | 2024-05-09 02:54 | - | |
| rust-svg/ | 2024-05-09 02:54 | - | |
| rust-sysctl/ | 2024-05-09 02:54 | - | |
| rust-strength-reduce/ | 2024-05-09 02:54 | - | |
| rust-strict/ | 2024-05-09 02:54 | - | |
| rust-signal-hook-tokio/ | 2024-05-09 02:54 | - | |
| rust-str-indices/ | 2024-05-09 02:54 | - | |
| rust-stacker/ | 2024-05-09 02:54 | - | |
| r-other-disgenet2r/ | 2024-05-09 05:20 | - | |
| r-cran-rocr/ | 2024-05-09 05:20 | - | |
| rime-cangjie/ | 2024-05-09 07:10 | - | |
| rt-tests/ | 2024-05-09 07:10 | - | |
| ristretto/ | 2024-05-09 07:10 | - | |
| rtl-sdr/ | 2024-05-09 07:10 | - | |
| rime-array/ | 2024-05-09 07:10 | - | |
| renattach/ | 2024-05-09 07:10 | - | |
| rapache/ | 2024-05-09 07:10 | - | |
| rafkill/ | 2024-05-09 07:10 | - | |
| rabbitsign/ | 2024-05-09 07:10 | - | |
| railway-gtk/ | 2024-05-09 08:08 | - | |
| rust-istring/ | 2024-05-09 08:08 | - | |
| rockdodger/ | 2024-05-09 09:00 | - | |
| ripperx/ | 2024-05-09 09:01 | - | |
| r-cran-rstan/ | 2024-05-09 09:58 | - | |
| r-cran-tweenr/ | 2024-05-09 09:58 | - | |
| rust-libpulse-binding/ | 2024-05-09 09:58 | - | |
| r-cran-ggforce/ | 2024-05-09 09:58 | - | |
| r-cran-huge/ | 2024-05-09 09:58 | - | |
| r-cran-irlba/ | 2024-05-09 09:58 | - | |
| r-cran-influencer/ | 2024-05-09 09:58 | - | |
| r-cran-httpuv/ | 2024-05-09 09:58 | - | |
| r-cran-ggrepel/ | 2024-05-09 09:58 | - | |
| r-cran-htmltools/ | 2024-05-09 09:58 | - | |
| r-cran-erm/ | 2024-05-09 09:58 | - | |
| ruby-rails-assets-jquery-textchange/ | 2024-05-09 10:50 | - | |
| r-cran-bdsmatrix/ | 2024-05-09 17:31 | - | |
| r-cran-brio/ | 2024-05-09 17:31 | - | |
| r-cran-glasso/ | 2024-05-09 17:31 | - | |
| r-cran-mime/ | 2024-05-09 17:31 | - | |
| rust-hmac-sha256/ | 2024-05-09 17:54 | - | |
| rust-fax/ | 2024-05-09 18:19 | - | |
| rust-primal-bit/ | 2024-05-09 18:19 | - | |
| rust-suggest/ | 2024-05-09 18:19 | - | |
| rust-thiserror-no-std/ | 2024-05-09 18:19 | - | |
| r-cran-qgraph/ | 2024-05-09 20:59 | - | |
| ruby-money/ | 2024-05-09 22:35 | - | |
| ruby-airbrussh/ | 2024-05-09 22:35 | - | |
| r-cran-m2r/ | 2024-05-10 01:06 | - | |
| rust-notify-debouncer-full/ | 2024-05-10 04:36 | - | |
| rust-logos-derive/ | 2024-05-10 04:36 | - | |
| rust-libraw-rs/ | 2024-05-10 04:36 | - | |
| rust-macho-unwind-info/ | 2024-05-10 04:36 | - | |
| rust-linux-perf-data/ | 2024-05-10 04:36 | - | |
| rust-is-wsl/ | 2024-05-10 04:36 | - | |
| rust-fluent-bundle/ | 2024-05-10 04:36 | - | |
| rust-cli-log/ | 2024-05-10 04:36 | - | |
| rust-card-backend-pcsc/ | 2024-05-10 04:36 | - | |
| rust-openssl/ | 2024-05-10 05:30 | - | |
| rust-rcgen/ | 2024-05-10 05:30 | - | |
| rust-ropey/ | 2024-05-10 05:30 | - | |
| rust-gix-packetline/ | 2024-05-10 16:52 | - | |
| rust-fluent/ | 2024-05-10 16:52 | - | |
| rnp/ | 2024-05-10 23:40 | - | |
| r-cran-estimability/ | 2024-05-11 11:03 | - | |
| rpi-lgpio/ | 2024-05-11 11:48 | - | |
| rust-hickory-recursor/ | 2024-05-11 17:33 | - | |
| rust-typemap-ors/ | 2024-05-11 17:33 | - | |
| r-cran-gprofiler2/ | 2024-05-12 04:43 | - | |
| r-cran-cliapp/ | 2024-05-12 10:58 | - | |
| r-cran-callr/ | 2024-05-12 10:58 | - | |
| rust-automod/ | 2024-05-12 10:58 | - | |
| rust-gix-quote/ | 2024-05-13 18:28 | - | |
| rtl-ais/ | 2024-05-13 19:59 | - | |
| r-cran-igraph/ | 2024-05-13 20:43 | - | |
| rust-cookie-store/ | 2024-05-13 20:43 | - | |
| r-cran-bigmemory/ | 2024-05-13 20:43 | - | |
| roger-router/ | 2024-05-14 05:56 | - | |
| rust-log4rs/ | 2024-05-14 10:19 | - | |
| ruby-appraiser-rubocop/ | 2024-05-14 11:48 | - | |
| rsnapshot/ | 2024-05-14 17:04 | - | |
| rust-thread-priority/ | 2024-05-15 09:34 | - | |
| rem/ | 2024-05-15 11:49 | - | |
| rust-tower/ | 2024-05-16 10:17 | - | |
| rust-serde-derive-internals/ | 2024-05-16 10:17 | - | |
| rust-no-std-compat/ | 2024-05-16 10:17 | - | |
| rust-elsa/ | 2024-05-16 10:17 | - | |
| racket/ | 2024-05-16 17:53 | - | |
| r-cran-sass/ | 2024-05-16 17:53 | - | |
| rust-xmltree/ | 2024-05-16 17:53 | - | |
| rust-indexmap/ | 2024-05-17 01:44 | - | |
| rust-ordered-multimap/ | 2024-05-17 04:08 | - | |
| rust-hashlink/ | 2024-05-17 04:08 | - | |
| rust-async-tls/ | 2024-05-17 04:08 | - | |
| rust-dashmap/ | 2024-05-17 04:08 | - | |
| rust-chumsky/ | 2024-05-17 04:08 | - | |
| rust-trust-dns-recursor/ | 2024-05-17 04:08 | - | |
| rust-ahash-0.7/ | 2024-05-17 05:00 | - | |
| r-cran-cmstatr/ | 2024-05-17 05:00 | - | |
| r-cran-promises/ | 2024-05-17 05:49 | - | |
| rust-trust-dns-proto/ | 2024-05-17 11:44 | - | |
| r-cran-bslib/ | 2024-05-18 04:58 | - | |
| rust-unsafe-libyaml/ | 2024-05-18 11:07 | - | |
| rust-treediff/ | 2024-05-18 11:07 | - | |
| rust-config-file/ | 2024-05-18 11:07 | - | |
| rust-scraper/ | 2024-05-18 17:42 | - | |
| rust-serde-yaml/ | 2024-05-19 01:07 | - | |
| rust-carapace-spec-clap/ | 2024-05-20 13:03 | - | |
| r-cran-spatstat.random/ | 2024-05-20 14:41 | - | |
| r-cran-ggfortify/ | 2024-05-20 22:38 | - | |
| r-cran-rvest/ | 2024-05-20 22:38 | - | |
| r-cran-gbrd/ | 2024-05-21 00:24 | - | |
| r-cran-spatstat.model/ | 2024-05-21 08:04 | - | |
| r-cran-spatstat.linnet/ | 2024-05-21 11:44 | - | |
| rust-alsa/ | 2024-05-21 17:32 | - | |
| r-cran-spatstat.explore/ | 2024-05-21 17:53 | - | |
| rust-clap-mangen/ | 2024-05-21 23:50 | - | |
| r-cran-spatstat/ | 2024-05-22 11:09 | - | |
| r-cran-tidytext/ | 2024-05-22 22:43 | - | |
| rust-evdev-rs/ | 2024-05-23 05:53 | - | |
| r-cran-ggplot2/ | 2024-05-23 23:14 | - | |
| rust-enum-map-derive/ | 2024-05-24 17:26 | - | |
| rust-hashbrown/ | 2024-05-24 23:53 | - | |
| rust-enum-map/ | 2024-05-25 05:03 | - | |
| rust-rustpython-compiler-core/ | 2024-05-25 10:54 | - | |
| rust-rustpython-common/ | 2024-05-25 10:54 | - | |
| rust-expect-test/ | 2024-05-25 10:54 | - | |
| rust-logos/ | 2024-05-25 17:43 | - | |
| rust-spake2/ | 2024-05-25 17:43 | - | |
| rust-crypto-secretbox/ | 2024-05-25 17:43 | - | |
| ruby-grape-entity/ | 2024-05-25 23:09 | - | |
| ripe-atlas-tools/ | 2024-05-25 23:09 | - | |
| r-cran-rtweet/ | 2024-05-26 23:15 | - | |
| rkward/ | 2024-05-28 05:51 | - | |
| rdflib-sqlalchemy/ | 2024-05-28 22:54 | - | |
| r-cran-lavasearch2/ | 2024-05-28 22:54 | - | |
| rust-synstructure/ | 2024-05-29 04:24 | - | |
| rmlint/ | 2024-05-29 05:58 | - | |
| r-cran-rsample/ | 2024-05-29 23:09 | - | |
| r-cran-pracma/ | 2024-05-29 23:57 | - | |
| rust-serial-unix/ | 2024-05-30 23:25 | - | |
| rust-bytecodec/ | 2024-05-30 23:25 | - | |
| rust-vmm-sys-util/ | 2024-05-30 23:25 | - | |
| rust-bytecheck-derive/ | 2024-05-31 00:14 | - | |
| rust-bytecheck/ | 2024-05-31 05:16 | - | |
| rss2email/ | 2024-05-31 10:34 | - | |
| ruby-hoe/ | 2024-05-31 23:14 | - | |
| rust-x11-clipboard/ | 2024-06-01 05:02 | - | |
| rust-clipboard/ | 2024-06-01 05:02 | - | |
| ruby-googleapis-common-protos-types/ | 2024-06-01 11:03 | - | |
| rime-prelude/ | 2024-06-01 16:33 | - | |
| rinetd/ | 2024-06-01 17:23 | - | |
| rust-terminal-clipboard/ | 2024-06-02 11:43 | - | |
| r-cran-munsell/ | 2024-06-02 22:48 | - | |
| r-cran-satellite/ | 2024-06-02 23:33 | - | |
| rust-fork/ | 2024-06-02 23:33 | - | |
| rust-basic-toml/ | 2024-06-02 23:33 | - | |
| r-cran-mvnormtest/ | 2024-06-02 23:53 | - | |
| rtl8812au/ | 2024-06-03 09:38 | - | |
| r-cran-qlcmatrix/ | 2024-06-04 04:43 | - | |
| raku-readline/ | 2024-06-04 08:58 | - | |
| r-cran-hardhat/ | 2024-06-04 22:58 | - | |
| rhsrvany/ | 2024-06-04 22:58 | - | |
| r-cran-logger/ | 2024-06-05 05:14 | - | |
| rust-axum-core/ | 2024-06-05 08:52 | - | |
| rust-cxxbridge-macro/ | 2024-06-05 16:43 | - | |
| r-cran-repr/ | 2024-06-06 04:48 | - | |
| r-cran-popepi/ | 2024-06-06 04:48 | - | |
| r-cran-terra/ | 2024-06-06 05:45 | - | |
| ruby-kramdown-rfc2629/ | 2024-06-06 17:47 | - | |
| r-cran-ape/ | 2024-06-06 22:58 | - | |
| re2/ | 2024-06-07 02:54 | - | |
| r-cran-logspline/ | 2024-06-07 04:58 | - | |
| rust-multihash-derive-impl/ | 2024-06-07 05:43 | - | |
| rust-memsec/ | 2024-06-07 17:14 | - | |
| rust-minijinja/ | 2024-06-07 17:14 | - | |
| rust-shared-child/ | 2024-06-07 23:03 | - | |
| r-cran-gh/ | 2024-06-09 23:02 | - | |
| r-cran-pkgbuild/ | 2024-06-10 04:43 | - | |
| r-cran-emayili/ | 2024-06-10 04:43 | - | |
| r-cran-ggdendro/ | 2024-06-10 04:43 | - | |
| r-cran-splines2/ | 2024-06-10 05:23 | - | |
| r-cran-qpdf/ | 2024-06-10 05:23 | - | |
| r-cran-tidyselect/ | 2024-06-10 05:23 | - | |
| ruby-capybara/ | 2024-06-10 11:24 | - | |
| rickslab-gpu-utils/ | 2024-06-10 11:24 | - | |
| refmac-dictionary/ | 2024-06-10 17:24 | - | |
| r-cran-rlang/ | 2024-06-10 23:28 | - | |
| r-cran-smoother/ | 2024-06-11 10:54 | - | |
| rust-rustls-native-certs/ | 2024-06-11 10:54 | - | |
| rust-strum-macros/ | 2024-06-11 10:54 | - | |
| r-cran-mlbench/ | 2024-06-11 10:54 | - | |
| r-cran-highr/ | 2024-06-11 11:49 | - | |
| rust-xkbcommon-dl/ | 2024-06-11 17:05 | - | |
| rust-xkeysym/ | 2024-06-11 17:05 | - | |
| rust-wayland-backend/ | 2024-06-11 17:05 | - | |
| rust-wayland-csd-frame/ | 2024-06-11 17:05 | - | |
| rust-vt100/ | 2024-06-11 17:05 | - | |
| rust-vte/ | 2024-06-11 17:05 | - | |
| rust-tiny-skia-path/ | 2024-06-11 17:05 | - | |
| rust-glutin-glx-sys/ | 2024-06-11 17:05 | - | |
| rust-glutin-egl-sys/ | 2024-06-11 17:05 | - | |
| rust-ansitok/ | 2024-06-11 17:05 | - | |
| rust-cursor-icon/ | 2024-06-11 17:05 | - | |
| rust-erased-serde/ | 2024-06-11 17:05 | - | |
| rust-alacritty-config-derive/ | 2024-06-11 17:05 | - | |
| rust-crossfont/ | 2024-06-11 17:05 | - | |
| r-cran-rsconnect/ | 2024-06-11 22:59 | - | |
| r-cran-factominer/ | 2024-06-11 22:59 | - | |
| rust-noise-protocol/ | 2024-06-11 22:59 | - | |
| r-cran-estimatr/ | 2024-06-11 23:55 | - | |
| rust-wl-clipboard-rs/ | 2024-06-12 04:54 | - | |
| rust-wayland-server/ | 2024-06-12 04:54 | - | |
| rust-wayland-protocols-wlr/ | 2024-06-12 04:54 | - | |
| rust-wayland-protocols-plasma/ | 2024-06-12 04:54 | - | |
| rust-wayland-client/ | 2024-06-12 04:54 | - | |
| rust-wayland-cursor/ | 2024-06-12 04:54 | - | |
| rust-tiny-skia/ | 2024-06-12 04:54 | - | |
| rust-smithay-clipboard/ | 2024-06-12 04:54 | - | |
| rust-sctk-adwaita/ | 2024-06-12 04:54 | - | |
| rust-notify-debouncer-mini/ | 2024-06-12 04:54 | - | |
| rust-calloop-wayland-source/ | 2024-06-12 04:54 | - | |
| rust-wayland-protocols/ | 2024-06-12 06:00 | - | |
| rust-copypasta/ | 2024-06-12 17:46 | - | |
| rust-mdns/ | 2024-06-12 23:39 | - | |
| rust-wayland-egl/ | 2024-06-12 23:39 | - | |
| rust-rustls-webpki/ | 2024-06-13 11:04 | - | |
| rust-syscallz/ | 2024-06-13 12:00 | - | |
| rust-gix-packetline-blocking/ | 2024-06-13 17:49 | - | |
| rust-alacritty-config/ | 2024-06-14 05:56 | - | |
| rio/ | 2024-06-16 11:03 | - | |
| renrot/ | 2024-06-16 11:03 | - | |
| r-cran-mass/ | 2024-06-16 11:43 | - | |
| r-cran-remotes/ | 2024-06-16 23:03 | - | |
| r-cran-processx/ | 2024-06-16 23:03 | - | |
| r-cran-gee/ | 2024-06-16 23:03 | - | |
| rosegarden/ | 2024-06-16 23:57 | - | |
| r-cran-transformr/ | 2024-06-17 05:04 | - | |
| r-cran-leaps/ | 2024-06-17 05:04 | - | |
| rust-gix-validate/ | 2024-06-17 17:10 | - | |
| rust-gix-bitmap/ | 2024-06-17 17:10 | - | |
| rust-brotli-decompressor/ | 2024-06-17 17:10 | - | |
| rubiks/ | 2024-06-17 17:10 | - | |
| r-cran-sjstats/ | 2024-06-17 23:05 | - | |
| r-cran-incidence/ | 2024-06-18 06:03 | - | |
| rust-supports-hyperlinks/ | 2024-06-18 19:11 | - | |
| rust-gix-hashtable/ | 2024-06-18 19:11 | - | |
| r-cran-r2html/ | 2024-06-18 23:09 | - | |
| r-cran-fs/ | 2024-06-18 23:09 | - | |
| ruby-omniauth-shibboleth-redux/ | 2024-06-19 05:56 | - | |
| rkdeveloptool/ | 2024-06-19 23:09 | - | |
| r-cran-bayesfm/ | 2024-06-19 23:09 | - | |
| r10k/ | 2024-06-20 05:20 | - | |
| roffit/ | 2024-06-20 17:55 | - | |
| r-cran-rcdklibs/ | 2024-06-20 23:11 | - | |
| responses/ | 2024-06-21 00:14 | - | |
| rtmidi/ | 2024-06-21 01:12 | - | |
| rtaudio/ | 2024-06-21 01:12 | - | |
| rust-tikv-jemallocator/ | 2024-06-21 13:10 | - | |
| rp-pppoe/ | 2024-06-21 14:08 | - | |
| rust-ciborium-io/ | 2024-06-21 17:55 | - | |
| r-cran-farver/ | 2024-06-22 00:04 | - | |
| ruby-googleapis-common-protos/ | 2024-06-23 00:02 | - | |
| ru-tts/ | 2024-06-23 00:02 | - | |
| r-cran-ggsci/ | 2024-06-23 00:02 | - | |
| rust-av-metrics/ | 2024-06-23 17:30 | - | |
| rust-ciborium/ | 2024-06-24 00:08 | - | |
| ruff/ | 2024-06-24 17:30 | - | |
| rust-roaring/ | 2024-06-25 12:53 | - | |
| rust-nucleo-matcher/ | 2024-06-25 12:53 | - | |
| rust-cntr-fuse-sys/ | 2024-06-25 12:53 | - | |
| rust-drop-tracker/ | 2024-06-25 12:53 | - | |
| rust-http/ | 2024-06-25 17:52 | - | |
| r-cran-officer/ | 2024-06-25 23:09 | - | |
| r-cran-amelia/ | 2024-06-25 23:11 | - | |
| rust-backoff/ | 2024-06-25 23:11 | - | |
| rust-netlink-packet-utils/ | 2024-06-26 01:44 | - | |
| rust-simple-error/ | 2024-06-26 12:39 | - | |
| rust-temp-testdir/ | 2024-06-26 17:12 | - | |
| r-cran-flextable/ | 2024-06-26 23:04 | - | |
| rust-etherparse/ | 2024-06-26 23:04 | - | |
| r-cran-redland/ | 2024-06-26 23:04 | - | |
| r-cran-forecast/ | 2024-06-27 06:40 | - | |
| rime-terra-pinyin/ | 2024-06-27 16:50 | - | |
| r-cran-phytools/ | 2024-06-27 22:46 | - | |
| r-cran-dt/ | 2024-06-27 22:46 | - | |
| r-cran-marginaleffects/ | 2024-06-27 23:46 | - | |
| r-cran-systemfonts/ | 2024-06-27 23:46 | - | |
| rust-tracing-journald/ | 2024-06-28 03:46 | - | |
| rust-lockfree-object-pool/ | 2024-06-28 03:46 | - | |
| rust-container-pid/ | 2024-06-28 03:46 | - | |
| rust-cntr-fuse-abi/ | 2024-06-28 03:46 | - | |
| rust-bitter/ | 2024-06-28 17:57 | - | |
| rust-bcrypt/ | 2024-06-28 17:57 | - | |
| rust-ntp-proto/ | 2024-06-29 11:14 | - | |
| rust-apple-nvram/ | 2024-06-29 11:49 | - | |
| rust-imperative/ | 2024-06-29 16:39 | - | |
| rust-nalgebra-macros/ | 2024-06-30 00:00 | - | |
| rust-deser-hjson/ | 2024-06-30 05:51 | - | |
| rust-phf-generator/ | 2024-07-01 00:16 | - | |
| ros2-colcon-ros/ | 2024-07-01 17:41 | - | |
| rust-primeorder/ | 2024-07-01 17:41 | - | |
| r-cran-polycub/ | 2024-07-01 23:57 | - | |
| rust-ntp-udp/ | 2024-07-02 06:14 | - | |
| rust-criterion-0.3/ | 2024-07-02 18:00 | - | |
| ruby-gitlab-fog-azure-rm/ | 2024-07-02 23:38 | - | |
| ruby-mini-magick/ | 2024-07-02 23:38 | - | |
| rust-simba/ | 2024-07-03 00:10 | - | |
| rust-predicates/ | 2024-07-03 00:57 | - | |
| rust-lru/ | 2024-07-03 00:57 | - | |
| rust-h3/ | 2024-07-03 00:57 | - | |
| rust-eyre/ | 2024-07-03 00:57 | - | |
| rust-byte-unit/ | 2024-07-03 00:57 | - | |
| rubberband/ | 2024-07-03 04:15 | - | |
| relatorio/ | 2024-07-03 11:16 | - | |
| rust-ntp-os-clock/ | 2024-07-03 11:57 | - | |
| recon-ng/ | 2024-07-04 04:46 | - | |
| rust-noise-rust-crypto/ | 2024-07-04 04:47 | - | |
| rust-simd-adler32/ | 2024-07-04 04:47 | - | |
| rust-matchers/ | 2024-07-04 04:47 | - | |
| rust-cntr-fuse/ | 2024-07-04 04:47 | - | |
| rust-unicode-general-category/ | 2024-07-04 04:47 | - | |
| rocalution/ | 2024-07-04 08:51 | - | |
| rust-loom/ | 2024-07-04 10:12 | - | |
| rust-libusb1-sys/ | 2024-07-04 10:12 | - | |
| rust-concread/ | 2024-07-04 10:12 | - | |
| r-cran-teachingdemos/ | 2024-07-04 11:10 | - | |
| rust-zoxide/ | 2024-07-04 11:56 | - | |
| rust-gix-utils/ | 2024-07-04 11:56 | - | |
| rust-rusb/ | 2024-07-04 12:49 | - | |
| ruby-redis-store/ | 2024-07-04 16:59 | - | |
| ruby-discordrb-webhooks/ | 2024-07-04 16:59 | - | |
| rust-const-random-macro/ | 2024-07-04 16:59 | - | |
| rust-byte-slice-cast/ | 2024-07-04 16:59 | - | |
| r-cran-testthat/ | 2024-07-04 16:59 | - | |
| r-cran-spatstat.geom/ | 2024-07-04 17:59 | - | |
| r-cran-spdata/ | 2024-07-04 23:14 | - | |
| r-cran-sjmisc/ | 2024-07-04 23:14 | - | |
| rust-rustc-serialize/ | 2024-07-04 23:14 | - | |
| rust-safe-transmute/ | 2024-07-04 23:14 | - | |
| rust-rand-core/ | 2024-07-04 23:14 | - | |
| rust-malloc-buf/ | 2024-07-04 23:14 | - | |
| rust-names/ | 2024-07-05 02:59 | - | |
| rust-itoap/ | 2024-07-05 02:59 | - | |
| ruby-jira/ | 2024-07-05 04:51 | - | |
| rust-nalgebra/ | 2024-07-05 06:09 | - | |
| rust-regex-cursor/ | 2024-07-05 11:16 | - | |
| rust-nucleo/ | 2024-07-05 11:16 | - | |
| rust-tracing-subscriber/ | 2024-07-05 11:57 | - | |
| rust-prost/ | 2024-07-05 14:55 | - | |
| renaissance/ | 2024-07-05 15:49 | - | |
| rust-prost-types/ | 2024-07-05 17:35 | - | |
| rust-proc-macro2/ | 2024-07-05 17:52 | - | |
| rulex/ | 2024-07-06 11:53 | - | |
| rust-prometheus-client/ | 2024-07-06 23:00 | - | |
| rust-gpgme/ | 2024-07-08 05:48 | - | |
| r-cran-nloptr/ | 2024-07-08 05:48 | - | |
| r-cran-xml/ | 2024-07-08 05:48 | - | |
| rust-memoffset/ | 2024-07-08 05:48 | - | |
| rust-intrusive-collections/ | 2024-07-08 08:13 | - | |
| rust-field-offset/ | 2024-07-08 08:13 | - | |
| rust-argh-shared/ | 2024-07-08 17:41 | - | |
| rust-os-pipe/ | 2024-07-09 12:31 | - | |
| rust-argh-derive/ | 2024-07-09 16:31 | - | |
| rust-cfg-expr/ | 2024-07-09 17:39 | - | |
| rust-clone-file/ | 2024-07-09 17:39 | - | |
| rust-prodash/ | 2024-07-10 00:22 | - | |
| rust-crosstermion/ | 2024-07-10 00:22 | - | |
| rust-argh/ | 2024-07-10 10:04 | - | |
| rust-csv2svg/ | 2024-07-11 00:23 | - | |
| r-cran-diagrammer/ | 2024-07-11 00:23 | - | |
| r-cran-argparse/ | 2024-07-11 05:59 | - | |
| r-cran-ggeffects/ | 2024-07-11 05:59 | - | |
| rust-cargo-platform/ | 2024-07-11 17:52 | - | |
| rust-wayland-sys/ | 2024-07-11 18:09 | - | |
| r-cran-metafor/ | 2024-07-11 23:38 | - | |
| r-cran-pkgload/ | 2024-07-11 23:38 | - | |
| rust-eui48/ | 2024-07-11 23:38 | - | |
| rust-vsprintf/ | 2024-07-12 09:02 | - | |
| rust-termini/ | 2024-07-12 09:02 | - | |
| rust-trait-variant/ | 2024-07-12 09:02 | - | |
| rust-kv-log-macro/ | 2024-07-12 11:35 | - | |
| r-cran-dials/ | 2024-07-12 11:35 | - | |
| rust-easy-parallel/ | 2024-07-12 11:35 | - | |
| rust-femme/ | 2024-07-12 11:35 | - | |
| rust-fast-srgb8/ | 2024-07-12 11:35 | - | |
| randomplay/ | 2024-07-12 12:11 | - | |
| rust-rusty-pool/ | 2024-07-12 17:28 | - | |
| rust-threadfin/ | 2024-07-12 17:28 | - | |
| rust-souper-ir/ | 2024-07-12 17:28 | - | |
| rust-strfmt/ | 2024-07-12 17:28 | - | |
| rust-socks/ | 2024-07-12 17:28 | - | |
| rust-slice-group-by/ | 2024-07-12 17:28 | - | |
| rust-serde-fmt/ | 2024-07-12 17:28 | - | |
| r-cran-rsqlite/ | 2024-07-12 17:59 | - | |
| rust-async-attributes/ | 2024-07-13 07:24 | - | |
| rust-assert-json-diff/ | 2024-07-13 07:24 | - | |
| ruby-web-console/ | 2024-07-13 17:10 | - | |
| rust-pandoc-ast/ | 2024-07-13 17:51 | - | |
| rust-linemux/ | 2024-07-13 17:51 | - | |
| rust-leptonica-plumbing/ | 2024-07-13 17:51 | - | |
| ruby-redis-client/ | 2024-07-13 17:51 | - | |
| rust-snow/ | 2024-07-14 00:08 | - | |
| rust-multiaddr/ | 2024-07-14 00:08 | - | |
| rumur/ | 2024-07-14 05:49 | - | |
| rust-zbus-names/ | 2024-07-14 11:49 | - | |
| rust-async-broadcast/ | 2024-07-14 11:49 | - | |
| rust-async-mutex/ | 2024-07-14 11:49 | - | |
| rust-roadmap/ | 2024-07-14 11:54 | - | |
| rust-async-generic/ | 2024-07-14 18:41 | - | |
| rust-hickory-server/ | 2024-07-15 00:11 | - | |
| rust-forensic-adb/ | 2024-07-15 01:45 | - | |
| rust-mockall-double/ | 2024-07-15 01:45 | - | |
| rust-downcast/ | 2024-07-15 01:45 | - | |
| rust-supports-unicode/ | 2024-07-15 01:45 | - | |
| r-cran-cubature/ | 2024-07-15 07:35 | - | |
| rclone-browser/ | 2024-07-15 12:20 | - | |
| rust-usb-ids/ | 2024-07-15 12:20 | - | |
| rust-ogg-pager/ | 2024-07-15 12:20 | - | |
| rust-anyhow/ | 2024-07-16 06:17 | - | |
| rope/ | 2024-07-17 06:23 | - | |
| ruby-mechanize/ | 2024-07-17 16:48 | - | |
| ruby-rack-test/ | 2024-07-18 04:44 | - | |
| rust-microformats/ | 2024-07-18 16:46 | - | |
| rust-async-io/ | 2024-07-19 00:17 | - | |
| r-cran-httptest2/ | 2024-07-19 00:17 | - | |
| ruby-base64/ | 2024-07-19 06:17 | - | |
| ruby-cri/ | 2024-07-19 11:49 | - | |
| ruby-enumerize/ | 2024-07-19 11:49 | - | |
| ruby-adsf/ | 2024-07-19 11:49 | - | |
| r-cran-prodlim/ | 2024-07-19 15:38 | - | |
| rust-sudo-rs/ | 2024-07-19 15:38 | - | |
| rime-pinyin-simp/ | 2024-07-19 15:38 | - | |
| rust-serde-regex/ | 2024-07-19 15:38 | - | |
| rust-rb-sys-env/ | 2024-07-19 15:38 | - | |
| rust-sql-builder/ | 2024-07-19 15:38 | - | |
| rust-railway-api-derive/ | 2024-07-19 15:38 | - | |
| rust-minspan/ | 2024-07-19 15:38 | - | |
| rust-argon2/ | 2024-07-19 15:38 | - | |
| rust-backtrace-ext/ | 2024-07-19 15:38 | - | |
| rust-gat-std-proc/ | 2024-07-19 15:38 | - | |
| rust-deflate64/ | 2024-07-19 15:38 | - | |
| ruby-org/ | 2024-07-19 16:42 | - | |
| rust-dialoguer/ | 2024-07-21 03:15 | - | |
| ruby-minitest-hooks/ | 2024-07-21 11:07 | - | |
| ruby-http/ | 2024-07-21 11:07 | - | |
| rust-csv-core/ | 2024-07-21 12:17 | - | |
| rust-csv/ | 2024-07-21 15:05 | - | |
| ruby-train/ | 2024-07-21 23:23 | - | |
| ruby-mocha/ | 2024-07-21 23:23 | - | |
| r-cran-dslabs/ | 2024-07-21 23:23 | - | |
| r-cran-sparsem/ | 2024-07-22 06:14 | - | |
| r-cran-spdep/ | 2024-07-22 09:06 | - | |
| r-cran-openssl/ | 2024-07-22 09:06 | - | |
| rust-interim/ | 2024-07-22 12:13 | - | |
| ruby-net-http-pipeline/ | 2024-07-22 22:36 | - | |
| ruby-nanotest/ | 2024-07-22 22:36 | - | |
| relational/ | 2024-07-23 00:13 | - | |
| rust-serde-html-form/ | 2024-07-23 03:38 | - | |
| rust-gat-std/ | 2024-07-23 03:38 | - | |
| r-cran-rmariadb/ | 2024-07-23 03:38 | - | |
| robtk/ | 2024-07-23 11:36 | - | |
| ruby-state-machines/ | 2024-07-23 11:36 | - | |
| r-cran-ucminf/ | 2024-07-23 11:38 | - | |
| ruby-state-machines-activemodel/ | 2024-07-23 17:17 | - | |
| rust-walkdir/ | 2024-07-23 17:17 | - | |
| ruby-omniauth-multipassword/ | 2024-07-24 11:53 | - | |
| ruby-apollo-upload-server/ | 2024-07-24 11:53 | - | |
| rust-tokio-test/ | 2024-07-24 11:54 | - | |
| r-cran-stars/ | 2024-07-24 18:01 | - | |
| ruby-carrierwave/ | 2024-07-25 11:14 | - | |
| ruby-rantly/ | 2024-07-25 11:14 | - | |
| ruby-sass/ | 2024-07-25 11:14 | - | |
| ruby-gettext/ | 2024-07-25 11:14 | - | |
| ruby-rails-i18n/ | 2024-07-25 11:14 | - | |
| rust-hyper-timeout/ | 2024-07-25 12:13 | - | |
| ruby-ffaker/ | 2024-07-25 12:13 | - | |
| ruby-gitlab-sdk/ | 2024-07-25 12:13 | - | |
| ruby-acts-as-tree/ | 2024-07-25 17:32 | - | |
| ruby-did-you-mean/ | 2024-07-25 17:32 | - | |
| rainbow-identifiers-el/ | 2024-07-25 17:32 | - | |
| rainbow-delimiters/ | 2024-07-25 17:32 | - | |
| rust-greetd-ipc/ | 2024-07-25 18:09 | - | |
| ruby-semver-dialects/ | 2024-07-25 18:09 | - | |
| ruby-sassc/ | 2024-07-25 22:37 | - | |
| rust-uuid/ | 2024-07-25 23:43 | - | |
| rust-atomic/ | 2024-07-25 23:43 | - | |
| rust-unicode-segmentation/ | 2024-07-25 23:43 | - | |
| rust-unicode-bom/ | 2024-07-25 23:43 | - | |
| rich-minority/ | 2024-07-26 05:20 | - | |
| redtick/ | 2024-07-26 05:20 | - | |
| recursive-narrow/ | 2024-07-26 05:20 | - | |
| ruby-ecma-re-validator/ | 2024-07-26 05:20 | - | |
| restart-emacs/ | 2024-07-26 05:20 | - | |
| rainbow-mode/ | 2024-07-26 05:20 | - | |
| rust-try-lock/ | 2024-07-26 05:21 | - | |
| rust-railway-provider-search-ch/ | 2024-07-26 09:22 | - | |
| rust-subunit/ | 2024-07-26 09:22 | - | |
| rust-timestamped-socket/ | 2024-07-26 09:22 | - | |
| rust-miette-derive/ | 2024-07-26 09:22 | - | |
| rust-clock-steering/ | 2024-07-26 09:22 | - | |
| rust-assert-matches2/ | 2024-07-26 09:22 | - | |
| rust-miette/ | 2024-07-26 13:02 | - | |
| r-cran-htmltable/ | 2024-07-26 17:10 | - | |
| ruby-sentry-ruby/ | 2024-07-27 10:37 | - | |
| rtags/ | 2024-07-27 11:57 | - | |
| ruby-sentry-rails/ | 2024-07-27 14:41 | - | |
| ruby-sentry-sidekiq/ | 2024-07-28 05:00 | - | |
| requirejs/ | 2024-07-28 17:51 | - | |
| rust-koibumi-base32/ | 2024-07-29 11:50 | - | |
| rust-regex-lite/ | 2024-07-29 11:50 | - | |
| rust-kdl/ | 2024-07-29 11:50 | - | |
| r-cran-pbkrtest/ | 2024-07-29 17:01 | - | |
| rust-target-lexicon/ | 2024-07-29 17:02 | - | |
| r-cran-gsl/ | 2024-07-30 03:25 | - | |
| r-cran-rcppgsl/ | 2024-07-30 03:25 | - | |
| raysession/ | 2024-07-30 05:38 | - | |
| rpavlik-cmake-modules/ | 2024-07-30 18:03 | - | |
| rust-pythonize/ | 2024-07-30 18:20 | - | |
| rust-tabwriter/ | 2024-07-30 18:20 | - | |
| rust-subtle/ | 2024-07-30 18:20 | - | |
| rust-pyo3-log/ | 2024-07-30 23:30 | - | |
| riscemu/ | 2024-07-31 05:05 | - | |
| r-cran-av/ | 2024-07-31 11:24 | - | |
| rust-zstd/ | 2024-07-31 12:09 | - | |
| rust-netlink-packet-core/ | 2024-07-31 14:05 | - | |
| rust-netlink-proto/ | 2024-07-31 14:06 | - | |
| rust-netlink-packet-route/ | 2024-07-31 14:06 | - | |
| rust-rtnetlink/ | 2024-07-31 16:21 | - | |
| rust-erbium-core/ | 2024-07-31 19:26 | - | |
| rust-netlink-packet-generic/ | 2024-07-31 19:26 | - | |
| rust-netlink-packet-audit/ | 2024-07-31 19:26 | - | |
| rust-erbium/ | 2024-07-31 21:26 | - | |
| rust-hkdf/ | 2024-08-01 05:58 | - | |
| rust-genetlink/ | 2024-08-01 05:58 | - | |
| rust-json-event-parser/ | 2024-08-01 06:14 | - | |
| rust-flume/ | 2024-08-01 06:14 | - | |
| rust-crdts/ | 2024-08-01 06:14 | - | |
| r-cran-irkernel/ | 2024-08-01 06:14 | - | |
| rust-ethtool/ | 2024-08-01 07:12 | - | |
| rust-mptcp-pm/ | 2024-08-01 07:12 | - | |
| rust-nispor/ | 2024-08-01 09:58 | - | |
| rust-bounded-static/ | 2024-08-01 12:08 | - | |
| rust-sha1/ | 2024-08-01 12:52 | - | |
| rust-keccak/ | 2024-08-01 12:52 | - | |
| rust-dsa/ | 2024-08-01 12:52 | - | |
| rust-id-arena/ | 2024-08-01 18:03 | - | |
| rust-ahash/ | 2024-08-01 18:03 | - | |
| rust-sha3/ | 2024-08-01 23:09 | - | |
| r-cran-uuid/ | 2024-08-01 23:09 | - | |
| rust-nanorand/ | 2024-08-02 00:20 | - | |
| rquantlib/ | 2024-08-02 00:20 | - | |
| rust-blake2s-simd/ | 2024-08-02 00:34 | - | |
| rust-blake2-rfc/ | 2024-08-02 00:34 | - | |
| rust-blake2b-simd/ | 2024-08-02 00:34 | - | |
| rust-totp-rs/ | 2024-08-02 05:59 | - | |
| rust-retry/ | 2024-08-02 06:16 | - | |
| rust-pkcs8/ | 2024-08-02 06:16 | - | |
| rust-peg/ | 2024-08-02 06:16 | - | |
| rust-nom-locate/ | 2024-08-02 12:06 | - | |
| rust-oxilangtag/ | 2024-08-02 12:06 | - | |
| rust-libheif-sys/ | 2024-08-02 12:37 | - | |
| raven/ | 2024-08-03 06:00 | - | |
| rocprim/ | 2024-08-03 10:25 | - | |
| rust-z-base-32/ | 2024-08-03 17:15 | - | |
| rocfft/ | 2024-08-04 05:59 | - | |
| rust-const-fn/ | 2024-08-04 12:00 | - | |
| rust-lsp-types/ | 2024-08-04 17:11 | - | |
| rocthrust/ | 2024-08-04 17:54 | - | |
| ripe-atlas-sagan/ | 2024-08-04 22:30 | - | |
| rust-vergen/ | 2024-08-05 00:10 | - | |
| rust-sysinfo/ | 2024-08-05 00:10 | - | |
| rust-openpgp-card/ | 2024-08-05 00:10 | - | |
| ruby-jekyll-asciidoc/ | 2024-08-05 02:37 | - | |
| rust-cint/ | 2024-08-05 02:39 | - | |
| rust-totp-lite/ | 2024-08-05 02:39 | - | |
| rust-fun-time-derive/ | 2024-08-05 02:39 | - | |
| rust-trawld/ | 2024-08-05 02:39 | - | |
| rust-railway-provider-motis/ | 2024-08-05 02:39 | - | |
| rust-stalkerware-indicators/ | 2024-08-05 02:39 | - | |
| rust-drm-ffi/ | 2024-08-05 05:10 | - | |
| rust-num-enum-derive/ | 2024-08-05 16:50 | - | |
| rust-unscanny/ | 2024-08-05 21:35 | - | |
| rust-drm/ | 2024-08-05 21:35 | - | |
| r-cran-vioplot/ | 2024-08-05 22:30 | - | |
| r-cran-mlmetrics/ | 2024-08-05 22:30 | - | |
| rust-railway-provider-hafas/ | 2024-08-06 06:09 | - | |
| rtsp-to-webrtc/ | 2024-08-06 06:09 | - | |
| rust-env-logger/ | 2024-08-06 12:13 | - | |
| rail/ | 2024-08-06 12:13 | - | |
| ruby-github-markup/ | 2024-08-06 17:29 | - | |
| requirement-parser/ | 2024-08-06 18:07 | - | |
| r-cran-smcfcs/ | 2024-08-07 01:06 | - | |
| rust-trybuild/ | 2024-08-07 06:07 | - | |
| rust-err-derive/ | 2024-08-07 06:07 | - | |
| r-cran-roxygen2/ | 2024-08-07 08:23 | - | |
| r-cran-dimred/ | 2024-08-07 17:52 | - | |
| r-cran-rcpproll/ | 2024-08-08 00:20 | - | |
| r-cran-psychtools/ | 2024-08-08 05:03 | - | |
| r-cran-bayestestr/ | 2024-08-09 00:09 | - | |
| ruby-rbpdf/ | 2024-08-09 05:06 | - | |
| r-cran-effectsize/ | 2024-08-09 06:10 | - | |
| rustc/ | 2024-08-09 16:16 | - | |
| rust-libheif-rs/ | 2024-08-10 05:49 | - | |
| r-cran-swagger/ | 2024-08-10 11:50 | - | |
| rust-tree-sitter-loader/ | 2024-08-10 17:42 | - | |
| rust-dunce/ | 2024-08-10 17:42 | - | |
| rust-unindent/ | 2024-08-10 17:42 | - | |
| rust-nvml-wrapper/ | 2024-08-10 17:42 | - | |
| rust-libloading/ | 2024-08-10 17:42 | - | |
| rust-nvml-wrapper-sys/ | 2024-08-10 17:42 | - | |
| rust-khronos-egl/ | 2024-08-10 17:42 | - | |
| rust-indoc/ | 2024-08-10 17:42 | - | |
| rust-dlib/ | 2024-08-10 17:42 | - | |
| rust-cryptoki-sys/ | 2024-08-10 17:42 | - | |
| rust-cryptoki/ | 2024-08-10 17:42 | - | |
| rust-merlin/ | 2024-08-10 19:56 | - | |
| rust-sha1-checked/ | 2024-08-10 19:56 | - | |
| rust-seq-macro/ | 2024-08-10 19:56 | - | |
| rust-gperftools/ | 2024-08-10 19:56 | - | |
| rust-iter-read/ | 2024-08-10 19:56 | - | |
| rust-railway-api/ | 2024-08-10 19:56 | - | |
| rust-pnet-base/ | 2024-08-10 19:56 | - | |
| rust-magnus-macros/ | 2024-08-10 19:56 | - | |
| rust-crc24/ | 2024-08-10 19:56 | - | |
| rt-extension-jsgantt/ | 2024-08-11 04:56 | - | |
| rt-extension-calendar/ | 2024-08-11 04:56 | - | |
| rt-extension-resetpassword/ | 2024-08-11 04:56 | - | |
| rust-selinux/ | 2024-08-11 04:57 | - | |
| rust-scopeguard/ | 2024-08-11 11:05 | - | |
| rust-num-integer/ | 2024-08-11 11:05 | - | |
| rust-netlink-sys/ | 2024-08-11 16:50 | - | |
| rt-extension-repeatticket/ | 2024-08-12 04:28 | - | |
| rt-extension-commandbymail/ | 2024-08-12 04:28 | - | |
| react/ | 2024-08-12 04:28 | - | |
| reactivedata/ | 2024-08-12 07:48 | - | |
| rygel/ | 2024-08-12 10:34 | - | |
| rust-notify/ | 2024-08-12 12:02 | - | |
| r-cran-metamix/ | 2024-08-12 12:02 | - | |
| rust-num-modular/ | 2024-08-12 17:53 | - | |
| retroarch/ | 2024-08-13 06:02 | - | |
| ruby-gitlab-markup/ | 2024-08-13 07:39 | - | |
| rust-parsec-interface/ | 2024-08-13 11:40 | - | |
| rust-bitvec-helpers/ | 2024-08-13 15:34 | - | |
| rust-input/ | 2024-08-13 17:57 | - | |
| rust-ntest-test-cases/ | 2024-08-13 18:06 | - | |
| rust-insta/ | 2024-08-13 18:06 | - | |
| r-cran-kernlab/ | 2024-08-13 18:06 | - | |
| rust-filetime/ | 2024-08-13 23:59 | - | |
| rust-bitstream-io/ | 2024-08-14 01:36 | - | |
| rust-either/ | 2024-08-14 01:37 | - | |
| rust-parking/ | 2024-08-14 02:53 | - | |
| rust-ntest-timeout/ | 2024-08-14 05:27 | - | |
| rust-ntest/ | 2024-08-14 17:53 | - | |
| rust-oo7/ | 2024-08-15 17:58 | - | |
| rust-lzxd/ | 2024-08-16 01:47 | - | |
| rust-condtype/ | 2024-08-16 01:47 | - | |
| relint-el/ | 2024-08-16 11:57 | - | |
| ruby-kyotocabinet/ | 2024-08-16 14:12 | - | |
| ruby-kgio/ | 2024-08-16 14:12 | - | |
| ruby-murmurhash3/ | 2024-08-16 14:12 | - | |
| ruby-levenshtein/ | 2024-08-16 14:12 | - | |
| ruby-enumerable-statistics/ | 2024-08-16 14:12 | - | |
| ruby-jaro-winkler/ | 2024-08-16 14:12 | - | |
| ruby-fast-blank/ | 2024-08-16 14:12 | - | |
| ruby-gpgme/ | 2024-08-16 14:12 | - | |
| ruby-ffi-yajl/ | 2024-08-16 14:12 | - | |
| ruby-exif/ | 2024-08-16 14:12 | - | |
| ruby-ed25519/ | 2024-08-16 14:12 | - | |
| ruby-fast-stemmer/ | 2024-08-16 14:12 | - | |
| ruby-dbm/ | 2024-08-16 14:12 | - | |
| ruby-damerau-levenshtein/ | 2024-08-16 14:12 | - | |
| ruby-bert/ | 2024-08-16 14:12 | - | |
| ruby-version-sorter/ | 2024-08-16 14:12 | - | |
| ruby-thrift/ | 2024-08-16 14:12 | - | |
| ruby-timfel-krb5-auth/ | 2024-08-16 14:12 | - | |
| ruby-termios/ | 2024-08-16 14:12 | - | |
| ruby-rpam-ruby19/ | 2024-08-16 14:12 | - | |
| ruby-rinku/ | 2024-08-16 14:12 | - | |
| ruby-redcarpet/ | 2024-08-16 14:12 | - | |
| ruby-oj/ | 2024-08-16 14:12 | - | |
| ruby-raindrops/ | 2024-08-16 14:12 | - | |
| ruby-ox/ | 2024-08-16 14:12 | - | |
| ruby-vmstat/ | 2024-08-16 15:18 | - | |
| ruby-zoom/ | 2024-08-16 15:18 | - | |
| ruby-yajl/ | 2024-08-16 15:18 | - | |
| ruby-sdl/ | 2024-08-16 15:18 | - | |
| rust-async-global-executor/ | 2024-08-16 17:49 | - | |
| ruby-defaults/ | 2024-08-16 17:49 | - | |
| recoverdm/ | 2024-08-17 00:31 | - | |
| rust-cab/ | 2024-08-17 00:31 | - | |
| ruby-binding-ninja/ | 2024-08-17 13:11 | - | |
| ruby3.3/ | 2024-08-17 14:07 | - | |
| ruby-hitimes/ | 2024-08-17 14:15 | - | |
| ruby-debian/ | 2024-08-17 14:15 | - | |
| ruby-xmlhash/ | 2024-08-17 14:15 | - | |
| ruby-unf-ext/ | 2024-08-17 14:15 | - | |
| ruby-strptime/ | 2024-08-17 14:15 | - | |
| ruby-sequel-pg/ | 2024-08-17 14:15 | - | |
| ruby-rpatricia/ | 2024-08-17 14:15 | - | |
| ruby-regexp-property-values/ | 2024-08-17 14:15 | - | |
| ruby-rbtree/ | 2024-08-17 14:15 | - | |
| ruby-concurrent/ | 2024-08-18 17:48 | - | |
| rpmlint/ | 2024-08-19 05:56 | - | |
| ruby-standalone/ | 2024-08-19 13:11 | - | |
| ruby-password/ | 2024-08-19 13:11 | - | |
| ruby-oj-introspect/ | 2024-08-19 13:11 | - | |
| ruby-http-parser.rb/ | 2024-08-19 13:11 | - | |
| ruby-fftw3/ | 2024-08-19 13:11 | - | |
| ruby-github-markdown/ | 2024-08-19 13:11 | - | |
| ruby-github-linguist/ | 2024-08-19 13:11 | - | |
| ruby-commonmarker/ | 2024-08-19 13:11 | - | |
| ruby-bson/ | 2024-08-19 13:11 | - | |
| ruby-aliyun-sdk/ | 2024-08-19 13:11 | - | |
| ruby-lapack/ | 2024-08-19 14:12 | - | |
| ruby-pg-query/ | 2024-08-19 14:12 | - | |
| rtorrent/ | 2024-08-19 15:11 | - | |
| rust-futures-lite/ | 2024-08-19 23:59 | - | |
| rust-async-zip/ | 2024-08-19 23:59 | - | |
| rust-async-net/ | 2024-08-19 23:59 | - | |
| rust-async-fs/ | 2024-08-19 23:59 | - | |
| rust-event-listener/ | 2024-08-20 05:53 | - | |
| rust-blocking/ | 2024-08-20 05:53 | - | |
| rust-async-task/ | 2024-08-20 05:53 | - | |
| rust-async-lock/ | 2024-08-20 05:53 | - | |
| ruby-haml/ | 2024-08-20 06:53 | - | |
| ruby-xmlparser/ | 2024-08-20 06:53 | - | |
| ruby-escape-utils/ | 2024-08-20 09:52 | - | |
| rust-threecpio/ | 2024-08-20 11:52 | - | |
| ruby-hamlit/ | 2024-08-20 13:16 | - | |
| ruby-netcdf/ | 2024-08-20 14:48 | - | |
| ruby-multibitnums/ | 2024-08-20 14:48 | - | |
| ruby-gsl/ | 2024-08-20 17:52 | - | |
| raspell/ | 2024-08-21 12:12 | - | |
| ruby-fast-xs/ | 2024-08-21 13:10 | - | |
| ruby-hiredis/ | 2024-08-21 13:10 | - | |
| ruby-mysql2/ | 2024-08-21 14:05 | - | |
| ruby-posix-spawn/ | 2024-08-21 15:00 | - | |
| ruby-tioga/ | 2024-08-21 15:55 | - | |
| ruby-uconv/ | 2024-08-21 15:55 | - | |
| ruby-hdfeos5/ | 2024-08-21 21:25 | - | |
| ruby-byebug/ | 2024-08-21 21:25 | - | |
| robot-testing-framework/ | 2024-08-21 23:55 | - | |
| ruby-odbc/ | 2024-08-22 01:23 | - | |
| ruby-rblineprof/ | 2024-08-22 06:33 | - | |
| ruby-psych/ | 2024-08-22 06:33 | - | |
| ruby-safely-block/ | 2024-08-22 14:36 | - | |
| ruby-representable/ | 2024-08-22 14:36 | - | |
| ruby-default-value-for/ | 2024-08-22 14:36 | - | |
| ruby-declarative-option/ | 2024-08-22 14:36 | - | |
| ruby-clockwork/ | 2024-08-22 14:36 | - | |
| ruby-chronic/ | 2024-08-22 14:36 | - | |
| ruby-filesystem/ | 2024-08-22 17:46 | - | |
| ruby-slim/ | 2024-08-23 05:32 | - | |
| rshim-user-space/ | 2024-08-23 17:43 | - | |
| rdma-core/ | 2024-08-25 17:39 | - | |
| rust-dhcproto/ | 2024-08-25 18:28 | - | |
| rocm-smi-lib/ | 2024-08-26 11:44 | - | |
| radvd/ | 2024-08-27 00:16 | - | |
| rstcheck/ | 2024-08-27 03:21 | - | |
| rust-reis/ | 2024-08-27 03:21 | - | |
| rust-gufo-common/ | 2024-08-27 03:21 | - | |
| r-cran-statcheck/ | 2024-08-27 05:53 | - | |
| rust-gufo-exif/ | 2024-08-27 08:45 | - | |
| ruby-toml/ | 2024-08-28 17:46 | - | |
| rlottie/ | 2024-08-29 13:40 | - | |
| ruby-jekyll-gist/ | 2024-08-29 14:40 | - | |
| rsyslog/ | 2024-08-29 17:45 | - | |
| reform-setup-wizard/ | 2024-08-29 23:52 | - | |
| ruby-method-source/ | 2024-08-30 15:00 | - | |
| ruby-sprockets/ | 2024-08-30 15:00 | - | |
| ruby-memory-profiler/ | 2024-08-30 17:53 | - | |
| ruby-rails-assets-jquery.slimscroll/ | 2024-08-30 20:03 | - | |
| ruby-rails-assets-jquery/ | 2024-08-30 20:03 | - | |
| ruby-sass-rails/ | 2024-08-30 20:03 | - | |
| ruby-mousetrap-rails/ | 2024-08-30 20:54 | - | |
| referencing/ | 2024-09-02 02:25 | - | |
| ruby-cleanroom/ | 2024-09-02 12:15 | - | |
| racc/ | 2024-09-02 12:15 | - | |
| ruby-jquery-ui-rails/ | 2024-09-02 13:09 | - | |
| ruby-rails-assets-jquery-colorbox/ | 2024-09-02 13:09 | - | |
| rust-pangocairo-sys/ | 2024-09-04 00:01 | - | |
| rust-gstreamer/ | 2024-09-04 00:01 | - | |
| rust-gstreamer-base/ | 2024-09-04 05:55 | - | |
| ruby-rgen/ | 2024-09-04 13:54 | - | |
| ruby-rabl-rails/ | 2024-09-04 14:49 | - | |
| ruby-mimemagic/ | 2024-09-04 14:50 | - | |
| ruby-ahoy-email/ | 2024-09-04 15:44 | - | |
| ruby-mail/ | 2024-09-05 08:55 | - | |
| ruby-websocket-driver/ | 2024-09-06 00:01 | - | |
| ruby-haml-rails/ | 2024-09-06 11:54 | - | |
| ruby-unparser/ | 2024-09-06 11:54 | - | |
| ruby-gelf/ | 2024-09-06 14:16 | - | |
| ruby-rspec-parameterized/ | 2024-09-06 14:16 | - | |
| ruby-pcaprub/ | 2024-09-07 11:39 | - | |
| rust-system-deps/ | 2024-09-07 17:40 | - | |
| rust-version-check/ | 2024-09-07 22:44 | - | |
| rust-iso8601/ | 2024-09-07 22:44 | - | |
| rust-python3-dll-a/ | 2024-09-07 22:44 | - | |
| rust-num-bigint/ | 2024-09-07 22:44 | - | |
| rust-enum-dispatch/ | 2024-09-07 22:44 | - | |
| rust-castaway/ | 2024-09-08 02:49 | - | |
| rust-clap-lex/ | 2024-09-08 03:38 | - | |
| rust-anstyle/ | 2024-09-08 05:19 | - | |
| rust-prettytable-rs/ | 2024-09-08 06:09 | - | |
| rust-papergrid/ | 2024-09-08 06:09 | - | |
| rust-console/ | 2024-09-08 06:09 | - | |
| rust-clap-builder/ | 2024-09-08 07:03 | - | |
| rust-tabled/ | 2024-09-08 07:48 | - | |
| rust-clap/ | 2024-09-08 08:38 | - | |
| rust-uzers/ | 2024-09-08 08:38 | - | |
| rust-clap-derive/ | 2024-09-08 09:28 | - | |
| rust-strsim/ | 2024-09-08 10:18 | - | |
| rust-clap-complete/ | 2024-09-08 11:09 | - | |
| rust-clap-verbosity-flag/ | 2024-09-08 11:09 | - | |
| ruby-selenium-webdriver/ | 2024-09-08 11:59 | - | |
| ruby-warden/ | 2024-09-08 11:59 | - | |
| ruby-xpath/ | 2024-09-08 11:59 | - | |
| ruby-orm-adapter/ | 2024-09-08 11:59 | - | |
| rust-darling-core/ | 2024-09-08 13:00 | - | |
| rust-escargot/ | 2024-09-08 13:56 | - | |
| rust-docopt/ | 2024-09-08 13:56 | - | |
| rust-deluxe-core/ | 2024-09-08 13:56 | - | |
| rust-defmt-parser/ | 2024-09-08 13:56 | - | |
| rust-crc32fast/ | 2024-09-08 13:56 | - | |
| rust-color-to-tui/ | 2024-09-08 13:56 | - | |
| rust-const-format-proc-macros/ | 2024-09-08 13:56 | - | |
| rust-chrono-tz-build/ | 2024-09-08 13:56 | - | |
| rust-cc/ | 2024-09-08 13:56 | - | |
| rust-cargo-config2/ | 2024-09-08 13:56 | - | |
| rust-bumpalo/ | 2024-09-08 13:56 | - | |
| rust-bitflags/ | 2024-09-08 13:56 | - | |
| rust-asn1-derive/ | 2024-09-08 13:56 | - | |
| rust-enum-iterator-derive/ | 2024-09-08 14:51 | - | |
| rust-rmp/ | 2024-09-08 14:51 | - | |
| rust-rayon/ | 2024-09-08 14:51 | - | |
| rust-radix-heap/ | 2024-09-08 14:51 | - | |
| rust-numbat-exchange-rates/ | 2024-09-08 14:51 | - | |
| rust-merge/ | 2024-09-08 14:51 | - | |
| rust-iptables/ | 2024-09-08 14:51 | - | |
| rust-jobserver/ | 2024-09-08 14:51 | - | |
| rust-is-terminal/ | 2024-09-08 14:51 | - | |
| rust-is-macro/ | 2024-09-08 14:51 | - | |
| rust-iana-time-zone/ | 2024-09-08 14:51 | - | |
| rust-html-escape/ | 2024-09-08 14:51 | - | |
| rust-serde-spanned/ | 2024-09-08 15:45 | - | |
| rust-darling-macro/ | 2024-09-08 15:45 | - | |
| rust-zeroize/ | 2024-09-08 15:45 | - | |
| rust-toml-datetime/ | 2024-09-08 15:45 | - | |
| rust-tokio-macros/ | 2024-09-08 15:45 | - | |
| rust-termcolor/ | 2024-09-08 15:45 | - | |
| rust-asn1/ | 2024-09-08 15:45 | - | |
| rust-signal-hook-mio/ | 2024-09-08 16:40 | - | |
| rust-tokio/ | 2024-09-08 16:40 | - | |
| rust-enum-iterator/ | 2024-09-08 16:40 | - | |
| rust-const-format/ | 2024-09-08 16:40 | - | |
| rust-serde-value/ | 2024-09-08 16:40 | - | |
| rust-rmp-serde/ | 2024-09-08 16:40 | - | |
| rust-darling/ | 2024-09-08 17:41 | - | |
| rust-chrono-tz/ | 2024-09-08 18:40 | - | |
| rust-openssh/ | 2024-09-08 18:40 | - | |
| rust-spin/ | 2024-09-08 18:40 | - | |
| rust-enum-unitary/ | 2024-09-08 18:40 | - | |
| rust-tiny-bip39/ | 2024-09-09 02:20 | - | |
| rust-derive-builder-core/ | 2024-09-09 02:20 | - | |
| rust-runtime-format/ | 2024-09-09 02:20 | - | |
| rust-kmon/ | 2024-09-09 03:20 | - | |
| rust-rstest-test/ | 2024-09-09 03:20 | - | |
| rust-toml/ | 2024-09-09 03:20 | - | |
| rust-openssh-mux-client/ | 2024-09-09 05:34 | - | |
| rust-derive-builder-macro/ | 2024-09-09 05:34 | - | |
| rust-datetime/ | 2024-09-09 05:52 | - | |
| rust-derive-builder/ | 2024-09-09 07:51 | - | |
| rust-rspec/ | 2024-09-09 10:11 | - | |
| rust-chbs/ | 2024-09-09 10:11 | - | |
| rust-smallvec/ | 2024-09-09 11:52 | - | |
| rust-ansi-to-tui/ | 2024-09-09 13:15 | - | |
| rust-zstd-safe/ | 2024-09-09 17:53 | - | |
| rust-tui-react/ | 2024-09-09 17:53 | - | |
| rust-quick-xml/ | 2024-09-09 17:53 | - | |
| rust-quick-junit/ | 2024-09-09 17:53 | - | |
| rust-process-viewer/ | 2024-09-09 17:53 | - | |
| rust-fd-find/ | 2024-09-09 17:53 | - | |
| rust-droid-juicer/ | 2024-09-09 17:53 | - | |
| rust-blake3/ | 2024-09-09 17:53 | - | |
| rust-assorted-debian-utils/ | 2024-09-09 17:53 | - | |
| ruby-jbuilder/ | 2024-09-09 17:53 | - | |
| rust-plist/ | 2024-09-10 00:02 | - | |
| rust-gstreamer-gl-x11-sys/ | 2024-09-10 00:02 | - | |
| rust-gstreamer-audio-sys/ | 2024-09-10 00:02 | - | |
| rust-gst-plugin-gif/ | 2024-09-10 00:02 | - | |
| rust-dav1d-sys/ | 2024-09-10 00:02 | - | |
| rust-cairo-sys-rs/ | 2024-09-10 00:02 | - | |
| rust-winnow/ | 2024-09-10 06:03 | - | |
| rust-trivialdb/ | 2024-09-10 06:03 | - | |
| rust-soup3/ | 2024-09-10 06:03 | - | |
| rust-pnet-sys/ | 2024-09-10 06:03 | - | |
| rust-pleaser/ | 2024-09-10 06:03 | - | |
| rust-pangocairo/ | 2024-09-10 06:03 | - | |
| rust-p521/ | 2024-09-10 06:03 | - | |
| rust-libshumate-sys/ | 2024-09-10 06:03 | - | |
| rust-indicatif/ | 2024-09-10 06:03 | - | |
| rust-gweather-sys/ | 2024-09-10 06:03 | - | |
| rust-gvdb-macros/ | 2024-09-10 06:03 | - | |
| rust-gtk4-layer-shell/ | 2024-09-10 06:03 | - | |
| rust-gtk4-layer-shell-sys/ | 2024-09-10 06:03 | - | |
| rust-gstreamer-play/ | 2024-09-10 06:03 | - | |
| rust-gstreamer-play-sys/ | 2024-09-10 06:03 | - | |
| rust-gstreamer-pbutils/ | 2024-09-10 06:03 | - | |
| rust-gstreamer-gl-wayland/ | 2024-09-10 06:03 | - | |
| rust-gstreamer-gl-wayland-sys/ | 2024-09-10 06:03 | - | |
| rust-gsettings-macro/ | 2024-09-10 06:03 | - | |
| rust-gping/ | 2024-09-10 06:03 | - | |
| rust-gpgme-sys/ | 2024-09-10 06:03 | - | |
| rust-async-channel/ | 2024-09-10 06:03 | - | |
| rust-aperture/ | 2024-09-10 06:03 | - | |
| rust-typed-builder/ | 2024-09-10 12:00 | - | |
| rust-typed-builder-macro/ | 2024-09-10 12:00 | - | |
| rust-trust-dns-server/ | 2024-09-10 12:00 | - | |
| rust-soup3-sys/ | 2024-09-10 12:00 | - | |
| rust-prost-derive/ | 2024-09-10 12:00 | - | |
| rust-prost-build/ | 2024-09-10 12:00 | - | |
| rust-proptest/ | 2024-09-10 12:00 | - | |
| rust-libshumate/ | 2024-09-10 12:00 | - | |
| rust-libgweather/ | 2024-09-10 12:00 | - | |
| rust-libgpg-error-sys/ | 2024-09-10 12:00 | - | |
| rust-gstreamer-video-sys/ | 2024-09-10 12:00 | - | |
| rust-gstreamer-pbutils-sys/ | 2024-09-10 12:00 | - | |
| rust-gstreamer-gl-sys/ | 2024-09-10 12:00 | - | |
| rust-enumflags2/ | 2024-09-10 12:00 | - | |
| rust-enumflags2-derive/ | 2024-09-10 12:00 | - | |
| rust-ed25519/ | 2024-09-10 12:00 | - | |
| rust-drt-tools/ | 2024-09-10 12:00 | - | |
| rust-concurrent-queue/ | 2024-09-10 12:00 | - | |
| rhythmbox/ | 2024-09-10 12:11 | - | |
| rust-typenum/ | 2024-09-10 17:53 | - | |
| rust-handlebars/ | 2024-09-11 00:00 | - | |
| ruby-unicode/ | 2024-09-11 00:00 | - | |
| ruby-tokyocabinet/ | 2024-09-11 00:00 | - | |
| ruby-re2/ | 2024-09-11 00:00 | - | |
| ruby-rdiscount/ | 2024-09-11 00:00 | - | |
| ruby-prof/ | 2024-09-11 00:00 | - | |
| ruby-pg/ | 2024-09-11 00:00 | - | |
| ruby-nokogiri/ | 2024-09-11 00:00 | - | |
| ruby-ncurses/ | 2024-09-11 00:00 | - | |
| ruby-libxml/ | 2024-09-11 00:00 | - | |
| ruby-libvirt/ | 2024-09-11 00:00 | - | |
| ruby-json/ | 2024-09-11 00:00 | - | |
| ruby-fusefs/ | 2024-09-11 00:00 | - | |
| ruby-fcgi/ | 2024-09-11 00:00 | - | |
| ruby-eventmachine/ | 2024-09-11 00:00 | - | |
| ruby-debug-inspector/ | 2024-09-11 00:00 | - | |
| ruby-curses/ | 2024-09-11 00:00 | - | |
| ruby-curb/ | 2024-09-11 00:00 | - | |
| ruby-cool.io/ | 2024-09-11 00:00 | - | |
| ruby-character-set/ | 2024-09-11 00:00 | - | |
| ruby-cbor/ | 2024-09-11 00:00 | - | |
| ruby-bootsnap/ | 2024-09-11 00:00 | - | |
| ruby-bindex/ | 2024-09-11 00:00 | - | |
| ruby-bcrypt-pbkdf/ | 2024-09-11 00:00 | - | |
| ruby-augeas/ | 2024-09-11 00:00 | - | |
| ruby-atomic/ | 2024-09-11 00:00 | - | |
| rust-search-provider/ | 2024-09-11 05:58 | - | |
| rust-pango/ | 2024-09-11 05:58 | - | |
| rust-gstreamer-audio/ | 2024-09-11 05:58 | - | |
| rust-target/ | 2024-09-11 12:01 | - | |
| rust-hickory-proto/ | 2024-09-11 12:01 | - | |
| rust-gstreamer-gl/ | 2024-09-11 12:01 | - | |
| rust-ureq/ | 2024-09-11 17:53 | - | |
| rust-cargo-credential/ | 2024-09-11 17:53 | - | |
| rust-rav1e/ | 2024-09-12 05:58 | - | |
| rust-quote/ | 2024-09-12 05:58 | - | |
| rust-hyper-rustls/ | 2024-09-12 05:58 | - | |
| rust-gstreamer-sys/ | 2024-09-12 05:58 | - | |
| rust-gstreamer-allocators-sys/ | 2024-09-12 05:58 | - | |
| rust-rusty-tags/ | 2024-09-12 09:13 | - | |
| rust-xml-rs/ | 2024-09-12 09:13 | - | |
| rust-rustfilt/ | 2024-09-12 09:13 | - | |
| rust-sha1collisiondetection/ | 2024-09-12 09:13 | - | |
| rust-protobuf-codegen/ | 2024-09-12 09:13 | - | |
| rust-proton-call/ | 2024-09-12 09:13 | - | |
| rust-lalrpop/ | 2024-09-12 09:13 | - | |
| rust-netr/ | 2024-09-12 09:13 | - | |
| rust-bindgen-0.65/ | 2024-09-12 09:13 | - | |
| rust-hexyl/ | 2024-09-12 09:13 | - | |
| rust-cargo-lock/ | 2024-09-12 09:13 | - | |
| rust-cargo-auditable/ | 2024-09-12 09:13 | - | |
| rust-dotenv/ | 2024-09-12 09:13 | - | |
| rust-difference/ | 2024-09-12 09:13 | - | |
| rust-bkt/ | 2024-09-12 09:13 | - | |
| rust-diffr/ | 2024-09-12 09:13 | - | |
| rust-zip/ | 2024-09-12 11:47 | - | |
| rust-xcb/ | 2024-09-12 11:47 | - | |
| rust-wayland-scanner/ | 2024-09-12 11:47 | - | |
| rust-toml-edit/ | 2024-09-12 11:47 | - | |
| rust-strum/ | 2024-09-12 11:47 | - | |
| rust-strip-ansi-escapes/ | 2024-09-12 11:47 | - | |
| rust-sourceview5-sys/ | 2024-09-12 11:47 | - | |
| rust-rust-decimal/ | 2024-09-12 11:47 | - | |
| rust-pyo3-filelike/ | 2024-09-12 11:47 | - | |
| rust-proc-macro-crate/ | 2024-09-12 11:47 | - | |
| rust-numbat/ | 2024-09-12 11:47 | - | |
| rust-num-traits/ | 2024-09-12 11:47 | - | |
| rust-gst-plugin-version-helper/ | 2024-09-12 11:47 | - | |
| rust-cid-npm/ | 2024-09-12 15:30 | - | |
| rust-rustdoc-stripper/ | 2024-09-12 15:30 | - | |
| rust-nitrocli/ | 2024-09-12 15:30 | - | |
| rust-markdown/ | 2024-09-12 15:30 | - | |
| rust-ucd-generate/ | 2024-09-12 15:30 | - | |
| rust-cargo-mutants/ | 2024-09-12 15:30 | - | |
| rust-filespooler/ | 2024-09-12 15:30 | - | |
| rust-gvdb/ | 2024-09-12 17:50 | - | |
| rust-gstreamer-video/ | 2024-09-12 23:56 | - | |
| rust-gstreamer-gl-x11/ | 2024-09-12 23:56 | - | |
| rman/ | 2024-09-13 00:20 | - | |
| rust-oid/ | 2024-09-13 01:16 | - | |
| rust-lazycell/ | 2024-09-13 01:16 | - | |
| rust-impl-trait-for-tuples/ | 2024-09-13 01:16 | - | |
| rust-futures/ | 2024-09-13 01:16 | - | |
| rust-deluxe/ | 2024-09-13 01:16 | - | |
| r-bioc-biocgenerics/ | 2024-09-13 06:43 | - | |
| r-bioc-zlibbioc/ | 2024-09-13 10:17 | - | |
| r-bioc-tximportdata/ | 2024-09-13 10:17 | - | |
| r-bioc-tximport/ | 2024-09-13 10:17 | - | |
| r-bioc-stringdb/ | 2024-09-13 10:17 | - | |
| r-bioc-tcgabiolinksgui.data/ | 2024-09-13 10:17 | - | |
| r-bioc-seqlogo/ | 2024-09-13 10:17 | - | |
| r-bioc-savr/ | 2024-09-13 10:17 | - | |
| r-bioc-rwikipathways/ | 2024-09-13 10:17 | - | |
| r-bioc-qvalue/ | 2024-09-13 10:17 | - | |
| r-bioc-protgenerics/ | 2024-09-13 10:17 | - | |
| r-bioc-pfamanalyzer/ | 2024-09-13 10:17 | - | |
| r-bioc-mergeomics/ | 2024-09-13 10:17 | - | |
| r-bioc-matrixgenerics/ | 2024-09-13 10:17 | - | |
| r-bioc-interactivedisplaybase/ | 2024-09-13 10:17 | - | |
| r-bioc-hsmmsinglecell/ | 2024-09-13 10:17 | - | |
| r-bioc-dir.expiry/ | 2024-09-13 10:17 | - | |
| r-bioc-decontam/ | 2024-09-13 10:17 | - | |
| r-bioc-ctc/ | 2024-09-13 10:17 | - | |
| r-bioc-biocversion/ | 2024-09-13 10:17 | - | |
| r-bioc-biocfilecache/ | 2024-09-13 10:17 | - | |
| r-bioc-biocbaseutils/ | 2024-09-13 10:17 | - | |
| r-bioc-aroma.light/ | 2024-09-13 10:17 | - | |
| rust-roxmltree/ | 2024-09-13 10:18 | - | |
| rust-ttf-parser/ | 2024-09-13 10:18 | - | |
| r-bioc-rsubread/ | 2024-09-13 10:18 | - | |
| r-bioc-rhdf5lib/ | 2024-09-13 10:18 | - | |
| r-bioc-preprocesscore/ | 2024-09-13 10:18 | - | |
| r-bioc-metapod/ | 2024-09-13 10:18 | - | |
| r-bioc-lpsymphony/ | 2024-09-13 10:18 | - | |
| r-bioc-impute/ | 2024-09-13 10:18 | - | |
| r-bioc-graph/ | 2024-09-13 10:18 | - | |
| r-bioc-ebseq/ | 2024-09-13 10:18 | - | |
| r-bioc-dnacopy/ | 2024-09-13 10:18 | - | |
| r-bioc-chemminer/ | 2024-09-13 10:18 | - | |
| r-bioc-biocparallel/ | 2024-09-13 10:18 | - | |
| r-bioc-biobase/ | 2024-09-13 10:18 | - | |
| r-bioc-affxparser/ | 2024-09-13 10:18 | - | |
| r-bioc-s4vectors/ | 2024-09-13 11:16 | - | |
| r-bioc-ihw/ | 2024-09-13 12:16 | - | |
| r-bioc-wrench/ | 2024-09-13 12:16 | - | |
| r-bioc-noiseq/ | 2024-09-13 12:16 | - | |
| r-bioc-qusage/ | 2024-09-13 12:16 | - | |
| r-bioc-decoupler/ | 2024-09-13 12:16 | - | |
| r-bioc-bladderbatch/ | 2024-09-13 12:16 | - | |
| r-bioc-geoquery/ | 2024-09-13 12:16 | - | |
| r-bioc-dupradar/ | 2024-09-13 12:16 | - | |
| r-bioc-biocio/ | 2024-09-13 12:16 | - | |
| r-bioc-basilisk.utils/ | 2024-09-13 12:16 | - | |
| r-bioc-hypergraph/ | 2024-09-13 12:16 | - | |
| r-bioc-all/ | 2024-09-13 12:16 | - | |
| r-bioc-rhdf5filters/ | 2024-09-13 13:16 | - | |
| r-bioc-multtest/ | 2024-09-13 13:16 | - | |
| r-bioc-pcamethods/ | 2024-09-13 13:16 | - | |
| r-bioc-biocneighbors/ | 2024-09-13 13:16 | - | |
| r-bioc-fmcsr/ | 2024-09-13 13:16 | - | |
| r-bioc-iranges/ | 2024-09-13 13:16 | - | |
| r-bioc-eir/ | 2024-09-13 13:16 | - | |
| r-bioc-affyio/ | 2024-09-13 13:16 | - | |
| r-bioc-rbgl/ | 2024-09-13 13:16 | - | |
| r-bioc-rhtslib/ | 2024-09-13 13:16 | - | |
| r-bioc-sparsematrixstats/ | 2024-09-13 14:16 | - | |
| r-bioc-snpstats/ | 2024-09-13 14:16 | - | |
| r-bioc-rots/ | 2024-09-13 15:12 | - | |
| r-bioc-metagenomeseq/ | 2024-09-13 17:05 | - | |
| r-bioc-progeny/ | 2024-09-13 17:05 | - | |
| r-bioc-consensusclusterplus/ | 2024-09-13 17:05 | - | |
| r-bioc-complexheatmap/ | 2024-09-13 17:05 | - | |
| r-bioc-biocviews/ | 2024-09-13 17:05 | - | |
| r-bioc-basilisk/ | 2024-09-13 17:06 | - | |
| r-bioc-s4arrays/ | 2024-09-13 17:06 | - | |
| r-bioc-affy/ | 2024-09-13 17:06 | - | |
| r-bioc-bluster/ | 2024-09-13 17:06 | - | |
| rust-vivid/ | 2024-09-13 17:46 | - | |
| rust-virtiofsd/ | 2024-09-13 17:46 | - | |
| rust-tre-command/ | 2024-09-13 17:46 | - | |
| rust-tokei/ | 2024-09-13 17:46 | - | |
| rust-sniffglue/ | 2024-09-13 17:46 | - | |
| rust-sd/ | 2024-09-13 17:46 | - | |
| rust-ntpd/ | 2024-09-13 17:46 | - | |
| rust-lscolors/ | 2024-09-13 17:46 | - | |
| rust-dfrs/ | 2024-09-13 17:46 | - | |
| rust-cargo-binutils/ | 2024-09-13 17:46 | - | |
| rust-brotli/ | 2024-09-13 17:46 | - | |
| rust-alacritty/ | 2024-09-13 17:46 | - | |
| r-bioc-xvector/ | 2024-09-13 18:55 | - | |
| r-bioc-golubesets/ | 2024-09-13 23:36 | - | |
| rust-linescroll/ | 2024-09-13 23:51 | - | |
| r-bioc-genomeinfodbdata/ | 2024-09-14 00:40 | - | |
| r-bioc-biomformat/ | 2024-09-14 00:40 | - | |
| r-bioc-bioccheck/ | 2024-09-14 00:40 | - | |
| r-bioc-sparsearray/ | 2024-09-14 00:40 | - | |
| r-bioc-monocle/ | 2024-09-14 00:40 | - | |
| r-bioc-makecdfenv/ | 2024-09-14 00:40 | - | |
| rust-core-maths/ | 2024-09-14 00:40 | - | |
| r-bioc-genomeinfodb/ | 2024-09-14 02:20 | - | |
| rust-num-complex/ | 2024-09-14 05:40 | - | |
| rust-gstreamer-base-sys/ | 2024-09-14 05:40 | - | |
| rust-fun-time/ | 2024-09-14 05:40 | - | |
| rust-owned-ttf-parser/ | 2024-09-14 05:45 | - | |
| r-bioc-pwmenrich/ | 2024-09-14 06:39 | - | |
| r-bioc-megadepth/ | 2024-09-14 06:39 | - | |
| r-bioc-keggrest/ | 2024-09-14 06:39 | - | |
| r-bioc-annotationfilter/ | 2024-09-14 06:39 | - | |
| r-bioc-phyloseq/ | 2024-09-14 06:39 | - | |
| r-bioc-qtlizer/ | 2024-09-14 06:39 | - | |
| r-bioc-drimseq/ | 2024-09-14 06:39 | - | |
| r-bioc-altcdfenvs/ | 2024-09-14 06:39 | - | |
| r-bioc-delayedarray/ | 2024-09-14 06:39 | - | |
| r-bioc-rsamtools/ | 2024-09-14 07:29 | - | |
| r-bioc-residualmatrix/ | 2024-09-14 08:18 | - | |
| r-bioc-summarizedexperiment/ | 2024-09-14 08:18 | - | |
| r-bioc-scaledmatrix/ | 2024-09-14 08:18 | - | |
| r-bioc-delayedmatrixstats/ | 2024-09-14 08:18 | - | |
| r-bioc-annotationdbi/ | 2024-09-14 08:18 | - | |
| r-bioc-hdf5array/ | 2024-09-14 09:04 | - | |
| rust-rusttype/ | 2024-09-14 09:04 | - | |
| rust-ab-glyph/ | 2024-09-14 09:04 | - | |
| r-bioc-singlecellexperiment/ | 2024-09-14 09:53 | - | |
| r-bioc-annotationhub/ | 2024-09-14 09:53 | - | |
| r-bioc-annotate/ | 2024-09-14 09:53 | - | |
| r-bioc-multiassayexperiment/ | 2024-09-14 09:53 | - | |
| r-bioc-biomart/ | 2024-09-14 09:53 | - | |
| r-bioc-beachmat/ | 2024-09-14 09:53 | - | |
| r-bioc-oligoclasses/ | 2024-09-14 10:38 | - | |
| r-bioc-genomicalignments/ | 2024-09-14 10:38 | - | |
| r-bioc-gosemsim/ | 2024-09-14 10:38 | - | |
| recode/ | 2024-09-14 10:39 | - | |
| r-bioc-saturn/ | 2024-09-14 11:30 | - | |
| rust-gstreamer-allocators/ | 2024-09-14 11:41 | - | |
| r-bioc-gypsum/ | 2024-09-14 11:41 | - | |
| r-bioc-alabaster.schemas/ | 2024-09-14 11:41 | - | |
| r-bioc-biocsingular/ | 2024-09-14 12:19 | - | |
| r-bioc-mofa/ | 2024-09-14 14:33 | - | |
| r-bioc-htsfilter/ | 2024-09-14 14:33 | - | |
| r-bioc-gseabase/ | 2024-09-14 14:33 | - | |
| r-bioc-geneplotter/ | 2024-09-14 14:33 | - | |
| r-bioc-fishpond/ | 2024-09-14 14:33 | - | |
| r-bioc-experimenthub/ | 2024-09-14 14:33 | - | |
| r-bioc-degreport/ | 2024-09-14 14:33 | - | |
| r-bioc-singler/ | 2024-09-14 14:34 | - | |
| r-bioc-rtracklayer/ | 2024-09-14 14:34 | - | |
| r-bioc-oligo/ | 2024-09-14 14:34 | - | |
| r-bioc-glmgampoi/ | 2024-09-14 14:34 | - | |
| r-bioc-genefilter/ | 2024-09-14 14:34 | - | |
| r-bioc-destiny/ | 2024-09-14 14:34 | - | |
| r-bioc-scuttle/ | 2024-09-14 15:18 | - | |
| r-bioc-shortread/ | 2024-09-14 16:04 | - | |
| rust-gstreamer-gl-egl-sys/ | 2024-09-14 17:44 | - | |
| r-bioc-ucsc.utils/ | 2024-09-14 17:44 | - | |
| r-bioc-dada2/ | 2024-09-15 01:24 | - | |
| r-bioc-bsgenome/ | 2024-09-15 01:24 | - | |
| r-bioc-dexseq/ | 2024-09-15 01:24 | - | |
| r-bioc-arrayexpress/ | 2024-09-15 01:24 | - | |
| r-bioc-spatialexperiment/ | 2024-09-15 01:24 | - | |
| r-bioc-go.db/ | 2024-09-15 02:14 | - | |
| r-bioc-ioniser/ | 2024-09-15 02:14 | - | |
| r-bioc-genomicfeatures/ | 2024-09-15 02:14 | - | |
| r-bioc-scater/ | 2024-09-15 02:14 | - | |
| r-bioc-sva/ | 2024-09-15 02:14 | - | |
| r-bioc-deseq/ | 2024-09-15 02:14 | - | |
| r-bioc-scran/ | 2024-09-15 02:14 | - | |
| r-bioc-grohmm/ | 2024-09-15 02:14 | - | |
| r-bioc-gsva/ | 2024-09-15 03:54 | - | |
| r-bioc-cner/ | 2024-09-15 03:54 | - | |
| r-bioc-ensembldb/ | 2024-09-15 04:39 | - | |
| r-bioc-ballgown/ | 2024-09-15 04:39 | - | |
| r-bioc-edaseq/ | 2024-09-15 04:39 | - | |
| r-bioc-bsseq/ | 2024-09-15 04:39 | - | |
| r-bioc-variantannotation/ | 2024-09-15 04:39 | - | |
| r-bioc-txdbmaker/ | 2024-09-15 05:23 | - | |
| r-bioc-alabaster.se/ | 2024-09-15 05:23 | - | |
| r-bioc-org.hs.eg.db/ | 2024-09-15 06:14 | - | |
| r-bioc-netsam/ | 2024-09-15 06:14 | - | |
| r-bioc-tfbstools/ | 2024-09-15 06:14 | - | |
| r-bioc-tximeta/ | 2024-09-15 06:58 | - | |
| r-bioc-structuralvariantannotation/ | 2024-09-15 06:58 | - | |
| r-bioc-purecn/ | 2024-09-15 06:58 | - | |
| r-bioc-organismdbi/ | 2024-09-15 06:58 | - | |
| r-bioc-genomicfiles/ | 2024-09-15 06:58 | - | |
| r-bioc-genelendatabase/ | 2024-09-15 06:58 | - | |
| r-bioc-mutationalpatterns/ | 2024-09-15 06:58 | - | |
| r-bioc-alabaster.sce/ | 2024-09-15 07:43 | - | |
| r-bioc-titancna/ | 2024-09-15 07:43 | - | |
| r-bioc-degnorm/ | 2024-09-15 07:43 | - | |
| r-bioc-biovizbase/ | 2024-09-15 07:43 | - | |
| r-bioc-dss/ | 2024-09-15 07:43 | - | |
| r-bioc-gviz/ | 2024-09-15 09:13 | - | |
| r-bioc-ggbio/ | 2024-09-15 09:13 | - | |
| r-bioc-goseq/ | 2024-09-15 09:13 | - | |
| r-bioc-scrnaseq/ | 2024-09-15 09:13 | - | |
| r-bioc-isoformswitchanalyzer/ | 2024-09-15 09:59 | - | |
| r-bioc-demixt/ | 2024-09-15 09:59 | - | |
| r-bioc-rgsepd/ | 2024-09-15 11:40 | - | |
| r-bioc-cummerbund/ | 2024-09-15 11:40 | - | |
| r-bioc-alabaster.ranges/ | 2024-09-15 11:41 | - | |
| rust-rio/ | 2024-09-15 17:45 | - | |
| r-bioc-pwalign/ | 2024-09-15 17:45 | - | |
| r-bioc-gsvadata/ | 2024-09-16 06:03 | - | |
| r-bioc-hgu95a.db/ | 2024-09-16 12:28 | - | |
| rust-gstreamer-gl-egl/ | 2024-09-16 18:11 | - | |
| rust-ashpd/ | 2024-09-16 18:11 | - | |
| rust-log/ | 2024-09-17 00:01 | - | |
| rust-delog/ | 2024-09-17 00:01 | - | |
| ruby-shadow/ | 2024-09-18 00:04 | - | |
| ruby-jsonpath/ | 2024-09-18 00:04 | - | |
| ruby-html2haml/ | 2024-09-18 00:04 | - | |
| ruby-cookiejar/ | 2024-09-18 00:04 | - | |
| ruby-cairo/ | 2024-09-18 00:04 | - | |
| rbac-client-clojure/ | 2024-09-18 00:04 | - | |
| rust-librsvg-rebind/ | 2024-09-18 17:45 | - | |
| r-bioc-rcwl/ | 2024-09-20 11:49 | - | |
| r-bioc-hilbertvis/ | 2024-09-20 11:49 | - | |
| r-bioc-dirichletmultinomial/ | 2024-09-20 11:49 | - | |
| r-bioc-deseq2/ | 2024-09-20 11:49 | - | |
| r-bioc-biostrings/ | 2024-09-20 11:49 | - | |
| rust-gix-trace/ | 2024-09-20 17:46 | - | |
| rust-gix-path/ | 2024-09-21 05:46 | - | |
| rep-gtk/ | 2024-09-22 05:09 | - | |
| rust-gtk4/ | 2024-09-24 17:46 | - | |
| rust-cbindgen/ | 2024-09-25 11:48 | - | |
| rapiddisk/ | 2024-09-25 11:48 | - | |
| ruby-rack/ | 2024-09-25 22:29 | - | |
| rustc-1.79/ | 2024-09-26 17:51 | - | |
| rustc-1.78/ | 2024-09-26 17:51 | - | |
| rustc-1.77/ | 2024-09-26 17:51 | - | |
| ruby-roadie/ | 2024-09-26 23:59 | - | |
| retry/ | 2024-09-27 09:31 | - | |
| rustc-1.76/ | 2024-09-27 23:51 | - | |
| rust-lofty-attr/ | 2024-09-29 08:09 | - | |
| rust-launchpadlib/ | 2024-09-30 11:48 | - | |
| rust-lofty/ | 2024-09-30 17:40 | - | |
| rpki-client/ | 2024-10-01 17:42 | - | |
| rpds-py/ | 2024-10-02 00:45 | - | |
| rust-keyring/ | 2024-10-02 09:59 | - | |
| rust-gufo-jpeg/ | 2024-10-04 01:16 | - | |
| razor/ | 2024-10-20 16:48 | - | |
| rxvt-unicode/ | 2024-10-20 18:01 | - | |
| redland-bindings/ | 2024-10-20 18:01 | - | |
| rapid-photo-downloader/ | 2024-10-21 01:50 | - | |
| restfuldb/ | 2024-10-24 23:13 | - | |
| rt-extension-mergeusers/ | 2024-10-27 11:42 | - | |
| rspamd/ | 2024-10-28 02:51 | - | |
| resource-agents/ | 2024-10-28 04:06 | - | |
| runit/ | 2024-10-30 15:59 | - | |
| ruby-premailer/ | 2024-10-31 11:58 | - | |
| ruby-jaeger-client/ | 2024-10-31 11:58 | - | |
| ruby-handlebars-assets/ | 2024-10-31 11:58 | - | |
| ros-catkin-lint/ | 2024-10-31 11:59 | - | |
| rpm/ | 2024-10-31 14:32 | - | |
| redis/ | 2024-10-31 14:32 | - | |
| r-cran-spacetime/ | 2024-10-31 17:56 | - | |
| r-cran-broom/ | 2024-10-31 17:56 | - | |
| r-cran-chk/ | 2024-10-31 17:56 | - | |
| r-cran-clubsandwich/ | 2024-10-31 17:56 | - | |
| r-cran-broom.mixed/ | 2024-10-31 17:56 | - | |
| r-cran-sjplot/ | 2024-10-31 17:56 | - | |
| r-cran-blme/ | 2024-10-31 17:56 | - | |
| r-cran-biocmanager/ | 2024-10-31 17:56 | - | |
| r-cran-afex/ | 2024-10-31 17:56 | - | |
| r-cran-aer/ | 2024-10-31 17:56 | - | |
| r-cran-shape/ | 2024-10-31 17:56 | - | |
| r-bioc-rcpi/ | 2024-10-31 17:56 | - | |
| r-cran-sfsmisc/ | 2024-10-31 17:56 | - | |
| r-cran-segmented/ | 2024-10-31 17:56 | - | |
| r-cran-rstudioapi/ | 2024-10-31 17:56 | - | |
| r-cran-rmarkdown/ | 2024-10-31 17:57 | - | |
| r-cran-rio/ | 2024-10-31 17:57 | - | |
| r-cran-reprex/ | 2024-10-31 17:57 | - | |
| r-cran-renv/ | 2024-10-31 17:57 | - | |
| r-cran-recipes/ | 2024-10-31 17:57 | - | |
| r-cran-readbrukerflexdata/ | 2024-10-31 17:57 | - | |
| r-cran-rdflib/ | 2024-10-31 17:57 | - | |
| r-cran-rcppdate/ | 2024-10-31 17:57 | - | |
| r-cran-pscbs/ | 2024-10-31 17:57 | - | |
| r-cran-prediction/ | 2024-10-31 17:57 | - | |
| r-cran-prabclus/ | 2024-10-31 17:57 | - | |
| r-cran-posterior/ | 2024-10-31 17:57 | - | |
| r-cran-pls/ | 2024-10-31 17:57 | - | |
| r-cran-pkgkitten/ | 2024-10-31 17:57 | - | |
| r-cran-plotmo/ | 2024-10-31 17:57 | - | |
| r-cran-performance/ | 2024-10-31 17:57 | - | |
| r-cran-pixmap/ | 2024-10-31 17:57 | - | |
| r-cran-patchwork/ | 2024-10-31 17:57 | - | |
| r-cran-parameters/ | 2024-10-31 17:57 | - | |
| r-cran-optparse/ | 2024-10-31 17:57 | - | |
| r-cran-modeldata/ | 2024-10-31 17:57 | - | |
| r-cran-metap/ | 2024-10-31 17:57 | - | |
| r-cran-maxlik/ | 2024-10-31 17:58 | - | |
| r-cran-matlab/ | 2024-10-31 17:58 | - | |
| r-cran-loo/ | 2024-10-31 17:58 | - | |
| r-cran-lavaan/ | 2024-10-31 17:58 | - | |
| r-cran-labelled/ | 2024-10-31 17:59 | - | |
| r-bioc-densvis/ | 2024-10-31 18:02 | - | |
| rust-xor-name/ | 2024-10-31 22:15 | - | |
| rust-smol/ | 2024-10-31 22:16 | - | |
| rust-async-std/ | 2024-10-31 22:16 | - | |
| rust-async-executor/ | 2024-10-31 22:16 | - | |
| rust-async-process/ | 2024-10-31 22:16 | - | |
| rust-abnf-core/ | 2024-10-31 22:16 | - | |
| ruby-test-xml/ | 2024-10-31 22:16 | - | |
| ruby-sidekiq/ | 2024-10-31 22:16 | - | |
| ruby-sassc-rails/ | 2024-10-31 22:16 | - | |
| ruby-saml/ | 2024-10-31 22:16 | - | |
| ruby-rspec-parameterized-core/ | 2024-10-31 22:16 | - | |
| ruby-redis/ | 2024-10-31 22:16 | - | |
| ruby-pluggaloid/ | 2024-10-31 22:16 | - | |
| ruby-puppetserver-ca-cli/ | 2024-10-31 22:16 | - | |
| ruby-net-ssh/ | 2024-10-31 22:16 | - | |
| ruby-open4/ | 2024-10-31 22:16 | - | |
| ruby-packetfu/ | 2024-10-31 22:16 | - | |
| ruby-optimist/ | 2024-10-31 22:16 | - | |
| ruby-marcel/ | 2024-10-31 22:16 | - | |
| ruby-lru-redux/ | 2024-10-31 22:16 | - | |
| ruby-kpeg/ | 2024-10-31 22:16 | - | |
| ruby-jnunemaker-matchy/ | 2024-10-31 22:16 | - | |
| ruby-kdl/ | 2024-10-31 22:16 | - | |
| ruby-image-processing/ | 2024-10-31 22:16 | - | |
| ruby-gitlab-labkit/ | 2024-10-31 22:16 | - | |
| rr/ | 2024-10-31 22:16 | - | |
| ruby-foreman/ | 2024-10-31 22:16 | - | |
| ruby-gitlab-sidekiq-fetcher/ | 2024-10-31 22:16 | - | |
| ruby-flores/ | 2024-10-31 22:16 | - | |
| ruby-faraday/ | 2024-10-31 22:16 | - | |
| ruby-css-parser/ | 2024-10-31 22:16 | - | |
| ruby-cose/ | 2024-10-31 22:16 | - | |
| ruby-chunky-png/ | 2024-10-31 22:16 | - | |
| ruby-dry-cli/ | 2024-10-31 22:16 | - | |
| ruby-cabin/ | 2024-10-31 22:16 | - | |
| ruby-bullet/ | 2024-10-31 22:16 | - | |
| ruby-blade/ | 2024-10-31 22:16 | - | |
| ruby-beaneater/ | 2024-10-31 22:16 | - | |
| rst2pdf/ | 2024-10-31 22:16 | - | |
| ruby-asciidoctor-kroki/ | 2024-10-31 22:16 | - | |
| ruby-ammeter/ | 2024-10-31 22:16 | - | |
| ruby-arr-pm/ | 2024-10-31 22:16 | - | |
| ruby-active-model-serializers/ | 2024-10-31 22:16 | - | |
| ruby-aggregate/ | 2024-10-31 22:16 | - | |
| ruby-ansi/ | 2024-10-31 22:16 | - | |
| rovclock/ | 2024-10-31 22:16 | - | |
| ropgadget/ | 2024-10-31 22:16 | - | |
| rkcommon/ | 2024-10-31 22:17 | - | |
| rhino/ | 2024-10-31 22:17 | - | |
| requirements-parser/ | 2024-10-31 22:17 | - | |
| range-v3/ | 2024-10-31 22:17 | - | |
| rapt-ble/ | 2024-10-31 22:17 | - | |
| refind/ | 2024-10-31 22:17 | - | |
| rename-flac/ | 2024-10-31 22:17 | - | |
| reniced/ | 2024-10-31 22:17 | - | |
| rake-compiler/ | 2024-10-31 22:17 | - | |
| radon/ | 2024-10-31 22:17 | - | |
| rabbitvcs/ | 2024-10-31 22:17 | - | |
| r-cran-yulab.utils/ | 2024-10-31 22:17 | - | |
| rcmdr/ | 2024-10-31 22:17 | - | |
| rust-oxiri/ | 2024-10-31 22:17 | - | |
| r-cran-webmockr/ | 2024-10-31 22:17 | - | |
| r-cran-visnetwork/ | 2024-10-31 22:17 | - | |
| r-cran-wikipedir/ | 2024-10-31 22:17 | - | |
| r-cran-thematic/ | 2024-10-31 22:17 | - | |
| r-cran-vcr/ | 2024-10-31 22:17 | - | |
| r-cran-insight/ | 2024-10-31 22:17 | - | |
| r-cran-vcd/ | 2024-10-31 22:17 | - | |
| r-cran-unitizer/ | 2024-10-31 22:17 | - | |
| r-cran-usethis/ | 2024-10-31 22:17 | - | |
| r-cran-tinytex/ | 2024-10-31 22:17 | - | |
| r-cran-jsonld/ | 2024-10-31 22:17 | - | |
| r-cran-gparotation/ | 2024-10-31 22:17 | - | |
| r-cran-hsaur3/ | 2024-10-31 22:17 | - | |
| r-cran-ggstats/ | 2024-10-31 22:17 | - | |
| r-cran-taxize/ | 2024-10-31 22:17 | - | |
| r-cran-gganimate/ | 2024-10-31 22:17 | - | |
| r-cran-fitdistrplus/ | 2024-10-31 22:17 | - | |
| r-cran-fpc/ | 2024-10-31 22:17 | - | |
| r-cran-epir/ | 2024-10-31 22:17 | - | |
| r-cran-fastdummies/ | 2024-10-31 22:17 | - | |
| r-cran-startupmsg/ | 2024-10-31 22:17 | - | |
| r-cran-emmeans/ | 2024-10-31 22:17 | - | |
| r-cran-evaluate/ | 2024-10-31 22:17 | - | |
| r-cran-stabledist/ | 2024-10-31 22:17 | - | |
| r-cran-downlit/ | 2024-10-31 22:17 | - | |
| r-cran-spelling/ | 2024-10-31 22:17 | - | |
| r-cran-doby/ | 2024-10-31 22:17 | - | |
| r-cran-deriv/ | 2024-10-31 22:17 | - | |
| r-cran-dendextend/ | 2024-10-31 22:17 | - | |
| r-cran-dbplyr/ | 2024-10-31 22:17 | - | |
| r-cran-crul/ | 2024-10-31 22:17 | - | |
| r-cran-cpp11/ | 2024-10-31 22:17 | - | |
| r-cran-credentials/ | 2024-10-31 22:17 | - | |
| r-cran-corrplot/ | 2024-10-31 22:17 | - | |
| rhash/ | 2024-10-31 22:30 | - | |
| r-cran-future/ | 2024-10-31 23:48 | - | |
| request-tracker5/ | 2024-11-01 01:05 | - | |
| rachiopy/ | 2024-11-01 01:05 | - | |
| rpi-bad-power/ | 2024-11-01 01:05 | - | |
| radiotherm/ | 2024-11-01 01:05 | - | |
| routine-update/ | 2024-11-01 01:05 | - | |
| rsshfs/ | 2024-11-01 01:05 | - | |
| ruuvitag-ble/ | 2024-11-01 01:05 | - | |
| rust-smtp-proto/ | 2024-11-01 01:05 | - | |
| rust-serde-qs/ | 2024-11-01 01:05 | - | |
| rust-hashbag/ | 2024-11-01 01:05 | - | |
| rails/ | 2024-11-01 02:52 | - | |
| rows/ | 2024-11-01 02:52 | - | |
| roct-thunk-interface/ | 2024-11-01 02:53 | - | |
| rocm-hipamd/ | 2024-11-01 02:53 | - | |
| rocdbgapi/ | 2024-11-01 02:53 | - | |
| rust-rustls/ | 2024-11-01 05:32 | - | |
| r-cran-spatstat.data/ | 2024-11-01 05:32 | - | |
| rust-clio/ | 2024-11-01 05:32 | - | |
| ruby-faraday-typhoeus/ | 2024-11-01 05:32 | - | |
| ruby-omniauth-saml/ | 2024-11-01 05:33 | - | |
| r-cran-timeseries/ | 2024-11-01 05:33 | - | |
| r-cran-httr2/ | 2024-11-01 05:33 | - | |
| r-cran-datawizard/ | 2024-11-01 05:33 | - | |
| r-cran-bookdown/ | 2024-11-01 05:33 | - | |
| rocrand/ | 2024-11-01 05:35 | - | |
| r-cran-shiny/ | 2024-11-01 09:37 | - | |
| ruby-typhoeus/ | 2024-11-01 09:37 | - | |
| ruby-rspec-parameterized-table-syntax/ | 2024-11-01 11:14 | - | |
| ruby-deb-version/ | 2024-11-01 11:14 | - | |
| regenmaschine/ | 2024-11-01 11:14 | - | |
| rust-docmatic/ | 2024-11-01 12:41 | - | |
| rust-dirty-tracker/ | 2024-11-01 12:41 | - | |
| rust-diffutils/ | 2024-11-01 12:41 | - | |
| rust-fmt2io/ | 2024-11-01 14:00 | - | |
| rust-flate2/ | 2024-11-01 14:00 | - | |
| rust-fips203/ | 2024-11-01 14:00 | - | |
| rust-fernet/ | 2024-11-01 14:00 | - | |
| rust-fastrand/ | 2024-11-01 14:00 | - | |
| rust-fake-instant/ | 2024-11-01 14:00 | - | |
| rust-expectrl/ | 2024-11-01 14:00 | - | |
| rust-euclid/ | 2024-11-01 14:00 | - | |
| rocr-runtime/ | 2024-11-01 15:19 | - | |
| rust-diesel/ | 2024-11-01 15:19 | - | |
| rust-gio/ | 2024-11-01 15:20 | - | |
| rust-futures-task/ | 2024-11-01 15:20 | - | |
| rust-futures-sink/ | 2024-11-01 15:20 | - | |
| rust-futures-macro/ | 2024-11-01 15:20 | - | |
| rust-futures-io/ | 2024-11-01 15:20 | - | |
| rust-findutils/ | 2024-11-01 15:20 | - | |
| rust-futures-core/ | 2024-11-01 15:20 | - | |
| rust-nu-ansi-term/ | 2024-11-01 17:36 | - | |
| rust-mio-extras/ | 2024-11-01 17:36 | - | |
| rust-maxminddb/ | 2024-11-01 17:36 | - | |
| rust-memchr/ | 2024-11-01 17:36 | - | |
| rust-platform-info/ | 2024-11-01 17:36 | - | |
| rust-lyon-geom/ | 2024-11-01 17:36 | - | |
| rust-lv2-worker/ | 2024-11-01 17:36 | - | |
| rust-lv2-sys/ | 2024-11-01 17:36 | - | |
| rust-linux-raw-sys/ | 2024-11-01 17:36 | - | |
| rsstail/ | 2024-11-01 17:36 | - | |
| rust-lock-api/ | 2024-11-01 17:36 | - | |
| rsskit/ | 2024-11-01 17:36 | - | |
| rust-librsvg-rebind-sys/ | 2024-11-01 17:36 | - | |
| rust-libspa/ | 2024-11-01 17:36 | - | |
| rust-libz-sys/ | 2024-11-01 17:36 | - | |
| rust-picky-asn1-x509/ | 2024-11-01 17:36 | - | |
| rust-libm/ | 2024-11-01 17:36 | - | |
| rust-libdbus-sys/ | 2024-11-01 17:36 | - | |
| rl-renderpm/ | 2024-11-01 17:36 | - | |
| rust-k256/ | 2024-11-01 17:36 | - | |
| rust-lazy-static/ | 2024-11-01 17:36 | - | |
| rl-accel/ | 2024-11-01 17:36 | - | |
| rust-jemalloc-sys/ | 2024-11-01 17:36 | - | |
| rakudo/ | 2024-11-01 17:36 | - | |
| rust-itertools-num/ | 2024-11-01 17:36 | - | |
| rust-itertools/ | 2024-11-01 17:36 | - | |
| rust-imara-diff/ | 2024-11-01 17:36 | - | |
| rust-indefinite/ | 2024-11-01 17:36 | - | |
| resolv-wrapper/ | 2024-11-01 17:36 | - | |
| rust-imagesize/ | 2024-11-01 17:36 | - | |
| rust-gtk4-sys/ | 2024-11-01 17:36 | - | |
| rust-home/ | 2024-11-01 17:36 | - | |
| rust-gsk4-sys/ | 2024-11-01 17:36 | - | |
| rust-heed-traits/ | 2024-11-01 17:36 | - | |
| rauc/ | 2024-11-01 17:36 | - | |
| rust-half/ | 2024-11-01 17:36 | - | |
| rust-grep-searcher/ | 2024-11-01 17:36 | - | |
| rust-gtk4-macros/ | 2024-11-01 17:36 | - | |
| rust-grep-regex/ | 2024-11-01 17:36 | - | |
| rust-grep-pcre2/ | 2024-11-01 17:36 | - | |
| rust-graphene-sys/ | 2024-11-01 17:36 | - | |
| rasdaemon/ | 2024-11-01 17:36 | - | |
| rust-graphene-rs/ | 2024-11-01 17:36 | - | |
| rust-pcap/ | 2024-11-01 17:36 | - | |
| randtype/ | 2024-11-01 17:36 | - | |
| reglookup/ | 2024-11-01 17:36 | - | |
| rust-globset/ | 2024-11-01 17:36 | - | |
| redshift-qt/ | 2024-11-01 17:36 | - | |
| redict/ | 2024-11-01 17:36 | - | |
| rust-paste/ | 2024-11-01 17:36 | - | |
| rust-pasetors/ | 2024-11-01 17:36 | - | |
| rust-gix-sec/ | 2024-11-01 17:36 | - | |
| radeontool/ | 2024-11-01 17:36 | - | |
| razercfg/ | 2024-11-01 17:36 | - | |
| rust-os-info/ | 2024-11-01 17:36 | - | |
| rust-gix-features/ | 2024-11-01 17:36 | - | |
| rust-gix-date/ | 2024-11-01 17:36 | - | |
| rust-gix-config-value/ | 2024-11-01 17:36 | - | |
| rust-gix-command/ | 2024-11-01 17:36 | - | |
| rust-sqlformat/ | 2024-11-01 19:05 | - | |
| rust-snapbox-macros/ | 2024-11-01 19:05 | - | |
| rust-slog/ | 2024-11-01 19:05 | - | |
| rust-smawk/ | 2024-11-01 19:05 | - | |
| rust-slotmap/ | 2024-11-01 19:05 | - | |
| rust-slice-ring-buffer/ | 2024-11-01 19:05 | - | |
| rust-serde-with-macros/ | 2024-11-01 19:05 | - | |
| rust-shrinkwraprs/ | 2024-11-01 19:05 | - | |
| rust-serde-ignored/ | 2024-11-01 19:05 | - | |
| rust-derive-getters/ | 2024-11-01 19:05 | - | |
| rust-datasize-derive/ | 2024-11-01 19:05 | - | |
| rust-crates-io/ | 2024-11-01 19:05 | - | |
| rust-critical-section/ | 2024-11-01 19:05 | - | |
| rust-crc-catalog/ | 2024-11-01 19:05 | - | |
| rust-cookie/ | 2024-11-01 19:05 | - | |
| rust-concat-string/ | 2024-11-01 19:05 | - | |
| rust-clang-sys/ | 2024-11-01 19:05 | - | |
| rust-compact-str/ | 2024-11-01 19:05 | - | |
| rust-cfg-aliases/ | 2024-11-01 19:05 | - | |
| rust-calloop/ | 2024-11-01 19:05 | - | |
| rust-bk-tree/ | 2024-11-01 19:05 | - | |
| rust-bigdecimal/ | 2024-11-01 19:05 | - | |
| ruby-gnome/ | 2024-11-01 19:05 | - | |
| rust-semver/ | 2024-11-01 19:05 | - | |
| rust-scrawl/ | 2024-11-01 19:05 | - | |
| rust-base64ct/ | 2024-11-01 19:05 | - | |
| rust-base64/ | 2024-11-01 19:05 | - | |
| rust-schemars-derive/ | 2024-11-01 19:05 | - | |
| rust-async-signal/ | 2024-11-01 19:05 | - | |
| rust-async-trait/ | 2024-11-01 19:05 | - | |
| rust-async-compression/ | 2024-11-01 19:05 | - | |
| rust-arc-swap/ | 2024-11-01 19:05 | - | |
| rust-ascii-table/ | 2024-11-01 19:05 | - | |
| rust-apr/ | 2024-11-01 19:05 | - | |
| rust-rustls-pemfile/ | 2024-11-01 19:05 | - | |
| rust-approx/ | 2024-11-01 19:05 | - | |
| rust-rustfix/ | 2024-11-01 19:05 | - | |
| rush/ | 2024-11-01 19:05 | - | |
| rust-anstream/ | 2024-11-01 19:05 | - | |
| rust-ripcalc/ | 2024-11-01 19:05 | - | |
| rust-annotate-snippets/ | 2024-11-01 19:05 | - | |
| rust-rhai/ | 2024-11-01 19:05 | - | |
| rust-aho-corasick/ | 2024-11-01 19:05 | - | |
| rust-ring/ | 2024-11-01 19:05 | - | |
| rust-aead/ | 2024-11-01 19:05 | - | |
| rust-rfc2047-decoder/ | 2024-11-01 19:05 | - | |
| ruby-sqlite3/ | 2024-11-01 19:05 | - | |
| ruby-stackprof/ | 2024-11-01 19:05 | - | |
| rust-rfc822-like/ | 2024-11-01 19:05 | - | |
| rsbackup/ | 2024-11-01 19:05 | - | |
| ruby-redcloth/ | 2024-11-01 19:05 | - | |
| rust-ptyprocess/ | 2024-11-01 19:05 | - | |
| rust-protoc/ | 2024-11-01 19:05 | - | |
| ruby-oily-png/ | 2024-11-01 19:05 | - | |
| rust-prometheus/ | 2024-11-01 19:05 | - | |
| ruby-liquid-c/ | 2024-11-01 19:05 | - | |
| rust-privdrop/ | 2024-11-01 19:05 | - | |
| rust-primal-slowsieve/ | 2024-11-01 19:05 | - | |
| rust-open/ | 2024-11-01 19:05 | - | |
| rust-primal-sieve/ | 2024-11-01 19:05 | - | |
| rust-once-cell/ | 2024-11-01 19:05 | - | |
| rust-ocb3/ | 2024-11-01 19:05 | - | |
| rust-primal/ | 2024-11-01 19:05 | - | |
| rust-num-rational/ | 2024-11-01 19:05 | - | |
| rna-star/ | 2024-11-01 19:05 | - | |
| rust-num-threads/ | 2024-11-01 19:05 | - | |
| rocminfo/ | 2024-11-01 20:17 | - | |
| rust-zvariant-utils/ | 2024-11-01 20:18 | - | |
| rust-xmlparser/ | 2024-11-01 20:18 | - | |
| rust-xdg-home/ | 2024-11-01 20:18 | - | |
| rust-whoami/ | 2024-11-01 20:18 | - | |
| rust-which/ | 2024-11-01 20:18 | - | |
| rust-wayland-commons/ | 2024-11-01 20:18 | - | |
| rust-uom/ | 2024-11-01 20:18 | - | |
| rust-tss-esapi/ | 2024-11-01 20:18 | - | |
| rust-url/ | 2024-11-01 20:18 | - | |
| rust-unicode-ident/ | 2024-11-01 20:18 | - | |
| rust-trybuild2/ | 2024-11-01 20:18 | - | |
| rust-typed-arena/ | 2024-11-01 20:18 | - | |
| rust-symphonia-core/ | 2024-11-01 20:18 | - | |
| rust-svg-metadata/ | 2024-11-01 20:18 | - | |
| rust-svgtypes/ | 2024-11-01 20:18 | - | |
| rust-swayipc-types/ | 2024-11-01 20:18 | - | |
| rust-char-reader/ | 2024-11-01 21:22 | - | |
| rust-cairo-sys-rs-0.18/ | 2024-11-01 21:22 | - | |
| rust-fontconfig-parser/ | 2024-11-01 23:14 | - | |
| rust-flex-grow/ | 2024-11-01 23:14 | - | |
| rust-escape8259/ | 2024-11-01 23:14 | - | |
| rust-displaydoc/ | 2024-11-01 23:14 | - | |
| rust-display-error-chain/ | 2024-11-01 23:14 | - | |
| rust-derive-more-impl/ | 2024-11-01 23:14 | - | |
| rust-derive-destructure2/ | 2024-11-01 23:14 | - | |
| rust-deltae/ | 2024-11-01 23:14 | - | |
| rust-deb822-derive/ | 2024-11-01 23:14 | - | |
| rust-dary-heap/ | 2024-11-01 23:14 | - | |
| rust-custom-error/ | 2024-11-01 23:14 | - | |
| rust-cursive-macros/ | 2024-11-01 23:14 | - | |
| rust-crc32c/ | 2024-11-01 23:14 | - | |
| rust-counter/ | 2024-11-01 23:14 | - | |
| rust-cobs/ | 2024-11-01 23:14 | - | |
| rust-vtparse/ | 2024-11-02 00:28 | - | |
| rust-vec-strings/ | 2024-11-02 00:28 | - | |
| rust-unicode-ccc/ | 2024-11-02 00:28 | - | |
| rust-unicode-bidi-mirroring/ | 2024-11-02 00:28 | - | |
| rust-transpose/ | 2024-11-02 00:28 | - | |
| rust-typeid/ | 2024-11-02 00:28 | - | |
| rust-text-trees/ | 2024-11-02 00:28 | - | |
| rust-toml-span/ | 2024-11-02 00:28 | - | |
| rust-splitty/ | 2024-11-02 00:28 | - | |
| rust-simple-moving-average/ | 2024-11-02 00:28 | - | |
| rust-secstr/ | 2024-11-02 00:28 | - | |
| rust-sorted-iter/ | 2024-11-02 00:28 | - | |
| rust-secular/ | 2024-11-02 00:28 | - | |
| rust-search-path/ | 2024-11-02 00:28 | - | |
| rust-rasciigraph/ | 2024-11-02 00:28 | - | |
| rust-roots/ | 2024-11-02 00:28 | - | |
| rust-process-control/ | 2024-11-02 00:28 | - | |
| rust-pretty/ | 2024-11-02 00:28 | - | |
| rust-pnet-datalink/ | 2024-11-02 00:28 | - | |
| rust-patiencediff/ | 2024-11-02 00:28 | - | |
| rust-obey/ | 2024-11-02 00:28 | - | |
| rust-num-conv/ | 2024-11-02 00:28 | - | |
| rust-murmurhash3/ | 2024-11-02 00:28 | - | |
| rust-memmem/ | 2024-11-02 00:28 | - | |
| rust-liblzma-sys/ | 2024-11-02 00:28 | - | |
| rust-leb128/ | 2024-11-02 00:28 | - | |
| rust-input-event-codes/ | 2024-11-02 00:28 | - | |
| rust-git-state/ | 2024-11-02 00:28 | - | |
| rust-getch/ | 2024-11-02 00:28 | - | |
| ruby3.1/ | 2024-11-02 03:01 | - | |
| ruby-rbtrace/ | 2024-11-02 03:02 | - | |
| rust-base16/ | 2024-11-02 03:02 | - | |
| rust-az/ | 2024-11-02 03:02 | - | |
| rust-aes-kw/ | 2024-11-02 03:02 | - | |
| rust-awaitable-error/ | 2024-11-02 03:02 | - | |
| readsb/ | 2024-11-02 03:02 | - | |
| rust-anstyle-lossy/ | 2024-11-02 03:02 | - | |
| rust-ansi-escapes/ | 2024-11-02 03:02 | - | |
| rust-zune-inflate/ | 2024-11-02 03:02 | - | |
| rust-wezterm-dynamic-derive/ | 2024-11-02 03:02 | - | |
| r-cran-withr/ | 2024-11-02 05:41 | - | |
| rust-wasm-encoder/ | 2024-11-02 07:16 | - | |
| rust-wasm-bindgen-test-macro/ | 2024-11-02 07:16 | - | |
| raku-json-optin/ | 2024-11-02 08:17 | - | |
| rlinetd/ | 2024-11-02 10:22 | - | |
| rust-ordered-float/ | 2024-11-02 11:27 | - | |
| rust-pdf-derive/ | 2024-11-02 11:27 | - | |
| rust-syn/ | 2024-11-02 11:41 | - | |
| rpyc/ | 2024-11-02 14:14 | - | |
| raku-uri/ | 2024-11-02 14:15 | - | |
| rust-unicode-width/ | 2024-11-02 15:22 | - | |
| rust-test-case/ | 2024-11-02 15:22 | - | |
| rust-parking-lot-core/ | 2024-11-02 15:23 | - | |
| rust-mockall-derive/ | 2024-11-02 15:23 | - | |
| rust-gix-macros/ | 2024-11-02 15:23 | - | |
| rust-fips203-ffi/ | 2024-11-02 16:22 | - | |
| rust-futures-util/ | 2024-11-02 16:22 | - | |
| rust-futures-channel/ | 2024-11-02 16:22 | - | |
| rust-embed-doc-image/ | 2024-11-02 16:22 | - | |
| rust-dbus/ | 2024-11-02 16:22 | - | |
| rust-datasize/ | 2024-11-02 16:22 | - | |
| rust-crc/ | 2024-11-02 16:22 | - | |
| rust-charset/ | 2024-11-02 16:22 | - | |
| rust-chic/ | 2024-11-02 16:22 | - | |
| rust-buffered-reader/ | 2024-11-02 16:22 | - | |
| raku-json-name/ | 2024-11-02 16:22 | - | |
| rust-parking-lot/ | 2024-11-02 17:45 | - | |
| rust-pem/ | 2024-11-02 17:45 | - | |
| rust-openssh-keys/ | 2024-11-02 17:45 | - | |
| rust-lyon-path/ | 2024-11-02 17:45 | - | |
| rust-headers/ | 2024-11-02 17:45 | - | |
| rawtherapee/ | 2024-11-02 17:46 | - | |
| rust-libp2p-identity/ | 2024-11-04 04:06 | - | |
| ruby-moneta/ | 2024-11-04 04:06 | - | |
| rust-tree-sitter-cli/ | 2024-11-04 04:09 | - | |
| rust-pikchr/ | 2024-11-04 04:09 | - | |
| rust-ron/ | 2024-11-04 04:09 | - | |
| rust-resource-proof/ | 2024-11-04 04:09 | - | |
| rust-openpgp-cert-d/ | 2024-11-04 04:09 | - | |
| rust-ignore/ | 2024-11-04 04:09 | - | |
| rust-pprof/ | 2024-11-04 04:09 | - | |
| rust-procfs/ | 2024-11-04 04:09 | - | |
| rust-postgres-protocol/ | 2024-11-04 04:09 | - | |
| rust-gix-prompt/ | 2024-11-04 04:09 | - | |
| rust-malachite-base/ | 2024-11-04 04:09 | - | |
| rust-mockall/ | 2024-11-04 04:09 | - | |
| rust-http-auth/ | 2024-11-04 04:09 | - | |
| rust-heed-types/ | 2024-11-04 04:09 | - | |
| rust-grep-cli/ | 2024-11-04 04:09 | - | |
| rust-ciborium-ll/ | 2024-11-04 04:09 | - | |
| rust-grep-printer/ | 2024-11-04 04:09 | - | |
| rust-libtest-mimic/ | 2024-11-04 04:09 | - | |
| rust-glutin/ | 2024-11-04 04:09 | - | |
| rust-gix-actor/ | 2024-11-04 04:09 | - | |
| rust-compiletest-rs/ | 2024-11-04 04:09 | - | |
| rust-ansi-parser/ | 2024-11-04 04:09 | - | |
| rust-cargo-util/ | 2024-11-04 04:09 | - | |
| rust-bson/ | 2024-11-04 04:09 | - | |
| rust-cargo-options/ | 2024-11-04 04:09 | - | |
| rust-condure/ | 2024-11-04 04:09 | - | |
| rust-alacritty-terminal/ | 2024-11-04 04:09 | - | |
| rust-cargo-lichking/ | 2024-11-04 04:09 | - | |
| rust-cargo-credential-libsecret/ | 2024-11-04 04:09 | - | |
| rsass/ | 2024-11-04 04:09 | - | |
| rust-derive-more/ | 2024-11-04 04:09 | - | |
| rust-serde-with/ | 2024-11-04 04:11 | - | |
| rust-python-pkginfo/ | 2024-11-04 04:11 | - | |
| rust-sequoia-directories/ | 2024-11-04 04:11 | - | |
| rust-reqwest/ | 2024-11-04 04:11 | - | |
| rust-rustix/ | 2024-11-04 04:11 | - | |
| rust-trash/ | 2024-11-04 04:11 | - | |
| rust-zvariant-derive/ | 2024-11-04 04:11 | - | |
| rust-sshkeys/ | 2024-11-04 04:11 | - | |
| rust-winit/ | 2024-11-04 04:11 | - | |
| rust-sqlx-core/ | 2024-11-04 04:12 | - | |
| rust-tower-http/ | 2024-11-04 04:12 | - | |
| rust-serde-untagged/ | 2024-11-04 04:12 | - | |
| rust-time/ | 2024-11-04 04:12 | - | |
| rust-speakersafetyd/ | 2024-11-04 04:12 | - | |
| rust-rusty-paseto/ | 2024-11-04 04:12 | - | |
| rust-zbus-macros/ | 2024-11-04 04:12 | - | |
| rust-sequoia-openpgp/ | 2024-11-04 04:12 | - | |
| rust-starship-battery/ | 2024-11-04 04:12 | - | |
| rust-serde-cbor/ | 2024-11-04 04:12 | - | |
| rust-regalloc2/ | 2024-11-04 04:12 | - | |
| rust-snapbox/ | 2024-11-04 04:12 | - | |
| rust-schemars/ | 2024-11-04 04:12 | - | |
| rust-wasmparser/ | 2024-11-04 04:12 | - | |
| rust-triomphe/ | 2024-11-04 04:12 | - | |
| rust-nix/ | 2024-11-04 04:12 | - | |
| rust-archery/ | 2024-11-04 04:12 | - | |
| rust-cradle/ | 2024-11-04 04:12 | - | |
| rust-psl/ | 2024-11-04 04:12 | - | |
| rust-yansi/ | 2024-11-04 04:12 | - | |
| rust-futures-executor/ | 2024-11-04 04:12 | - | |
| rtl-433/ | 2024-11-04 10:09 | - | |
| ruby-ipaddress/ | 2024-11-04 10:49 | - | |
| ros-bloom/ | 2024-11-04 10:49 | - | |
| resampy/ | 2024-11-04 10:49 | - | |
| rust-mio/ | 2024-11-04 16:03 | - | |
| rust-io-lifetimes/ | 2024-11-04 16:03 | - | |
| resfinder/ | 2024-11-05 04:18 | - | |
| rust-zxcvbn/ | 2024-11-05 10:49 | - | |
| rust-rustfft/ | 2024-11-05 10:49 | - | |
| rust-curve25519-dalek/ | 2024-11-05 10:49 | - | |
| ruby-timecop/ | 2024-11-05 10:49 | - | |
| r-cran-survey/ | 2024-11-05 10:49 | - | |
| r-cran-backports/ | 2024-11-05 10:49 | - | |
| ruby-necromancer/ | 2024-11-05 13:32 | - | |
| rust-thiserror-impl/ | 2024-11-05 16:23 | - | |
| rust-xkbcommon/ | 2024-11-05 16:23 | - | |
| rust-rockfile/ | 2024-11-05 16:23 | - | |
| rust-xattr/ | 2024-11-05 16:23 | - | |
| rust-syn-derive/ | 2024-11-05 18:31 | - | |
| rust-reword/ | 2024-11-05 18:32 | - | |
| rust-directories-next/ | 2024-11-05 18:32 | - | |
| rust-jiff-tzdb/ | 2024-11-05 18:32 | - | |
| rust-crossterm/ | 2024-11-05 22:52 | - | |
| r-cran-gtable/ | 2024-11-06 01:34 | - | |
| rust-pretty-assertions/ | 2024-11-06 01:35 | - | |
| rust-nutmeg/ | 2024-11-06 01:35 | - | |
| rust-input-linux-sys/ | 2024-11-06 01:35 | - | |
| rust-command-group/ | 2024-11-06 01:35 | - | |
| rust-ctrlc/ | 2024-11-06 01:35 | - | |
| rust-futures-timer/ | 2024-11-06 03:26 | - | |
| rust-criterion/ | 2024-11-06 03:26 | - | |
| rust-vsock/ | 2024-11-06 03:26 | - | |
| rust-rustyline/ | 2024-11-06 03:26 | - | |
| rust-wycheproof/ | 2024-11-06 05:53 | - | |
| r-base/ | 2024-11-06 05:53 | - | |
| rust-zvariant/ | 2024-11-06 05:53 | - | |
| rust-shadow-rs/ | 2024-11-06 05:53 | - | |
| rust-tempfile/ | 2024-11-06 05:53 | - | |
| rust-gsk4/ | 2024-11-06 05:53 | - | |
| rust-grep/ | 2024-11-06 05:53 | - | |
| rust-git2-curl/ | 2024-11-06 05:53 | - | |
| rust-futures-test/ | 2024-11-06 05:53 | - | |
| rust-yamux/ | 2024-11-06 07:18 | - | |
| rust-async-fn-stream/ | 2024-11-06 07:18 | - | |
| rust-bet/ | 2024-11-06 07:19 | - | |
| rust-thiserror/ | 2024-11-06 07:19 | - | |
| r-cran-ks/ | 2024-11-06 09:01 | - | |
| r-cran-lamw/ | 2024-11-06 09:01 | - | |
| rust-input-linux/ | 2024-11-06 10:53 | - | |
| rust-glib-sys-0.18/ | 2024-11-06 10:56 | - | |
| rust-adblock/ | 2024-11-06 12:06 | - | |
| r-cran-locfit/ | 2024-11-06 18:41 | - | |
| r-cran-reticulate/ | 2024-11-06 18:41 | - | |
| r-cran-rcppeigen/ | 2024-11-06 18:41 | - | |
| r-cran-openxlsx/ | 2024-11-06 18:41 | - | |
| r-cran-nanotime/ | 2024-11-06 18:41 | - | |
| r-cran-rcurl/ | 2024-11-06 18:41 | - | |
| r-cran-pcapp/ | 2024-11-06 18:41 | - | |
| r-cran-pdftools/ | 2024-11-06 18:41 | - | |
| r-cran-party/ | 2024-11-06 18:41 | - | |
| r-cran-nmf/ | 2024-11-06 18:41 | - | |
| r-cran-poissonbinomial/ | 2024-11-06 18:41 | - | |
| r-cran-ordinal/ | 2024-11-06 18:41 | - | |
| r-cran-partykit/ | 2024-11-06 18:41 | - | |
| r-cran-memisc/ | 2024-11-06 18:41 | - | |
| r-cran-msm/ | 2024-11-06 18:41 | - | |
| r-cran-minqa/ | 2024-11-06 18:41 | - | |
| r-cran-openmx/ | 2024-11-06 22:36 | - | |
| rust-async-native-tls/ | 2024-11-06 22:36 | - | |
| rust-openssh-sftp-protocol-error/ | 2024-11-06 22:36 | - | |
| rust-jiff-tzdb-platform/ | 2024-11-06 22:36 | - | |
| rmatrix/ | 2024-11-06 22:36 | - | |
| r-cran-stringi/ | 2024-11-06 22:36 | - | |
| r-cran-cli/ | 2024-11-06 22:36 | - | |
| r-cran-s2/ | 2024-11-06 22:36 | - | |
| r-cran-rann/ | 2024-11-06 22:36 | - | |
| r-cran-randomforest/ | 2024-11-06 22:36 | - | |
| r-cran-spc/ | 2024-11-06 22:36 | - | |
| r-cran-parmigene/ | 2024-11-06 22:36 | - | |
| r-cran-rbibutils/ | 2024-11-06 22:36 | - | |
| r-cran-nnls/ | 2024-11-06 22:36 | - | |
| r-cran-vgam/ | 2024-11-06 22:36 | - | |
| r-cran-ps/ | 2024-11-06 22:36 | - | |
| r-cran-microbenchmark/ | 2024-11-06 22:36 | - | |
| r-cran-maldiquant/ | 2024-11-06 22:36 | - | |
| r-cran-mclust/ | 2024-11-06 22:36 | - | |
| r-cran-polyclip/ | 2024-11-06 22:36 | - | |
| r-cran-suppdists/ | 2024-11-06 22:36 | - | |
| r-cran-parallelly/ | 2024-11-06 22:36 | - | |
| r-cran-ncdf4/ | 2024-11-06 22:36 | - | |
| r-cran-rjson/ | 2024-11-06 22:36 | - | |
| r-cran-matrixstats/ | 2024-11-06 22:36 | - | |
| r-cran-fnn/ | 2024-11-06 22:36 | - | |
| r-cran-wk/ | 2024-11-06 22:36 | - | |
| r-cran-jsonlite/ | 2024-11-06 22:36 | - | |
| r-cran-timedate/ | 2024-11-06 22:36 | - | |
| r-cran-intervals/ | 2024-11-06 22:36 | - | |
| r-cran-gss/ | 2024-11-06 22:36 | - | |
| r-cran-quickjsr/ | 2024-11-06 22:36 | - | |
| r-cran-yaml/ | 2024-11-06 22:36 | - | |
| r-cran-git2r/ | 2024-11-06 22:36 | - | |
| r-cran-admisc/ | 2024-11-06 22:36 | - | |
| r-cran-qtl/ | 2024-11-06 22:36 | - | |
| r-cran-evd/ | 2024-11-06 22:36 | - | |
| r-cran-sys/ | 2024-11-06 22:36 | - | |
| rcpp/ | 2024-11-06 22:36 | - | |
| r-cran-fftw/ | 2024-11-06 22:36 | - | |
| r-cran-fdrtool/ | 2024-11-06 22:36 | - | |
| r-cran-rgenoud/ | 2024-11-06 22:36 | - | |
| r-cran-spatstat.utils/ | 2024-11-06 22:36 | - | |
| r-cran-data.table/ | 2024-11-06 22:36 | - | |
| r-cran-tmb/ | 2024-11-06 22:36 | - | |
| r-cran-digest/ | 2024-11-06 22:36 | - | |
| r-cran-emoa/ | 2024-11-06 22:36 | - | |
| r-cran-fastmap/ | 2024-11-06 22:36 | - | |
| r-cran-bitops/ | 2024-11-06 22:36 | - | |
| r-cran-oaqc/ | 2024-11-06 22:36 | - | |
| r-cran-curl/ | 2024-11-06 22:36 | - | |
| r-cran-diptest/ | 2024-11-06 22:36 | - | |
| r-cran-uwot/ | 2024-11-06 22:36 | - | |
| r-cran-hdf5r/ | 2024-11-06 22:36 | - | |
| r-cran-colorspace/ | 2024-11-06 22:36 | - | |
| r-cran-amap/ | 2024-11-06 22:36 | - | |
| r-cran-graphlayouts/ | 2024-11-06 22:36 | - | |
| r-cran-v8/ | 2024-11-06 22:36 | - | |
| r-cran-xts/ | 2024-11-06 22:36 | - | |
| r-cran-vegan/ | 2024-11-06 22:36 | - | |
| r-cran-tm/ | 2024-11-06 22:36 | - | |
| robustbase/ | 2024-11-06 22:36 | - | |
| r-cran-hunspell/ | 2024-11-06 22:36 | - | |
| rmysql/ | 2024-11-06 22:36 | - | |
| r-cran-webutils/ | 2024-11-06 22:36 | - | |
| r-cran-gstat/ | 2024-11-06 22:36 | - | |
| r-cran-ggraph/ | 2024-11-06 22:36 | - | |
| r-cran-tgp/ | 2024-11-06 22:36 | - | |
| r-cran-writexl/ | 2024-11-06 22:36 | - | |
| r-cran-xslt/ | 2024-11-06 22:36 | - | |
| r-cran-tidygraph/ | 2024-11-06 22:36 | - | |
| r-cran-clock/ | 2024-11-06 22:36 | - | |
| r-cran-geepack/ | 2024-11-06 22:36 | - | |
| r-cran-gert/ | 2024-11-06 22:36 | - | |
| r-cran-collapse/ | 2024-11-06 22:36 | - | |
| r-cran-gdtools/ | 2024-11-06 22:36 | - | |
| r-cran-sf/ | 2024-11-06 22:36 | - | |
| r-cran-geometry/ | 2024-11-06 22:36 | - | |
| r-cran-genieclust/ | 2024-11-06 22:36 | - | |
| r-cran-ff/ | 2024-11-06 22:36 | - | |
| r-cran-stanheaders/ | 2024-11-06 22:36 | - | |
| r-cran-gam/ | 2024-11-06 22:36 | - | |
| r-cran-fields/ | 2024-11-06 22:36 | - | |
| r-cran-dbscan/ | 2024-11-06 22:36 | - | |
| r-cran-ddalpha/ | 2024-11-06 22:36 | - | |
| r-cran-filehash/ | 2024-11-06 22:36 | - | |
| r-cran-expm/ | 2024-11-06 22:36 | - | |
| r-cran-energy/ | 2024-11-06 22:36 | - | |
| r-cran-epi/ | 2024-11-06 22:36 | - | |
| r-cran-eaf/ | 2024-11-06 22:36 | - | |
| r-bioc-edger/ | 2024-11-06 22:36 | - | |
| r-cran-rspectra/ | 2024-11-06 22:36 | - | |
| r-cran-ragg/ | 2024-11-06 22:36 | - | |
| r-cran-e1071/ | 2024-11-06 22:36 | - | |
| r-cran-dosefinding/ | 2024-11-06 22:36 | - | |
| r-cran-distr/ | 2024-11-06 22:36 | - | |
| r-cran-bdgraph/ | 2024-11-06 22:36 | - | |
| r-cran-spam/ | 2024-11-06 22:36 | - | |
| r-cran-sp/ | 2024-11-06 22:36 | - | |
| r-cran-apcluster/ | 2024-11-06 22:36 | - | |
| r-cran-checkmate/ | 2024-11-06 22:36 | - | |
| r-cran-cba/ | 2024-11-06 22:36 | - | |
| r-cran-sna/ | 2024-11-06 22:36 | - | |
| r-cran-raster/ | 2024-11-06 22:36 | - | |
| r-bioc-limma/ | 2024-11-06 22:36 | - | |
| r-bioc-rhdf5/ | 2024-11-06 22:36 | - | |
| r-bioc-genomicranges/ | 2024-11-06 22:36 | - | |
| r-cran-seriation/ | 2024-11-06 22:36 | - | |
| r-cran-askpass/ | 2024-11-06 22:36 | - | |
| r-cran-sem/ | 2024-11-06 22:36 | - | |
| r-cran-rrcov/ | 2024-11-06 22:36 | - | |
| r-cran-robust/ | 2024-11-06 22:36 | - | |
| r-cran-rpostgresql/ | 2024-11-06 22:36 | - | |
| r-cran-lhs/ | 2024-11-06 22:36 | - | |
| r-cran-rjags/ | 2024-11-06 22:36 | - | |
| rust-sixel-tokenizer/ | 2024-11-06 23:28 | - | |
| rust-num-prime/ | 2024-11-07 04:58 | - | |
| r-cran-xfun/ | 2024-11-07 04:58 | - | |
| rust-tokio-socks/ | 2024-11-07 05:40 | - | |
| rust-versions/ | 2024-11-07 05:40 | - | |
| rust-gix-mailmap/ | 2024-11-07 05:40 | - | |
| rust-gobject-sys-0.18/ | 2024-11-07 05:41 | - | |
| rust-histogram/ | 2024-11-07 07:45 | - | |
| rust-zopfli/ | 2024-11-07 07:45 | - | |
| rust-edit/ | 2024-11-07 07:45 | - | |
| rust-wezterm-blob-leases/ | 2024-11-07 07:45 | - | |
| rust-smol-timeout2/ | 2024-11-07 07:45 | - | |
| rust-serde-norway/ | 2024-11-07 07:45 | - | |
| rust-pest-vm/ | 2024-11-07 07:45 | - | |
| rust-ofiles/ | 2024-11-07 07:45 | - | |
| rust-minus/ | 2024-11-07 07:45 | - | |
| rust-gtk3-macros-0.18/ | 2024-11-07 07:45 | - | |
| rust-gloo-timers/ | 2024-11-07 07:45 | - | |
| rust-glib-macros-0.18/ | 2024-11-07 07:45 | - | |
| rust-env-filter/ | 2024-11-07 07:45 | - | |
| rust-confy/ | 2024-11-07 07:45 | - | |
| rust-codepage-437/ | 2024-11-07 07:45 | - | |
| rust-chronoutil/ | 2024-11-07 07:45 | - | |
| rust-buffer-redux/ | 2024-11-07 07:45 | - | |
| rust-bgzip/ | 2024-11-07 07:45 | - | |
| rust-abnf/ | 2024-11-07 07:45 | - | |
| rust-gix-commitgraph/ | 2024-11-07 07:45 | - | |
| rust-sixel-image/ | 2024-11-07 07:45 | - | |
| rust-gix-glob/ | 2024-11-07 09:04 | - | |
| rust-liblzma/ | 2024-11-07 09:05 | - | |
| rust-glib-build-tools/ | 2024-11-07 09:05 | - | |
| rust-openssh-sftp-protocol/ | 2024-11-07 09:05 | - | |
| rust-devicemapper-sys/ | 2024-11-07 09:05 | - | |
| rust-fontdb/ | 2024-11-07 09:05 | - | |
| rust-awaitable/ | 2024-11-07 09:05 | - | |
| rust-wezterm-dynamic/ | 2024-11-07 09:05 | - | |
| rust-qr2term/ | 2024-11-07 09:05 | - | |
| rust-gix-url/ | 2024-11-07 09:05 | - | |
| rust-ttrpc/ | 2024-11-07 09:05 | - | |
| rust-jsonwebtoken/ | 2024-11-07 09:05 | - | |
| rust-varbincode/ | 2024-11-07 10:21 | - | |
| rust-rustybuzz/ | 2024-11-07 10:21 | - | |
| rust-magnus/ | 2024-11-07 10:21 | - | |
| rust-rustdct/ | 2024-11-07 10:21 | - | |
| rust-parsec-tool/ | 2024-11-07 10:23 | - | |
| r-cran-cachem/ | 2024-11-07 10:23 | - | |
| rust-libslirp/ | 2024-11-07 10:23 | - | |
| rust-x11rb-protocol/ | 2024-11-07 10:23 | - | |
| rust-vec-collections/ | 2024-11-07 10:23 | - | |
| rust-sequoia-tpm/ | 2024-11-07 10:23 | - | |
| rlottie-qml/ | 2024-11-07 10:57 | - | |
| rust-openssh-sftp-error/ | 2024-11-07 11:40 | - | |
| rust-csscolorparser/ | 2024-11-07 11:40 | - | |
| rust-comfy-table/ | 2024-11-07 11:40 | - | |
| rust-ratatui/ | 2024-11-07 11:41 | - | |
| rust-piz/ | 2024-11-07 11:41 | - | |
| rust-openpgp-card-state/ | 2024-11-07 11:41 | - | |
| rust-nftables/ | 2024-11-07 11:41 | - | |
| rust-netlink-packet-wireguard/ | 2024-11-07 11:41 | - | |
| rust-needletail/ | 2024-11-07 11:41 | - | |
| rust-merge3/ | 2024-11-07 11:41 | - | |
| rust-k9/ | 2024-11-07 11:41 | - | |
| rust-hyperlocal/ | 2024-11-07 11:41 | - | |
| rust-git-cinnabar/ | 2024-11-07 11:41 | - | |
| rust-git-absorb/ | 2024-11-07 11:41 | - | |
| rust-gix-fs/ | 2024-11-07 11:41 | - | |
| rust-erbium-net/ | 2024-11-07 11:41 | - | |
| rust-cntr/ | 2024-11-07 11:41 | - | |
| rust-cast-sender/ | 2024-11-07 11:41 | - | |
| rust-lsd/ | 2024-11-07 11:41 | - | |
| rust-human-panic/ | 2024-11-07 11:41 | - | |
| rust-oauth2/ | 2024-11-07 11:41 | - | |
| rust-mozim/ | 2024-11-07 11:41 | - | |
| rust-bmap-parser/ | 2024-11-07 11:41 | - | |
| rust-ammonia/ | 2024-11-07 11:41 | - | |
| r-bioc-alabaster.base/ | 2024-11-07 11:41 | - | |
| r-bioc-alabaster.matrix/ | 2024-11-07 11:41 | - | |
| rust-gix-attributes/ | 2024-11-07 13:22 | - | |
| rust-heed/ | 2024-11-07 13:22 | - | |
| rust-openpgp-card-rpgp/ | 2024-11-07 13:22 | - | |
| rust-atk-sys-0.18/ | 2024-11-07 13:22 | - | |
| rust-copypasta-ext/ | 2024-11-07 13:22 | - | |
| rust-ripgrep/ | 2024-11-07 13:22 | - | |
| rust-udev/ | 2024-11-07 13:22 | - | |
| rust-blight/ | 2024-11-07 13:22 | - | |
| rust-bat/ | 2024-11-07 13:22 | - | |
| rust-gio-sys-0.18/ | 2024-11-07 13:22 | - | |
| rust-pipewire/ | 2024-11-07 13:22 | - | |
| rust-sqlx-postgres/ | 2024-11-07 13:22 | - | |
| rust-swtchr/ | 2024-11-07 13:22 | - | |
| rust-yubico/ | 2024-11-07 13:22 | - | |
| rust-wadl/ | 2024-11-07 13:22 | - | |
| rust-toml2json/ | 2024-11-07 13:22 | - | |
| rust-syntect-no-panic/ | 2024-11-07 13:22 | - | |
| rust-sqlx-macros-core/ | 2024-11-07 13:22 | - | |
| rust-ssri/ | 2024-11-07 13:22 | - | |
| rust-sqlx-sqlite/ | 2024-11-07 13:22 | - | |
| rust-sequoia-keystore/ | 2024-11-07 13:22 | - | |
| rust-sequoia-autocrypt/ | 2024-11-07 13:22 | - | |
| rust-sequoia-net/ | 2024-11-07 13:22 | - | |
| rust-select/ | 2024-11-07 13:22 | - | |
| rust-ripasso/ | 2024-11-07 13:22 | - | |
| rust-pango-sys-0.18/ | 2024-11-07 13:22 | - | |
| rust-sequoia-keystore-tpm/ | 2024-11-07 13:22 | - | |
| rust-wezterm-bidi/ | 2024-11-07 13:22 | - | |
| rust-wezterm-input-types/ | 2024-11-07 13:22 | - | |
| rust-niffler/ | 2024-11-07 13:22 | - | |
| rust-openssh-sftp-client-lowlevel/ | 2024-11-07 13:22 | - | |
| rust-gix-tempfile/ | 2024-11-07 13:22 | - | |
| rust-devicemapper/ | 2024-11-07 13:22 | - | |
| rust-octocrab/ | 2024-11-07 13:22 | - | |
| raku-meta6/ | 2024-11-07 15:36 | - | |
| raku-json-class/ | 2024-11-07 15:36 | - | |
| rust-gix-object/ | 2024-11-07 15:37 | - | |
| rust-dockworker/ | 2024-11-07 15:37 | - | |
| rust-gix-pathspec/ | 2024-11-07 15:37 | - | |
| r-cran-profvis/ | 2024-11-07 15:38 | - | |
| rust-zbus/ | 2024-11-07 17:03 | - | |
| rust-prr/ | 2024-11-07 17:04 | - | |
| rust-openssh-sftp-client/ | 2024-11-07 17:04 | - | |
| rust-gix-lock/ | 2024-11-07 17:04 | - | |
| r-bioc-dropletutils/ | 2024-11-07 17:04 | - | |
| rust-wezterm-color-types/ | 2024-11-07 17:04 | - | |
| rust-rpgpie/ | 2024-11-07 17:04 | - | |
| rust-sqlx-macros/ | 2024-11-07 22:13 | - | |
| rust-yaxpeax-arch/ | 2024-11-07 22:13 | - | |
| r-cran-rpact/ | 2024-11-07 23:01 | - | |
| r-cran-gbm/ | 2024-11-07 23:01 | - | |
| rust-sourceview5/ | 2024-11-07 23:40 | - | |
| rust-sequoia-openpgp-mt/ | 2024-11-07 23:40 | - | |
| rust-sequoia-keyring-linter/ | 2024-11-07 23:40 | - | |
| rust-sequoia-keystore-gpg-agent/ | 2024-11-07 23:40 | - | |
| rust-numbat-cli/ | 2024-11-07 23:40 | - | |
| rust-sequoia-policy-config/ | 2024-11-07 23:40 | - | |
| rust-sequoia-keystore-softkeys/ | 2024-11-07 23:40 | - | |
| rust-sequoia-keystore-backend/ | 2024-11-07 23:40 | - | |
| rust-sequoia-gpg-agent/ | 2024-11-07 23:40 | - | |
| rust-sequoia-ipc/ | 2024-11-07 23:40 | - | |
| rust-html2pango/ | 2024-11-07 23:40 | - | |
| rust-backon/ | 2024-11-07 23:40 | - | |
| rust-hypothesis/ | 2024-11-07 23:40 | - | |
| rust-uucore/ | 2024-11-07 23:40 | - | |
| rust-gix-ignore/ | 2024-11-07 23:40 | - | |
| rust-rockusb/ | 2024-11-07 23:40 | - | |
| rplay/ | 2024-11-07 23:40 | - | |
| rust-gix-transport/ | 2024-11-07 23:40 | - | |
| rust-gix-revwalk/ | 2024-11-07 23:40 | - | |
| rust-gix-ref/ | 2024-11-07 23:40 | - | |
| rust-inquire/ | 2024-11-08 01:08 | - | |
| rust-procs/ | 2024-11-08 01:08 | - | |
| rust-gdk-pixbuf-sys-0.18/ | 2024-11-08 01:08 | - | |
| rust-sequoia-keystore-openpgp-card/ | 2024-11-08 01:08 | - | |
| rust-sqlx/ | 2024-11-08 01:08 | - | |
| rust-glib-0.18/ | 2024-11-08 01:08 | - | |
| rust-zune-core/ | 2024-11-08 01:08 | - | |
| rust-tonic/ | 2024-11-08 02:38 | - | |
| rust-sequoia-cert-store/ | 2024-11-08 02:38 | - | |
| rust-mpris-server/ | 2024-11-08 02:38 | - | |
| rust-gdk-sys-0.18/ | 2024-11-08 05:45 | - | |
| rust-atk-0.18/ | 2024-11-08 05:45 | - | |
| rust-cairo-rs-0.18/ | 2024-11-08 05:45 | - | |
| rust-gio-0.18/ | 2024-11-08 05:46 | - | |
| rust-gix-traverse/ | 2024-11-08 05:46 | - | |
| rust-gix-protocol/ | 2024-11-08 05:46 | - | |
| rust-gix-revision/ | 2024-11-08 05:46 | - | |
| rust-gix-negotiate/ | 2024-11-08 05:46 | - | |
| rust-gix-discover/ | 2024-11-08 05:46 | - | |
| rust-gix-filter/ | 2024-11-08 05:46 | - | |
| rust-gix-config/ | 2024-11-08 05:46 | - | |
| rust-dep3/ | 2024-11-08 05:46 | - | |
| r-cran-seuratobject/ | 2024-11-08 05:46 | - | |
| r-cran-ipred/ | 2024-11-08 05:46 | - | |
| redland/ | 2024-11-08 05:46 | - | |
| r-cran-seurat/ | 2024-11-08 09:08 | - | |
| rust-gix-refspec/ | 2024-11-08 09:08 | - | |
| rust-gix-index/ | 2024-11-08 09:08 | - | |
| rust-pango-0.18/ | 2024-11-08 09:08 | - | |
| rust-gdk-pixbuf-0.18/ | 2024-11-08 09:08 | - | |
| ruby-erubis/ | 2024-11-08 11:22 | - | |
| rust-gtk-sys-0.18/ | 2024-11-08 11:23 | - | |
| rust-pdf/ | 2024-11-08 16:58 | - | |
| r-cran-wgcna/ | 2024-11-08 16:58 | - | |
| rust-gix-submodule/ | 2024-11-08 17:38 | - | |
| rust-gix-worktree/ | 2024-11-08 17:38 | - | |
| rust-gdk-0.18/ | 2024-11-08 17:38 | - | |
| rust-gix-worktree-stream/ | 2024-11-08 18:57 | - | |
| ruptime/ | 2024-11-08 22:52 | - | |
| rust-gix-status/ | 2024-11-09 01:21 | - | |
| rust-gix-diff/ | 2024-11-09 01:21 | - | |
| rust-gix-worktree-state/ | 2024-11-09 01:21 | - | |
| rust-gix-dir/ | 2024-11-09 01:21 | - | |
| rust-abnf-to-pest/ | 2024-11-09 03:27 | - | |
| rust-anstyle-svg/ | 2024-11-09 03:27 | - | |
| rust-gix-pack/ | 2024-11-09 06:31 | - | |
| rust-gix-archive/ | 2024-11-09 06:31 | - | |
| rust-debian-copyright/ | 2024-11-09 07:49 | - | |
| r-bioc-tcgabiolinks/ | 2024-11-09 16:24 | - | |
| rust-lopdf/ | 2024-11-09 16:25 | - | |
| rust-wayland-protocols-misc/ | 2024-11-09 16:52 | - | |
| rust-heapless/ | 2024-11-09 16:52 | - | |
| ruby-rmagick/ | 2024-11-09 16:52 | - | |
| rust-fs4/ | 2024-11-09 16:52 | - | |
| readstat/ | 2024-11-09 16:52 | - | |
| r-cran-magick/ | 2024-11-09 16:52 | - | |
| rust-gix-odb/ | 2024-11-09 17:38 | - | |
| rust-plotters-backend/ | 2024-11-09 21:48 | - | |
| rust-gix/ | 2024-11-10 02:04 | - | |
| rust-plotters-svg/ | 2024-11-10 03:15 | - | |
| radio-beam/ | 2024-11-10 04:50 | - | |
| rust-wasm-bindgen-futures/ | 2024-11-10 13:33 | - | |
| rust-lebe/ | 2024-11-10 13:33 | - | |
| rust-hollow/ | 2024-11-10 13:33 | - | |
| rust-async-dup/ | 2024-11-10 13:33 | - | |
| rust-tower-test/ | 2024-11-10 13:33 | - | |
| rust-genawaiter/ | 2024-11-10 13:33 | - | |
| rust-as-slice/ | 2024-11-10 13:33 | - | |
| rust-portpicker/ | 2024-11-10 13:33 | - | |
| rust-magma/ | 2024-11-10 13:33 | - | |
| rust-libhandy-sys-0.11/ | 2024-11-10 13:33 | - | |
| rust-gtk-0.18/ | 2024-11-10 13:33 | - | |
| r-cran-inline/ | 2024-11-10 16:42 | - | |
| rust-io-uring/ | 2024-11-10 16:47 | - | |
| rbdoom3bfg/ | 2024-11-10 16:47 | - | |
| rust-arboard/ | 2024-11-10 20:01 | - | |
| rust-imagepipe/ | 2024-11-10 20:01 | - | |
| rust-webp/ | 2024-11-10 20:01 | - | |
| rust-qrcode-generator/ | 2024-11-10 20:01 | - | |
| rust-qrcode/ | 2024-11-10 20:01 | - | |
| runc/ | 2024-11-10 22:48 | - | |
| rdflib/ | 2024-11-10 22:48 | - | |
| rust-wat/ | 2024-11-11 02:28 | - | |
| rust-wasm-bindgen-test/ | 2024-11-11 02:28 | - | |
| rust-libhandy-0.11/ | 2024-11-11 02:28 | - | |
| rust-async-h1/ | 2024-11-11 02:28 | - | |
| rust-qrencode/ | 2024-11-11 03:31 | - | |
| rust-image-webp/ | 2024-11-11 04:56 | - | |
| rust-speculoos/ | 2024-11-11 05:01 | - | |
| rust-scanlex/ | 2024-11-11 05:01 | - | |
| ruby-sprockets-rails/ | 2024-11-11 09:50 | - | |
| rust-librsvg/ | 2024-11-11 13:17 | - | |
| rust-notify-rust/ | 2024-11-11 16:07 | - | |
| rust-zune-jpeg/ | 2024-11-11 16:49 | - | |
| r-cran-pbdzmq/ | 2024-11-11 22:58 | - | |
| rust-rust-lzma/ | 2024-11-12 02:22 | - | |
| roc-toolkit/ | 2024-11-12 02:22 | - | |
| riseup-vpn/ | 2024-11-12 04:54 | - | |
| reposurgeon/ | 2024-11-12 04:54 | - | |
| rawdns/ | 2024-11-12 04:54 | - | |
| rosbags/ | 2024-11-12 10:48 | - | |
| r-cran-glmmtmb/ | 2024-11-12 10:48 | - | |
| ruby-acme-client/ | 2024-11-12 16:33 | - | |
| rust-ripasso-cursive/ | 2024-11-12 16:33 | - | |
| rust-secret-service/ | 2024-11-12 22:28 | - | |
| rust-sop/ | 2024-11-12 22:28 | - | |
| rust-tesseract-plumbing/ | 2024-11-12 22:52 | - | |
| rust-leptess/ | 2024-11-12 22:52 | - | |
| r-cran-rcppspdlog/ | 2024-11-12 22:52 | - | |
| rpi.gpio/ | 2024-11-13 02:22 | - | |
| rust-sequoia-keystore-server/ | 2024-11-13 06:42 | - | |
| rust-tracing-chrome/ | 2024-11-13 06:42 | - | |
| rust-cargo/ | 2024-11-13 10:57 | - | |
| ruby-elasticsearch/ | 2024-11-13 11:20 | - | |
| ruby-aws-partitions/ | 2024-11-13 17:24 | - | |
| ruby-aws-sigv4/ | 2024-11-13 17:24 | - | |
| rust-uriparse/ | 2024-11-13 18:44 | - | |
| rust-juniper-codegen/ | 2024-11-13 18:44 | - | |
| rust-adaptive-barrier/ | 2024-11-13 18:44 | - | |
| rust-cdylib-link-lines/ | 2024-11-13 18:44 | - | |
| rust-base64-url/ | 2024-11-13 18:44 | - | |
| ruby-aws-sdk-core/ | 2024-11-13 21:03 | - | |
| rust-tar/ | 2024-11-13 22:53 | - | |
| ruby-icalendar/ | 2024-11-13 23:07 | - | |
| ruby-aws-sdk-s3/ | 2024-11-14 01:44 | - | |
| rust-dbus-secret-service/ | 2024-11-14 04:57 | - | |
| ruby-mini-portile2/ | 2024-11-14 15:36 | - | |
| ruby-slack-messenger/ | 2024-11-14 22:44 | - | |
| rust-cargo-outdated/ | 2024-11-14 22:51 | - | |
| ruby-redis-clustering/ | 2024-11-15 04:35 | - | |
| rocsolver/ | 2024-11-15 10:46 | - | |
| ruamel.yaml.clib/ | 2024-11-15 21:03 | - | |
| ruby-rouge/ | 2024-11-15 22:48 | - | |
| r-cran-fastcluster/ | 2024-11-16 05:46 | - | |
| refnx/ | 2024-11-16 11:00 | - | |
| ruby-charlock-holmes/ | 2024-11-16 14:19 | - | |
| rzip/ | 2024-11-16 15:11 | - | |
| ruby-colored2/ | 2024-11-16 16:06 | - | |
| reuse/ | 2024-11-16 16:06 | - | |
| ruby-ronn/ | 2024-11-16 16:06 | - | |
| ruby-fuubar/ | 2024-11-16 16:06 | - | |
| rust-b3sum/ | 2024-11-16 16:06 | - | |
| rust-rowan/ | 2024-11-16 17:06 | - | |
| rust-tealdeer/ | 2024-11-16 18:40 | - | |
| rust-irc-proto/ | 2024-11-16 19:35 | - | |
| rust-infer/ | 2024-11-16 21:37 | - | |
| rust-freetype-sys/ | 2024-11-16 21:37 | - | |
| rust-mint/ | 2024-11-16 22:42 | - | |
| rust-image-hasher/ | 2024-11-16 22:42 | - | |
| rust-imap-client/ | 2024-11-16 22:51 | - | |
| rex/ | 2024-11-17 03:54 | - | |
| rust-deb822-lossless/ | 2024-11-17 04:50 | - | |
| restorecond/ | 2024-11-17 07:25 | - | |
| rust-servo-fontconfig-sys/ | 2024-11-17 07:25 | - | |
| rust-font-kit/ | 2024-11-17 07:25 | - | |
| rust-freetype-rs/ | 2024-11-17 07:25 | - | |
| rust-freetype/ | 2024-11-17 07:25 | - | |
| ruby-proc-to-ast/ | 2024-11-17 16:11 | - | |
| raritan-json-rpc-sdk/ | 2024-11-17 16:11 | - | |
| r-cran-rdpack/ | 2024-11-17 16:43 | - | |
| rust-debian-watch/ | 2024-11-17 18:29 | - | |
| ruby-rugged/ | 2024-11-17 22:48 | - | |
| ruby-semantic-puppet/ | 2024-11-18 04:16 | - | |
| rust-wasmtime/ | 2024-11-18 04:54 | - | |
| rust-pyo3/ | 2024-11-18 04:54 | - | |
| rust-pyo3-macros/ | 2024-11-18 04:54 | - | |
| rust-pyo3-ffi/ | 2024-11-18 04:54 | - | |
| rust-pyo3-macros-backend/ | 2024-11-18 04:54 | - | |
| rust-pyo3-build-config/ | 2024-11-18 04:54 | - | |
| rgl/ | 2024-11-18 04:54 | - | |
| r-cran-slam/ | 2024-11-18 04:54 | - | |
| rust-plotters/ | 2024-11-18 16:48 | - | |
| remctl/ | 2024-11-18 16:48 | - | |
| rust-udevrs/ | 2024-11-18 22:54 | - | |
| rust-http-types/ | 2024-11-18 22:54 | - | |
| rust-yaxpeax-x86/ | 2024-11-18 23:41 | - | |
| rust-opendal/ | 2024-11-18 23:41 | - | |
| rust-version-ranges/ | 2024-11-18 23:42 | - | |
| rust-cargo-debstatus/ | 2024-11-19 00:35 | - | |
| rootlesskit/ | 2024-11-19 05:09 | - | |
| robustirc-bridge/ | 2024-11-19 05:09 | - | |
| reflex/ | 2024-11-19 05:09 | - | |
| ratt/ | 2024-11-19 05:09 | - | |
| rapidfuzz-cpp/ | 2024-11-19 05:34 | - | |
| rust-debian-control/ | 2024-11-19 07:00 | - | |
| ruby-sinatra/ | 2024-11-19 11:50 | - | |
| rust-rust-apt/ | 2024-11-20 02:29 | - | |
| rust-zerofrom/ | 2024-11-20 05:03 | - | |
| rust-yoke/ | 2024-11-20 05:03 | - | |
| rust-simple-logger/ | 2024-11-20 05:03 | - | |
| rust-pep440-rs/ | 2024-11-20 05:03 | - | |
| ruby-mojo-magick/ | 2024-11-20 05:03 | - | |
| rrdtool/ | 2024-11-20 05:03 | - | |
| rrootage/ | 2024-11-20 10:49 | - | |
| rust-gstreamer-player/ | 2024-11-20 14:20 | - | |
| rust-rustls-0.20/ | 2024-11-20 14:20 | - | |
| rustc-1.68/ | 2024-11-20 14:20 | - | |
| rust-railway-core/ | 2024-11-20 16:33 | - | |
| rust-swaysome/ | 2024-11-20 16:52 | - | |
| rclone/ | 2024-11-20 16:52 | - | |
| rapidfuzz/ | 2024-11-20 16:52 | - | |
| ruby-bcrypt/ | 2024-11-20 22:12 | - | |
| reproject/ | 2024-11-21 10:43 | - | |
| ruby-octokit/ | 2024-11-21 10:48 | - | |
| ruby-barby/ | 2024-11-21 15:51 | - | |
| rust-postcard/ | 2024-11-21 22:52 | - | |
| rust-zstd-sys/ | 2024-11-22 05:04 | - | |
| rust-drm-sys/ | 2024-11-22 05:04 | - | |
| rust-drm-fourcc/ | 2024-11-22 05:04 | - | |
| rust-bindgen/ | 2024-11-22 05:04 | - | |
| rust-exacl/ | 2024-11-22 05:04 | - | |
| rust-input-sys/ | 2024-11-22 05:04 | - | |
| rust-lmdb-master-sys/ | 2024-11-22 05:04 | - | |
| rust-capstone-sys/ | 2024-11-22 10:24 | - | |
| rg-el/ | 2024-11-22 16:21 | - | |
| rust-xkbcommon-sys/ | 2024-11-22 17:26 | - | |
| rust-tss-esapi-sys/ | 2024-11-22 17:26 | - | |
| rust-rb-sys-build/ | 2024-11-22 17:26 | - | |
| rust-loopdev/ | 2024-11-22 17:26 | - | |
| rust-nettle-sys/ | 2024-11-22 17:26 | - | |
| rust-libspa-sys/ | 2024-11-22 17:26 | - | |
| rust-libraw-rs-sys/ | 2024-11-22 17:26 | - | |
| rust-aom-sys/ | 2024-11-22 17:26 | - | |
| rust-timer/ | 2024-11-22 22:56 | - | |
| rust-asn1-rs-impl/ | 2024-11-22 22:56 | - | |
| rust-asn1-rs-derive/ | 2024-11-22 22:56 | - | |
| rust-test-casing/ | 2024-11-22 22:56 | - | |
| rmagic/ | 2024-11-23 04:16 | - | |
| rust-pipewire-sys/ | 2024-11-23 06:06 | - | |
| ruby-redis-cluster-client/ | 2024-11-23 10:39 | - | |
| rust-parsec-service/ | 2024-11-23 10:49 | - | |
| rust-hyperfine/ | 2024-11-23 10:49 | - | |
| rust-eza/ | 2024-11-23 10:49 | - | |
| rust-cargo-util-schemas/ | 2024-11-23 10:49 | - | |
| ruby-fast-gettext/ | 2024-11-23 10:49 | - | |
| rust-tesseract-sys/ | 2024-11-23 16:12 | - | |
| rime-emoji/ | 2024-11-23 16:12 | - | |
| remmina/ | 2024-11-23 16:12 | - | |
| ranger/ | 2024-11-23 22:28 | - | |
| ruby-ruby-openai/ | 2024-11-23 22:28 | - | |
| raincat/ | 2024-11-23 22:29 | - | |
| rust-bindgen-cli/ | 2024-11-23 22:53 | - | |
| rust-psa-crypto-sys/ | 2024-11-24 10:39 | - | |
| rust-wayland-egl-0.29/ | 2024-11-24 16:07 | - | |
| rust-wayland-scanner-0.29/ | 2024-11-24 16:07 | - | |
| rust-darling-0.14/ | 2024-11-24 16:07 | - | |
| rust-speedate/ | 2024-11-24 16:07 | - | |
| rust-time-0.1/ | 2024-11-24 16:07 | - | |
| rust-smithay-client-toolkit-0.16/ | 2024-11-24 16:07 | - | |
| rust-darling-core-0.14/ | 2024-11-24 16:07 | - | |
| rust-clap-derive-3/ | 2024-11-24 16:07 | - | |
| rust-syn-1/ | 2024-11-24 16:07 | - | |
| rust-toml-0.5/ | 2024-11-24 16:07 | - | |
| rust-volatile-0.3/ | 2024-11-24 16:07 | - | |
| rust-darling-macro-0.14/ | 2024-11-24 16:07 | - | |
| rust-clap-complete-3/ | 2024-11-24 16:07 | - | |
| rust-clap-3/ | 2024-11-24 16:07 | - | |
| rust-clap-2/ | 2024-11-24 16:07 | - | |
| rust-cfg-if-0.1/ | 2024-11-24 16:07 | - | |
| rust-arrayvec-0.5/ | 2024-11-24 16:07 | - | |
| rust-serde-json/ | 2024-11-24 16:07 | - | |
| rust-serde-derive/ | 2024-11-24 16:07 | - | |
| rust-regex-syntax/ | 2024-11-24 16:07 | - | |
| rust-mio-0.6/ | 2024-11-24 16:07 | - | |
| rust-semver-parser-0.7/ | 2024-11-24 16:07 | - | |
| rust-rust-embed-utils/ | 2024-11-24 16:07 | - | |
| rust-rle-decode-fast/ | 2024-11-24 16:07 | - | |
| rust-proc-macro-crate-1/ | 2024-11-24 16:07 | - | |
| rust-roff-0.1/ | 2024-11-24 16:07 | - | |
| rust-semver-0.9/ | 2024-11-24 16:07 | - | |
| ruby-puppetfile-resolver/ | 2024-11-24 16:46 | - | |
| rust-zvariant-2/ | 2024-11-24 16:59 | - | |
| rust-zvariant-derive-2/ | 2024-11-24 16:59 | - | |
| rust-zbus-macros-1/ | 2024-11-24 16:59 | - | |
| rust-wayland-sys-0.29/ | 2024-11-24 16:59 | - | |
| rust-wayland-protocols-0.29/ | 2024-11-24 16:59 | - | |
| rocblas/ | 2024-11-24 17:57 | - | |
| rust-selinux-sys/ | 2024-11-24 22:52 | - | |
| rust-fts-sys/ | 2024-11-24 22:52 | - | |
| rime-combo-pinyin/ | 2024-11-24 22:52 | - | |
| rime-cantonese/ | 2024-11-24 22:52 | - | |
| rust-wide/ | 2024-11-25 04:54 | - | |
| rust-rb-sys/ | 2024-11-25 04:54 | - | |
| rust-foreign-types-0.3/ | 2024-11-25 05:00 | - | |
| rust-foreign-types-shared-0.1/ | 2024-11-25 05:01 | - | |
| rust-serde/ | 2024-11-25 05:01 | - | |
| ruby-licensee/ | 2024-11-25 10:37 | - | |
| rapidjson/ | 2024-11-25 10:38 | - | |
| rust-regex-automata/ | 2024-11-25 11:40 | - | |
| rust-rust-embed-impl/ | 2024-11-25 11:40 | - | |
| rust-tracing-log/ | 2024-11-25 14:11 | - | |
| rust-regex/ | 2024-11-25 14:11 | - | |
| rust-rust-embed/ | 2024-11-25 14:11 | - | |
| rust-glycin/ | 2024-11-25 16:18 | - | |
| rust-wayland-client-0.29/ | 2024-11-25 16:53 | - | |
| rust-plotters-bitmap/ | 2024-11-25 16:53 | - | |
| rust-calloop-0.10/ | 2024-11-25 16:53 | - | |
| r-cran-deoptimr/ | 2024-11-25 22:23 | - | |
| rust-zbus-1/ | 2024-11-25 22:53 | - | |
| rocsparse/ | 2024-11-26 01:25 | - | |
| rust-sysexits/ | 2024-11-26 05:00 | - | |
| r-cran-waldo/ | 2024-11-26 05:00 | - | |
| r-cran-knitr/ | 2024-11-26 05:00 | - | |
| refstack-client/ | 2024-11-26 09:48 | - | |
| r-bioc-biocstyle/ | 2024-11-26 09:48 | - | |
| r-cran-quantreg/ | 2024-11-26 11:01 | - | |
| rust-jiter/ | 2024-11-26 14:12 | - | |
| redmine-plugin-redhopper/ | 2024-11-26 14:59 | - | |
| ros2-ament-cmake-ros/ | 2024-11-26 14:59 | - | |
| ros2-ament-index/ | 2024-11-26 14:59 | - | |
| ros2-osrf-testing-tools-cpp/ | 2024-11-26 14:59 | - | |
| ros2-performance-test-fixture/ | 2024-11-26 14:59 | - | |
| ros2-rcpputils/ | 2024-11-26 14:59 | - | |
| ros2-rcutils/ | 2024-11-26 14:59 | - | |
| ros2-rosidl/ | 2024-11-26 14:59 | - | |
| ros2-test-interface-files/ | 2024-11-26 14:59 | - | |
| rust-blake2b-simd-0.5/ | 2024-11-26 14:59 | - | |
| rust-block-buffer-0.9/ | 2024-11-26 14:59 | - | |
| rust-const-fn-assert/ | 2024-11-26 14:59 | - | |
| rust-digest-0.9/ | 2024-11-26 14:59 | - | |
| rust-gstreamer-player-sys/ | 2024-11-26 14:59 | - | |
| rust-ipfs-unixfs/ | 2024-11-26 14:59 | - | |
| rust-sha-1-0.9/ | 2024-11-26 14:59 | - | |
| rust-sha2-0.9/ | 2024-11-26 14:59 | - | |
| rust-sha3-0.9/ | 2024-11-26 14:59 | - | |
| rust-wasmer-enumset/ | 2024-11-26 14:59 | - | |
| rust-debcargo/ | 2024-11-26 16:53 | - | |
| ruby-terser/ | 2024-11-27 10:24 | - | |
| rust-sequoia-octopus-librnp/ | 2024-11-27 10:52 | - | |
| rust-mail-send/ | 2024-11-27 15:56 | - | |
| rainbows/ | 2024-11-27 22:37 | - | |
| rust-libseccomp-sys/ | 2024-11-27 22:38 | - | |
| rust-libseccomp/ | 2024-11-28 05:59 | - | |
| rust-cddl/ | 2024-11-28 15:59 | - | |
| rust-rpgpie-sop/ | 2024-11-28 16:49 | - | |
| rust-leptonica-sys/ | 2024-11-28 16:49 | - | |
| rust-imap-codec/ | 2024-11-28 16:49 | - | |
| rust-rsop/ | 2024-11-28 22:58 | - | |
| rust-grcov/ | 2024-11-29 04:55 | - | |
| rdkit/ | 2024-11-29 04:55 | - | |
| rust-pep508-rs/ | 2024-11-29 08:07 | - | |
| rust-asahi-nvram/ | 2024-11-29 16:34 | - | |
| rust-asahi-bless/ | 2024-11-29 16:34 | - | |
| rust-ulid/ | 2024-11-29 16:54 | - | |
| ros2-colcon-core/ | 2024-11-29 22:51 | - | |
| r-cran-rnaturalearth/ | 2024-11-29 22:51 | - | |
| rust-pbr/ | 2024-11-29 23:47 | - | |
| rust-pyproject-toml/ | 2024-11-29 23:47 | - | |
| rust-sequoia-sq/ | 2024-11-30 22:48 | - | |
| ruby-soap4r/ | 2024-11-30 22:48 | - | |
| rust-if-watch/ | 2024-12-01 04:42 | - | |
| rmpi/ | 2024-12-01 04:42 | - | |
| rust-enumset-derive/ | 2024-12-01 06:42 | - | |
| rust-cursive/ | 2024-12-01 06:42 | - | |
| rust-virtio-bindings/ | 2024-12-01 06:42 | - | |
| rust-parity-wasm/ | 2024-12-01 09:52 | - | |
| rust-virtio-queue/ | 2024-12-01 13:30 | - | |
| rust-vhost/ | 2024-12-01 13:30 | - | |
| ros2-colcon-cmake/ | 2024-12-01 15:45 | - | |
| ruby-cssbundling-rails/ | 2024-12-01 15:45 | - | |
| rust-enumset/ | 2024-12-01 16:46 | - | |
| rust-humantime/ | 2024-12-01 16:46 | - | |
| robocode/ | 2024-12-02 05:26 | - | |
| rust-vhost-user-backend/ | 2024-12-02 06:52 | - | |
| ruby-puppet-syntax/ | 2024-12-02 10:37 | - | |
| rust-env-logger-0.7/ | 2024-12-02 10:37 | - | |
| rust-git2/ | 2024-12-02 10:44 | - | |
| relion/ | 2024-12-02 10:44 | - | |
| ruby-narray/ | 2024-12-02 11:40 | - | |
| roary/ | 2024-12-02 15:31 | - | |
| rss-glx/ | 2024-12-02 16:48 | - | |
| rust-comrak/ | 2024-12-02 22:53 | - | |
| rust-isahc/ | 2024-12-03 03:59 | - | |
| rust-cruet/ | 2024-12-03 03:59 | - | |
| rust-highway/ | 2024-12-03 03:59 | - | |
| rust-wayland-server-0.29/ | 2024-12-03 05:02 | - | |
| rust-wayland-cursor-0.29/ | 2024-12-03 05:02 | - | |
| rust-vm-memory/ | 2024-12-03 05:02 | - | |
| rust-strsim-0.10/ | 2024-12-03 05:02 | - | |
| rust-smithay-client-toolkit/ | 2024-12-03 05:02 | - | |
| rust-derive-more-0.99/ | 2024-12-03 05:02 | - | |
| rust-transmission-client/ | 2024-12-03 10:16 | - | |
| rust-sequoia-sop/ | 2024-12-03 10:48 | - | |
| rust-r-description/ | 2024-12-03 10:48 | - | |
| radare2/ | 2024-12-03 17:00 | - | |
| reform-firedecor/ | 2024-12-04 05:10 | - | |
| rust-swayipc/ | 2024-12-04 05:38 | - | |
| rust-stun-codec/ | 2024-12-04 05:38 | - | |
| rust-similar-asserts/ | 2024-12-04 05:38 | - | |
| rust-similar/ | 2024-12-04 05:38 | - | |
| r-cran-glue/ | 2024-12-04 05:38 | - | |
| rime-luna-pinyin/ | 2024-12-04 11:04 | - | |
| ruby-mpi/ | 2024-12-04 12:14 | - | |
| rust-cargo-test-support/ | 2024-12-04 15:38 | - | |
| rust-tungstenite/ | 2024-12-04 17:50 | - | |
| rust-simplelog/ | 2024-12-05 00:01 | - | |
| rust-embedded-io-async/ | 2024-12-05 01:52 | - | |
| rust-deadpool-runtime/ | 2024-12-05 01:52 | - | |
| rust-crc64/ | 2024-12-05 01:52 | - | |
| rust-pnet-macros-support/ | 2024-12-05 01:52 | - | |
| rust-state/ | 2024-12-05 01:52 | - | |
| rust-cargo-test-macro/ | 2024-12-05 01:52 | - | |
| rust-unicode-width-0.1/ | 2024-12-05 01:52 | - | |
| rust-paste-test-suite/ | 2024-12-05 01:52 | - | |
| rust-is-terminal-polyfill/ | 2024-12-05 01:52 | - | |
| rust-line-col/ | 2024-12-05 01:52 | - | |
| rust-tokio-tungstenite/ | 2024-12-05 05:26 | - | |
| rust-async-tungstenite/ | 2024-12-05 05:26 | - | |
| radicale/ | 2024-12-05 06:48 | - | |
| rust-deadpool/ | 2024-12-05 06:49 | - | |
| rust-soketto/ | 2024-12-05 10:55 | - | |
| rust-meow-cli/ | 2024-12-05 10:55 | - | |
| rust-axum/ | 2024-12-05 10:55 | - | |
| rust-warp/ | 2024-12-05 11:41 | - | |
| rust-liboverdrop/ | 2024-12-05 11:41 | - | |
| rust-cairo-rs/ | 2024-12-05 11:41 | - | |
| rust-event-listener-strategy/ | 2024-12-05 11:41 | - | |
| rheolef/ | 2024-12-05 13:06 | - | |
| rust-zram-generator/ | 2024-12-05 15:18 | - | |
| rust-signature/ | 2024-12-05 17:09 | - | |
| rust-spki/ | 2024-12-05 18:21 | - | |
| rust-tokio-stream/ | 2024-12-06 01:07 | - | |
| rust-typetag-impl/ | 2024-12-06 01:07 | - | |
| rust-macrotest/ | 2024-12-06 01:07 | - | |
| rust-io-extras/ | 2024-12-06 01:07 | - | |
| rust-fs-set-times/ | 2024-12-06 01:07 | - | |
| rust-exr/ | 2024-12-06 01:07 | - | |
| rust-escaper/ | 2024-12-06 01:07 | - | |
| rust-derive-utils/ | 2024-12-06 01:07 | - | |
| rust-by-address/ | 2024-12-06 01:07 | - | |
| rust-ambient-authority/ | 2024-12-06 01:07 | - | |
| rust-unicode-math-class/ | 2024-12-06 05:04 | - | |
| rust-pinger/ | 2024-12-06 05:17 | - | |
| rust-debbugs/ | 2024-12-06 05:18 | - | |
| rust-cap-rand/ | 2024-12-06 06:33 | - | |
| rust-sequoia-wot/ | 2024-12-06 10:50 | - | |
| rasterio/ | 2024-12-06 10:50 | - | |
| rust-termbg/ | 2024-12-06 16:50 | - | |
| rust-glycin-utils/ | 2024-12-06 16:50 | - | |
| rebar/ | 2024-12-06 18:01 | - | |
| rust-reflink-copy/ | 2024-12-06 22:54 | - | |
| rust-imap-next/ | 2024-12-06 22:54 | - | |
| rebar3/ | 2024-12-06 22:54 | - | |
| rust-users/ | 2024-12-07 00:16 | - | |
| rust-tiny-dfr/ | 2024-12-07 10:39 | - | |
| rust-patchkit/ | 2024-12-07 10:39 | - | |
| rust-image/ | 2024-12-07 10:39 | - | |
| rust-debversion/ | 2024-12-07 10:39 | - | |
| rust-debian-changelog/ | 2024-12-07 10:39 | - | |
| rust-buildlog-consultant/ | 2024-12-07 10:39 | - | |
| rust-breezyshim/ | 2024-12-07 10:39 | - | |
| rust-rsa/ | 2024-12-07 16:44 | - | |
| rust-upstream-ontologist/ | 2024-12-07 22:49 | - | |
| rust-pgp/ | 2024-12-07 22:49 | - | |
| rust-circular-buffer/ | 2024-12-08 00:45 | - | |
| rust-gst-plugin-gtk4/ | 2024-12-08 10:38 | - | |
| r-cran-rcpparmadillo/ | 2024-12-08 10:38 | - | |
| rust-ppv-lite86/ | 2024-12-08 16:07 | - | |
| rust-getrandom/ | 2024-12-08 16:07 | - | |
| rust-arrayref/ | 2024-12-08 16:07 | - | |
| rust-tui-input/ | 2024-12-08 16:46 | - | |
| rust-serde-yml/ | 2024-12-08 16:46 | - | |
| rust-libyml/ | 2024-12-08 16:46 | - | |
| reportbug/ | 2024-12-09 02:46 | - | |
| ruby-with-advisory-lock/ | 2024-12-09 04:54 | - | |
| renson-endura-delta/ | 2024-12-09 04:54 | - | |
| rust-scriptisto/ | 2024-12-09 04:56 | - | |
| rust-pam/ | 2024-12-09 04:56 | - | |
| rust-test-with/ | 2024-12-09 04:56 | - | |
| resteasy/ | 2024-12-09 10:21 | - | |
| rust-bitflags-1/ | 2024-12-09 10:59 | - | |
| reprozip/ | 2024-12-10 01:43 | - | |
| rpy2/ | 2024-12-10 05:07 | - | |
| rubber/ | 2024-12-10 09:58 | - | |
| rust-manifest-dir-macros/ | 2024-12-10 09:58 | - | |
| rust-matrixmultiply/ | 2024-12-10 09:58 | - | |
| rust-easy-ext/ | 2024-12-10 09:58 | - | |
| rust-portable-atomic/ | 2024-12-10 10:59 | - | |
| rust-bytes/ | 2024-12-10 10:59 | - | |
| repmgr/ | 2024-12-10 16:59 | - | |
| ruby-jsonb-accessor/ | 2024-12-10 17:00 | - | |
| ruby-rspec-profiling/ | 2024-12-10 17:00 | - | |
| rtpengine/ | 2024-12-11 04:59 | - | |
| rabbit/ | 2024-12-11 10:15 | - | |
| readucks/ | 2024-12-11 10:15 | - | |
| r-cran-dplyr/ | 2024-12-11 10:48 | - | |
| rust-no-panic/ | 2024-12-11 15:08 | - | |
| rust-lz4-flex/ | 2024-12-11 15:08 | - | |
| rust-itoa/ | 2024-12-11 15:08 | - | |
| rust-dtoa-short/ | 2024-12-11 15:08 | - | |
| rust-data-encoding/ | 2024-12-11 15:08 | - | |
| rust-constant-time-eq/ | 2024-12-11 15:08 | - | |
| rust-bstr/ | 2024-12-11 15:08 | - | |
| rambo-k/ | 2024-12-11 16:39 | - | |
| ruby-html-pipeline/ | 2024-12-11 16:39 | - | |
| rust-spytrap-adb/ | 2024-12-11 16:39 | - | |
| rust-tls-parser/ | 2024-12-11 16:40 | - | |
| rust-unicode-bidi/ | 2024-12-11 16:40 | - | |
| rust-stringprep/ | 2024-12-11 16:40 | - | |
| rust-socket2/ | 2024-12-11 16:40 | - | |
| rust-shellwords/ | 2024-12-11 16:40 | - | |
| rust-peeking-take-while/ | 2024-12-11 16:40 | - | |
| r-cran-commonmark/ | 2024-12-11 22:57 | - | |
| rust-derp/ | 2024-12-12 03:06 | - | |
| route-rnd/ | 2024-12-12 11:13 | - | |
| rust-libadwaita-sys/ | 2024-12-12 16:56 | - | |
| ray/ | 2024-12-12 16:56 | - | |
| rust-fxprof-processed-profile/ | 2024-12-12 17:10 | - | |
| rodbc/ | 2024-12-12 17:10 | - | |
| r-cran-rcppcctz/ | 2024-12-12 17:10 | - | |
| rust-rebuilderd-common/ | 2024-12-12 22:54 | - | |
| restic/ | 2024-12-12 22:54 | - | |
| rust-unicase/ | 2024-12-13 04:54 | - | |
| ruby-build/ | 2024-12-13 10:13 | - | |
| readline/ | 2024-12-13 10:13 | - | |
| ruby-rest-client/ | 2024-12-13 16:38 | - | |
| rekor/ | 2024-12-13 21:38 | - | |
| rust-libbpf-sys/ | 2024-12-13 22:51 | - | |
| rocs/ | 2024-12-13 22:51 | - | |
| r-cran-rms/ | 2024-12-13 22:51 | - | |
| rust-in-toto/ | 2024-12-14 02:47 | - | |
| rust-pollster/ | 2024-12-14 02:47 | - | |
| rust-jj-lib-proc-macros/ | 2024-12-14 02:47 | - | |
| rust-jiff/ | 2024-12-14 02:47 | - | |
| ruby-fakefs/ | 2024-12-14 22:17 | - | |
| rust-rebuilderd-worker/ | 2024-12-15 00:42 | - | |
| rust-http-body-0.4/ | 2024-12-15 00:42 | - | |
| rust-http-0.2/ | 2024-12-15 00:42 | - | |
| ruby-kramdown/ | 2024-12-15 10:06 | - | |
| rust-statrs/ | 2024-12-15 10:50 | - | |
| ruby-batch-loader/ | 2024-12-15 15:51 | - | |
| rust-termwiz/ | 2024-12-15 16:44 | - | |
| rust-lazy-regex/ | 2024-12-15 16:44 | - | |
| radsecproxy/ | 2024-12-15 16:52 | - | |
| ruby-redis-namespace/ | 2024-12-15 21:46 | - | |
| rust-systemstat/ | 2024-12-15 22:47 | - | |
| rust-rustls-pki-types/ | 2024-12-15 22:47 | - | |
| rust-nusb/ | 2024-12-15 22:47 | - | |
| rust-coreutils/ | 2024-12-15 22:47 | - | |
| rust-terminal-prompt/ | 2024-12-15 22:53 | - | |
| rust-synstructure-0.12/ | 2024-12-15 22:53 | - | |
| rust-sha256/ | 2024-12-15 22:53 | - | |
| rust-svp-client/ | 2024-12-15 22:53 | - | |
| rust-rustc-hash-2/ | 2024-12-15 22:53 | - | |
| rust-proc-macro-error-attr2/ | 2024-12-15 22:53 | - | |
| rust-never/ | 2024-12-15 22:53 | - | |
| rust-rinja-parser/ | 2024-12-15 22:53 | - | |
| rust-libphosh-sys/ | 2024-12-15 22:53 | - | |
| rust-diligent-date-parser/ | 2024-12-15 22:53 | - | |
| rust-auditable-info/ | 2024-12-15 22:53 | - | |
| rust-defer-drop/ | 2024-12-15 22:53 | - | |
| rust-debian-analyzer/ | 2024-12-16 04:55 | - | |
| r-cran-lpsolve/ | 2024-12-16 04:55 | - | |
| rust-libphosh/ | 2024-12-16 07:36 | - | |
| ruby-whitequark-parser/ | 2024-12-16 10:47 | - | |
| rust-subtile/ | 2024-12-16 16:34 | - | |
| ruby-excon/ | 2024-12-16 16:51 | - | |
| ruby-rack-cors/ | 2024-12-16 21:43 | - | |
| ruby-model-tokenizer/ | 2024-12-16 21:43 | - | |
| ruby-mathml/ | 2024-12-16 21:43 | - | |
| ruby-fog-core/ | 2024-12-16 21:43 | - | |
| ruby-paranoia/ | 2024-12-16 21:43 | - | |
| ruby-webmock/ | 2024-12-16 21:43 | - | |
| ruby-friendly-id/ | 2024-12-16 21:43 | - | |
| ruby-kubeclient/ | 2024-12-16 21:43 | - | |
| ruby-qr4r/ | 2024-12-16 21:43 | - | |
| ruby-omniauth-openid-connect/ | 2024-12-16 21:43 | - | |
| ruby-ftw/ | 2024-12-16 21:43 | - | |
| rust-auth-git2/ | 2024-12-16 22:50 | - | |
| rust-palette-derive/ | 2024-12-17 04:13 | - | |
| rust-gix-credentials/ | 2024-12-17 04:49 | - | |
| rserve/ | 2024-12-17 16:49 | - | |
| rust-memmap2/ | 2024-12-17 16:49 | - | |
| rust-hash32/ | 2024-12-17 16:49 | - | |
| ruby-ruby-magic-static/ | 2024-12-17 16:49 | - | |
| rust-rustc-demangle/ | 2024-12-17 17:56 | - | |
| redeclipse-data/ | 2024-12-17 22:30 | - | |
| ruby-mono-logger/ | 2024-12-17 22:30 | - | |
| redeclipse/ | 2024-12-17 22:30 | - | |
| rust-numerals/ | 2024-12-17 22:51 | - | |
| ruby-instance-storage/ | 2024-12-17 22:51 | - | |
| rust-repro-env/ | 2024-12-17 23:43 | - | |
| ruby-messagebus-api/ | 2024-12-18 04:07 | - | |
| rustc-1.82/ | 2024-12-18 09:02 | - | |
| r-cran-fontbitstreamvera/ | 2024-12-18 10:07 | - | |
| rustc-1.81/ | 2024-12-18 11:32 | - | |
| rust-defaults/ | 2024-12-18 14:38 | - | |
| r-cran-fontliberation/ | 2024-12-18 16:49 | - | |
| redfishtool/ | 2024-12-18 16:49 | - | |
| remind/ | 2024-12-18 16:53 | - | |
| ruby-dalli/ | 2024-12-18 22:08 | - | |
| ruby-minitest-stub-const/ | 2024-12-18 22:08 | - | |
| ruby-vcr/ | 2024-12-18 22:08 | - | |
| ruby-net-ldap/ | 2024-12-18 22:08 | - | |
| ruby-pkg-config/ | 2024-12-18 22:08 | - | |
| ruby-peek-pg/ | 2024-12-18 22:08 | - | |
| ruby-maven-tools/ | 2024-12-18 22:08 | - | |
| ruby-flexmock/ | 2024-12-18 22:08 | - | |
| ruby-grit/ | 2024-12-18 22:08 | - | |
| rust-laurel/ | 2024-12-18 22:51 | - | |
| ruby-openid/ | 2024-12-18 22:51 | - | |
| rocketcea/ | 2024-12-19 00:29 | - | |
| rustc-1.80/ | 2024-12-19 01:43 | - | |
| r8168/ | 2024-12-19 04:01 | - | |
| rustc-1.83/ | 2024-12-19 04:02 | - | |
| renpy/ | 2024-12-19 04:54 | - | |
| recoll/ | 2024-12-19 07:22 | - | |
| rust-always-assert/ | 2024-12-19 07:22 | - | |
| rust-symphonia-format-caf/ | 2024-12-19 15:28 | - | |
| rust-document-tree/ | 2024-12-19 16:43 | - | |
| rust-iter-fixed/ | 2024-12-19 16:45 | - | |
| rsgain/ | 2024-12-19 16:45 | - | |
| rust-rst-renderer/ | 2024-12-19 21:02 | - | |
| ruby-vips/ | 2024-12-19 22:02 | - | |
| rally/ | 2024-12-19 22:53 | - | |
| rust-associative-cache/ | 2024-12-19 23:08 | - | |
| rust-regolith-powerd/ | 2024-12-20 00:23 | - | |
| rust-trawldb/ | 2024-12-20 00:23 | - | |
| rust-typetag/ | 2024-12-20 00:23 | - | |
| rust-typeshare-annotation/ | 2024-12-20 00:23 | - | |
| rust-proc-macro-error2/ | 2024-12-20 00:23 | - | |
| rust-write16/ | 2024-12-20 01:56 | - | |
| rust-extended/ | 2024-12-20 01:56 | - | |
| rust-close-fds/ | 2024-12-20 01:56 | - | |
| rust-version-sync/ | 2024-12-20 03:03 | - | |
| rust-compiler-builtins/ | 2024-12-20 03:03 | - | |
| rust-dolby-vision/ | 2024-12-20 03:03 | - | |
| rust-stackdriver-logger/ | 2024-12-20 03:03 | - | |
| rust-magic-wormhole/ | 2024-12-20 04:07 | - | |
| rust-du-dust/ | 2024-12-20 07:57 | - | |
| rust-palette/ | 2024-12-20 07:57 | - | |
| rust-skeptic/ | 2024-12-20 07:57 | - | |
| rust-magic-wormhole-cli/ | 2024-12-20 08:55 | - | |
| rust-libgit2-sys/ | 2024-12-20 10:43 | - | |
| rust-boxcar/ | 2024-12-20 10:43 | - | |
| rust-terminfo/ | 2024-12-20 16:57 | - | |
| rust-color-print-proc-macro/ | 2024-12-20 16:57 | - | |
| rust-pcsc-sys/ | 2024-12-20 16:57 | - | |
| rust-rustpython-parser/ | 2024-12-20 16:57 | - | |
| rust-widestring/ | 2024-12-20 16:57 | - | |
| rust-safe-arch/ | 2024-12-20 22:07 | - | |
| requests-file/ | 2024-12-20 22:48 | - | |
| redmine/ | 2024-12-20 22:48 | - | |
| ruby-launchy-shim/ | 2024-12-21 01:02 | - | |
| ruby-uber/ | 2024-12-21 01:02 | - | |
| ruby-attr-encrypted/ | 2024-12-21 01:02 | - | |
| ruby-archive-zip/ | 2024-12-21 01:02 | - | |
| ruby-crass/ | 2024-12-21 01:02 | - | |
| rust-rst-parser/ | 2024-12-21 04:44 | - | |
| rust-cargo-c/ | 2024-12-21 04:44 | - | |
| runit-services/ | 2024-12-21 04:44 | - | |
| rust-color-print/ | 2024-12-21 06:12 | - | |
| rust-cursive-core/ | 2024-12-21 10:22 | - | |
| receptor/ | 2024-12-21 10:40 | - | |
| rocksdb/ | 2024-12-21 13:00 | - | |
| rust-oxhttp/ | 2024-12-21 16:42 | - | |
| rust-libc/ | 2024-12-21 16:42 | - | |
| rust-hdrhistogram/ | 2024-12-21 16:42 | - | |
| rancid/ | 2024-12-21 16:52 | - | |
| reapr/ | 2024-12-21 22:44 | - | |
| rdiff-backup/ | 2024-12-21 22:44 | - | |
| rust-rebuildctl/ | 2024-12-21 22:48 | - | |
| roundcube/ | 2024-12-21 22:48 | - | |
| rednotebook/ | 2024-12-21 22:48 | - | |
| rust-pulldown-cmark-escape/ | 2024-12-22 04:36 | - | |
| ruby-chef-config/ | 2024-12-22 10:17 | - | |
| rust-sqlx-mysql/ | 2024-12-22 10:42 | - | |
| rust-pcsc/ | 2024-12-22 10:42 | - | |
| request-tracker4/ | 2024-12-22 10:42 | - | |
| refpolicy/ | 2024-12-22 10:42 | - | |
| rust-zerocopy-derive/ | 2024-12-22 11:15 | - | |
| rust-gdk-pixbuf-sys/ | 2024-12-22 11:15 | - | |
| rust-zerocopy/ | 2024-12-22 14:10 | - | |
| rust-ruma-common/ | 2024-12-22 16:40 | - | |
| rust-rinja-derive/ | 2024-12-22 16:40 | - | |
| rust-pulldown-cmark/ | 2024-12-22 16:40 | - | |
| rust-makefile-lossless/ | 2024-12-22 16:40 | - | |
| rust-crokey-proc-macros/ | 2024-12-22 17:31 | - | |
| rust-coolor/ | 2024-12-22 17:31 | - | |
| reprof/ | 2024-12-22 22:23 | - | |
| rust-subversion/ | 2024-12-23 03:16 | - | |
| ruby-msgpack/ | 2024-12-23 03:16 | - | |
| rust-crokey/ | 2024-12-23 03:16 | - | |
| rust-terminal-light/ | 2024-12-23 03:16 | - | |
| rust-libadwaita/ | 2024-12-23 04:17 | - | |
| ratfor/ | 2024-12-23 10:45 | - | |
| rust-dysk-cli/ | 2024-12-23 12:35 | - | |
| r-cran-rsdmx/ | 2024-12-23 16:00 | - | |
| rust-reqsign/ | 2024-12-23 16:41 | - | |
| rust-concurrent-arena/ | 2024-12-23 16:41 | - | |
| rcheevos/ | 2024-12-23 16:41 | - | |
| rust-debian-repro-status/ | 2024-12-23 17:01 | - | |
| rust-sailfish-compiler/ | 2024-12-23 17:01 | - | |
| rust-xterm-query/ | 2024-12-23 22:53 | - | |
| rust-lfs-core/ | 2024-12-23 22:53 | - | |
| rust-gdk4-x11-sys/ | 2024-12-23 22:53 | - | |
| rust-gdk4-wayland-sys/ | 2024-12-23 22:53 | - | |
| rust-clearscreen/ | 2024-12-23 22:53 | - | |
| rust-probe/ | 2024-12-24 09:00 | - | |
| rust-chardetng/ | 2024-12-24 09:00 | - | |
| rust-derive-where/ | 2024-12-24 09:00 | - | |
| rust-trim-in-place/ | 2024-12-24 09:00 | - | |
| rust-cursive-table-view/ | 2024-12-24 09:00 | - | |
| rust-librocksdb-sys/ | 2024-12-24 09:00 | - | |
| rust-cplus-demangle/ | 2024-12-24 09:00 | - | |
| retroarch-assets/ | 2024-12-24 09:55 | - | |
| rust-termimad/ | 2024-12-24 10:39 | - | |
| rust-pango-sys/ | 2024-12-24 10:39 | - | |
| rust-ognibuild/ | 2024-12-24 10:39 | - | |
| rust-gio-sys/ | 2024-12-24 10:39 | - | |
| rust-glib-sys/ | 2024-12-24 10:39 | - | |
| rust-gdk4/ | 2024-12-24 10:39 | - | |
| reprotest/ | 2024-12-24 10:39 | - | |
| rust-effective-limits/ | 2024-12-24 10:51 | - | |
| rust-sys-info/ | 2024-12-24 11:45 | - | |
| rust-rust-ini/ | 2024-12-24 13:30 | - | |
| rust-broot/ | 2024-12-24 16:39 | - | |
| rust-backdown/ | 2024-12-24 16:39 | - | |
| rust-config/ | 2024-12-24 17:00 | - | |
| rust-rusty-paserk/ | 2024-12-24 22:43 | - | |
| rust-rust-argon2/ | 2024-12-24 22:43 | - | |
| rust-dysk/ | 2024-12-24 22:43 | - | |
| rust-libbpf-rs/ | 2024-12-25 04:39 | - | |
| rust-libbpf-cargo/ | 2024-12-25 04:39 | - | |
| rust-sequoia-sqv/ | 2024-12-25 08:25 | - | |
| rust-vid-dup-finder-lib/ | 2024-12-25 21:40 | - | |
| rust-just/ | 2024-12-25 22:42 | - | |
| rust-freedesktop-icons/ | 2024-12-25 22:42 | - | |
| rust-asahi-wifisync/ | 2024-12-25 22:42 | - | |
| rust-asahi-btsync/ | 2024-12-25 22:42 | - | |
| rsyslog-doc/ | 2024-12-25 23:11 | - | |
| rust-sequoia-chameleon-gnupg/ | 2024-12-25 23:11 | - | |
| rustup/ | 2024-12-25 23:11 | - | |
| rust-ruzstd/ | 2024-12-25 23:11 | - | |
| rust-wast/ | 2024-12-25 23:11 | - | |
| rust-rocksdb/ | 2024-12-25 23:11 | - | |
| rust-gdk4-sys/ | 2024-12-25 23:11 | - | |
| rust-gdk4-x11/ | 2024-12-25 23:11 | - | |
| rust-glib-macros/ | 2024-12-25 23:11 | - | |
| rust-gimli/ | 2024-12-25 23:11 | - | |
| r-cran-fastica/ | 2024-12-25 23:11 | - | |
| rust-ruma-state-res/ | 2024-12-26 04:41 | - | |
| rust-ffmpeg-cmdline-utils/ | 2024-12-26 04:41 | - | |
| rust-object/ | 2024-12-26 06:55 | - | |
| rust-addr2line/ | 2024-12-26 08:45 | - | |
| rust-gobject-sys/ | 2024-12-26 10:41 | - | |
| rust-implib/ | 2024-12-26 12:16 | - | |
| rust-elfx86exts/ | 2024-12-26 16:28 | - | |
| rust-gdk-pixbuf/ | 2024-12-26 16:28 | - | |
| rust-memuse/ | 2024-12-26 16:29 | - | |
| rust-nonempty/ | 2024-12-26 16:29 | - | |
| rust-i18n-embed/ | 2024-12-26 16:29 | - | |
| rust-jpegxl-sys/ | 2024-12-26 16:29 | - | |
| rust-i18n-embed-impl/ | 2024-12-26 16:29 | - | |
| rust-glib/ | 2024-12-26 16:29 | - | |
| rust-framehop/ | 2024-12-26 16:29 | - | |
| rust-i18n-config/ | 2024-12-26 16:29 | - | |
| rust-gdk4-wayland/ | 2024-12-26 16:29 | - | |
| rust-color-eyre/ | 2024-12-26 16:29 | - | |
| rust-clap-help/ | 2024-12-26 16:29 | - | |
| rust-backtrace/ | 2024-12-26 16:29 | - | |
| rust-jpegxl-rs/ | 2024-12-26 20:15 | - | |
| rust-i18n-embed-fl/ | 2024-12-26 20:15 | - | |
