You're awesome. Have a mirror on us.
We love Linux, privacy, fast and affordable internet access, and working to fulfill our mission of internet freedom for all.
![[ICO]](/icons/blank.gif){kind=icon} | Name | Last modified | Size | Description |
|---|---|---|---|---|
![[PARENTDIR]](/icons/back.gif){kind=icon} | Parent Directory | - | ||
![[DIR]](/icons/folder.gif){kind=icon} | c++-annotations/ | 2020-12-03 18:42 | - | |
| c-ares/ | 2022-07-02 00:20 | - | |
| c-blosc/ | 2020-12-18 18:42 | - | |
| c-graph/ | 2019-11-16 06:41 | - | |
| c-icap-modules/ | 2021-02-11 01:16 | - | |
| c-icap/ | 2021-02-09 18:42 | - | |
| c-sig/ | 2021-01-05 18:42 | - | |
| c2esp/ | 2020-07-31 07:44 | - | |
| c2hs/ | 2020-02-04 06:42 | - | |
| c2x/ | 2021-02-06 18:44 | - | |
| c3/ | 2021-01-23 18:42 | - | |
| c3p0/ | 2019-01-05 19:53 | - | |
| c2050/ | 2018-03-06 16:27 | - | |
| ca-certificates-java/ | 2019-10-01 19:02 | - | |
| ca-certificates/ | 2021-03-11 12:42 | - | |
| cabal-debian/ | 2020-07-10 19:42 | - | |
| cabextract/ | 2020-02-25 12:42 | - | |
| cached-property/ | 2020-12-27 18:42 | - | |
| cachefilesd/ | 2019-10-02 08:55 | - | |
| cachy/ | 2021-02-18 00:42 | - | |
| cackey/ | 2020-01-03 12:44 | - | |
| cacti-spine/ | 2021-01-15 18:42 | - | |
| cacti/ | 2021-03-11 12:42 | - | |
| cactoos/ | 2020-11-29 12:42 | - | |
| cadabra/ | 2018-11-07 19:53 | - | |
| cadabra2/ | 2021-02-08 18:48 | - | |
| cadaver/ | 2019-10-01 15:30 | - | |
| cadencii/ | 2021-01-11 18:58 | - | |
| cado/ | 2020-05-08 19:53 | - | |
| cadubi/ | 2020-12-23 18:42 | - | |
| cadvisor/ | 2021-03-02 06:42 | - | |
| cafeobj/ | 2020-02-29 18:42 | - | |
| caffe/ | 2021-02-06 18:43 | - | |
| caffeine-cache/ | 2021-01-13 18:54 | - | |
| caffeine/ | 2020-09-06 07:47 | - | |
| cain/ | 2018-07-25 19:53 | - | |
| cairo-5c/ | 2020-03-16 14:25 | - | |
| cairo-dock-plug-ins/ | 2021-01-13 18:42 | - | |
| cairo-dock/ | 2021-01-12 06:42 | - | |
| cairo-ocaml/ | 2020-11-13 01:18 | - | |
| cairo/ | 2021-03-11 12:42 | - | |
| cairocffi/ | 2021-01-02 18:42 | - | |
| cairodevice/ | 2020-07-21 19:42 | - | |
| cairomm/ | 2019-01-08 19:54 | - | |
| cairosvg/ | 2021-01-28 18:42 | - | |
| caja-actions/ | 2018-08-04 19:54 | - | |
| caja-admin/ | 2021-01-02 18:42 | - | |
| caja-eiciel/ | 2020-04-21 02:03 | - | |
| caja-extensions/ | 2020-09-01 19:42 | - | |
| caja-mediainfo/ | 2020-09-05 19:42 | - | |
| caja-rename/ | 2020-12-03 18:42 | - | |
| caja-seahorse/ | 2020-08-28 19:47 | - | |
| caja/ | 2020-02-27 18:42 | - | |
| cajun/ | 2016-09-13 13:59 | - | |
| cakephp/ | 2021-01-07 18:53 | - | |
| cal/ | 2018-12-24 19:53 | - | |
| cal3d/ | 2018-03-06 13:12 | - | |
| calabash/ | 2016-09-13 14:20 | - | |
| calamares-settings-debian/ | 2021-08-05 19:42 | - | |
| calamares/ | 2021-10-12 01:43 | - | |
| calamaris/ | 2017-11-20 11:59 | - | |
| calc/ | 2019-10-07 01:49 | - | |
| calcoo/ | 2020-11-12 18:42 | - | |
| calculix-ccx-doc/ | 2016-09-13 14:07 | - | |
| calculix-ccx-test/ | 2016-09-13 11:44 | - | |
| calculix-ccx/ | 2021-02-27 00:42 | - | |
| calculix-cgx/ | 2020-09-16 19:46 | - | |
| calcurse/ | 2020-07-24 02:15 | - | |
| caldav-tester/ | 2020-12-16 00:42 | - | |
| calendar/ | 2020-11-13 01:18 | - | |
| calendarserver/ | 2018-12-31 19:53 | - | |
| calf/ | 2019-12-21 12:41 | - | |
| calibre/ | 2021-12-26 18:42 | - | |
| calife/ | 2021-01-02 06:42 | - | |
| callaudiod/ | 2021-03-09 01:15 | - | |
| calligra/ | 2020-12-15 06:42 | - | |
| calligraplan/ | 2021-02-09 18:42 | - | |
| callisto/ | 2020-08-30 07:42 | - | |
| calls/ | 2021-03-04 00:42 | - | |
| calypso/ | 2021-01-22 18:42 | - | |
| camera.app/ | 2020-07-28 02:35 | - | |
| camitk/ | 2020-01-27 00:47 | - | |
| caml-crush/ | 2020-11-30 01:15 | - | |
| caml-mode/ | 2019-11-12 06:44 | - | |
| caml2html/ | 2020-11-13 01:18 | - | |
| camlbz2/ | 2020-11-13 01:18 | - | |
| camlidl-doc/ | 2020-08-02 01:46 | - | |
| camlidl/ | 2020-11-13 01:18 | - | |
| camlimages/ | 2020-12-05 18:42 | - | |
| camljava/ | 2020-11-30 01:15 | - | |
| camlmix/ | 2020-10-15 13:42 | - | |
| camlp4/ | 2020-11-14 12:42 | - | |
| camlp5/ | 2020-11-13 01:16 | - | |
| camlpdf/ | 2020-11-14 12:42 | - | |
| camltemplate/ | 2020-11-13 01:18 | - | |
| camlzip/ | 2020-11-13 01:18 | - | |
| camo/ | 2018-03-04 00:03 | - | |
| camomile/ | 2020-11-13 01:15 | - | |
| camp/ | 2019-12-21 00:41 | - | |
| campania/ | 2019-11-24 07:29 | - | |
| camping/ | 2017-05-22 22:58 | - | |
| can-utils/ | 2021-01-07 18:42 | - | |
| canadian-ham-exam/ | 2021-01-29 18:42 | - | |
| caneda/ | 2019-12-05 00:49 | - | |
| canid/ | 2021-03-02 06:42 | - | |
| canl-c/ | 2021-01-14 06:42 | - | |
| canl-java/ | 2020-06-27 19:46 | - | |
| canlock/ | 2021-02-06 18:42 | - | |
| canna-shion/ | 2020-05-14 19:48 | - | |
| canna/ | 2020-09-17 19:42 | - | |
| cantata/ | 2020-10-07 19:42 | - | |
| cantor/ | 2021-05-31 19:42 | - | |
| canu/ | 2020-04-07 19:42 | - | |
| capi4hylafax/ | 2019-11-30 00:41 | - | |
| capistrano/ | 2021-04-04 01:42 | - | |
| capnproto/ | 2020-07-15 02:15 | - | |
| cappuccino/ | 2021-01-09 18:58 | - | |
| caps/ | 2018-11-02 19:54 | - | |
| capstats/ | 2020-08-14 19:42 | - | |
| capstone/ | 2021-02-06 18:42 | - | |
| car/ | 2020-10-14 13:42 | - | |
| carbon-c-relay/ | 2020-09-27 15:06 | - | |
| carbons/ | 2020-10-06 08:18 | - | |
| cardo/ | 2018-05-11 18:59 | - | |
| cardpeek/ | 2021-01-12 06:42 | - | |
| care/ | 2017-04-03 07:20 | - | |
| carettah/ | 2020-09-08 07:42 | - | |
| cargo-mozilla/ | 2022-03-26 07:44 | - | |
| cargo/ | 2020-12-18 18:42 | - | |
| caribou/ | 2021-01-24 18:48 | - | |
| carmetal/ | 2021-01-07 18:53 | - | |
| carrotsearch-hppc/ | 2019-01-31 19:54 | - | |
| carrotsearch-randomizedtesting/ | 2020-11-18 18:25 | - | |
| casacore-data-igrf/ | 2017-08-10 07:59 | - | |
| casacore-data-jplde/ | 2020-06-13 19:42 | - | |
| casacore-data-lines/ | 2016-12-12 23:52 | - | |
| casacore-data-observatories/ | 2020-01-25 00:47 | - | |
| casacore-data-sources/ | 2016-12-12 23:52 | - | |
| casacore-data-tai-utc/ | 2021-02-06 18:51 | - | |
| casacore-data/ | 2019-01-28 19:54 | - | |
| casacore/ | 2020-12-14 12:42 | - | |
| case/ | 2019-10-01 18:11 | - | |
| caspar/ | 2020-07-15 19:46 | - | |
| casper/ | 2018-09-02 14:49 | - | |
| cassbeam/ | 2021-02-13 00:42 | - | |
| cassiopee/ | 2020-12-14 12:42 | - | |
| castle-game-engine/ | 2021-03-05 18:42 | - | |
| castor/ | 2018-08-11 19:54 | - | |
| castxml/ | 2020-12-16 18:42 | - | |
| casync/ | 2021-03-09 01:15 | - | |
| cat-bat/ | 2021-01-29 18:42 | - | |
| cataclysm-dda/ | 2020-12-29 18:42 | - | |
| catatonit/ | 2020-12-13 18:47 | - | |
| catch/ | 2021-03-18 13:47 | - | |
| catch2/ | 2021-01-23 18:42 | - | |
| catcodec/ | 2018-05-22 13:21 | - | |
| catdoc/ | 2018-03-06 20:42 | - | |
| catdvi/ | 2018-03-06 15:45 | - | |
| catfish/ | 2021-01-19 18:42 | - | |
| catimg/ | 2020-10-21 10:27 | - | |
| cattle-1.0/ | 2020-04-25 19:48 | - | |
| catwalk/ | 2016-09-13 15:14 | - | |
| cava-alsa/ | 2020-10-25 19:42 | - | |
| cava/ | 2021-01-12 18:53 | - | |
| caveconverter/ | 2021-01-05 18:48 | - | |
| caveexpress/ | 2020-05-29 01:42 | - | |
| cavezofphear/ | 2021-01-15 00:49 | - | |
| cawbird/ | 2021-01-17 18:42 | - | |
| cb2bib/ | 2021-03-09 01:15 | - | |
| cba/ | 2019-10-10 01:49 | - | |
| cbatticon/ | 2019-10-01 18:57 | - | |
| cbflib/ | 2021-02-05 06:51 | - | |
| cbios/ | 2021-01-08 18:52 | - | |
| cbm/ | 2021-02-06 18:43 | - | |
| cbmc/ | 2020-05-14 19:48 | - | |
| cbmplugs/ | 2021-01-21 18:47 | - | |
| cbootimage/ | 2018-08-22 19:53 | - | |
| cbor2/ | 2021-03-05 18:42 | - | |
| cbp2make/ | 2020-09-08 01:42 | - | |
| cc-tool/ | 2020-12-14 18:42 | - | |
| cc65/ | 2020-12-07 18:42 | - | |
| cc1541/ | 2021-02-09 18:50 | - | |
| ccache/ | 2021-02-23 18:42 | - | |
| ccbuild/ | 2020-05-15 19:42 | - | |
| cccc/ | 2019-10-01 17:54 | - | |
| cccd/ | 2018-03-06 20:33 | - | |
| cccolutils/ | 2021-02-05 06:44 | - | |
| ccd2iso/ | 2019-10-02 11:19 | - | |
| ccdiff/ | 2021-01-02 18:42 | - | |
| ccdproc/ | 2021-01-03 18:42 | - | |
| ccextractor/ | 2020-08-11 19:46 | - | |
| ccfits/ | 2020-08-30 07:42 | - | |
| ccid/ | 2021-02-04 17:56 | - | |
| cciss-vol-status/ | 2020-09-09 19:42 | - | |
| cclib/ | 2020-07-31 07:42 | - | |
| cclive/ | 2021-01-25 18:47 | - | |
| ccls/ | 2021-05-02 19:42 | - | |
| ccontrol/ | 2018-03-06 20:00 | - | |
| cconv/ | 2018-03-06 19:23 | - | |
| ccrypt/ | 2020-12-06 06:42 | - | |
| ccsm/ | 2020-10-16 13:42 | - | |
| cct/ | 2020-11-02 18:42 | - | |
| cctools/ | 2021-02-06 18:42 | - | |
| cctz/ | 2020-01-16 00:46 | - | |
| ccze/ | 2020-07-24 13:43 | - | |
| cd-circleprint/ | 2021-01-09 18:58 | - | |
| cd-discid/ | 2018-03-06 12:39 | - | |
| cd-hit/ | 2020-12-01 18:42 | - | |
| cd5/ | 2019-10-02 09:28 | - | |
| cdargs/ | 2019-03-17 19:54 | - | |
| cdbackup/ | 2019-10-01 16:12 | - | |
| cdbfasta/ | 2021-01-26 18:42 | - | |
| cdbs/ | 2021-01-06 18:42 | - | |
| cdcat/ | 2018-03-06 19:56 | - | |
| cdcd/ | 2019-10-02 12:06 | - | |
| cdck/ | 2020-04-22 19:47 | - | |
| cdcover/ | 2019-10-02 12:16 | - | |
| cdde/ | 2018-03-06 17:01 | - | |
| cddlib/ | 2020-12-11 18:48 | - | |
| cde/ | 2017-07-08 09:03 | - | |
| cdebconf-entropy/ | 2021-04-16 19:42 | - | |
| cdebconf-terminal/ | 2021-04-16 19:42 | - | |
| cdebconf/ | 2021-07-28 19:42 | - | |
| cdebootstrap/ | 2021-03-13 12:43 | - | |
| cdecl/ | 2019-10-01 14:03 | - | |
| cdftools/ | 2020-02-16 00:54 | - | |
| cdi-api/ | 2021-02-08 18:48 | - | |
| cdiff/ | 2019-10-17 01:49 | - | |
| cdist/ | 2021-02-08 18:48 | - | |
| cdk/ | 2020-08-09 19:42 | - | |
| cdkr/ | 2020-12-11 18:48 | - | |
| cdlabelgen/ | 2021-01-08 18:52 | - | |
| cdo/ | 2021-02-03 15:37 | - | |
| cdparanoia/ | 2021-03-04 06:44 | - | |
| cdpr/ | 2020-08-03 13:42 | - | |
| cdrdao/ | 2021-02-11 18:52 | - | |
| cdrkit/ | 2021-02-15 18:42 | - | |
| cdrom-checker/ | 2021-07-29 19:42 | - | |
| cdrom-detect/ | 2021-08-03 19:42 | - | |
| cdrom-retriever/ | 2021-07-29 19:42 | - | |
| cds-healpix-java/ | 2021-01-22 18:42 | - | |
| cdtool/ | 2021-01-13 18:54 | - | |
| cdw/ | 2020-08-17 19:48 | - | |
| cecil-flowanalysis/ | 2021-01-11 18:58 | - | |
| cecil/ | 2021-01-02 18:49 | - | |
| cecilia/ | 2020-09-14 19:42 | - | |
| cedar-backup2/ | 2018-10-27 19:53 | - | |
| cedar-backup3/ | 2021-04-08 19:42 | - | |
| ceferino/ | 2018-03-06 15:35 | - | |
| cegui-mk2/ | 2021-02-05 06:51 | - | |
| ceilometer/ | 2021-03-28 19:43 | - | |
| celery-haystack/ | 2020-12-14 00:42 | - | |
| celery/ | 2020-11-09 18:42 | - | |
| celluloid/ | 2020-12-05 18:42 | - | |
| cellwriter/ | 2021-02-18 00:42 | - | |
| cen64-qt/ | 2020-03-10 01:50 | - | |
| cen64/ | 2020-07-30 01:46 | - | |
| ceni/ | 2019-02-11 19:54 | - | |
| cenon.app/ | 2020-06-14 19:51 | - | |
| centreon-broker/ | 2019-01-19 20:04 | - | |
| centreon-clib/ | 2020-01-04 08:48 | - | |
| centreon-connectors/ | 2021-02-05 06:45 | - | |
| centreon-engine/ | 2020-02-12 00:42 | - | |
| centrifuge/ | 2020-11-18 18:25 | - | |
| ceph-iscsi/ | 2021-01-30 18:42 | - | |
| ceph/ | 2021-06-06 19:42 | - | |
| cereal/ | 2021-01-12 18:53 | - | |
| cerealizer/ | 2019-12-16 00:49 | - | |
| ceres-solver/ | 2021-03-10 18:42 | - | |
| cernlib/ | 2019-03-03 19:53 | - | |
| certmonger/ | 2020-11-13 18:42 | - | |
| certspotter/ | 2021-03-02 06:42 | - | |
| cervisia/ | 2021-06-27 19:42 | - | |
| cewl/ | 2020-09-27 02:14 | - | |
| cfengine3/ | 2020-09-20 01:46 | - | |
| cffi/ | 2020-12-05 18:42 | - | |
| cfflib/ | 2018-07-10 20:01 | - | |
| cffsubr/ | 2020-12-29 18:47 | - | |
| cfget/ | 2016-09-12 20:29 | - | |
| cfgrib/ | 2021-01-15 18:42 | - | |
| cfgv/ | 2021-02-09 18:42 | - | |
| cfi/ | 2021-01-10 18:55 | - | |
| cfingerd/ | 2020-10-03 19:42 | - | |
| cfitsio/ | 2020-10-14 13:43 | - | |
| cflow/ | 2019-10-02 12:14 | - | |
| cfortran/ | 2018-06-17 15:00 | - | |
| cfourcc/ | 2020-09-28 19:42 | - | |
| cfrpki/ | 2022-01-11 18:49 | - | |
| cftime/ | 2021-02-13 00:42 | - | |
| cg3/ | 2021-02-06 18:43 | - | |
| cgal/ | 2021-09-27 01:42 | - | |
| cgdb/ | 2019-10-02 11:34 | - | |
| cgilib/ | 2019-10-02 08:45 | - | |
| cgit/ | 2020-04-04 01:47 | - | |
| cglib/ | 2019-10-01 16:39 | - | |
| cglm/ | 2020-12-01 18:42 | - | |
| cgmanager/ | 2020-10-05 07:42 | - | |
| cgoban/ | 2020-08-05 19:46 | - | |
| cgreen/ | 2020-11-22 18:42 | - | |
| cgroupfs-mount/ | 2017-06-26 19:59 | - | |
| cgsi-gsoap/ | 2021-01-11 06:42 | - | |
| cgvg/ | 2019-10-01 18:24 | - | |
| cgview/ | 2020-09-13 19:47 | - | |
| ch5m3d/ | 2021-01-11 18:58 | - | |
| chafa/ | 2021-01-25 18:42 | - | |
| chake/ | 2020-12-22 18:42 | - | |
| chaksem/ | 2021-02-17 00:42 | - | |
| chalow/ | 2021-01-05 18:48 | - | |
| chameleon-cursor-theme/ | 2019-03-04 19:53 | - | |
| changeme/ | 2020-09-19 19:42 | - | |
| changeo/ | 2021-01-29 18:42 | - | |
| changetrack/ | 2020-09-30 18:21 | - | |
| chaosread/ | 2019-10-02 09:46 | - | |
| chaosreader/ | 2020-05-14 19:42 | - | |
| char-menu-el/ | 2020-12-20 18:42 | - | |
| charactermanaj/ | 2020-02-13 00:47 | - | |
| chardet/ | 2021-01-11 18:42 | - | |
| chargebee-python/ | 2019-10-01 17:32 | - | |
| chargebee2-python/ | 2020-04-12 19:42 | - | |
| charliecloud/ | 2020-12-31 18:42 | - | |
| charls/ | 2021-02-06 18:43 | - | |
| charmap.app/ | 2020-06-19 07:42 | - | |
| charmtimetracker/ | 2019-12-03 10:54 | - | |
| chartkick.js/ | 2021-01-11 18:58 | - | |
| charts4j/ | 2021-01-15 18:42 | - | |
| charybdis/ | 2021-03-09 18:44 | - | |
| chase/ | 2020-08-16 13:49 | - | |
| chasen/ | 2019-10-02 08:56 | - | |
| chasquid/ | 2021-03-02 06:42 | - | |
| chatty/ | 2022-07-03 19:42 | - | |
| chaussette/ | 2021-02-07 18:48 | - | |
| chealpix/ | 2020-08-30 07:42 | - | |
| check-all-the-things/ | 2017-05-05 02:03 | - | |
| check-manifest/ | 2021-01-29 18:42 | - | |
| check-pgactivity/ | 2021-01-11 18:58 | - | |
| check-pgbackrest/ | 2020-09-27 15:06 | - | |
| check-postgres/ | 2020-02-18 18:42 | - | |
| check/ | 2021-01-26 18:42 | - | |
| checkbot/ | 2021-02-05 11:27 | - | |
| checker-framework-java/ | 2021-02-02 18:42 | - | |
| checkinstall/ | 2019-10-15 19:41 | - | |
| checkit-tiff/ | 2018-03-06 11:57 | - | |
| checkpolicy/ | 2020-07-27 13:42 | - | |
| checkpw/ | 2018-03-06 20:08 | - | |
| checksec/ | 2020-11-05 18:42 | - | |
| checksecurity/ | 2021-01-06 18:56 | - | |
| checkstyle/ | 2021-02-04 17:56 | - | |
| cheese/ | 2020-12-05 18:42 | - | |
| cheesecutter/ | 2020-10-09 19:47 | - | |
| cheetah/ | 2021-02-05 06:49 | - | |
| chef-zero/ | 2021-02-08 12:42 | - | |
| chef/ | 2021-02-08 12:42 | - | |
| chemeq/ | 2019-10-02 11:02 | - | |
| chemfp/ | 2019-12-18 12:41 | - | |
| chemical-mime-data/ | 2021-01-01 18:49 | - | |
| chemical-structures/ | 2020-12-17 18:42 | - | |
| chemps2/ | 2021-03-08 06:27 | - | |
| chemtool/ | 2020-10-08 01:45 | - | |
| cherrypy3/ | 2021-03-17 19:44 | - | |
| cherrytree/ | 2021-02-04 17:56 | - | |
| cheshire-clojure/ | 2021-01-10 18:55 | - | |
| chess.app/ | 2020-12-01 18:42 | - | |
| chessx/ | 2019-12-03 10:51 | - | |
| chewing-editor/ | 2019-12-03 00:53 | - | |
| chewmail/ | 2021-01-11 18:58 | - | |
| chez-srfi/ | 2020-11-22 00:46 | - | |
| chezscheme/ | 2021-05-03 19:42 | - | |
| chiaki/ | 2021-06-15 19:42 | - | |
| chiark-tcl-applet/ | 2020-06-12 19:45 | - | |
| chiark-tcl/ | 2020-08-20 01:42 | - | |
| chiark-utils/ | 2020-07-31 07:42 | - | |
| chicken/ | 2020-11-07 18:42 | - | |
| childsplay/ | 2018-05-21 21:12 | - | |
| chip-seq/ | 2020-03-31 01:47 | - | |
| chipmunk/ | 2020-10-27 19:42 | - | |
| chipw/ | 2018-03-06 18:55 | - | |
| chirp/ | 2020-08-27 19:42 | - | |
| chise-base/ | 2018-03-21 01:04 | - | |
| chkboot/ | 2020-12-08 15:24 | - | |
| chkrootkit/ | 2021-01-17 18:42 | - | |
| chkservice/ | 2021-07-12 02:24 | - | |
| chktex/ | 2020-12-18 18:42 | - | |
| chm2pdf/ | 2016-09-13 13:56 | - | |
| chmlib/ | 2020-07-27 13:42 | - | |
| chntpw/ | 2018-11-11 19:53 | - | |
| chocolate-doom/ | 2020-12-11 18:43 | - | |
| choose-mirror/ | 2022-01-13 18:42 | - | |
| choosewm/ | 2018-03-06 17:24 | - | |
| choqok/ | 2020-03-23 19:42 | - | |
| chordii/ | 2020-08-16 01:47 | - | |
| chromaprint/ | 2021-02-11 18:42 | - | |
| chrome-gnome-shell/ | 2019-03-05 19:54 | - | |
| chromhmm/ | 2020-08-13 19:47 | - | |
| chromimpute/ | 2020-10-06 19:46 | - | |
| chromium-bsu/ | 2018-05-12 18:59 | - | |
| chromium/ | 2022-06-26 01:43 | - | |
| chron/ | 2020-08-28 19:42 | - | |
| chronicle/ | 2021-01-10 18:55 | - | |
| chrony/ | 2022-04-03 19:42 | - | |
| chrootuid/ | 2018-03-06 15:39 | - | |
| chrpath/ | 2018-03-06 19:20 | - | |
| chuck/ | 2018-03-06 17:37 | - | |
| cider/ | 2020-07-17 07:47 | - | |
| ciderwebmail/ | 2020-03-11 19:42 | - | |
| cif-api/ | 2020-10-25 19:46 | - | |
| cif-tools/ | 2020-12-15 18:42 | - | |
| cifs-utils/ | 2022-06-03 07:49 | - | |
| ciftilib/ | 2021-02-01 00:42 | - | |
| cil/ | 2018-09-20 19:53 | - | |
| cimg/ | 2022-03-26 07:44 | - | |
| cinder-tempest-plugin/ | 2020-10-28 19:42 | - | |
| cinder/ | 2021-01-29 18:42 | - | |
| cinfony/ | 2016-09-13 13:07 | - | |
| cinnamon-control-center/ | 2021-01-10 18:42 | - | |
| cinnamon-desktop-environment/ | 2021-02-23 18:42 | - | |
| cinnamon-desktop/ | 2020-12-31 18:42 | - | |
| cinnamon-menus/ | 2021-03-17 19:44 | - | |
| cinnamon-screensaver/ | 2021-07-04 19:42 | - | |
| cinnamon-session/ | 2021-06-02 19:42 | - | |
| cinnamon-settings-daemon/ | 2021-01-26 18:42 | - | |
| cinnamon-translations/ | 2021-01-13 18:42 | - | |
| cinnamon/ | 2022-04-03 19:42 | - | |
| ciphersaber/ | 2017-06-22 02:28 | - | |
| circe/ | 2019-10-01 14:19 | - | |
| circlator/ | 2021-03-07 18:42 | - | |
| circos-tools/ | 2018-11-07 19:53 | - | |
| circos/ | 2020-06-15 19:42 | - | |
| circuit-macros/ | 2021-01-13 18:42 | - | |
| circuits/ | 2019-10-02 10:01 | - | |
| circus/ | 2016-09-13 14:40 | - | |
| circuslinux/ | 2021-01-12 06:42 | - | |
| citadel-client/ | 2019-10-01 17:36 | - | |
| citadel/ | 2019-10-22 19:41 | - | |
| citation-style-language-locales/ | 2021-03-16 19:46 | - | |
| citation-style-language-styles/ | 2021-03-16 19:46 | - | |
| citeproc-py/ | 2020-10-11 18:22 | - | |
| citus/ | 2019-03-01 19:54 | - | |
| civetweb/ | 2021-02-02 00:42 | - | |
| civicrm/ | 2021-01-29 18:42 | - | |
| cjet/ | 2020-07-02 01:43 | - | |
| cjk/ | 2021-03-17 19:44 | - | |
| cjose/ | 2018-08-14 19:53 | - | |
| cjs/ | 2021-01-23 18:42 | - | |
| cjson/ | 2021-03-11 12:42 | - | |
| ck/ | 2020-04-17 02:14 | - | |
| ckb-next/ | 2021-01-25 18:42 | - | |
| ckbuilder/ | 2018-06-30 13:49 | - | |
| ckeditor/ | 2021-06-21 19:42 | - | |
| ckeditor3/ | 2020-07-21 01:46 | - | |
| ckermit/ | 2020-09-29 19:46 | - | |
| ckon/ | 2020-12-14 12:42 | - | |
| ckport/ | 2020-12-01 18:42 | - | |
| cksfv/ | 2020-08-19 01:48 | - | |
| cl-abnf/ | 2021-01-09 18:58 | - | |
| cl-alexandria/ | 2020-12-05 18:42 | - | |
| cl-anaphora/ | 2020-05-25 19:46 | - | |
| cl-asdf-finalizers/ | 2021-01-09 18:58 | - | |
| cl-asdf-flv/ | 2021-01-06 18:56 | - | |
| cl-asdf-system-connections/ | 2021-01-09 18:58 | - | |
| cl-asdf/ | 2021-01-22 18:42 | - | |
| cl-babel/ | 2020-12-07 18:42 | - | |
| cl-base64/ | 2020-10-05 19:47 | - | |
| cl-chipz/ | 2020-02-01 00:47 | - | |
| cl-chunga/ | 2020-04-16 19:50 | - | |
| cl-closer-mop/ | 2020-12-04 00:46 | - | |
| cl-closure-common/ | 2021-01-10 18:55 | - | |
| cl-cluck/ | 2020-10-14 13:42 | - | |
| cl-clx-sbcl/ | 2018-12-14 19:53 | - | |
| cl-command-line-arguments/ | 2021-01-09 18:58 | - | |
| cl-containers/ | 2021-01-09 18:58 | - | |
| cl-contextl/ | 2020-09-16 19:46 | - | |
| cl-csv/ | 2020-10-26 19:46 | - | |
| cl-curry-compose-reader-macros/ | 2021-01-11 18:59 | - | |
| cl-cxml/ | 2021-01-10 18:55 | - | |
| cl-daemon/ | 2021-01-11 18:59 | - | |
| cl-db3/ | 2020-06-14 19:46 | - | |
| cl-drakma/ | 2020-04-13 19:48 | - | |
| cl-dynamic-classes/ | 2021-01-09 18:58 | - | |
| cl-esrap/ | 2021-01-10 18:55 | - | |
| cl-fad/ | 2020-12-10 18:42 | - | |
| cl-fftw3/ | 2020-10-14 13:42 | - | |
| cl-fiveam/ | 2020-11-29 00:47 | - | |
| cl-ftp/ | 2021-01-11 18:59 | - | |
| cl-garbage-pools/ | 2021-01-10 18:55 | - | |
| cl-getopt/ | 2019-10-02 11:00 | - | |
| cl-github-v3/ | 2021-01-11 18:59 | - | |
| cl-graph/ | 2021-01-12 18:53 | - | |
| cl-hyperobject/ | 2020-10-11 19:45 | - | |
| cl-ieee-floats/ | 2021-01-10 18:55 | - | |
| cl-interpol/ | 2020-12-01 00:46 | - | |
| cl-irc-logger/ | 2019-10-01 13:20 | - | |
| cl-irc/ | 2018-04-18 18:59 | - | |
| cl-ironclad/ | 2021-01-15 18:42 | - | |
| cl-iterate/ | 2021-01-09 18:58 | - | |
| cl-ixf/ | 2021-01-10 18:55 | - | |
| cl-kmrcl/ | 2020-10-03 19:46 | - | |
| cl-launch/ | 2021-01-09 18:58 | - | |
| cl-lml/ | 2019-10-02 09:08 | - | |
| cl-lml2/ | 2019-10-02 10:41 | - | |
| cl-local-time/ | 2021-01-09 18:58 | - | |
| cl-log/ | 2021-01-09 18:58 | - | |
| cl-lparallel/ | 2021-01-09 18:58 | - | |
| cl-lw-compat/ | 2018-06-02 18:53 | - | |
| cl-markdown/ | 2021-01-09 18:58 | - | |
| cl-md5/ | 2018-05-09 18:59 | - | |
| cl-metabang-bind/ | 2021-01-09 18:58 | - | |
| cl-metatilities-base/ | 2021-01-09 18:58 | - | |
| cl-modlisp/ | 2019-10-01 17:01 | - | |
| cl-mssql/ | 2021-01-10 18:55 | - | |
| cl-mustache/ | 2021-01-11 18:59 | - | |
| cl-named-readtables/ | 2020-12-30 18:42 | - | |
| cl-nibbles/ | 2020-12-26 18:42 | - | |
| cl-parse-number/ | 2021-01-09 18:59 | - | |
| cl-pg/ | 2018-04-19 18:59 | - | |
| cl-photo/ | 2019-10-01 17:19 | - | |
| cl-pipes/ | 2019-10-01 14:53 | - | |
| cl-plus-ssl/ | 2020-12-11 18:43 | - | |
| cl-portable-aserve/ | 2020-12-11 18:48 | - | |
| cl-postmodern/ | 2021-02-27 18:42 | - | |
| cl-ppcre/ | 2020-02-08 00:44 | - | |
| cl-ptester/ | 2018-05-15 18:59 | - | |
| cl-pubmed/ | 2019-10-02 08:46 | - | |
| cl-puri/ | 2020-10-05 19:47 | - | |
| cl-py-configparser/ | 2021-01-09 18:59 | - | |
| cl-qmynd/ | 2021-01-10 18:55 | - | |
| cl-quri/ | 2021-01-10 18:55 | - | |
| cl-regex/ | 2018-12-27 19:53 | - | |
| cl-reversi/ | 2020-10-11 19:45 | - | |
| cl-rfc2388/ | 2021-01-10 18:56 | - | |
| cl-rsm-mod/ | 2017-01-05 09:18 | - | |
| cl-rss/ | 2020-10-09 19:47 | - | |
| cl-rt/ | 2018-05-03 18:59 | - | |
| cl-salza2/ | 2021-01-11 18:59 | - | |
| cl-split-sequence/ | 2020-01-21 00:46 | - | |
| cl-sql/ | 2021-02-07 18:42 | - | |
| cl-sqlite/ | 2021-01-09 18:59 | - | |
| cl-trivial-backtrace/ | 2020-12-17 18:42 | - | |
| cl-trivial-garbage/ | 2020-12-15 18:42 | - | |
| cl-trivial-utf-8/ | 2021-01-09 18:59 | - | |
| cl-uffi/ | 2021-01-14 06:42 | - | |
| cl-unicode/ | 2020-12-26 18:42 | - | |
| cl-usocket/ | 2020-12-21 18:42 | - | |
| cl-utilities/ | 2021-01-09 18:59 | - | |
| cl-uuid/ | 2021-01-09 18:59 | - | |
| cl-who/ | 2021-01-11 18:59 | - | |
| cl-xlunit/ | 2019-10-02 10:20 | - | |
| cl-xmls/ | 2019-02-17 19:54 | - | |
| cl-xptest/ | 2019-10-01 18:08 | - | |
| cl-yason/ | 2021-01-10 18:56 | - | |
| cl-zip/ | 2021-01-12 18:53 | - | |
| cl-zs3/ | 2021-01-11 18:59 | - | |
| clalsadrv/ | 2021-01-06 18:56 | - | |
| clamassassin/ | 2021-01-07 18:53 | - | |
| clamav-unofficial-sigs/ | 2021-01-06 18:56 | - | |
| clamav/ | 2022-06-04 19:42 | - | |
| clamfs/ | 2020-05-01 07:42 | - | |
| clamsmtp/ | 2021-01-22 12:42 | - | |
| clamtk/ | 2021-04-01 19:42 | - | |
| clamz/ | 2018-11-26 19:54 | - | |
| clanlib/ | 2020-03-08 09:47 | - | |
| clap/ | 2020-12-21 18:46 | - | |
| clasp/ | 2021-01-04 18:42 | - | |
| class.js/ | 2021-01-13 18:54 | - | |
| classified-ads/ | 2019-12-03 10:52 | - | |
| classmate/ | 2020-11-08 00:46 | - | |
| classycle/ | 2021-01-02 18:49 | - | |
| claws-mail-themes/ | 2020-09-15 19:46 | - | |
| claws-mail/ | 2021-02-05 06:52 | - | |
| clawsker/ | 2021-03-10 18:42 | - | |
| clazy/ | 2021-01-28 18:42 | - | |
| clblas/ | 2018-11-18 19:54 | - | |
| clblast/ | 2021-05-13 19:42 | - | |
| clc-intercal/ | 2021-01-11 18:59 | - | |
| cld2/ | 2020-06-21 19:42 | - | |
| cldump/ | 2020-09-22 01:42 | - | |
| clear-sans/ | 2019-10-01 19:12 | - | |
| clearcut/ | 2020-12-12 18:42 | - | |
| clearlooks-phenix-theme/ | 2018-09-25 19:53 | - | |
| clearsilver/ | 2021-02-05 06:50 | - | |
| clementine/ | 2021-01-04 06:42 | - | |
| cleo/ | 2021-01-03 18:48 | - | |
| clevis/ | 2021-09-09 16:37 | - | |
| clex/ | 2019-10-01 18:08 | - | |
| clfft/ | 2021-01-17 12:42 | - | |
| clfswm/ | 2018-04-23 02:03 | - | |
| clhep/ | 2018-03-06 12:22 | - | |
| cli-common/ | 2019-03-27 19:54 | - | |
| click-man/ | 2020-04-13 19:48 | - | |
| clickhouse/ | 2020-12-15 00:42 | - | |
| clif/ | 2019-10-02 09:23 | - | |
| cligh/ | 2018-01-19 11:58 | - | |
| clikit/ | 2021-02-07 00:44 | - | |
| clinfo/ | 2021-03-10 18:42 | - | |
| clipf/ | 2019-10-12 01:49 | - | |
| clipit/ | 2020-05-06 19:47 | - | |
| clipman/ | 2021-03-02 06:42 | - | |
| clipper/ | 2020-11-23 00:49 | - | |
| clippoly/ | 2021-01-22 18:42 | - | |
| clips/ | 2020-04-05 01:47 | - | |
| cliquer/ | 2018-03-06 13:45 | - | |
| clirr/ | 2018-04-04 18:59 | - | |
| clisp/ | 2020-08-26 01:42 | - | |
| clitest/ | 2021-02-15 00:42 | - | |
| clj-digest-clojure/ | 2020-12-12 18:48 | - | |
| clj-http-clojure/ | 2021-01-11 18:59 | - | |
| clj-stacktrace-clojure/ | 2020-11-29 00:47 | - | |
| clj-time-clojure/ | 2020-12-12 18:48 | - | |
| clj-tuple-clojure/ | 2021-01-11 18:59 | - | |
| clj-yaml-clojure/ | 2020-10-25 19:46 | - | |
| cljx-clojure/ | 2021-01-09 18:59 | - | |
| cln/ | 2020-01-23 18:42 | - | |
| cloc/ | 2020-07-16 19:42 | - | |
| clock-setup/ | 2021-07-29 19:42 | - | |
| clod/ | 2016-11-05 02:03 | - | |
| clog/ | 2019-10-01 15:57 | - | |
| clojure-maven-plugin/ | 2018-07-07 18:53 | - | |
| clojure-mode/ | 2021-02-03 15:37 | - | |
| clojure/ | 2021-02-15 00:42 | - | |
| clonalframe/ | 2020-05-17 07:42 | - | |
| clonalframeml/ | 2020-03-08 09:47 | - | |
| clonalorigin/ | 2020-12-13 06:42 | - | |
| clonezilla/ | 2021-05-08 19:42 | - | |
| cloog/ | 2018-07-04 02:03 | - | |
| cloop/ | 2018-03-06 18:22 | - | |
| closql-el/ | 2020-08-29 19:46 | - | |
| closure-compiler/ | 2020-09-08 19:46 | - | |
| closure-linter/ | 2016-09-13 12:37 | - | |
| cloud-init/ | 2021-10-17 19:42 | - | |
| cloud-initramfs-tools/ | 2020-03-17 07:43 | - | |
| cloud-sptheme/ | 2021-02-18 00:42 | - | |
| cloud-utils/ | 2020-06-08 19:42 | - | |
| cloudcompare/ | 2020-09-19 07:42 | - | |
| cloudkitty-dashboard/ | 2021-07-21 02:24 | - | |
| cloudkitty-tempest-plugin/ | 2020-10-28 19:42 | - | |
| cloudkitty/ | 2021-06-01 19:42 | - | |
| cloudpickle/ | 2020-11-14 12:42 | - | |
| cloudprint/ | 2021-02-05 11:27 | - | |
| cloudsql-proxy/ | 2021-03-02 06:42 | - | |
| clout-clojure/ | 2021-01-11 18:59 | - | |
| clp/ | 2020-03-11 19:42 | - | |
| clsync/ | 2021-08-04 19:42 | - | |
| clthreads/ | 2019-12-03 10:48 | - | |
| clucene-core/ | 2019-10-02 11:44 | - | |
| clues-emacs/ | 2021-02-05 18:42 | - | |
| clustalo/ | 2020-12-01 18:42 | - | |
| clustalw/ | 2020-11-17 18:40 | - | |
| clustalx/ | 2020-12-14 06:42 | - | |
| cluster-glue/ | 2021-01-29 18:42 | - | |
| cluster/ | 2021-03-02 18:42 | - | |
| clustershell/ | 2020-01-14 16:29 | - | |
| clusterssh/ | 2021-02-13 00:42 | - | |
| clutter-1.0/ | 2020-12-03 18:42 | - | |
| clutter-gst-3.0/ | 2020-10-04 19:42 | - | |
| clutter-gtk/ | 2019-01-03 19:53 | - | |
| clutter-imcontext/ | 2020-12-30 18:49 | - | |
| clxclient/ | 2020-02-29 00:48 | - | |
| clzip/ | 2021-02-04 17:56 | - | |
| cm-super/ | 2019-10-01 13:32 | - | |
| cmake-extras/ | 2020-11-14 12:42 | - | |
| cmake-fedora/ | 2017-06-28 07:58 | - | |
| cmake-format/ | 2020-10-14 13:42 | - | |
| cmake-vala/ | 2019-10-01 18:45 | - | |
| cmake/ | 2021-12-26 18:42 | - | |
| cmark-gfm/ | 2020-09-10 19:42 | - | |
| cmark/ | 2020-06-26 19:42 | - | |
| cmatrix/ | 2021-01-23 18:42 | - | |
| cmd2/ | 2019-10-31 01:50 | - | |
| cmdliner/ | 2020-11-13 01:18 | - | |
| cmdreader/ | 2018-04-11 18:59 | - | |
| cmdtest/ | 2020-12-03 18:42 | - | |
| cme/ | 2020-07-27 13:42 | - | |
| cmigemo/ | 2021-01-12 06:42 | - | |
| cminpack/ | 2019-01-03 19:54 | - | |
| cmlxom/ | 2020-10-15 01:42 | - | |
| cmocka/ | 2019-10-01 13:27 | - | |
| cmor-tables/ | 2021-01-09 18:59 | - | |
| cmor/ | 2021-02-06 18:44 | - | |
| cmospwd/ | 2017-04-03 07:26 | - | |
| cmph/ | 2019-10-01 13:22 | - | |
| cmst/ | 2019-12-03 00:53 | - | |
| cmt/ | 2019-10-01 13:10 | - | |
| cmtk/ | 2020-11-21 12:42 | - | |
| cmucl/ | 2021-01-22 06:44 | - | |
| cmus/ | 2021-02-02 18:42 | - | |
| cntlm/ | 2018-03-06 13:24 | - | |
| cnvkit/ | 2021-01-09 18:42 | - | |
| cobertura/ | 2018-07-26 19:53 | - | |
| coccinella/ | 2018-09-06 19:53 | - | |
| coccinelle/ | 2021-09-27 01:42 | - | |
| cockpit-podman/ | 2021-02-15 00:42 | - | |
| cockpit/ | 2021-03-30 19:42 | - | |
| coco-cpp/ | 2018-03-06 13:52 | - | |
| coco-cs/ | 2021-01-12 18:53 | - | |
| coco-doc/ | 2019-12-27 06:43 | - | |
| coco-java/ | 2019-10-01 17:48 | - | |
| cod-tools/ | 2021-05-25 19:42 | - | |
| coda/ | 2021-02-05 06:53 | - | |
| code-saturne/ | 2020-04-27 19:42 | - | |
| code2html/ | 2017-01-05 09:19 | - | |
| codeblocks/ | 2020-04-29 19:42 | - | |
| codec2/ | 2020-12-15 18:42 | - | |
| codecgraph/ | 2019-10-01 13:04 | - | |
| codecrypt/ | 2020-12-30 19:00 | - | |
| codegroup/ | 2018-09-13 19:53 | - | |
| codelite/ | 2020-12-07 12:42 | - | |
| codemirror-js/ | 2021-02-06 18:42 | - | |
| codenarc/ | 2018-04-10 18:59 | - | |
| codequery/ | 2019-12-07 12:41 | - | |
| coderay/ | 2021-04-08 19:42 | - | |
| codesearch/ | 2021-03-02 06:42 | - | |
| codespell/ | 2020-12-05 18:42 | - | |
| codetools/ | 2020-11-14 12:42 | - | |
| codeville/ | 2016-09-13 11:27 | - | |
| codfis/ | 2018-03-06 17:57 | - | |
| codicefiscale/ | 2019-10-01 13:06 | - | |
| codonw/ | 2021-03-07 18:42 | - | |
| coffeescript/ | 2021-01-15 00:50 | - | |
| cofoja/ | 2018-12-10 19:54 | - | |
| cog/ | 2021-03-12 12:43 | - | |
| cogl/ | 2020-12-07 18:42 | - | |
| cohomcalg/ | 2020-07-18 19:46 | - | |
| coils/ | 2020-12-01 18:47 | - | |
| coin3/ | 2020-01-30 18:42 | - | |
| coinmp/ | 2020-06-25 19:46 | - | |
| coinor-cbc/ | 2020-10-25 19:42 | - | |
| coinor-cgl/ | 2020-03-11 19:42 | - | |
| coinor-csdp/ | 2020-07-24 19:42 | - | |
| coinor-dylp/ | 2020-01-04 00:45 | - | |
| coinor-ipopt/ | 2020-11-04 06:42 | - | |
| coinor-osi/ | 2021-02-19 18:42 | - | |
| coinor-symphony/ | 2021-01-08 18:42 | - | |
| coinor-vol/ | 2020-04-05 19:42 | - | |
| coinst/ | 2020-10-18 01:42 | - | |
| coinutils/ | 2020-03-11 19:42 | - | |
| collada-dom/ | 2020-12-14 12:42 | - | |
| collada2gltf/ | 2021-02-28 18:42 | - | |
| collatinus/ | 2019-12-05 18:41 | - | |
| collectd/ | 2021-08-02 19:42 | - | |
| collectl/ | 2019-10-01 19:22 | - | |
| colmap/ | 2020-10-20 01:43 | - | |
| colobot/ | 2020-12-14 12:42 | - | |
| color-theme-modern/ | 2019-11-18 00:47 | - | |
| colorcet/ | 2020-12-05 00:46 | - | |
| colorclass/ | 2021-01-11 18:59 | - | |
| colorcode/ | 2019-12-05 00:41 | - | |
| colord-gtk/ | 2018-03-06 11:07 | - | |
| colord/ | 2021-01-23 18:42 | - | |
| colordiff/ | 2021-01-06 18:56 | - | |
| colored/ | 2021-01-25 18:42 | - | |
| colorhug-client/ | 2019-10-01 16:56 | - | |
| colorize/ | 2020-04-06 07:42 | - | |
| colorized-logs/ | 2020-01-12 06:43 | - | |
| colormake/ | 2020-09-18 01:42 | - | |
| colorpicker/ | 2017-11-03 12:59 | - | |
| colors.js/ | 2020-01-02 06:44 | - | |
| colorspacious/ | 2019-11-19 00:49 | - | |
| colortail/ | 2018-03-06 18:10 | - | |
| colortest-python/ | 2021-07-02 19:42 | - | |
| colortest/ | 2021-02-24 18:42 | - | |
| colpack/ | 2020-06-07 07:42 | - | |
| colplot/ | 2021-01-08 18:52 | - | |
| com-hypirion-io-clojure/ | 2021-02-20 18:46 | - | |
| combblas/ | 2021-02-06 18:43 | - | |
| comedilib/ | 2021-02-05 06:45 | - | |
| comet-ms/ | 2020-08-29 19:42 | - | |
| comgt/ | 2019-10-01 19:04 | - | |
| comic-neue/ | 2020-10-27 19:46 | - | |
| comidi-clojure/ | 2021-01-23 18:49 | - | |
| comitup/ | 2021-03-05 18:42 | - | |
| comixcursors/ | 2021-01-07 18:53 | - | |
| command-not-found/ | 2021-01-10 18:56 | - | |
| commando/ | 2019-10-01 15:59 | - | |
| commit-patch/ | 2021-01-11 18:59 | - | |
| common-lisp-controller/ | 2018-04-20 18:59 | - | |
| commonmark-bkrs/ | 2020-12-01 18:42 | - | |
| commonmark/ | 2020-09-13 19:47 | - | |
| commons-beanutils/ | 2019-10-01 17:23 | - | |
| commons-configuration/ | 2017-07-07 13:58 | - | |
| commons-configuration2/ | 2020-12-11 18:42 | - | |
| commons-csv/ | 2020-09-21 01:42 | - | |
| commons-daemon/ | 2018-03-06 11:27 | - | |
| commons-dbcp2/ | 2020-07-02 19:42 | - | |
| commons-email/ | 2019-03-18 19:54 | - | |
| commons-exec/ | 2021-02-15 00:42 | - | |
| commons-httpclient/ | 2021-02-18 00:47 | - | |
| commons-io/ | 2021-10-12 19:42 | - | |
| commons-jci/ | 2020-05-01 19:47 | - | |
| commons-math/ | 2018-02-18 17:58 | - | |
| commons-math3/ | 2017-12-13 17:58 | - | |
| commons-parent/ | 2018-02-18 01:03 | - | |
| commons-pool/ | 2021-02-15 00:42 | - | |
| commons-pool2/ | 2020-02-07 18:42 | - | |
| commons-text/ | 2020-08-09 01:42 | - | |
| commons-vfs/ | 2018-03-23 18:59 | - | |
| compactheader/ | 2020-10-23 13:42 | - | |
| company-lsp/ | 2021-01-02 18:42 | - | |
| company-mode/ | 2021-02-02 00:42 | - | |
| comparelib/ | 2018-03-15 12:59 | - | |
| comparepdf/ | 2019-12-03 18:44 | - | |
| compartment/ | 2018-03-06 17:39 | - | |
| compass-blend-modes-plugin/ | 2021-03-11 18:52 | - | |
| compass-blueprint-plugin/ | 2021-03-11 18:52 | - | |
| compass-breakpoint-plugin/ | 2021-03-17 19:44 | - | |
| compass-color-schemer-plugin/ | 2021-03-11 18:52 | - | |
| compass-fancy-buttons-plugin/ | 2021-03-17 19:44 | - | |
| compass-h5bp-plugin/ | 2021-03-17 19:44 | - | |
| compass-layoutgala-plugin/ | 2021-03-17 19:44 | - | |
| compass-normalize-plugin/ | 2019-10-01 12:38 | - | |
| compass-sassy-maps-plugin/ | 2021-03-17 19:44 | - | |
| compass-singularitygs-plugin/ | 2017-09-01 13:59 | - | |
| compass-slickmap-plugin/ | 2017-03-13 11:58 | - | |
| compass-susy-plugin/ | 2021-07-20 19:42 | - | |
| compass-toolkit-plugin/ | 2021-03-17 19:44 | - | |
| compass-yui-plugin/ | 2017-02-06 18:04 | - | |
| compile-command-annotations/ | 2019-10-01 14:59 | - | |
| compiz-bcop/ | 2020-04-10 19:47 | - | |
| compiz-boxmenu/ | 2021-01-12 18:42 | - | |
| compiz-plugins-experimental/ | 2020-04-10 19:47 | - | |
| compiz-plugins-extra/ | 2020-04-10 19:47 | - | |
| compiz-plugins-main/ | 2020-10-14 13:42 | - | |
| compiz/ | 2021-01-12 18:42 | - | |
| compizconfig-python/ | 2021-02-05 06:51 | - | |
| complete-clojure/ | 2018-05-02 18:59 | - | |
| complexity/ | 2020-03-12 07:42 | - | |
| compojure-clojure/ | 2021-01-11 18:59 | - | |
| composer/ | 2021-09-12 19:42 | - | |
| compreffor/ | 2021-02-06 18:43 | - | |
| compress-lzf/ | 2019-02-08 19:54 | - | |
| comprez/ | 2020-09-19 19:42 | - | |
| comptext/ | 2020-03-10 01:43 | - | |
| compton-conf/ | 2021-01-16 06:42 | - | |
| compton/ | 2020-12-27 18:42 | - | |
| comptty/ | 2019-10-01 14:30 | - | |
| compyle/ | 2021-01-06 18:56 | - | |
| comskip/ | 2020-08-09 19:42 | - | |
| concalc/ | 2018-03-06 12:28 | - | |
| concavity/ | 2020-12-05 00:46 | - | |
| concordance/ | 2020-10-16 13:42 | - | |
| concurrent-dfsg/ | 2021-01-08 18:52 | - | |
| concurrentqueue/ | 2020-11-11 13:38 | - | |
| conda-package-handling/ | 2021-02-06 18:43 | - | |
| condor/ | 2022-05-22 13:44 | - | |
| confclerk/ | 2020-05-11 07:42 | - | |
| confget/ | 2020-12-11 18:42 | - | |
| config-package-dev/ | 2018-02-10 17:58 | - | |
| configobj/ | 2020-04-16 07:48 | - | |
| configparser/ | 2020-10-23 13:42 | - | |
| configure-debian/ | 2021-01-06 18:57 | - | |
| confuse/ | 2020-10-03 19:42 | - | |
| confy/ | 2022-07-05 19:42 | - | |
| congress/ | 2020-07-24 19:42 | - | |
| congruity/ | 2018-07-16 13:54 | - | |
| conky/ | 2020-08-27 19:42 | - | |
| conman/ | 2018-03-06 18:20 | - | |
| conmon/ | 2021-07-29 19:42 | - | |
| conmux/ | 2021-01-12 18:53 | - | |
| connect-proxy/ | 2021-01-18 18:42 | - | |
| connectagram/ | 2020-07-31 07:42 | - | |
| connectome-workbench/ | 2021-03-07 18:42 | - | |
| connectomeviewer/ | 2019-01-24 19:54 | - | |
| connman-gtk/ | 2021-02-22 06:42 | - | |
| connman-ui/ | 2019-10-02 11:54 | - | |
| connman/ | 2021-09-12 19:42 | - | |
| conntrack-tools/ | 2021-02-06 18:42 | - | |
| conque/ | 2016-09-13 15:44 | - | |
| consensuscore/ | 2021-02-05 06:45 | - | |
| conservation-code/ | 2019-12-18 00:45 | - | |
| conserver/ | 2021-02-05 18:42 | - | |
| consolation/ | 2020-06-14 19:42 | - | |
| console-braille/ | 2020-11-11 13:37 | - | |
| console-bridge/ | 2020-01-16 18:44 | - | |
| console-common/ | 2020-06-13 19:42 | - | |
| console-cyrillic/ | 2021-01-07 18:53 | - | |
| console-data/ | 2019-10-01 18:52 | - | |
| console-log/ | 2021-01-09 18:59 | - | |
| console-setup/ | 2021-07-30 19:42 | - | |
| consonance/ | 2021-01-10 18:42 | - | |
| conspy/ | 2020-08-28 19:47 | - | |
| constantly/ | 2020-04-11 19:46 | - | |
| construct.legacy/ | 2019-10-19 01:49 | - | |
| construct/ | 2021-02-05 18:42 | - | |
| consul/ | 2021-05-04 13:45 | - | |
| consulfs/ | 2021-02-16 06:43 | - | |
| containerd/ | 2022-06-12 13:50 | - | |
| context-modules/ | 2020-04-27 19:42 | - | |
| context/ | 2020-04-27 19:42 | - | |
| contextfree/ | 2020-06-10 07:43 | - | |
| contextlib2/ | 2020-07-31 07:44 | - | |
| continuity/ | 2021-02-02 18:42 | - | |
| controlsfx/ | 2018-11-29 19:54 | - | |
| conv-tools/ | 2018-03-06 20:51 | - | |
| conversant-disruptor/ | 2019-10-02 11:25 | - | |
| converseen/ | 2021-03-06 18:44 | - | |
| convertall/ | 2020-04-07 19:42 | - | |
| convertdate/ | 2021-04-13 19:42 | - | |
| convlit/ | 2019-10-01 17:59 | - | |
| convmv/ | 2021-01-06 18:57 | - | |
| convoy/ | 2016-09-13 13:12 | - | |
| cookiecutter/ | 2019-12-21 00:41 | - | |
| cookietool/ | 2018-03-06 15:02 | - | |
| cool-retro-term/ | 2021-06-03 19:42 | - | |
| coolkey/ | 2020-09-23 19:42 | - | |
| coolmail/ | 2018-03-06 12:29 | - | |
| copyfs/ | 2020-01-15 17:23 | - | |
| copyq/ | 2020-11-08 18:42 | - | |
| copyright-update/ | 2021-02-28 18:42 | - | |
| coq/ | 2020-12-04 12:43 | - | |
| core-async-clojure/ | 2020-12-26 18:42 | - | |
| core-cache-clojure/ | 2020-12-16 18:42 | - | |
| core-match-clojure/ | 2020-12-04 00:46 | - | |
| core-memoize-clojure/ | 2020-11-11 00:44 | - | |
| core-specs-alpha-clojure/ | 2021-02-07 18:48 | - | |
| coreapi/ | 2019-10-02 08:46 | - | |
| coreboot/ | 2018-06-28 18:53 | - | |
| corekeeper/ | 2019-05-20 18:53 | - | |
| coreschema/ | 2019-10-01 18:28 | - | |
| coreutils/ | 2020-10-06 07:42 | - | |
| corkscrew/ | 2021-01-20 18:42 | - | |
| corosync-qdevice/ | 2020-12-07 18:42 | - | |
| corosync/ | 2021-07-21 02:24 | - | |
| cortado/ | 2018-03-29 18:59 | - | |
| cothreads/ | 2020-11-13 01:18 | - | |
| coturn/ | 2021-04-25 19:42 | - | |
| courier-authlib/ | 2021-03-22 19:43 | - | |
| courier-filter-perl/ | 2019-02-03 14:00 | - | |
| courier-unicode/ | 2021-03-05 00:43 | - | |
| courier/ | 2021-04-17 19:42 | - | |
| couriergraph/ | 2021-01-11 18:59 | - | |
| couriergrey/ | 2019-02-03 14:00 | - | |
| cov-core/ | 2019-11-16 00:49 | - | |
| covered/ | 2021-01-07 18:53 | - | |
| covtobed/ | 2020-11-02 18:42 | - | |
| cowbell/ | 2019-10-02 10:18 | - | |
| cowdancer/ | 2020-10-13 19:45 | - | |
| cowpatty/ | 2020-09-18 01:42 | - | |
| cowsay/ | 2020-05-27 19:42 | - | |
| coyote/ | 2019-11-28 01:14 | - | |
| coz-profiler/ | 2020-09-06 19:45 | - | |
| cp2k/ | 2021-04-17 19:42 | - | |
| cpan-listchanges/ | 2018-08-29 13:53 | - | |
| cpanoutdated/ | 2021-01-06 18:57 | - | |
| cpath-clojure/ | 2020-12-19 18:50 | - | |
| cpio/ | 2020-09-28 19:42 | - | |
| cpipe/ | 2019-10-01 13:21 | - | |
| cpl-plugin-amber/ | 2021-03-19 19:44 | - | |
| cpl-plugin-fors/ | 2021-03-19 19:44 | - | |
| cpl-plugin-giraf/ | 2021-03-19 19:44 | - | |
| cpl-plugin-hawki/ | 2021-03-18 07:44 | - | |
| cpl-plugin-kmos/ | 2019-01-03 19:54 | - | |
| cpl-plugin-muse/ | 2021-03-19 19:44 | - | |
| cpl-plugin-naco/ | 2021-03-19 19:44 | - | |
| cpl-plugin-uves/ | 2021-03-19 19:44 | - | |
| cpl-plugin-vimos/ | 2021-03-19 19:44 | - | |
| cpl-plugin-visir/ | 2021-03-19 19:44 | - | |
| cpl-plugin-xshoo/ | 2021-03-19 19:44 | - | |
| cpl/ | 2021-02-27 00:42 | - | |
| cplay/ | 2018-04-26 12:59 | - | |
| cpluff/ | 2020-05-13 07:42 | - | |
| cpm/ | 2020-08-25 19:46 | - | |
| cpmtools/ | 2018-05-24 02:05 | - | |
| cpopen/ | 2018-07-21 19:53 | - | |
| cpp-hocon/ | 2020-12-16 18:42 | - | |
| cppad/ | 2021-03-09 01:15 | - | |
| cppcheck/ | 2020-12-22 18:42 | - | |
| cppdb/ | 2019-01-30 09:03 | - | |
| cpphs/ | 2020-10-21 11:57 | - | |
| cppman/ | 2019-10-05 02:04 | - | |
| cppo/ | 2020-11-13 01:16 | - | |
| cppreference-doc/ | 2020-01-27 00:47 | - | |
| cpprest/ | 2021-02-24 18:42 | - | |
| cpptasks/ | 2019-10-01 14:30 | - | |
| cpptest/ | 2019-10-01 16:06 | - | |
| cppunit/ | 2020-01-17 18:42 | - | |
| cpputest/ | 2020-08-11 02:07 | - | |
| cppy/ | 2020-09-08 19:46 | - | |
| cpqarrayd/ | 2019-10-01 18:47 | - | |
| cproto/ | 2021-03-30 19:42 | - | |
| cpu-checker/ | 2019-10-01 17:06 | - | |
| cpu-features/ | 2021-01-02 18:50 | - | |
| cpu-x/ | 2021-02-15 18:42 | - | |
| cpu/ | 2020-07-20 07:42 | - | |
| cpufreqd/ | 2020-05-16 19:42 | - | |
| cpufrequtils/ | 2020-05-09 19:47 | - | |
| cpuid/ | 2020-11-03 18:42 | - | |
| cpuinfo/ | 2020-11-08 18:42 | - | |
| cpulimit/ | 2020-05-09 19:42 | - | |
| cpupower-gui/ | 2019-12-07 00:50 | - | |
| cpuset/ | 2021-02-27 00:42 | - | |
| cpustat/ | 2020-11-18 18:25 | - | |
| cputool/ | 2018-03-06 16:52 | - | |
| cqrlib/ | 2019-10-01 18:41 | - | |
| cqrlog/ | 2021-05-05 19:42 | - | |
| crac/ | 2020-12-31 18:42 | - | |
| crack-attack/ | 2018-03-06 19:57 | - | |
| crack/ | 2021-02-13 12:42 | - | |
| cracklib2/ | 2021-02-06 18:42 | - | |
| cram/ | 2019-12-19 12:42 | - | |
| cramfsswap/ | 2021-02-09 18:42 | - | |
| crash/ | 2020-12-20 18:42 | - | |
| crashmail/ | 2021-02-11 18:52 | - | |
| crashme/ | 2018-03-06 18:58 | - | |
| crashtest/ | 2021-02-07 00:44 | - | |
| crasm/ | 2020-04-30 19:42 | - | |
| crawl/ | 2021-02-18 00:42 | - | |
| crazydiskinfo/ | 2020-07-28 19:43 | - | |
| crazywa/ | 2019-10-02 09:42 | - | |
| crda/ | 2020-04-05 19:47 | - | |
| cream/ | 2021-01-09 18:59 | - | |
| create-resources/ | 2020-04-12 19:46 | - | |
| createrepo-c/ | 2021-02-27 18:42 | - | |
| createrepo/ | 2016-09-13 15:30 | - | |
| credential-sheets/ | 2018-08-27 19:53 | - | |
| creduce/ | 2021-02-15 00:42 | - | |
| creoleparser/ | 2018-12-24 19:53 | - | |
| cricket/ | 2018-07-30 07:53 | - | |
| crimson/ | 2018-03-06 12:00 | - | |
| crip/ | 2018-09-17 19:53 | - | |
| crispy-doom/ | 2021-02-06 18:43 | - | |
| critcl/ | 2020-06-25 19:46 | - | |
| criterion/ | 2020-12-15 06:42 | - | |
| criticalmass/ | 2020-12-01 18:42 | - | |
| critterding/ | 2018-03-06 16:45 | - | |
| crm114/ | 2020-08-05 07:42 | - | |
| crmsh/ | 2021-09-12 19:42 | - | |
| croaring/ | 2021-01-09 18:59 | - | |
| cron-apt/ | 2021-01-06 18:57 | - | |
| cron-deja-vu/ | 2016-09-13 13:27 | - | |
| cron/ | 2021-10-25 14:33 | - | |
| cronic/ | 2021-01-08 18:52 | - | |
| cronolog/ | 2019-10-01 15:56 | - | |
| cronometer/ | 2020-12-09 00:47 | - | |
| cronutils/ | 2021-02-24 06:42 | - | |
| cross-gcc/ | 2021-01-03 18:42 | - | |
| cross-toolchain-base-mipsen/ | 2021-05-07 19:42 | - | |
| cross-toolchain-base-ports/ | 2021-04-17 19:42 | - | |
| cross-toolchain-base/ | 2021-03-23 19:42 | - | |
| crossfire-client-images/ | 2020-07-31 19:46 | - | |
| crossfire-client/ | 2021-02-25 18:42 | - | |
| crossfire-maps-small/ | 2021-01-13 18:54 | - | |
| crossfire-maps/ | 2021-01-29 18:48 | - | |
| crossfire/ | 2021-01-30 18:49 | - | |
| crossguid/ | 2018-08-17 19:53 | - | |
| crosshurd/ | 2020-11-11 13:37 | - | |
| crowdsec/ | 2021-05-28 19:42 | - | |
| crrcsim/ | 2019-12-13 12:46 | - | |
| crtmpserver/ | 2018-09-09 19:53 | - | |
| crudini/ | 2020-01-30 18:42 | - | |
| cruft-ng/ | 2020-12-18 18:42 | - | |
| cruft/ | 2020-05-28 07:42 | - | |
| crun/ | 2021-02-11 18:42 | - | |
| crunch/ | 2020-06-10 07:42 | - | |
| cryfs/ | 2021-01-11 18:42 | - | |
| crypt++el/ | 2021-01-09 18:59 | - | |
| cryptcat/ | 2018-03-06 13:02 | - | |
| cryptgps/ | 2020-11-13 01:18 | - | |
| cryptmount/ | 2021-01-18 18:42 | - | |
| crypto-equality-clojure/ | 2020-12-23 18:47 | - | |
| crypto-random-clojure/ | 2020-12-26 18:50 | - | |
| cryptojs/ | 2021-01-26 18:42 | - | |
| cryptokit/ | 2020-12-16 06:42 | - | |
| cryptominisat/ | 2021-02-05 06:49 | - | |
| cryptsetup/ | 2022-04-03 19:42 | - | |
| crystal-facet-uml/ | 2021-03-05 18:42 | - | |
| crystalcursors/ | 2021-01-07 18:53 | - | |
| crystalhd/ | 2018-05-11 18:59 | - | |
| cscope/ | 2018-11-05 13:54 | - | |
| csh/ | 2020-08-03 02:14 | - | |
| csladspa/ | 2019-10-01 13:51 | - | |
| csmash-demosong/ | 2016-10-04 00:53 | - | |
| csmash/ | 2018-03-06 15:13 | - | |
| csmith/ | 2019-11-16 06:43 | - | |
| csound-manual/ | 2021-02-25 18:42 | - | |
| csound/ | 2021-02-05 06:51 | - | |
| csoundqt/ | 2021-02-25 18:42 | - | |
| css2xslfo/ | 2017-11-01 02:03 | - | |
| css3pie/ | 2021-01-11 19:00 | - | |
| cssc/ | 2019-10-14 11:18 | - | |
| cssmin/ | 2020-04-02 19:42 | - | |
| cssparser/ | 2018-03-23 18:59 | - | |
| csstidy/ | 2020-01-11 12:41 | - | |
| cssutils/ | 2020-02-16 00:55 | - | |
| cstocs/ | 2019-10-11 01:48 | - | |
| cstore-fdw/ | 2020-11-19 06:42 | - | |
| cstream/ | 2019-03-13 19:54 | - | |
| csv-mode/ | 2020-02-27 18:42 | - | |
| csv2latex/ | 2020-01-09 00:46 | - | |
| csvimp/ | 2019-11-10 18:41 | - | |
| csvjdbc/ | 2020-01-04 18:41 | - | |
| csvkit/ | 2020-10-28 19:42 | - | |
| csync2/ | 2020-06-13 19:42 | - | |
| ctapi/ | 2021-01-11 19:00 | - | |
| ctdconverter/ | 2020-10-11 18:22 | - | |
| ctdopts/ | 2020-11-09 18:42 | - | |
| ctemplate/ | 2020-03-18 01:42 | - | |
| ctfutils/ | 2017-04-03 07:07 | - | |
| cthreadpool/ | 2020-04-24 19:48 | - | |
| cthumb/ | 2017-01-05 09:20 | - | |
| ctioga2/ | 2018-04-28 12:59 | - | |
| ctn/ | 2020-11-21 00:47 | - | |
| ctop/ | 2021-04-05 19:42 | - | |
| ctorrent/ | 2018-03-06 21:34 | - | |
| ctpl/ | 2021-01-11 06:42 | - | |
| ctpp2/ | 2019-01-10 19:54 | - | |
| ctsim/ | 2021-03-05 00:43 | - | |
| ctwm/ | 2020-08-11 02:07 | - | |
| cu2qu/ | 2021-03-06 18:44 | - | |
| cub/ | 2021-01-19 18:42 | - | |
| cubature/ | 2021-03-07 18:42 | - | |
| cube2-data/ | 2021-03-11 18:53 | - | |
| cube2/ | 2021-03-11 18:52 | - | |
| cube2font/ | 2018-11-07 19:53 | - | |
| cubemap/ | 2020-11-12 18:42 | - | |
| cubicsdr/ | 2021-02-05 06:50 | - | |
| cucumber/ | 2020-09-19 01:47 | - | |
| cudf/ | 2020-11-13 01:17 | - | |
| cue2toc/ | 2018-03-06 11:58 | - | |
| cuetools/ | 2020-03-29 19:42 | - | |
| culmus-fancy/ | 2021-02-23 18:42 | - | |
| culmus/ | 2021-02-15 00:42 | - | |
| cultivation/ | 2019-10-01 14:28 | - | |
| cunit/ | 2020-06-13 19:47 | - | |
| cup/ | 2018-10-13 01:54 | - | |
| cupp/ | 2020-03-08 09:48 | - | |
| cups-bjnp/ | 2020-02-25 12:42 | - | |
| cups-filters/ | 2022-04-03 19:42 | - | |
| cups-pdf/ | 2021-01-13 18:42 | - | |
| cups-pk-helper/ | 2018-03-06 13:08 | - | |
| cups-x2go/ | 2018-12-12 19:54 | - | |
| cups/ | 2022-05-26 13:50 | - | |
| cupt/ | 2020-12-29 18:42 | - | |
| cura-engine/ | 2021-02-06 18:44 | - | |
| cura/ | 2021-04-13 19:42 | - | |
| curl/ | 2021-12-26 18:42 | - | |
| curlftpfs/ | 2018-03-06 12:01 | - | |
| curlpp/ | 2020-10-24 19:48 | - | |
| curry-base/ | 2020-10-17 01:46 | - | |
| curry-frontend/ | 2021-02-15 18:42 | - | |
| curry-libs/ | 2021-02-15 18:42 | - | |
| curry-tools/ | 2021-02-15 18:42 | - | |
| curseofwar/ | 2020-08-27 19:46 | - | |
| curtain/ | 2018-03-06 16:56 | - | |
| curvedns/ | 2021-02-03 18:47 | - | |
| curvesapi/ | 2021-02-15 00:42 | - | |
| custodia/ | 2020-02-15 18:42 | - | |
| customdeb/ | 2016-09-13 15:50 | - | |
| cutecom/ | 2019-12-03 18:44 | - | |
| cutemaze/ | 2020-05-07 19:42 | - | |
| cutesdr/ | 2020-04-06 07:42 | - | |
| cutils/ | 2018-03-06 13:38 | - | |
| cutycapt/ | 2019-12-05 18:41 | - | |
| cuyo/ | 2021-02-10 18:44 | - | |
| cvc4/ | 2020-10-04 07:42 | - | |
| cvector/ | 2019-10-02 09:33 | - | |
| cvise/ | 2021-01-28 18:42 | - | |
| cvm/ | 2020-09-08 19:42 | - | |
| cvs-buildpackage/ | 2016-09-13 13:23 | - | |
| cvs-fast-export/ | 2020-11-14 18:42 | - | |
| cvs-mailcommit/ | 2020-06-14 19:42 | - | |
| cvs/ | 2021-02-11 01:17 | - | |
| cvs2svn/ | 2017-12-09 11:58 | - | |
| cvsd/ | 2019-10-02 11:19 | - | |
| cvsdelta/ | 2021-02-15 18:42 | - | |
| cvsgraph/ | 2019-10-01 16:55 | - | |
| cvsps/ | 2018-03-06 20:30 | - | |
| cvsutils/ | 2021-01-07 18:54 | - | |
| cvsweb/ | 2021-01-09 18:59 | - | |
| cvxopt/ | 2021-02-05 06:49 | - | |
| cwdaemon/ | 2019-10-01 16:06 | - | |
| cweb-latex/ | 2016-09-13 15:22 | - | |
| cwebx/ | 2021-02-01 18:48 | - | |
| cwidget/ | 2019-10-02 11:57 | - | |
| cwiid/ | 2021-02-05 11:28 | - | |
| cwlformat/ | 2021-02-02 18:42 | - | |
| cwltool/ | 2021-02-03 15:37 | - | |
| cwm/ | 2020-06-25 19:42 | - | |
| cxref/ | 2021-01-13 12:42 | - | |
| cxxopts/ | 2020-10-28 19:46 | - | |
| cxxtest/ | 2020-07-17 07:47 | - | |
| cxxtools/ | 2021-04-01 19:42 | - | |
| cyarray/ | 2021-02-05 06:51 | - | |
| cycfx2prog/ | 2020-01-30 00:46 | - | |
| cyclades-serial-client/ | 2021-02-01 06:42 | - | |
| cycle-quotes/ | 2021-01-02 18:42 | - | |
| cycle/ | 2020-02-22 01:14 | - | |
| cyclograph/ | 2021-01-10 18:56 | - | |
| cyclonedds/ | 2021-02-07 18:49 | - | |
| cylc/ | 2020-10-07 19:42 | - | |
| cynthiune.app/ | 2020-06-14 19:51 | - | |
| cypari2/ | 2021-03-13 18:44 | - | |
| cyphesis-cpp/ | 2020-01-23 11:46 | - | |
| cyrus-imapd/ | 2021-10-17 19:42 | - | |
| cyrus-imspd/ | 2019-03-05 19:53 | - | |
| cyrus-sasl2/ | 2022-04-03 19:42 | - | |
| cysignals/ | 2021-09-27 01:42 | - | |
| cython/ | 2021-02-05 06:43 | - | |
| cyvcf2/ | 2021-02-15 00:42 | - | |
| czmq/ | 2021-01-22 18:48 | - | |
