You're awesome. Have a mirror on us.
We love Linux, privacy, fast and affordable internet access, and working to fulfill our mission of internet freedom for all.
![[ICO]](/icons/blank.gif){kind=icon} | Name | Last modified | Size | Description |
|---|---|---|---|---|
![[PARENTDIR]](/icons/back.gif){kind=icon} | Parent Directory | - | ||
![[DIR]](/icons/folder.gif){kind=icon} | i2c-tools/ | 2021-02-05 06:49 | - | |
| i2p/ | 2021-05-25 01:42 | - | |
| i2pd/ | 2021-03-16 07:42 | - | |
| i2util/ | 2019-10-02 09:01 | - | |
| i3-wm/ | 2021-02-23 18:42 | - | |
| i3blocks/ | 2018-03-06 11:36 | - | |
| i3lock-fancy/ | 2020-02-22 01:14 | - | |
| i3lock/ | 2020-12-06 06:43 | - | |
| i3pystatus/ | 2019-12-06 12:41 | - | |
| i3status/ | 2020-05-18 19:42 | - | |
| i7z/ | 2020-04-28 19:42 | - | |
| i8kutils/ | 2021-02-11 18:56 | - | |
| i18nspector/ | 2020-10-11 18:22 | - | |
| i810switch/ | 2017-04-03 07:29 | - | |
| iagno/ | 2021-01-17 19:48 | - | |
| iannix/ | 2021-03-14 19:42 | - | |
| iapws/ | 2020-07-13 19:42 | - | |
| iat/ | 2018-03-06 17:19 | - | |
| iaxmodem/ | 2021-05-13 19:44 | - | |
| ibam/ | 2017-04-03 07:26 | - | |
| ibm-3270/ | 2020-11-24 01:15 | - | |
| ibniz/ | 2018-03-06 17:43 | - | |
| ibod/ | 2018-03-06 11:28 | - | |
| ibsim/ | 2021-02-13 00:42 | - | |
| ibuffer-projectile/ | 2020-03-11 19:50 | - | |
| ibuffer-vc/ | 2020-03-18 01:42 | - | |
| ibus-anthy/ | 2021-05-20 19:42 | - | |
| ibus-array/ | 2021-01-06 18:42 | - | |
| ibus-avro/ | 2020-09-28 19:42 | - | |
| ibus-braille/ | 2020-11-11 13:37 | - | |
| ibus-cangjie/ | 2019-12-26 18:41 | - | |
| ibus-chewing/ | 2019-01-15 19:54 | - | |
| ibus-client-clutter/ | 2021-04-07 19:42 | - | |
| ibus-hangul/ | 2020-11-01 01:42 | - | |
| ibus-input-pad/ | 2018-11-29 20:07 | - | |
| ibus-keyman/ | 2019-02-02 20:09 | - | |
| ibus-kkc/ | 2018-11-09 02:02 | - | |
| ibus-kmfl/ | 2019-01-14 19:55 | - | |
| ibus-libpinyin/ | 2021-01-06 18:42 | - | |
| ibus-libthai/ | 2020-05-03 19:42 | - | |
| ibus-libzhuyin/ | 2021-01-06 18:42 | - | |
| ibus-m17n/ | 2020-07-12 01:42 | - | |
| ibus-pinyin/ | 2020-11-21 12:42 | - | |
| ibus-rime/ | 2021-01-23 18:42 | - | |
| ibus-skk/ | 2018-10-08 19:53 | - | |
| ibus-sunpinyin/ | 2020-01-18 00:46 | - | |
| ibus-table-chinese/ | 2018-10-02 20:03 | - | |
| ibus-table-extraphrase/ | 2019-12-24 00:46 | - | |
| ibus-table-others/ | 2020-06-23 19:47 | - | |
| ibus-table/ | 2021-01-19 18:42 | - | |
| ibus-typing-booster/ | 2021-03-10 18:42 | - | |
| ibus-unikey/ | 2020-08-28 19:42 | - | |
| ibus-zhuyin/ | 2018-07-07 18:53 | - | |
| ibus/ | 2020-12-22 18:42 | - | |
| ibutils/ | 2020-11-16 18:47 | - | |
| ical2html/ | 2018-03-06 18:13 | - | |
| icb-utils/ | 2020-11-22 18:42 | - | |
| icc-profiles-free/ | 2021-01-01 18:55 | - | |
| icdiff/ | 2019-10-02 11:37 | - | |
| ice-builder-gradle/ | 2018-02-10 17:58 | - | |
| ice/ | 2020-10-10 10:20 | - | |
| icebreaker/ | 2019-10-01 18:51 | - | |
| icecast2/ | 2020-10-15 01:42 | - | |
| icecc-monitor/ | 2021-01-21 00:42 | - | |
| icecc/ | 2020-03-11 19:42 | - | |
| icecream-sundae/ | 2020-03-31 07:42 | - | |
| icecream/ | 2021-01-09 19:04 | - | |
| icedtea-web/ | 2020-06-18 19:42 | - | |
| ices2/ | 2020-10-19 02:15 | - | |
| icewm/ | 2021-02-25 18:42 | - | |
| icheck/ | 2021-02-05 06:42 | - | |
| icinga/ | 2020-07-29 19:42 | - | |
| icinga2/ | 2020-12-23 18:42 | - | |
| icingaweb2-module-audit/ | 2020-11-21 18:42 | - | |
| icingaweb2-module-boxydash/ | 2021-02-18 00:42 | - | |
| icingaweb2-module-businessprocess/ | 2021-03-06 18:44 | - | |
| icingaweb2-module-cube/ | 2021-02-09 18:42 | - | |
| icingaweb2-module-director/ | 2020-09-04 01:48 | - | |
| icingaweb2-module-eventdb/ | 2020-09-04 01:48 | - | |
| icingaweb2-module-fileshipper/ | 2021-02-11 18:56 | - | |
| icingaweb2-module-ipl/ | 2021-02-09 18:42 | - | |
| icingaweb2-module-map/ | 2020-09-04 01:48 | - | |
| icingaweb2-module-nagvis/ | 2020-09-04 01:48 | - | |
| icingaweb2-module-pdfexport/ | 2021-02-11 18:56 | - | |
| icingaweb2-module-pnp/ | 2020-09-09 19:42 | - | |
| icingaweb2-module-reactbundle/ | 2021-02-11 18:56 | - | |
| icingaweb2-module-statusmap/ | 2020-09-04 01:48 | - | |
| icingaweb2/ | 2020-12-28 18:42 | - | |
| icli/ | 2016-09-13 13:16 | - | |
| icmake/ | 2020-01-18 19:02 | - | |
| icmpinfo/ | 2019-10-02 11:25 | - | |
| icmptx/ | 2018-03-06 11:14 | - | |
| icmpush/ | 2018-03-06 12:11 | - | |
| icoextract/ | 2021-01-15 18:55 | - | |
| icom/ | 2019-10-01 19:20 | - | |
| icon-naming-utils/ | 2020-08-24 01:47 | - | |
| icon-slicer/ | 2020-03-26 02:13 | - | |
| icon/ | 2018-12-23 19:54 | - | |
| iconnect-tools/ | 2020-05-06 13:44 | - | |
| icoutils/ | 2019-10-02 11:13 | - | |
| icu-ext/ | 2021-02-06 18:43 | - | |
| icu-le-hb/ | 2020-06-10 07:42 | - | |
| icu/ | 2022-03-26 07:44 | - | |
| icu4j-4.4/ | 2021-02-18 00:52 | - | |
| icu4j/ | 2021-02-23 18:42 | - | |
| id-utils/ | 2020-05-29 19:50 | - | |
| id3/ | 2020-05-05 19:48 | - | |
| id3lib3.8.3/ | 2021-01-06 19:00 | - | |
| id3ren/ | 2018-03-06 19:24 | - | |
| id3tool/ | 2020-05-08 19:54 | - | |
| id3v2/ | 2021-02-15 18:42 | - | |
| idba/ | 2020-04-27 19:42 | - | |
| iddawc/ | 2021-01-18 18:42 | - | |
| ideep/ | 2020-11-27 00:48 | - | |
| ident2/ | 2020-12-18 18:42 | - | |
| identicurse/ | 2016-09-13 13:44 | - | |
| identify/ | 2021-02-04 17:56 | - | |
| identity4c/ | 2018-03-06 10:54 | - | |
| idesk/ | 2019-10-01 12:39 | - | |
| ideviceinstaller/ | 2020-07-15 08:20 | - | |
| idevicerestore/ | 2020-10-27 19:47 | - | |
| idjc/ | 2018-07-28 09:03 | - | |
| idl-font-lock-el/ | 2021-01-11 19:05 | - | |
| idlastro/ | 2021-02-02 18:42 | - | |
| idle3-tools/ | 2020-06-23 19:42 | - | |
| idlestat/ | 2020-07-15 19:42 | - | |
| idm-console-framework/ | 2018-12-14 19:53 | - | |
| ido-ubiquitous/ | 2021-02-02 18:42 | - | |
| ido-vertical-mode/ | 2021-02-02 00:42 | - | |
| idseq-bench/ | 2021-01-25 18:42 | - | |
| idzebra/ | 2020-11-21 18:42 | - | |
| iec16022/ | 2018-03-06 18:08 | - | |
| iedit/ | 2021-02-04 17:56 | - | |
| ieee-data/ | 2021-06-23 19:42 | - | |
| iem-plugin-suite/ | 2020-04-23 19:42 | - | |
| ifcplusplus/ | 2020-06-14 07:42 | - | |
| ifd-gempc/ | 2020-10-02 07:42 | - | |
| ifenslave/ | 2021-05-16 19:42 | - | |
| ifetch-tools/ | 2021-03-23 19:42 | - | |
| ifhp/ | 2020-08-16 19:48 | - | |
| ifile/ | 2019-10-02 12:40 | - | |
| ifmail/ | 2019-10-01 16:25 | - | |
| ifmetric/ | 2019-01-24 19:54 | - | |
| ifplugd/ | 2020-08-29 19:47 | - | |
| ifrench-gut/ | 2021-01-04 06:42 | - | |
| ifrench/ | 2021-01-22 18:42 | - | |
| ifrit/ | 2019-01-06 07:54 | - | |
| ifscheme/ | 2020-05-01 19:49 | - | |
| ifstat/ | 2020-10-02 07:42 | - | |
| iftop/ | 2020-07-27 01:47 | - | |
| ifupdown-extra/ | 2021-06-15 19:42 | - | |
| ifupdown-multi/ | 2020-11-03 00:48 | - | |
| ifupdown/ | 2020-11-19 06:42 | - | |
| ifupdown2/ | 2020-09-20 01:48 | - | |
| ifuse/ | 2018-10-20 19:54 | - | |
| igaelic/ | 2021-01-13 12:42 | - | |
| igal2/ | 2020-12-13 18:42 | - | |
| igdiscover/ | 2020-02-10 00:47 | - | |
| igerman98/ | 2021-01-25 18:42 | - | |
| igmpproxy/ | 2021-02-01 18:49 | - | |
| ignition-cmake/ | 2021-05-26 18:40 | - | |
| ignition-common/ | 2021-01-15 18:42 | - | |
| ignition-fuel-tools/ | 2020-12-15 06:42 | - | |
| ignition-math/ | 2020-12-05 18:42 | - | |
| ignition-math2/ | 2018-03-06 18:25 | - | |
| ignition-math4/ | 2018-04-15 18:59 | - | |
| ignition-msgs/ | 2021-02-06 18:44 | - | |
| ignition-transport/ | 2020-07-22 07:42 | - | |
| igor/ | 2020-08-14 19:42 | - | |
| igraph/ | 2021-02-15 00:43 | - | |
| igtf-policy-bundle/ | 2021-01-28 18:42 | - | |
| ii-esu/ | 2020-07-29 19:53 | - | |
| ii/ | 2019-10-01 17:08 | - | |
| iio-sensor-proxy/ | 2021-02-06 18:42 | - | |
| iipimage/ | 2020-03-18 01:42 | - | |
| iirish/ | 2021-01-13 12:42 | - | |
| iisemulator/ | 2021-01-12 18:57 | - | |
| iitalian/ | 2019-10-02 10:55 | - | |
| iitii/ | 2020-11-09 00:47 | - | |
| ijs/ | 2019-10-02 11:58 | - | |
| ikarus/ | 2020-05-22 19:48 | - | |
| ike-scan/ | 2021-02-05 18:49 | - | |
| ikiwiki-hosting/ | 2019-12-01 00:49 | - | |
| ikiwiki/ | 2020-02-15 00:47 | - | |
| ilisp/ | 2021-01-09 19:04 | - | |
| ilmbase/ | 2021-02-02 00:42 | - | |
| im-config/ | 2021-12-26 18:42 | - | |
| im/ | 2021-01-06 19:00 | - | |
| ima-evm-utils/ | 2020-05-06 19:48 | - | |
| image-factory/ | 2021-02-09 18:42 | - | |
| imageindex/ | 2019-01-22 19:54 | - | |
| imagej/ | 2021-01-15 18:42 | - | |
| imagemagick/ | 2021-06-09 19:42 | - | |
| imagetooth/ | 2020-11-27 00:48 | - | |
| imagevis3d/ | 2018-12-31 09:03 | - | |
| imagination/ | 2020-07-24 19:42 | - | |
| imanx/ | 2021-01-13 12:42 | - | |
| imapcopy/ | 2018-03-06 18:20 | - | |
| imapfilter/ | 2020-12-23 18:42 | - | |
| imaprowl/ | 2021-01-13 18:58 | - | |
| imaptool/ | 2021-02-11 18:56 | - | |
| imbalanced-learn/ | 2020-12-13 18:42 | - | |
| imdbpy/ | 2021-03-12 12:43 | - | |
| imediff/ | 2021-01-05 18:50 | - | |
| imediff2/ | 2021-01-09 19:04 | - | |
| imenu-list/ | 2020-12-17 18:42 | - | |
| imexam/ | 2020-10-21 11:56 | - | |
| img2pdf/ | 2020-09-05 19:42 | - | |
| imgp/ | 2020-12-11 18:43 | - | |
| imgsizer/ | 2020-01-13 00:46 | - | |
| imgui/ | 2021-03-15 19:42 | - | |
| imgvtopgm/ | 2018-03-06 15:32 | - | |
| imhangul-common/ | 2016-09-13 13:08 | - | |
| iml/ | 2018-03-06 19:12 | - | |
| imlib2/ | 2021-02-03 15:37 | - | |
| impacket/ | 2021-06-01 19:42 | - | |
| impass/ | 2020-01-12 06:44 | - | |
| importlib-resources/ | 2021-02-03 15:37 | - | |
| importmagic/ | 2018-05-09 18:59 | - | |
| impose+/ | 2021-01-07 18:57 | - | |
| imposm-parser/ | 2018-10-29 09:03 | - | |
| imposm/ | 2018-10-29 09:03 | - | |
| impress.js/ | 2019-11-26 00:50 | - | |
| impressive-display/ | 2018-08-25 13:53 | - | |
| impressive/ | 2020-06-13 19:42 | - | |
| imv/ | 2021-06-04 19:42 | - | |
| imview/ | 2021-02-23 18:42 | - | |
| imvirt/ | 2020-12-25 18:42 | - | |
| imwheel/ | 2019-10-02 08:38 | - | |
| imx-code-signing-tool/ | 2021-04-17 19:42 | - | |
| imx-usb-loader/ | 2020-06-07 19:42 | - | |
| in-toto/ | 2021-03-17 19:44 | - | |
| inadyn/ | 2018-03-06 12:10 | - | |
| inchi/ | 2020-08-14 19:42 | - | |
| incremental/ | 2020-11-09 18:42 | - | |
| incron/ | 2020-12-11 18:43 | - | |
| indelible/ | 2020-06-14 19:47 | - | |
| indent/ | 2019-02-12 19:54 | - | |
| indexed-gzip/ | 2021-02-05 18:42 | - | |
| indi/ | 2021-01-22 18:42 | - | |
| indicator-sensors/ | 2020-08-07 19:42 | - | |
| indigo/ | 2020-08-09 01:42 | - | |
| inetsim/ | 2021-02-15 00:42 | - | |
| inetutils/ | 2021-02-15 00:43 | - | |
| infernal/ | 2020-12-22 18:42 | - | |
| infineon-firmware-updater-master/ | 2019-08-19 12:20 | - | |
| infiniband-diags/ | 2018-12-26 07:53 | - | |
| infinipath-psm/ | 2021-01-12 06:42 | - | |
| inflection/ | 2019-10-01 18:20 | - | |
| influxdb-python/ | 2020-03-22 19:42 | - | |
| influxdb/ | 2021-03-11 12:42 | - | |
| infnoise/ | 2021-01-02 18:52 | - | |
| info-beamer/ | 2019-11-17 07:05 | - | |
| info2man/ | 2021-02-11 18:56 | - | |
| info2www/ | 2021-01-06 19:00 | - | |
| infomas-asl/ | 2020-12-11 18:50 | - | |
| infon/ | 2020-08-08 19:42 | - | |
| inform-mode/ | 2016-09-28 02:03 | - | |
| inform6-compiler/ | 2019-10-02 09:59 | - | |
| inform6-library/ | 2021-01-11 19:05 | - | |
| inhomog/ | 2020-05-12 19:57 | - | |
| ini4j/ | 2021-02-07 18:42 | - | |
| inifile/ | 2021-01-10 19:01 | - | |
| iniparser/ | 2019-01-05 19:53 | - | |
| init-system-helpers/ | 2020-12-25 18:42 | - | |
| initramfs-tools/ | 2022-03-24 14:33 | - | |
| initsplit-el/ | 2021-02-04 17:56 | - | |
| initz/ | 2021-01-13 18:58 | - | |
| injeqt/ | 2018-03-06 17:08 | - | |
| ink-generator/ | 2021-01-07 18:57 | - | |
| ink/ | 2019-03-07 19:54 | - | |
| inkscape-open-symbols/ | 2018-03-15 18:05 | - | |
| inkscape-speleo/ | 2020-01-10 00:48 | - | |
| inkscape-survex-export/ | 2021-01-05 18:42 | - | |
| inkscape-textext/ | 2020-12-14 18:47 | - | |
| inkscape/ | 2021-04-29 19:42 | - | |
| inn/ | 2021-02-05 06:51 | - | |
| inn2/ | 2021-03-03 18:44 | - | |
| innoextract/ | 2020-12-14 18:42 | - | |
| ino-headers/ | 2021-01-14 06:42 | - | |
| inosync/ | 2019-02-16 19:54 | - | |
| inoticoming/ | 2019-10-01 15:16 | - | |
| inotify-hookable/ | 2021-03-26 20:00 | - | |
| inotify-tools/ | 2020-06-10 15:37 | - | |
| inotifyx/ | 2019-12-16 00:42 | - | |
| input-pad/ | 2019-12-29 00:46 | - | |
| input-utils/ | 2018-03-06 12:21 | - | |
| inputlirc/ | 2020-03-16 13:51 | - | |
| inputplug/ | 2020-03-08 09:57 | - | |
| insighttoolkit4/ | 2021-02-06 18:43 | - | |
| insilicoseq/ | 2021-02-11 01:16 | - | |
| inspectrum/ | 2020-12-15 18:42 | - | |
| inspircd/ | 2021-09-27 01:42 | - | |
| insserv/ | 2021-03-14 19:42 | - | |
| install-mimic/ | 2020-05-08 19:55 | - | |
| installation-birthday/ | 2020-04-27 19:42 | - | |
| installation-guide/ | 2022-04-03 19:42 | - | |
| installation-locale/ | 2021-04-10 19:46 | - | |
| installation-report/ | 2021-03-12 18:42 | - | |
| instaparse-clojure/ | 2021-01-11 19:05 | - | |
| instead/ | 2020-09-14 19:46 | - | |
| insubstantial/ | 2019-10-01 19:17 | - | |
| integrit/ | 2021-01-19 00:45 | - | |
| intel-cmt-cat/ | 2020-12-28 18:42 | - | |
| intel-compute-runtime/ | 2020-11-18 20:15 | - | |
| intel-gmmlib/ | 2021-01-12 18:42 | - | |
| intel-gpu-tools/ | 2020-07-17 16:07 | - | |
| intel-graphics-compiler/ | 2020-11-17 18:41 | - | |
| intel-hdcp/ | 2020-10-29 19:47 | - | |
| intel-ipsec-mb/ | 2020-11-08 18:42 | - | |
| intel-media-driver/ | 2021-02-18 00:42 | - | |
| intel-mediasdk/ | 2021-02-06 18:43 | - | |
| intel-opencl-clang/ | 2020-11-22 18:42 | - | |
| intel-processor-trace/ | 2020-10-27 19:42 | - | |
| intel-vaapi-driver/ | 2020-07-21 19:42 | - | |
| intel2gas/ | 2019-10-01 18:01 | - | |
| intelhex/ | 2020-12-13 18:50 | - | |
| intellij-annotations/ | 2020-09-21 01:42 | - | |
| intellij-java-compatibility/ | 2020-11-03 18:47 | - | |
| intelrdfpmath/ | 2021-01-22 18:42 | - | |
| inteltool/ | 2017-04-03 07:19 | - | |
| intercal/ | 2020-08-09 19:42 | - | |
| interimap/ | 2021-01-09 18:42 | - | |
| intervalstorej/ | 2020-11-25 06:58 | - | |
| intlfonts/ | 2021-01-06 19:00 | - | |
| intltool-debian/ | 2019-02-02 19:53 | - | |
| intltool/ | 2020-12-17 18:42 | - | |
| invada-studio-plugins-lv2/ | 2018-03-06 18:51 | - | |
| invada-studio-plugins/ | 2018-03-06 20:27 | - | |
| invaders/ | 2020-07-31 07:42 | - | |
| inventor/ | 2021-05-05 19:42 | - | |
| invesalius/ | 2020-11-21 12:42 | - | |
| invokebinder/ | 2017-07-25 13:59 | - | |
| inxi/ | 2021-02-18 00:42 | - | |
| io-stringy/ | 2019-03-17 19:54 | - | |
| iodine/ | 2020-10-01 19:48 | - | |
| iog/ | 2018-12-07 19:53 | - | |
| ionit/ | 2021-06-03 19:42 | - | |
| ioping/ | 2020-10-02 07:42 | - | |
| ioport/ | 2019-10-01 13:22 | - | |
| ioprocess/ | 2018-07-21 19:53 | - | |
| ioquake3/ | 2020-12-25 18:42 | - | |
| iotjs/ | 2020-11-01 01:42 | - | |
| iotop-c/ | 2021-10-17 19:42 | - | |
| iotop/ | 2020-07-06 19:47 | - | |
| ip2host/ | 2021-01-06 19:00 | - | |
| ip4r/ | 2020-11-14 12:42 | - | |
| ipadic/ | 2021-01-17 12:42 | - | |
| ipband/ | 2020-11-18 20:15 | - | |
| ipcalc-ng/ | 2020-12-22 18:42 | - | |
| ipcalc/ | 2020-07-17 19:51 | - | |
| ipcheck/ | 2016-10-21 00:56 | - | |
| ipdb/ | 2020-07-31 07:44 | - | |
| ipe-tools/ | 2020-11-21 12:42 | - | |
| ipe/ | 2021-01-21 13:24 | - | |
| iperf/ | 2020-10-14 13:42 | - | |
| iperf3/ | 2020-10-15 01:42 | - | |
| ipfm/ | 2018-03-06 13:05 | - | |
| ipgrab/ | 2019-12-11 00:52 | - | |
| ipheth/ | 2018-03-06 20:24 | - | |
| ipig/ | 2020-11-12 06:46 | - | |
| ipip/ | 2020-08-11 03:05 | - | |
| ipkungfu/ | 2018-03-06 13:59 | - | |
| ipmctl/ | 2021-03-05 00:43 | - | |
| ipmitool/ | 2021-09-12 19:42 | - | |
| ipmiutil/ | 2020-09-26 02:15 | - | |
| ipolish/ | 2021-02-06 18:44 | - | |
| ipp-usb/ | 2021-04-13 19:42 | - | |
| ippl/ | 2018-03-06 11:06 | - | |
| ippusbxd/ | 2020-08-26 13:42 | - | |
| ipqalc/ | 2020-12-25 18:42 | - | |
| iprange/ | 2019-01-10 19:54 | - | |
| iproute2/ | 2021-03-11 12:42 | - | |
| iprutils/ | 2021-03-09 01:15 | - | |
| ips/ | 2018-05-24 02:06 | - | |
| ipset/ | 2021-02-11 01:15 | - | |
| ipsvd/ | 2019-10-02 09:50 | - | |
| iptables-converter/ | 2020-06-13 19:48 | - | |
| iptables-netflow/ | 2021-05-02 19:42 | - | |
| iptables-optimizer/ | 2016-12-31 01:04 | - | |
| iptables-persistent/ | 2021-03-01 18:42 | - | |
| iptables/ | 2021-01-25 18:42 | - | |
| iptotal/ | 2021-03-07 18:42 | - | |
| iptraf-ng/ | 2020-11-08 18:42 | - | |
| iptstate/ | 2018-05-24 02:06 | - | |
| iptux/ | 2021-02-03 15:37 | - | |
| iputils/ | 2021-09-09 16:38 | - | |
| ipv6calc/ | 2020-08-25 19:48 | - | |
| ipv6pref/ | 2019-10-01 16:19 | - | |
| ipv6toolkit/ | 2020-08-18 11:17 | - | |
| ipvsadm/ | 2020-03-16 13:51 | - | |
| ipwatchd-gnotify/ | 2018-03-06 21:25 | - | |
| ipwatchd/ | 2018-03-06 20:44 | - | |
| ipxe/ | 2021-02-23 18:42 | - | |
| ipy/ | 2021-02-06 18:43 | - | |
| ipykernel/ | 2021-01-25 18:42 | - | |
| ipyparallel/ | 2020-10-31 01:47 | - | |
| ipython-genutils/ | 2020-10-25 19:42 | - | |
| ipython/ | 2022-04-03 19:42 | - | |
| ipywidgets/ | 2021-02-18 00:42 | - | |
| iqtree/ | 2019-12-15 01:13 | - | |
| ir.lv2/ | 2020-05-23 19:42 | - | |
| iraf-fitsutil/ | 2020-08-30 07:42 | - | |
| iraf-mscred/ | 2020-08-30 07:42 | - | |
| iraf-rvsao/ | 2020-08-30 07:42 | - | |
| iraf-sptable/ | 2020-08-30 07:42 | - | |
| iraf/ | 2020-08-30 07:42 | - | |
| ircd-hybrid/ | 2021-03-15 19:42 | - | |
| ircd-irc2/ | 2020-12-15 18:47 | - | |
| ircd-ircu/ | 2020-08-26 01:42 | - | |
| ircii/ | 2021-09-12 19:42 | - | |
| irclog2html/ | 2019-10-01 13:32 | - | |
| ircmarkers/ | 2018-06-21 02:03 | - | |
| irker/ | 2021-03-03 18:44 | - | |
| iroffer/ | 2020-04-13 19:50 | - | |
| ironic-inspector/ | 2021-01-29 18:42 | - | |
| ironic-tempest-plugin/ | 2020-10-28 19:42 | - | |
| ironic-ui/ | 2021-07-21 02:24 | - | |
| ironic/ | 2021-01-29 18:42 | - | |
| ironseed/ | 2021-01-24 18:42 | - | |
| irony-mode/ | 2020-11-24 01:15 | - | |
| irqbalance/ | 2020-09-13 19:43 | - | |
| irrlicht/ | 2019-01-22 19:54 | - | |
| irsim/ | 2019-10-25 01:51 | - | |
| irssi-plugin-robustirc/ | 2018-06-23 02:03 | - | |
| irssi-plugin-xmpp/ | 2021-03-11 12:42 | - | |
| irssi-scripts/ | 2020-10-28 19:42 | - | |
| irssi/ | 2021-10-12 19:42 | - | |
| irstlm/ | 2019-10-01 14:19 | - | |
| irtt/ | 2021-03-02 06:42 | - | |
| isa-support/ | 2021-02-18 00:52 | - | |
| isakmpd/ | 2020-10-29 01:42 | - | |
| isatapd/ | 2020-08-24 01:47 | - | |
| isbg/ | 2020-08-25 19:42 | - | |
| isbnlib/ | 2019-10-19 01:51 | - | |
| isc-dhcp/ | 2021-09-12 19:42 | - | |
| isdnutils/ | 2019-03-13 19:54 | - | |
| iselect/ | 2020-04-23 19:54 | - | |
| isenkram/ | 2021-06-28 19:42 | - | |
| isl-0.18/ | 2018-03-27 19:09 | - | |
| isl/ | 2021-09-28 13:42 | - | |
| islamic-menus/ | 2020-02-02 00:47 | - | |
| ismrmrd/ | 2021-01-02 18:42 | - | |
| iso-codes/ | 2021-05-13 19:42 | - | |
| iso-flags-svg/ | 2021-01-01 18:55 | - | |
| iso-scan/ | 2021-06-09 19:42 | - | |
| isodate/ | 2020-03-21 01:47 | - | |
| isomaster/ | 2018-03-06 15:29 | - | |
| isomd5sum/ | 2021-02-05 06:44 | - | |
| isoqlog/ | 2020-12-21 18:50 | - | |
| isoquery/ | 2021-01-02 18:52 | - | |
| isorelax/ | 2019-03-13 19:54 | - | |
| isort/ | 2020-11-14 18:42 | - | |
| isospec/ | 2021-02-06 18:42 | - | |
| ispell-czech/ | 2021-01-13 12:42 | - | |
| ispell-et/ | 2021-01-08 06:46 | - | |
| ispell-fo/ | 2021-01-23 18:42 | - | |
| ispell-gl/ | 2021-01-08 06:46 | - | |
| ispell-lt/ | 2020-09-23 01:47 | - | |
| ispell-tl/ | 2021-01-08 06:46 | - | |
| ispell-uk/ | 2018-03-06 14:46 | - | |
| ispell.pt/ | 2021-01-23 18:42 | - | |
| ispell/ | 2021-01-24 18:42 | - | |
| isrcsubmit/ | 2019-03-13 19:54 | - | |
| isso/ | 2020-06-05 19:42 | - | |
| istack-commons/ | 2021-02-25 18:42 | - | |
| istgt/ | 2020-12-04 00:48 | - | |
| isync/ | 2021-12-26 18:42 | - | |
| itamae/ | 2021-01-07 18:42 | - | |
| itango/ | 2019-10-21 01:51 | - | |
| itcl3/ | 2021-01-11 06:42 | - | |
| itcl4/ | 2021-01-20 18:42 | - | |
| itk3/ | 2021-01-11 06:42 | - | |
| itk4/ | 2021-01-13 12:42 | - | |
| itksnap/ | 2019-12-14 18:51 | - | |
| itools/ | 2018-03-06 16:36 | - | |
| itop/ | 2018-03-06 20:09 | - | |
| its-playback-time/ | 2019-10-01 14:24 | - | |
| its/ | 2020-05-28 08:00 | - | |
| itsol/ | 2018-07-27 19:54 | - | |
| itstool/ | 2019-10-21 01:51 | - | |
| itypes/ | 2019-10-02 11:38 | - | |
| iva/ | 2021-01-30 18:43 | - | |
| ivar/ | 2020-12-25 18:42 | - | |
| iverilog/ | 2020-10-14 01:42 | - | |
| ivtools/ | 2021-01-13 18:42 | - | |
| ivy-debian-helper/ | 2021-01-28 00:42 | - | |
| ivy/ | 2021-01-22 18:50 | - | |
| ivykis/ | 2019-10-01 13:00 | - | |
| ivyplusplus/ | 2021-01-23 18:51 | - | |
| iw/ | 2020-11-13 18:42 | - | |
| iwatch/ | 2020-09-30 18:21 | - | |
| iwd/ | 2021-05-31 19:42 | - | |
| iwidgets4/ | 2021-01-06 19:01 | - | |
| iwyu/ | 2021-02-22 18:42 | - | |
| ixo-usb-jtag/ | 2020-07-02 19:50 | - | |
